diff --git a/.env.dusk.testing b/.env.dusk.testing deleted file mode 100644 index 756f4074..00000000 --- a/.env.dusk.testing +++ /dev/null @@ -1,14 +0,0 @@ -APP_ENV=testing -APP_DEBUG=true -APP_KEY=base64:6DJhvZLVjE6dD4Cqrteh+6Z5vZlG+v/soCKcDHLOAH0= -APP_URL=http://localhost:8000 -APP_LONGURL=localhost -APP_SHORTURL=local - -DB_CONNECTION=travis - -CACHE_DRIVER=array -SESSION_DRIVER=file -QUEUE_DRIVER=sync - -SCOUT_DRIVER=pgsql diff --git a/.env.example b/.env.example index ccd42db9..4eb61db5 100644 --- a/.env.example +++ b/.env.example @@ -4,15 +4,15 @@ APP_KEY= APP_DEBUG=true APP_TIMEZONE=UTC APP_URL=https://example.com -APP_LONGURL=example.com -APP_SHORTURL=examp.le APP_LOCALE=en APP_FALLBACK_LOCALE=en APP_FAKER_LOCALE=en_US APP_MAINTENANCE_DRIVER=file -APP_MAINTENANCE_STORE=database +# APP_MAINTENANCE_STORE=database + +PHP_CLI_SERVER_WORKERS=4 BCRYPT_ROUNDS=12 @@ -39,7 +39,7 @@ FILESYSTEM_DISK=local QUEUE_CONNECTION=database CACHE_STORE=database -CACHE_PREFIX= +# CACHE_PREFIX= MEMCACHED_HOST=127.0.0.1 @@ -49,6 +49,7 @@ REDIS_PASSWORD=null REDIS_PORT=6379 MAIL_MAILER=log +MAIL_SCHEME=null MAIL_HOST=127.0.0.1 MAIL_PORT=2525 MAIL_USERNAME=null diff --git a/.env.github b/.env.github deleted file mode 100644 index 0ef2b89b..00000000 --- a/.env.github +++ /dev/null @@ -1,70 +0,0 @@ -APP_NAME=Laravel -APP_ENV=testing -APP_KEY=SomeRandomString # Leave this -APP_DEBUG=false -APP_LOG_LEVEL=warning - -DB_CONNECTION=pgsql -DB_HOST=127.0.0.1 -DB_PORT=5432 -DB_DATABASE=jbukdev_testing -DB_USERNAME=postgres -DB_PASSWORD=postgres - -BROADCAST_DRIVER=log -CACHE_DRIVER=file -SESSION_DRIVER=file -QUEUE_DRIVER=sync - -REDIS_HOST=127.0.0.1 -REDIS_PASSWORD=null -REDIS_PORT=6379 - -MAIL_DRIVER=smtp -MAIL_HOST=smtp.mailtrap.io -MAIL_PORT=2525 -MAIL_USERNAME=null -MAIL_PASSWORD=null -MAIL_ENCRYPTION=null - -PUSHER_APP_ID= -PUSHER_APP_KEY= -PUSHER_APP_SECRET= - -AWS_S3_KEY=your-key -AWS_S3_SECRET=your-secret -AWS_S3_REGION=region -AWS_S3_BUCKET=your-bucket -AWS_S3_URL=https://xxxxxxx.s3-region.amazonaws.com - -APP_URL=https://example.com # This one is necessary -APP_LONGURL=example.com -APP_SHORTURL=examp.le - -ADMIN_USER=admin # pick something better, this is used for `/admin` -ADMIN_PASS=password -DISPLAY_NAME="Joe Bloggs" # This is used for example in the header and titles - -TWITTER_CONSUMER_KEY= -TWITTER_CONSUMER_SECRET= -TWITTER_ACCESS_TOKEN= -TWITTER_ACCESS_TOKEN_SECRET= - -SCOUT_DRIVER=database -SCOUT_QUEUE=false - -PIWIK=false - -FATHOM_ID= - -APP_TIMEZONE=UTC -APP_LANG=en -APP_LOG=daily -SECURE_SESSION_COOKIE=true - -LOG_SLACK_WEBHOOK_URL= -FLARE_KEY= - -FONT_LINK= - -BRIDGY_MASTODON_TOKEN= diff --git a/.eslintrc.yml b/.eslintrc.yml deleted file mode 100644 index 8e72ef3e..00000000 --- a/.eslintrc.yml +++ /dev/null @@ -1,38 +0,0 @@ -parserOptions: - sourceType: 'module' - ecmaVersion: 'latest' -extends: 'eslint:recommended' -env: - browser: true - es6: true -ignorePatterns: - - webpack.config.js -rules: - indent: - - error - - 2 - linebreak-style: - - error - - unix - quotes: - - error - - single - semi: - - error - - always - no-console: - - error - - allow: - - warn - - error - no-await-in-loop: - - error - no-promise-executor-return: - - error - require-atomic-updates: - - error - max-nested-callbacks: - - error - - 3 - prefer-promise-reject-errors: - - error diff --git a/.gitattributes b/.gitattributes index fcb21d39..78f41d7a 100644 --- a/.gitattributes +++ b/.gitattributes @@ -5,7 +5,3 @@ *.html diff=html *.md diff=markdown *.php diff=php - -/.github export-ignore -CHANGELOG.md export-ignore -.styleci.yml export-ignore diff --git a/.github/dependabot.yml b/.github/dependabot.yml deleted file mode 100644 index 47abe68c..00000000 --- a/.github/dependabot.yml +++ /dev/null @@ -1,12 +0,0 @@ -version: 2 - -updates: - - package-ecosystem: "composer" - directory: "/" - schedule: - interval: "daily" - - - package-ecosystem: "npm" - directory: "/" - schedule: - interval: "daily" diff --git a/.github/workflows/deploy.yml b/.github/workflows/deploy.yml deleted file mode 100644 index f66a77b4..00000000 --- a/.github/workflows/deploy.yml +++ /dev/null @@ -1,144 +0,0 @@ -name: Deploy - -on: - workflow_dispatch: - release: - types: [published] - -jobs: - deploy: - name: Deploy - runs-on: ubuntu-latest - environment: Hetzner - env: - repository: 'jonnybarnes/jonnybarnes.uk' - newReleaseName: '${{ github.run_id }}' - - steps: - - name: 🌍 Set Environment Variables - run: | - echo "releasesDir=${{ secrets.DEPLOYMENT_BASE_DIR }}/releases" >> $GITHUB_ENV - echo "persistentDir=${{ secrets.DEPLOYMENT_BASE_DIR }}/persistent" >> $GITHUB_ENV - echo "currentDir=${{ secrets.DEPLOYMENT_BASE_DIR }}/current" >> $GITHUB_ENV - - name: 🌎 Set Environment Variables Part 2 - run: | - echo "newReleaseDir=${{ env.releasesDir }}/${{ env.newReleaseName }}" >> $GITHUB_ENV - - name: 🔄 Clone Repository - uses: appleboy/ssh-action@master - with: - host: ${{ secrets.DEPLOYMENT_HOST }} - port: ${{ secrets.DEPLOYMENT_PORT }} - username: ${{ secrets.DEPLOYMENT_USER }} - key: ${{ secrets.DEPLOYMENT_KEY }} - script: | - [ -d ${{ env.releasesDir }} ] || mkdir ${{ env.releasesDir }} - [ -d ${{ env.persistentDir }} ] || mkdir ${{ env.persistentDir }} - [ -d ${{ env.persistentDir }}/storage ] || mkdir ${{ env.persistentDir }}/storage - - cd ${{ env.releasesDir }} - - # Create new release directory - mkdir ${{ env.newReleaseDir }} - - # Clone app - git clone --depth 1 --branch ${{ github.ref_name }} https://github.com/${{ env.repository }} ${{ env.newReleaseName }} - - # Mark release - cd ${{ env.newReleaseDir }} - echo "${{ env.newReleaseName }}" > public/release-name.txt - - # Fix cache directory permissions - sudo chown -R ${{ secrets.HTTP_USER }}:${{ secrets.HTTP_USER }} bootstrap/cache - - - name: 🎵 Run Composer - uses: appleboy/ssh-action@master - with: - host: ${{ secrets.DEPLOYMENT_HOST }} - port: ${{ secrets.DEPLOYMENT_PORT }} - username: ${{ secrets.DEPLOYMENT_USER }} - key: ${{ secrets.DEPLOYMENT_KEY }} - script: | - cd ${{ env.newReleaseDir }} - composer install --prefer-dist --no-scripts --no-dev --no-progress --optimize-autoloader --quiet --no-interaction - - - name: 🔗 Update Symlinks - uses: appleboy/ssh-action@master - with: - host: ${{ secrets.DEPLOYMENT_HOST }} - port: ${{ secrets.DEPLOYMENT_PORT }} - username: ${{ secrets.DEPLOYMENT_USER }} - key: ${{ secrets.DEPLOYMENT_KEY }} - script: | - # Import the environment config - cd ${{ env.newReleaseDir }}; - ln -nfs ${{ secrets.DEPLOYMENT_BASE_DIR }}/.env .env; - - # Remove the storage directory and replace with persistent data - rm -rf ${{ env.newReleaseDir }}/storage; - cd ${{ env.newReleaseDir }}; - ln -nfs ${{ secrets.DEPLOYMENT_BASE_DIR }}/persistent/storage storage; - - # Remove the public/profile-images directory and replace with persistent data - rm -rf ${{ env.newReleaseDir }}/public/assets/profile-images; - cd ${{ env.newReleaseDir }}; - ln -nfs ${{ secrets.DEPLOYMENT_BASE_DIR }}/persistent/profile-images public/assets/profile-images; - - # Add the persistent files data - cd ${{ env.newReleaseDir }}; - ln -nfs ${{ secrets.DEPLOYMENT_BASE_DIR }}/persistent/files public/files; - - # Add the persistent fonts data - cd ${{ env.newReleaseDir }}; - ln -nfs ${{ secrets.DEPLOYMENT_BASE_DIR }}/persistent/fonts public/fonts; - - - name: ✨ Optimize Installation - uses: appleboy/ssh-action@master - with: - host: ${{ secrets.DEPLOYMENT_HOST }} - port: ${{ secrets.DEPLOYMENT_PORT }} - username: ${{ secrets.DEPLOYMENT_USER }} - key: ${{ secrets.DEPLOYMENT_KEY }} - script: | - cd ${{ env.newReleaseDir }}; - sudo runuser -u ${{ secrets.HTTP_USER }} -- php artisan clear-compiled; - - - name: 🙈 Migrate database - uses: appleboy/ssh-action@master - with: - host: ${{ secrets.DEPLOYMENT_HOST }} - port: ${{ secrets.DEPLOYMENT_PORT }} - username: ${{ secrets.DEPLOYMENT_USER }} - key: ${{ secrets.DEPLOYMENT_KEY }} - script: | - cd ${{ env.newReleaseDir }} - sudo runuser -u ${{ secrets.HTTP_USER }} -- php artisan migrate --force - - - name: 🙏 Bless release - uses: appleboy/ssh-action@master - with: - host: ${{ secrets.DEPLOYMENT_HOST }} - port: ${{ secrets.DEPLOYMENT_PORT }} - username: ${{ secrets.DEPLOYMENT_USER }} - key: ${{ secrets.DEPLOYMENT_KEY }} - script: | - ln -nfs ${{ env.newReleaseDir }} ${{ env.currentDir }}; - cd ${{ env.newReleaseDir }} - sudo runuser -u ${{ secrets.HTTP_USER }} -- php artisan horizon:terminate - sudo runuser -u ${{ secrets.HTTP_USER }} -- php artisan config:cache - sudo runuser -u ${{ secrets.HTTP_USER }} -- php artisan event:cache - sudo runuser -u ${{ secrets.HTTP_USER }} -- php artisan route:cache - sudo runuser -u ${{ secrets.HTTP_USER }} -- php artisan view:cache - - sudo systemctl restart php-fpm.service - sudo systemctl restart jbuk-horizon.service - - - name: 🚾 Clean up old releases - uses: appleboy/ssh-action@master - with: - host: ${{ secrets.DEPLOYMENT_HOST }} - port: ${{ secrets.DEPLOYMENT_PORT }} - username: ${{ secrets.DEPLOYMENT_USER }} - key: ${{ secrets.DEPLOYMENT_KEY }} - script: | - fd '.+' ${{ env.releasesDir }} -d 1 | head -n -3 | xargs -d "\n" -I'{}' sudo chown -R ${{ secrets.DEPLOYMENT_USER }}:${{ secrets.DEPLOYMENT_USER }} {} - fd '.+' ${{ env.releasesDir }} -d 1 | head -n -3 | xargs -d "\n" -I'{}' rm -rf {} diff --git a/.github/workflows/phpunit.yml b/.github/workflows/phpunit.yml deleted file mode 100644 index e1765ef3..00000000 --- a/.github/workflows/phpunit.yml +++ /dev/null @@ -1,65 +0,0 @@ -name: PHP Unit - -on: - pull_request: - -jobs: - phpunit: - runs-on: ubuntu-latest - - name: PHPUnit test suite - - services: - postgres: - image: postgres:latest - env: - POSTGRES_USER: postgres - POSTGRES_PASSWORD: postgres - POSTGRES_DB: jbukdev_testing - ports: - - 5432:5432 - - steps: - - name: Checkout code - uses: actions/checkout@v4 - - - name: Setup PHP - uses: shivammathur/setup-php@v2 - with: - php-version: '8.3' - extensions: mbstring, intl, phpredis, imagick - coverage: xdebug - tools: phpunit - env: - GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} - - - name: Copy .env - run: php -r "file_exists('.env') || copy('.env.github', '.env');" - - - name: Get Composer Cache Directory - id: composer-cache - run: | - echo "::set-output name=dir::$(composer config cache-files-dir)" - - - name: Cache composer dependencies - uses: actions/cache@v3 - with: - path: ${{ steps.composer-cache.outputs.dir }} - key: ${{ runner.os }}-php-8.3-composer-${{ hashFiles('**/composer.lock') }} - restore-keys: | - ${{ runner.os }}-php-8.3-composer- - - - name: Install Composer Dependencies - run: composer install --quiet --no-ansi --no-interaction --no-progress - - - name: Generate Key - run: php artisan key:generate - - - name: Setup Directory Permissions - run: chmod -R 777 storage bootstrap/cache - - - name: Setup Database - run: php artisan migrate - - - name: Execute PHPUnit Tests - run: vendor/bin/phpunit diff --git a/.github/workflows/pint.yml b/.github/workflows/pint.yml deleted file mode 100644 index e6340c67..00000000 --- a/.github/workflows/pint.yml +++ /dev/null @@ -1,38 +0,0 @@ -name: Laravel Pint - -on: - pull_request: - -jobs: - pint: - runs-on: ubuntu-latest - - name: Laravel Pint - - steps: - - name: Checkout code - uses: actions/checkout@v3 - - - name: Setup PHP with pecl extensions - uses: shivammathur/setup-php@v2 - with: - php-version: '8.2' - - - name: Get Composer Cache Directory - id: composer-cache - run: | - echo "::set-output name=dir::$(composer config cache-files-dir)" - - - name: Cache composer dependencies - uses: actions/cache@v3 - with: - path: ${{ steps.composer-cache.outputs.dir }} - key: ${{ runner.os }}-composer-${{ hashFiles('**/composer.lock') }} - restore-keys: | - ${{ runner.os }}-composer- - - - name: Install Composer Dependencies - run: composer install --quiet --no-ansi --no-interaction --no-progress - - - name: Check Files with Laravel Pint - run: vendor/bin/pint --test diff --git a/.gitignore b/.gitignore index 5a9b11c9..a0c2459a 100644 --- a/.gitignore +++ b/.gitignore @@ -4,7 +4,6 @@ /public/coverage /public/hot /public/files -/public/fonts /public/storage /storage/*.key /vendor @@ -21,3 +20,5 @@ yarn-error.log /.idea /.vscode ray.php +/public/gpg.key +/public/assets/img/favicon.png diff --git a/.styleci.yml b/.styleci.yml deleted file mode 100644 index 9daadf16..00000000 --- a/.styleci.yml +++ /dev/null @@ -1,9 +0,0 @@ -php: - preset: laravel - disabled: - - no_unused_imports - finder: - not-name: - - index.php -js: true -css: true diff --git a/app/Console/Commands/CopyMediaToLocal.php b/app/Console/Commands/CopyMediaToLocal.php new file mode 100644 index 00000000..2e8d2bce --- /dev/null +++ b/app/Console/Commands/CopyMediaToLocal.php @@ -0,0 +1,69 @@ +path; + + $this->info('Processing: ' . $filename); + + // If the file is already saved locally skip to next one + if (Storage::disk('local')->exists('public/' . $filename)) { + $this->info('File already exists locally, skipping'); + + continue; + } + + // Copy the file from S3 to the local filesystem + if (! Storage::disk('s3')->exists($filename)) { + $this->error('File does not exist on S3'); + + continue; + } + $contents = Storage::disk('s3')->get($filename); + Storage::disk('local')->put('public/' . $filename, $contents); + + // Copy -medium and -small versions if they exist + $filenameParts = explode('.', $filename); + $extension = array_pop($filenameParts); + $basename = trim(implode('.', $filenameParts), '.'); + $mediumFilename = $basename . '-medium.' . $extension; + $smallFilename = $basename . '-small.' . $extension; + if (Storage::disk('s3')->exists($mediumFilename)) { + Storage::disk('local')->put('public/' . $mediumFilename, Storage::disk('s3')->get($mediumFilename)); + } + if (Storage::disk('s3')->exists($smallFilename)) { + Storage::disk('local')->put('public/' . $smallFilename, Storage::disk('s3')->get($smallFilename)); + } + } + } +} diff --git a/app/Console/Commands/MigratePlaceDataFromPostgis.php b/app/Console/Commands/MigratePlaceDataFromPostgis.php index e0026150..8d5d2c92 100644 --- a/app/Console/Commands/MigratePlaceDataFromPostgis.php +++ b/app/Console/Commands/MigratePlaceDataFromPostgis.php @@ -8,8 +8,6 @@ use Illuminate\Support\Facades\DB; /** * @codeCoverageIgnore - * - * @psalm-suppress UnusedClass */ class MigratePlaceDataFromPostgis extends Command { diff --git a/app/Console/Commands/ParseCachedWebMentions.php b/app/Console/Commands/ParseCachedWebMentions.php index 96d57332..a6b29176 100644 --- a/app/Console/Commands/ParseCachedWebMentions.php +++ b/app/Console/Commands/ParseCachedWebMentions.php @@ -9,9 +9,6 @@ use Illuminate\Console\Command; use Illuminate\Contracts\Filesystem\FileNotFoundException; use Illuminate\FileSystem\FileSystem; -/** - * @psalm-suppress UnusedClass - */ class ParseCachedWebMentions extends Command { /** @@ -37,7 +34,7 @@ class ParseCachedWebMentions extends Command { $htmlFiles = $filesystem->allFiles(storage_path() . '/HTML'); foreach ($htmlFiles as $file) { - if ($file->getExtension() !== 'backup') { //we don’t want to parse `.backup` files + if ($file->getExtension() !== 'backup') { // we don’t want to parse `.backup` files $filepath = $file->getPathname(); $this->info('Loading HTML from: ' . $filepath); $html = $filesystem->get($filepath); diff --git a/app/Console/Commands/ReDownloadWebMentions.php b/app/Console/Commands/ReDownloadWebMentions.php index b29e7da8..c6452ba9 100644 --- a/app/Console/Commands/ReDownloadWebMentions.php +++ b/app/Console/Commands/ReDownloadWebMentions.php @@ -8,9 +8,6 @@ use App\Jobs\DownloadWebMention; use App\Models\WebMention; use Illuminate\Console\Command; -/** - * @psalm-suppress UnusedClass - */ class ReDownloadWebMentions extends Command { /** diff --git a/app/Exceptions/InternetArchiveException.php b/app/Exceptions/InternetArchiveException.php index 7e810fea..99d5cab7 100644 --- a/app/Exceptions/InternetArchiveException.php +++ b/app/Exceptions/InternetArchiveException.php @@ -2,6 +2,4 @@ namespace App\Exceptions; -class InternetArchiveException extends \Exception -{ -} +class InternetArchiveException extends \Exception {} diff --git a/app/Exceptions/InvalidTokenScopeException.php b/app/Exceptions/InvalidTokenScopeException.php new file mode 100644 index 00000000..5966bccd --- /dev/null +++ b/app/Exceptions/InvalidTokenScopeException.php @@ -0,0 +1,7 @@ +hasFile('article')) { $file = request()->file('article')->openFile(); $content = $file->fread($file->getSize()); diff --git a/app/Http/Controllers/Admin/BioController.php b/app/Http/Controllers/Admin/BioController.php index 8560eba9..c760e12c 100644 --- a/app/Http/Controllers/Admin/BioController.php +++ b/app/Http/Controllers/Admin/BioController.php @@ -10,9 +10,6 @@ use Illuminate\Http\RedirectResponse; use Illuminate\Http\Request; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class BioController extends Controller { public function show(): View diff --git a/app/Http/Controllers/Admin/ClientsController.php b/app/Http/Controllers/Admin/ClientsController.php index 290da502..38524b62 100644 --- a/app/Http/Controllers/Admin/ClientsController.php +++ b/app/Http/Controllers/Admin/ClientsController.php @@ -9,9 +9,6 @@ use App\Models\MicropubClient; use Illuminate\Http\RedirectResponse; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class ClientsController extends Controller { /** diff --git a/app/Http/Controllers/Admin/ContactsController.php b/app/Http/Controllers/Admin/ContactsController.php index 836c99cc..eb45320c 100644 --- a/app/Http/Controllers/Admin/ContactsController.php +++ b/app/Http/Controllers/Admin/ContactsController.php @@ -12,9 +12,6 @@ use Illuminate\Http\RedirectResponse; use Illuminate\Support\Arr; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class ContactsController extends Controller { /** @@ -40,7 +37,7 @@ class ContactsController extends Controller */ public function store(): RedirectResponse { - $contact = new Contact(); + $contact = new Contact; $contact->name = request()->input('name'); $contact->nick = request()->input('nick'); $contact->homepage = request()->input('homepage'); @@ -79,7 +76,7 @@ class ContactsController extends Controller if (request()->hasFile('avatar') && (request()->input('homepage') != '')) { $dir = parse_url(request()->input('homepage'), PHP_URL_HOST); $destination = public_path() . '/assets/profile-images/' . $dir; - $filesystem = new Filesystem(); + $filesystem = new Filesystem; if ($filesystem->isDirectory($destination) === false) { $filesystem->makeDirectory($destination); } @@ -139,7 +136,7 @@ class ContactsController extends Controller } if ($avatar !== null) { $directory = public_path() . '/assets/profile-images/' . parse_url($contact->homepage, PHP_URL_HOST); - $filesystem = new Filesystem(); + $filesystem = new Filesystem; if ($filesystem->isDirectory($directory) === false) { $filesystem->makeDirectory($directory); } diff --git a/app/Http/Controllers/Admin/HomeController.php b/app/Http/Controllers/Admin/HomeController.php index d469c66c..ae4f4d36 100644 --- a/app/Http/Controllers/Admin/HomeController.php +++ b/app/Http/Controllers/Admin/HomeController.php @@ -7,9 +7,6 @@ namespace App\Http\Controllers\Admin; use App\Http\Controllers\Controller; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class HomeController extends Controller { /** diff --git a/app/Http/Controllers/Admin/LikesController.php b/app/Http/Controllers/Admin/LikesController.php index c8553348..9ebd7e74 100644 --- a/app/Http/Controllers/Admin/LikesController.php +++ b/app/Http/Controllers/Admin/LikesController.php @@ -10,9 +10,6 @@ use App\Models\Like; use Illuminate\Http\RedirectResponse; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class LikesController extends Controller { /** diff --git a/app/Http/Controllers/Admin/NotesController.php b/app/Http/Controllers/Admin/NotesController.php index afa75adb..c6ed93ba 100644 --- a/app/Http/Controllers/Admin/NotesController.php +++ b/app/Http/Controllers/Admin/NotesController.php @@ -11,9 +11,6 @@ use Illuminate\Http\RedirectResponse; use Illuminate\Http\Request; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class NotesController extends Controller { /** @@ -67,7 +64,7 @@ class NotesController extends Controller */ public function update(int $noteId): RedirectResponse { - //update note data + // update note data $note = Note::findOrFail($noteId); $note->note = request()->input('content'); $note->in_reply_to = request()->input('in-reply-to'); diff --git a/app/Http/Controllers/Admin/PasskeysController.php b/app/Http/Controllers/Admin/PasskeysController.php index 5fdca622..9f635f10 100644 --- a/app/Http/Controllers/Admin/PasskeysController.php +++ b/app/Http/Controllers/Admin/PasskeysController.php @@ -18,8 +18,8 @@ use Illuminate\Support\Facades\App; use Illuminate\Support\Facades\Auth; use Illuminate\View\View; use ParagonIE\ConstantTime\Base64UrlSafe; +use Random\RandomException; use Throwable; -use Webauthn\AttestationStatement\AttestationObjectLoader; use Webauthn\AttestationStatement\AttestationStatementSupportManager; use Webauthn\AttestationStatement\NoneAttestationStatementSupport; use Webauthn\AuthenticationExtensions\ExtensionOutputCheckerHandler; @@ -28,18 +28,17 @@ use Webauthn\AuthenticatorAssertionResponseValidator; use Webauthn\AuthenticatorAttestationResponse; use Webauthn\AuthenticatorAttestationResponseValidator; use Webauthn\AuthenticatorSelectionCriteria; +use Webauthn\CeremonyStep\CeremonyStepManagerFactory; +use Webauthn\Denormalizer\WebauthnSerializerFactory; use Webauthn\Exception\WebauthnException; +use Webauthn\PublicKeyCredential; use Webauthn\PublicKeyCredentialCreationOptions; -use Webauthn\PublicKeyCredentialLoader; use Webauthn\PublicKeyCredentialParameters; use Webauthn\PublicKeyCredentialRequestOptions; use Webauthn\PublicKeyCredentialRpEntity; use Webauthn\PublicKeyCredentialSource; use Webauthn\PublicKeyCredentialUserEntity; -/** - * @psalm-suppress UnusedClass - */ class PasskeysController extends Controller { public function index(): View @@ -51,22 +50,26 @@ class PasskeysController extends Controller return view('admin.passkeys.index', compact('passkeys')); } - public function getCreateOptions(): JsonResponse + /** + * @throws RandomException + * @throws \JsonException + */ + public function getCreateOptions(Request $request): JsonResponse { /** @var User $user */ $user = auth()->user(); // RP Entity i.e. the application $rpEntity = PublicKeyCredentialRpEntity::create( - config('app.name'), - config('url.longurl'), + name: config('app.name'), + id: config('app.url'), ); // User Entity $userEntity = PublicKeyCredentialUserEntity::create( - $user->name, - (string) $user->id, - $user->name, + name: $user->name, + id: (string) $user->id, + displayName: $user->name, ); // Challenge @@ -84,70 +87,100 @@ class PasskeysController extends Controller $authenticatorSelectionCriteria = AuthenticatorSelectionCriteria::create( userVerification: AuthenticatorSelectionCriteria::USER_VERIFICATION_REQUIREMENT_REQUIRED, residentKey: AuthenticatorSelectionCriteria::RESIDENT_KEY_REQUIREMENT_REQUIRED, - requireResidentKey: true, ); - $options = PublicKeyCredentialCreationOptions::create( - $rpEntity, - $userEntity, - $challenge, - $pubKeyCredParams, + $publicKeyCredentialCreationOptions = PublicKeyCredentialCreationOptions::create( + rp: $rpEntity, + user: $userEntity, + challenge: $challenge, + pubKeyCredParams: $pubKeyCredParams, authenticatorSelection: $authenticatorSelectionCriteria, attestation: PublicKeyCredentialCreationOptions::ATTESTATION_CONVEYANCE_PREFERENCE_NONE ); - $options = json_encode($options, JSON_THROW_ON_ERROR); + $attestationStatementSupportManager = new AttestationStatementSupportManager; + $attestationStatementSupportManager->add(new NoneAttestationStatementSupport); + $webauthnSerializerFactory = new WebauthnSerializerFactory( + attestationStatementSupportManager: $attestationStatementSupportManager + ); + $webauthnSerializer = $webauthnSerializerFactory->create(); + $publicKeyCredentialCreationOptions = $webauthnSerializer->serialize( + data: $publicKeyCredentialCreationOptions, + format: 'json' + ); - session(['create_options' => $options]); + $request->session()->put('create_options', $publicKeyCredentialCreationOptions); - return JsonResponse::fromJsonString($options); + return JsonResponse::fromJsonString($publicKeyCredentialCreationOptions); } + /** + * @throws Throwable + * @throws WebauthnException + * @throws \JsonException + */ public function create(Request $request): JsonResponse { /** @var User $user */ $user = auth()->user(); $publicKeyCredentialCreationOptionsData = session('create_options'); + // Unset session data to mitigate replay attacks + $request->session()->forget('create_options'); if (empty($publicKeyCredentialCreationOptionsData)) { throw new WebAuthnException('No public key credential request options found'); } - $publicKeyCredentialCreationOptions = PublicKeyCredentialCreationOptions::createFromString($publicKeyCredentialCreationOptionsData); - // Unset session data to mitigate replay attacks - session()->forget('create_options'); + $attestationStatementSupportManager = new AttestationStatementSupportManager; + $attestationStatementSupportManager->add(new NoneAttestationStatementSupport); + $webauthnSerializerFactory = new WebauthnSerializerFactory( + attestationStatementSupportManager: $attestationStatementSupportManager + ); + $webauthnSerializer = $webauthnSerializerFactory->create(); - $attestationSupportManager = AttestationStatementSupportManager::create(); - $attestationSupportManager->add(NoneAttestationStatementSupport::create()); - $attestationObjectLoader = AttestationObjectLoader::create($attestationSupportManager); - $publicKeyCredentialLoader = PublicKeyCredentialLoader::create($attestationObjectLoader); - - $publicKeyCredential = $publicKeyCredentialLoader->load(json_encode($request->all(), JSON_THROW_ON_ERROR)); + $publicKeyCredential = $webauthnSerializer->deserialize( + json_encode($request->all(), JSON_THROW_ON_ERROR), + PublicKeyCredential::class, + 'json' + ); if (! $publicKeyCredential->response instanceof AuthenticatorAttestationResponse) { throw new WebAuthnException('Invalid response type'); } - $attestationStatementSupportManager = AttestationStatementSupportManager::create(); - $attestationStatementSupportManager->add(NoneAttestationStatementSupport::create()); + $algorithmManager = new Manager; + $algorithmManager->add(new Ed25519); + $algorithmManager->add(new ES256); + $algorithmManager->add(new RS256); + + $ceremonyStepManagerFactory = new CeremonyStepManagerFactory; + $ceremonyStepManagerFactory->setAlgorithmManager($algorithmManager); + $ceremonyStepManagerFactory->setAttestationStatementSupportManager( + $attestationStatementSupportManager + ); + $ceremonyStepManagerFactory->setExtensionOutputCheckerHandler( + ExtensionOutputCheckerHandler::create() + ); + $allowedOrigins = []; + if (App::environment('local', 'development')) { + $allowedOrigins = [config('app.url')]; + } + $ceremonyStepManagerFactory->setAllowedOrigins($allowedOrigins); $authenticatorAttestationResponseValidator = AuthenticatorAttestationResponseValidator::create( - attestationStatementSupportManager: $attestationStatementSupportManager, - publicKeyCredentialSourceRepository: null, - tokenBindingHandler: null, - extensionOutputCheckerHandler: ExtensionOutputCheckerHandler::create(), + ceremonyStepManager: $ceremonyStepManagerFactory->creationCeremony() ); - $securedRelyingPartyId = []; - if (App::environment('local', 'development')) { - $securedRelyingPartyId = [config('url.longurl')]; - } + $publicKeyCredentialCreationOptions = $webauthnSerializer->deserialize( + $publicKeyCredentialCreationOptionsData, + PublicKeyCredentialCreationOptions::class, + 'json' + ); $publicKeyCredentialSource = $authenticatorAttestationResponseValidator->check( authenticatorAttestationResponse: $publicKeyCredential->response, publicKeyCredentialCreationOptions: $publicKeyCredentialCreationOptions, - request: config('url.longurl'), - securedRelyingPartyId: $securedRelyingPartyId, + host: config('app.url') ); $user->passkey()->create([ @@ -161,24 +194,37 @@ class PasskeysController extends Controller ]); } - public function getRequestOptions(): JsonResponse + /** + * @throws RandomException + * @throws \JsonException + */ + public function getRequestOptions(Request $request): JsonResponse { $publicKeyCredentialRequestOptions = PublicKeyCredentialRequestOptions::create( challenge: random_bytes(16), userVerification: PublicKeyCredentialRequestOptions::USER_VERIFICATION_REQUIREMENT_REQUIRED ); - $publicKeyCredentialRequestOptions = json_encode($publicKeyCredentialRequestOptions, JSON_THROW_ON_ERROR); + $attestationStatementSupportManager = AttestationStatementSupportManager::create(); + $attestationStatementSupportManager->add(NoneAttestationStatementSupport::create()); + $factory = new WebauthnSerializerFactory( + attestationStatementSupportManager: $attestationStatementSupportManager + ); + $serializer = $factory->create(); + $publicKeyCredentialRequestOptions = $serializer->serialize(data: $publicKeyCredentialRequestOptions, format: 'json'); - session(['request_options' => $publicKeyCredentialRequestOptions]); + $request->session()->put('request_options', $publicKeyCredentialRequestOptions); return JsonResponse::fromJsonString($publicKeyCredentialRequestOptions); } + /** + * @throws \JsonException + */ public function login(Request $request): JsonResponse { $requestOptions = session('request_options'); - session()->forget('request_options'); + $request->session()->forget('request_options'); if (empty($requestOptions)) { return response()->json([ @@ -187,14 +233,19 @@ class PasskeysController extends Controller ], 400); } - $publicKeyCredentialRequestOptions = PublicKeyCredentialRequestOptions::createFromString($requestOptions); + $attestationStatementSupportManager = new AttestationStatementSupportManager; + $attestationStatementSupportManager->add(new NoneAttestationStatementSupport); - $attestationSupportManager = AttestationStatementSupportManager::create(); - $attestationSupportManager->add(NoneAttestationStatementSupport::create()); - $attestationObjectLoader = AttestationObjectLoader::create($attestationSupportManager); - $publicKeyCredentialLoader = PublicKeyCredentialLoader::create($attestationObjectLoader); + $webauthnSerializerFactory = new WebauthnSerializerFactory( + attestationStatementSupportManager: $attestationStatementSupportManager + ); + $webauthnSerializer = $webauthnSerializerFactory->create(); - $publicKeyCredential = $publicKeyCredentialLoader->load(json_encode($request->all(), JSON_THROW_ON_ERROR)); + $publicKeyCredential = $webauthnSerializer->deserialize( + json_encode($request->all(), JSON_THROW_ON_ERROR), + PublicKeyCredential::class, + 'json' + ); if (! $publicKeyCredential->response instanceof AuthenticatorAssertionResponse) { return response()->json([ @@ -211,33 +262,51 @@ class PasskeysController extends Controller ], 404); } - $credential = PublicKeyCredentialSource::createFromArray(json_decode($passkey->passkey, true, 512, JSON_THROW_ON_ERROR)); - - $algorithmManager = Manager::create(); - $algorithmManager->add(new Ed25519()); - $algorithmManager->add(new ES256()); - $algorithmManager->add(new RS256()); - - $authenticatorAssertionResponseValidator = new AuthenticatorAssertionResponseValidator( - publicKeyCredentialSourceRepository: null, - tokenBindingHandler: null, - extensionOutputCheckerHandler: ExtensionOutputCheckerHandler::create(), - algorithmManager: $algorithmManager, + $publicKeyCredentialSource = $webauthnSerializer->deserialize( + $passkey->passkey, + PublicKeyCredentialSource::class, + 'json' ); - $securedRelyingPartyId = []; + $algorithmManager = new Manager; + $algorithmManager->add(new Ed25519); + $algorithmManager->add(new ES256); + $algorithmManager->add(new RS256); + + $attestationStatementSupportManager = new AttestationStatementSupportManager; + $attestationStatementSupportManager->add(new NoneAttestationStatementSupport); + + $ceremonyStepManagerFactory = new CeremonyStepManagerFactory; + $ceremonyStepManagerFactory->setAlgorithmManager($algorithmManager); + $ceremonyStepManagerFactory->setAttestationStatementSupportManager( + $attestationStatementSupportManager + ); + $ceremonyStepManagerFactory->setExtensionOutputCheckerHandler( + ExtensionOutputCheckerHandler::create() + ); + $allowedOrigins = []; if (App::environment('local', 'development')) { - $securedRelyingPartyId = [config('url.longurl')]; + $allowedOrigins = [config('app.url')]; } + $ceremonyStepManagerFactory->setAllowedOrigins($allowedOrigins); + + $authenticatorAssertionResponseValidator = AuthenticatorAssertionResponseValidator::create( + ceremonyStepManager: $ceremonyStepManagerFactory->requestCeremony() + ); + + $publicKeyCredentialRequestOptions = $webauthnSerializer->deserialize( + $requestOptions, + PublicKeyCredentialRequestOptions::class, + 'json' + ); try { $authenticatorAssertionResponseValidator->check( - credentialId: $credential, + publicKeyCredentialSource: $publicKeyCredentialSource, authenticatorAssertionResponse: $publicKeyCredential->response, publicKeyCredentialRequestOptions: $publicKeyCredentialRequestOptions, - request: config('url.longurl'), + host: config('app.url'), userHandle: null, - securedRelyingPartyId: $securedRelyingPartyId, ); } catch (Throwable) { return response()->json([ diff --git a/app/Http/Controllers/Admin/PlacesController.php b/app/Http/Controllers/Admin/PlacesController.php index 2b0d2e99..e5e82bcd 100644 --- a/app/Http/Controllers/Admin/PlacesController.php +++ b/app/Http/Controllers/Admin/PlacesController.php @@ -10,9 +10,6 @@ use App\Services\PlaceService; use Illuminate\Http\RedirectResponse; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class PlacesController extends Controller { protected PlaceService $placeService; diff --git a/app/Http/Controllers/Admin/SyndicationTargetsController.php b/app/Http/Controllers/Admin/SyndicationTargetsController.php index 6eb60f69..dc14a2d2 100644 --- a/app/Http/Controllers/Admin/SyndicationTargetsController.php +++ b/app/Http/Controllers/Admin/SyndicationTargetsController.php @@ -10,9 +10,6 @@ use Illuminate\Http\RedirectResponse; use Illuminate\Http\Request; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class SyndicationTargetsController extends Controller { /** diff --git a/app/Http/Controllers/ArticlesController.php b/app/Http/Controllers/ArticlesController.php index 725c5b91..9ab860d7 100644 --- a/app/Http/Controllers/ArticlesController.php +++ b/app/Http/Controllers/ArticlesController.php @@ -10,9 +10,6 @@ use Illuminate\Http\RedirectResponse; use Illuminate\View\View; use Jonnybarnes\IndieWeb\Numbers; -/** - * @psalm-suppress UnusedClass - */ class ArticlesController extends Controller { /** diff --git a/app/Http/Controllers/AuthController.php b/app/Http/Controllers/AuthController.php index 27f34eab..bd0022d6 100644 --- a/app/Http/Controllers/AuthController.php +++ b/app/Http/Controllers/AuthController.php @@ -9,9 +9,6 @@ use Illuminate\Http\Request; use Illuminate\Support\Facades\Auth; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class AuthController extends Controller { /** diff --git a/app/Http/Controllers/BookmarksController.php b/app/Http/Controllers/BookmarksController.php index ae9a0280..b4bb3c13 100644 --- a/app/Http/Controllers/BookmarksController.php +++ b/app/Http/Controllers/BookmarksController.php @@ -7,9 +7,6 @@ namespace App\Http\Controllers; use App\Models\Bookmark; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class BookmarksController extends Controller { /** diff --git a/app/Http/Controllers/ContactsController.php b/app/Http/Controllers/ContactsController.php index 503a75ff..280cc3ed 100644 --- a/app/Http/Controllers/ContactsController.php +++ b/app/Http/Controllers/ContactsController.php @@ -8,9 +8,6 @@ use App\Models\Contact; use Illuminate\Filesystem\Filesystem; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class ContactsController extends Controller { /** @@ -18,7 +15,7 @@ class ContactsController extends Controller */ public function index(): View { - $filesystem = new Filesystem(); + $filesystem = new Filesystem; $contacts = Contact::all(); foreach ($contacts as $contact) { $contact->homepageHost = parse_url($contact->homepage, PHP_URL_HOST); @@ -40,7 +37,7 @@ class ContactsController extends Controller $contact->homepageHost = parse_url($contact->homepage, PHP_URL_HOST); $file = public_path() . '/assets/profile-images/' . $contact->homepageHost . '/image'; - $filesystem = new Filesystem(); + $filesystem = new Filesystem; $image = ($filesystem->exists($file)) ? '/assets/profile-images/' . $contact->homepageHost . '/image' : diff --git a/app/Http/Controllers/FeedsController.php b/app/Http/Controllers/FeedsController.php index 4e887105..eb0847a3 100644 --- a/app/Http/Controllers/FeedsController.php +++ b/app/Http/Controllers/FeedsController.php @@ -9,9 +9,6 @@ use App\Models\Note; use Illuminate\Http\JsonResponse; use Illuminate\Http\Response; -/** - * @psalm-suppress UnusedClass - */ class FeedsController extends Controller { /** @@ -122,8 +119,8 @@ class FeedsController extends Controller foreach ($notes as $key => $note) { $data['items'][$key] = [ - 'id' => $note->longurl, - 'url' => $note->longurl, + 'id' => $note->uri, + 'url' => $note->uri, 'content_text' => $note->content, 'date_published' => $note->created_at->tz('UTC')->toRfc3339String(), 'date_modified' => $note->updated_at->tz('UTC')->toRfc3339String(), @@ -164,7 +161,7 @@ class FeedsController extends Controller 'author' => [ 'type' => 'card', 'name' => config('user.display_name'), - 'url' => config('url.longurl'), + 'url' => config('app.url'), ], 'children' => $items, ], 200, [ @@ -183,8 +180,8 @@ class FeedsController extends Controller $items[] = [ 'type' => 'entry', 'published' => $note->created_at, - 'uid' => $note->longurl, - 'url' => $note->longurl, + 'uid' => $note->uri, + 'url' => $note->uri, 'content' => [ 'text' => $note->getRawOriginal('note'), 'html' => $note->note, @@ -200,7 +197,7 @@ class FeedsController extends Controller 'author' => [ 'type' => 'card', 'name' => config('user.display_name'), - 'url' => config('url.longurl'), + 'url' => config('app.url'), ], 'children' => $items, ], 200, [ diff --git a/app/Http/Controllers/FrontPageController.php b/app/Http/Controllers/FrontPageController.php index 8ae9c3c6..19537663 100644 --- a/app/Http/Controllers/FrontPageController.php +++ b/app/Http/Controllers/FrontPageController.php @@ -10,9 +10,6 @@ use App\Models\Note; use Illuminate\Http\Response; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class FrontPageController extends Controller { /** diff --git a/app/Http/Controllers/IndieAuthController.php b/app/Http/Controllers/IndieAuthController.php new file mode 100644 index 00000000..45b488da --- /dev/null +++ b/app/Http/Controllers/IndieAuthController.php @@ -0,0 +1,327 @@ +json([ + 'issuer' => config('app.url'), + 'authorization_endpoint' => route('indieauth.start'), + 'token_endpoint' => route('indieauth.token'), + 'code_challenge_methods_supported' => ['S256'], + // 'introspection_endpoint' => route('indieauth.introspection'), + // 'introspection_endpoint_auth_methods_supported' => ['none'], + ]); + } + + /** + * Process a GET request to the IndieAuth endpoint. + * + * This is the first step in the IndieAuth flow, where the client app sends the user to the IndieAuth endpoint. + */ + public function start(Request $request): View + { + // First check all required params are present + $validator = Validator::make($request->all(), [ + 'response_type' => 'required:string', + 'client_id' => 'required', + 'redirect_uri' => 'required', + 'state' => 'required', + 'code_challenge' => 'required:string', + 'code_challenge_method' => 'required:string', + ], [ + 'response_type' => 'response_type is required', + 'client_id.required' => 'client_id is required to display which app is asking for authentication', + 'redirect_uri.required' => 'redirect_uri is required so we can progress successful requests', + 'state.required' => 'state is required', + 'code_challenge.required' => 'code_challenge is required', + 'code_challenge_method.required' => 'code_challenge_method is required', + ]); + + if ($validator->fails()) { + return view('indieauth.error')->withErrors($validator); + } + + if ($request->get('response_type') !== 'code') { + return view('indieauth.error')->withErrors(['response_type' => 'only a response_type of "code" is supported']); + } + + if (mb_strtoupper($request->get('code_challenge_method')) !== 'S256') { + return view('indieauth.error')->withErrors(['code_challenge_method' => 'only a code_challenge_method of "S256" is supported']); + } + + if (! $this->isValidRedirectUri($request->get('client_id'), $request->get('redirect_uri'))) { + return view('indieauth.error')->withErrors(['redirect_uri' => 'redirect_uri is not valid for this client_id']); + } + + $scopes = $request->get('scope', ''); + $scopes = explode(' ', $scopes); + + return view('indieauth.start', [ + 'me' => $request->get('me'), + 'client_id' => $request->get('client_id'), + 'redirect_uri' => $request->get('redirect_uri'), + 'state' => $request->get('state'), + 'scopes' => $scopes, + 'code_challenge' => $request->get('code_challenge'), + 'code_challenge_method' => $request->get('code_challenge_method'), + ]); + } + + /** + * Confirm an IndieAuth approval request. + * + * Generates an auth code and redirects the user back to the client app. + * + * @throws RandomException + */ + public function confirm(Request $request): RedirectResponse + { + $authCode = bin2hex(random_bytes(16)); + + $cacheKey = hash('xxh3', $request->get('client_id')); + + $indieAuthRequestData = [ + 'code_challenge' => $request->get('code_challenge'), + 'code_challenge_method' => $request->get('code_challenge_method'), + 'client_id' => $request->get('client_id'), + 'redirect_uri' => $request->get('redirect_uri'), + 'auth_code' => $authCode, + 'scope' => implode(' ', $request->get('scope', '')), + ]; + + Cache::put($cacheKey, $indieAuthRequestData, now()->addMinutes(10)); + + $redirectUri = new Uri($request->get('redirect_uri')); + $redirectUri = Uri::withQueryValues($redirectUri, [ + 'code' => $authCode, + 'state' => $request->get('state'), + 'iss' => config('app.url'), + ]); + + return redirect()->away($redirectUri); + } + + /** + * Process a POST request to the IndieAuth auth endpoint. + * + * This is one possible second step in the IndieAuth flow, where the client app sends the auth code to the IndieAuth + * endpoint. As it is to the auth endpoint we return profile information. A similar request can be made to the token + * endpoint to get an access token. + */ + public function processCodeExchange(Request $request): JsonResponse + { + $invalidCodeResponse = $this->validateAuthorizationCode($request); + + if ($invalidCodeResponse instanceof JsonResponse) { + return $invalidCodeResponse; + } + + return response()->json([ + 'me' => config('app.url'), + ]); + } + + /** + * Process a POST request to the IndieAuth token endpoint. + * + * This is another possible second step in the IndieAuth flow, where the client app sends the auth code to the + * IndieAuth token endpoint. As it is to the token endpoint we return an access token. + * + * @throws SodiumException + */ + public function processTokenRequest(Request $request): JsonResponse + { + $indieAuthData = $this->validateAuthorizationCode($request); + + if ($indieAuthData instanceof JsonResponse) { + return $indieAuthData; + } + + if ($indieAuthData['scope'] === '') { + return response()->json(['errors' => [ + 'scope' => [ + 'The scope property must be non-empty for an access token to be issued.', + ], + ]], 400); + } + + $tokenData = [ + 'me' => config('app.url'), + 'client_id' => $request->get('client_id'), + 'scope' => $indieAuthData['scope'], + ]; + $tokenService = resolve(TokenService::class); + $token = $tokenService->getNewToken($tokenData); + + return response()->json([ + 'access_token' => $token, + 'token_type' => 'Bearer', + 'scope' => $indieAuthData['scope'], + 'me' => config('app.url'), + ]); + } + + protected function isValidRedirectUri(string $clientId, string $redirectUri): bool + { + // If client_id is not a valid URL, then it's not valid + $clientIdParsed = \Mf2\parseUriToComponents($clientId); + if (! isset($clientIdParsed['authority'])) { + return false; + } + + // If redirect_uri is not a valid URL, then it's not valid + $redirectUriParsed = \Mf2\parseUriToComponents($redirectUri); + if (! isset($redirectUriParsed['authority'])) { + return false; + } + + // If client_id and redirect_uri are the same host, then it's valid + if ($clientIdParsed['authority'] === $redirectUriParsed['authority']) { + return true; + } + + // Otherwise we need to check the redirect_uri is in the client_id's redirect_uris + $guzzle = resolve(Client::class); + + try { + $clientInfo = $guzzle->get($clientId); + } catch (Exception) { + return false; + } + + $clientInfoParsed = \Mf2\parse($clientInfo->getBody()->getContents(), $clientId); + + $redirectUris = $clientInfoParsed['rels']['redirect_uri'] ?? []; + + return in_array($redirectUri, $redirectUris, true); + } + + /** + * @throws SodiumException + */ + protected function validateAuthorizationCode(Request $request): JsonResponse|array + { + // First check all the data is present + $validator = Validator::make($request->all(), [ + 'grant_type' => 'required:string', + 'code' => 'required:string', + 'client_id' => 'required', + 'redirect_uri' => 'required', + 'code_verifier' => 'required', + ]); + + if ($validator->fails()) { + return response()->json(['errors' => $validator->errors()], 400); + } + + if ($request->get('grant_type') !== 'authorization_code') { + return response()->json(['errors' => [ + 'grant_type' => [ + 'Only a grant type of "authorization_code" is supported.', + ], + ]], 400); + } + + // Check cache for auth code + $cacheKey = hash('xxh3', $request->get('client_id')); + $indieAuthRequestData = Cache::pull($cacheKey); + + if ($indieAuthRequestData === null) { + return response()->json(['errors' => [ + 'code' => [ + 'The code is invalid.', + ], + ]], 404); + } + + // Check the IndieAuth code + if (! array_key_exists('auth_code', $indieAuthRequestData)) { + return response()->json(['errors' => [ + 'code' => [ + 'The code is invalid.', + ], + ]], 400); + } + if ($indieAuthRequestData['auth_code'] !== $request->get('code')) { + return response()->json(['errors' => [ + 'code' => [ + 'The code is invalid.', + ], + ]], 400); + } + + // Check code verifier + if (! array_key_exists('code_challenge', $indieAuthRequestData)) { + return response()->json(['errors' => [ + 'code_verifier' => [ + 'The code verifier is invalid.', + ], + ]], 400); + } + if (! hash_equals( + $indieAuthRequestData['code_challenge'], + sodium_bin2base64( + hash('sha256', $request->get('code_verifier'), true), + SODIUM_BASE64_VARIANT_URLSAFE_NO_PADDING + ) + )) { + return response()->json(['errors' => [ + 'code_verifier' => [ + 'The code verifier is invalid.', + ], + ]], 400); + } + + // Check redirect_uri + if (! array_key_exists('redirect_uri', $indieAuthRequestData)) { + return response()->json(['errors' => [ + 'redirect_uri' => [ + 'The redirect uri is invalid.', + ], + ]], 400); + } + if ($indieAuthRequestData['redirect_uri'] !== $request->get('redirect_uri')) { + return response()->json(['errors' => [ + 'redirect_uri' => [ + 'The redirect uri is invalid.', + ], + ]], 400); + } + + // Check client_id + if (! array_key_exists('client_id', $indieAuthRequestData)) { + return response()->json(['errors' => [ + 'client_id' => [ + 'The client id is invalid.', + ], + ]], 400); + } + if ($indieAuthRequestData['client_id'] !== $request->get('client_id')) { + return response()->json(['errors' => [ + 'client_id' => [ + 'The client id is invalid.', + ], + ]], 400); + } + + return $indieAuthRequestData; + } +} diff --git a/app/Http/Controllers/LikesController.php b/app/Http/Controllers/LikesController.php index 77d5f963..af1c483c 100644 --- a/app/Http/Controllers/LikesController.php +++ b/app/Http/Controllers/LikesController.php @@ -7,9 +7,6 @@ namespace App\Http\Controllers; use App\Models\Like; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class LikesController extends Controller { /** diff --git a/app/Http/Controllers/MicropubController.php b/app/Http/Controllers/MicropubController.php index 629cb4e6..758b3255 100644 --- a/app/Http/Controllers/MicropubController.php +++ b/app/Http/Controllers/MicropubController.php @@ -4,110 +4,73 @@ declare(strict_types=1); namespace App\Http\Controllers; -use App\Http\Responses\MicropubResponses; +use App\Exceptions\InvalidTokenScopeException; +use App\Exceptions\MicropubHandlerException; +use App\Http\Requests\MicropubRequest; use App\Models\Place; use App\Models\SyndicationTarget; -use App\Services\Micropub\HCardService; -use App\Services\Micropub\HEntryService; -use App\Services\Micropub\UpdateService; -use App\Services\TokenService; +use App\Services\Micropub\MicropubHandlerRegistry; use Illuminate\Http\JsonResponse; use Illuminate\Http\Request; -use Lcobucci\JWT\Encoding\CannotDecodeContent; -use Lcobucci\JWT\Token\InvalidTokenStructure; -use Lcobucci\JWT\Validation\RequiredConstraintsViolated; -use Monolog\Handler\StreamHandler; -use Monolog\Logger; +use Lcobucci\JWT\Token; -/** - * @psalm-suppress UnusedClass - */ class MicropubController extends Controller { - protected TokenService $tokenService; + protected MicropubHandlerRegistry $handlerRegistry; - protected HEntryService $hentryService; - - protected HCardService $hcardService; - - protected UpdateService $updateService; - - public function __construct( - TokenService $tokenService, - HEntryService $hentryService, - HCardService $hcardService, - UpdateService $updateService - ) { - $this->tokenService = $tokenService; - $this->hentryService = $hentryService; - $this->hcardService = $hcardService; - $this->updateService = $updateService; + public function __construct(MicropubHandlerRegistry $handlerRegistry) + { + $this->handlerRegistry = $handlerRegistry; } /** - * This function receives an API request, verifies the authenticity - * then passes over the info to the relevant Service class. + * Respond to a POST request to the micropub endpoint. + * + * The request is initially processed by the MicropubRequest form request + * class. The normalizes the data, so we can pass it into the handlers for + * the different micropub requests, h-entry or h-card, for example. */ - public function post(Request $request): JsonResponse + public function post(MicropubRequest $request): JsonResponse { + $type = $request->getType(); + + if (! $type) { + return response()->json([ + 'error' => 'invalid_request', + 'error_description' => 'Microformat object type is missing, for example: h-entry or h-card', + ], 400); + } + try { - $tokenData = $this->tokenService->validateToken($request->input('access_token')); - } catch (RequiredConstraintsViolated|InvalidTokenStructure|CannotDecodeContent) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->invalidTokenResponse(); - } - - if ($tokenData->claims()->has('scope') === false) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->tokenHasNoScopeResponse(); - } - - $this->logMicropubRequest($request->all()); - - if (($request->input('h') === 'entry') || ($request->input('type.0') === 'h-entry')) { - if (stripos($tokenData->claims()->get('scope'), 'create') === false) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->insufficientScopeResponse(); - } - $location = $this->hentryService->process($request->all(), $this->getCLientId()); + $handler = $this->handlerRegistry->getHandler($type); + $result = $handler->handle($request->getMicropubData()); + // Return appropriate response based on the handler result return response()->json([ - 'response' => 'created', - 'location' => $location, - ], 201)->header('Location', $location); - } - - if ($request->input('h') === 'card' || $request->input('type.0') === 'h-card') { - if (stripos($tokenData->claims()->get('scope'), 'create') === false) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->insufficientScopeResponse(); - } - $location = $this->hcardService->process($request->all()); - + 'response' => $result['response'], + 'location' => $result['url'] ?? null, + ], 201)->header('Location', $result['url']); + } catch (\InvalidArgumentException $e) { return response()->json([ - 'response' => 'created', - 'location' => $location, - ], 201)->header('Location', $location); + 'error' => 'invalid_request', + 'error_description' => $e->getMessage(), + ], 400); + } catch (MicropubHandlerException) { + return response()->json([ + 'error' => 'Unknown Micropub type', + 'error_description' => 'The request could not be processed by this server', + ], 500); + } catch (InvalidTokenScopeException) { + return response()->json([ + 'error' => 'invalid_scope', + 'error_description' => 'The token does not have the required scope for this request', + ], 403); + } catch (\Exception) { + return response()->json([ + 'error' => 'server_error', + 'error_description' => 'An error occurred processing the request', + ], 500); } - - if ($request->input('action') === 'update') { - if (stripos($tokenData->claims()->get('scope'), 'update') === false) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->insufficientScopeResponse(); - } - - return $this->updateService->process($request->all()); - } - - return response()->json([ - 'response' => 'error', - 'error_description' => 'unsupported_request_type', - ], 500); } /** @@ -120,12 +83,6 @@ class MicropubController extends Controller */ public function get(Request $request): JsonResponse { - try { - $tokenData = $this->tokenService->validateToken($request->input('access_token')); - } catch (RequiredConstraintsViolated|InvalidTokenStructure) { - return (new MicropubResponses())->invalidTokenResponse(); - } - if ($request->input('q') === 'syndicate-to') { return response()->json([ 'syndicate-to' => SyndicationTarget::all(), @@ -157,36 +114,17 @@ class MicropubController extends Controller ]); } - // default response is just to return the token data + // the default response is just to return the token data + /** @var Token $tokenData */ + $tokenData = $request->input('token_data'); + return response()->json([ 'response' => 'token', 'token' => [ - 'me' => $tokenData->claims()->get('me'), - 'scope' => $tokenData->claims()->get('scope'), - 'client_id' => $tokenData->claims()->get('client_id'), + 'me' => $tokenData['me'], + 'scope' => $tokenData['scope'], + 'client_id' => $tokenData['client_id'], ], ]); } - - /** - * Determine the client id from the access token sent with the request. - * - * @throws RequiredConstraintsViolated - */ - private function getClientId(): string - { - return resolve(TokenService::class) - ->validateToken(app('request')->input('access_token')) - ->claims()->get('client_id'); - } - - /** - * Save the details of the micropub request to a log file. - */ - private function logMicropubRequest(array $request): void - { - $logger = new Logger('micropub'); - $logger->pushHandler(new StreamHandler(storage_path('logs/micropub.log'))); - $logger->debug('MicropubLog', $request); - } } diff --git a/app/Http/Controllers/MicropubMediaController.php b/app/Http/Controllers/MicropubMediaController.php index b3cdd3e2..fc804ea2 100644 --- a/app/Http/Controllers/MicropubMediaController.php +++ b/app/Http/Controllers/MicropubMediaController.php @@ -7,54 +7,29 @@ namespace App\Http\Controllers; use App\Http\Responses\MicropubResponses; use App\Jobs\ProcessMedia; use App\Models\Media; -use App\Services\TokenService; use Exception; use Illuminate\Contracts\Container\BindingResolutionException; -use Illuminate\Http\File; use Illuminate\Http\JsonResponse; use Illuminate\Http\Request; use Illuminate\Http\Response; use Illuminate\Http\UploadedFile; use Illuminate\Support\Carbon; use Illuminate\Support\Facades\Storage; -use Illuminate\Support\Str; use Intervention\Image\ImageManager; -use Lcobucci\JWT\Token\InvalidTokenStructure; -use Lcobucci\JWT\Validation\RequiredConstraintsViolated; use Ramsey\Uuid\Uuid; -/** - * @psalm-suppress UnusedClass - */ class MicropubMediaController extends Controller { - protected TokenService $tokenService; - - public function __construct(TokenService $tokenService) - { - $this->tokenService = $tokenService; - } - public function getHandler(Request $request): JsonResponse { - try { - $tokenData = $this->tokenService->validateToken($request->input('access_token')); - } catch (RequiredConstraintsViolated|InvalidTokenStructure) { - $micropubResponses = new MicropubResponses(); + $tokenData = $request->input('token_data'); - return $micropubResponses->invalidTokenResponse(); + $scopes = $tokenData['scope']; + if (is_string($scopes)) { + $scopes = explode(' ', $scopes); } - - if ($tokenData->claims()->has('scope') === false) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->tokenHasNoScopeResponse(); - } - - if (Str::contains($tokenData->claims()->get('scope'), 'create') === false) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->insufficientScopeResponse(); + if (! in_array('create', $scopes, true)) { + return (new MicropubResponses)->insufficientScopeResponse(); } if ($request->input('q') === 'last') { @@ -105,24 +80,14 @@ class MicropubMediaController extends Controller */ public function media(Request $request): JsonResponse { - try { - $tokenData = $this->tokenService->validateToken($request->input('access_token')); - } catch (RequiredConstraintsViolated|InvalidTokenStructure) { - $micropubResponses = new MicropubResponses(); + $tokenData = $request->input('token_data'); - return $micropubResponses->invalidTokenResponse(); + $scopes = $tokenData['scope']; + if (is_string($scopes)) { + $scopes = explode(' ', $scopes); } - - if ($tokenData->claims()->has('scope') === false) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->tokenHasNoScopeResponse(); - } - - if (Str::contains($tokenData->claims()->get('scope'), 'create') === false) { - $micropubResponses = new MicropubResponses(); - - return $micropubResponses->insufficientScopeResponse(); + if (! in_array('create', $scopes, true)) { + return (new MicropubResponses)->insufficientScopeResponse(); } if ($request->hasFile('file') === false) { @@ -133,7 +98,10 @@ class MicropubMediaController extends Controller ], 400); } - if ($request->file('file')->isValid() === false) { + /** @var UploadedFile $file */ + $file = $request->file('file'); + + if ($file->isValid() === false) { return response()->json([ 'response' => 'error', 'error' => 'invalid_request', @@ -141,7 +109,7 @@ class MicropubMediaController extends Controller ], 400); } - $filename = $this->saveFile($request->file('file')); + $filename = Storage::disk('local')->putFile('media', $file); /** @var ImageManager $manager */ $manager = resolve(ImageManager::class); @@ -154,19 +122,12 @@ class MicropubMediaController extends Controller } $media = Media::create([ - 'token' => $request->bearerToken(), - 'path' => 'media/' . $filename, + 'token' => $request->input('access_token'), + 'path' => $filename, 'type' => $this->getFileTypeFromMimeType($request->file('file')->getMimeType()), 'image_widths' => $width, ]); - // put the file on S3 initially, the ProcessMedia job may edit this - Storage::disk('s3')->putFileAs( - 'media', - new File(storage_path('app') . '/' . $filename), - $filename - ); - ProcessMedia::dispatch($filename); return response()->json([ @@ -188,7 +149,7 @@ class MicropubMediaController extends Controller */ private function getFileTypeFromMimeType(string $mimeType): string { - //try known images + // try known images $imageMimeTypes = [ 'image/gif', 'image/jpeg', @@ -200,7 +161,7 @@ class MicropubMediaController extends Controller if (in_array($mimeType, $imageMimeTypes)) { return 'image'; } - //try known video + // try known video $videoMimeTypes = [ 'video/mp4', 'video/mpeg', @@ -211,7 +172,7 @@ class MicropubMediaController extends Controller if (in_array($mimeType, $videoMimeTypes)) { return 'video'; } - //try known audio types + // try known audio types $audioMimeTypes = [ 'audio/midi', 'audio/mpeg', @@ -230,7 +191,7 @@ class MicropubMediaController extends Controller * * @throws Exception */ - private function saveFile(UploadedFile $file): string + private function saveFileToLocal(UploadedFile $file): string { $filename = Uuid::uuid4()->toString() . '.' . $file->extension(); Storage::disk('local')->putFileAs('', $file, $filename); diff --git a/app/Http/Controllers/NotesController.php b/app/Http/Controllers/NotesController.php index bef422cb..d5c9bc90 100644 --- a/app/Http/Controllers/NotesController.php +++ b/app/Http/Controllers/NotesController.php @@ -14,8 +14,6 @@ use Jonnybarnes\IndieWeb\Numbers; /** * @todo Need to sort out Twitter and webmentions! - * - * @psalm-suppress UnusedClass */ class NotesController extends Controller { @@ -67,7 +65,7 @@ class NotesController extends Controller */ public function redirect(int $decId): RedirectResponse { - return redirect(config('app.url') . '/notes/' . (new Numbers())->numto60($decId)); + return redirect(config('app.url') . '/notes/' . (new Numbers)->numto60($decId)); } /** diff --git a/app/Http/Controllers/PlacesController.php b/app/Http/Controllers/PlacesController.php index b9bae93b..b949ecde 100644 --- a/app/Http/Controllers/PlacesController.php +++ b/app/Http/Controllers/PlacesController.php @@ -7,9 +7,6 @@ namespace App\Http\Controllers; use App\Models\Place; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class PlacesController extends Controller { /** diff --git a/app/Http/Controllers/SearchController.php b/app/Http/Controllers/SearchController.php index a8116c88..3f366538 100644 --- a/app/Http/Controllers/SearchController.php +++ b/app/Http/Controllers/SearchController.php @@ -6,9 +6,6 @@ use App\Models\Note; use Illuminate\Http\Request; use Illuminate\View\View; -/** - * @psalm-suppress UnusedClass - */ class SearchController extends Controller { public function search(Request $request): View diff --git a/app/Http/Controllers/ShortURLsController.php b/app/Http/Controllers/ShortURLsController.php deleted file mode 100644 index a232fcdb..00000000 --- a/app/Http/Controllers/ShortURLsController.php +++ /dev/null @@ -1,55 +0,0 @@ -client = $client; - $this->guzzle = $guzzle; - $this->tokenService = $tokenService; - } - - /** - * If the user has auth’d via the IndieAuth protocol, issue a valid token. - */ - public function create(Request $request): JsonResponse - { - $auth = $this->verifyIndieAuthCode( - config('url.authorization_endpoint'), - $request->input('code'), - $request->input('redirect_uri'), - $request->input('client_id'), - ); - - if ($auth === null || ! array_key_exists('me', $auth)) { - return response()->json([ - 'error' => 'There was an error verifying the IndieAuth code', - ], 401); - } - - $scope = $auth['scope'] ?? ''; - $tokenData = [ - 'me' => config('app.url'), - 'client_id' => $request->input('client_id'), - 'scope' => $scope, - ]; - $token = $this->tokenService->getNewToken($tokenData); - $content = [ - 'me' => config('app.url'), - 'scope' => $scope, - 'access_token' => $token, - ]; - - return response()->json($content); - } - - protected function verifyIndieAuthCode( - string $authorizationEndpoint, - string $code, - string $redirectUri, - string $clientId - ): ?array { - try { - $response = $this->guzzle->request('POST', $authorizationEndpoint, [ - 'headers' => [ - 'Accept' => 'application/json', - ], - 'form_params' => [ - 'code' => $code, - 'me' => config('app.url'), - 'redirect_uri' => $redirectUri, - 'client_id' => $clientId, - ], - ]); - } catch (BadResponseException) { - return null; - } - - try { - $authData = json_decode((string) $response->getBody(), true, 512, JSON_THROW_ON_ERROR); - } catch (JsonException) { - return null; - } - - return $authData; - } -} diff --git a/app/Http/Controllers/WebMentionsController.php b/app/Http/Controllers/WebMentionsController.php index 700a7e23..49eac9b2 100644 --- a/app/Http/Controllers/WebMentionsController.php +++ b/app/Http/Controllers/WebMentionsController.php @@ -12,9 +12,6 @@ use Illuminate\Http\Response; use Illuminate\View\View; use Jonnybarnes\IndieWeb\Numbers; -/** - * @psalm-suppress UnusedClass - */ class WebMentionsController extends Controller { /** @@ -33,7 +30,7 @@ class WebMentionsController extends Controller */ public function receive(Request $request): Response { - //first we trivially reject requests that lack all required inputs + // first we trivially reject requests that lack all required inputs if (($request->has('target') !== true) || ($request->has('source') !== true)) { return response( 'You need both the target and source parameters', @@ -41,12 +38,12 @@ class WebMentionsController extends Controller ); } - //next check the $target is valid + // next check the $target is valid $path = parse_url($request->input('target'), PHP_URL_PATH); $pathParts = explode('/', $path); if ($pathParts[1] === 'notes') { - //we have a note + // we have a note $noteId = $pathParts[2]; try { $note = Note::findOrFail(resolve(Numbers::class)->b60tonum($noteId)); diff --git a/app/Http/Kernel.php b/app/Http/Kernel.php deleted file mode 100644 index 3557e09c..00000000 --- a/app/Http/Kernel.php +++ /dev/null @@ -1,74 +0,0 @@ - - */ - protected $middleware = [ - // \App\Http\Middleware\TrustHosts::class, - \App\Http\Middleware\TrustProxies::class, - \Illuminate\Http\Middleware\HandleCors::class, - \App\Http\Middleware\PreventRequestsDuringMaintenance::class, - \Illuminate\Foundation\Http\Middleware\ValidatePostSize::class, - \App\Http\Middleware\TrimStrings::class, - \Illuminate\Foundation\Http\Middleware\ConvertEmptyStringsToNull::class, - ]; - - /** - * The application's route middleware groups. - * - * @var array> - */ - protected $middlewareGroups = [ - 'web' => [ - \App\Http\Middleware\EncryptCookies::class, - \Illuminate\Cookie\Middleware\AddQueuedCookiesToResponse::class, - \Illuminate\Session\Middleware\StartSession::class, - \Illuminate\View\Middleware\ShareErrorsFromSession::class, - \App\Http\Middleware\VerifyCsrfToken::class, - \Illuminate\Routing\Middleware\SubstituteBindings::class, - \App\Http\Middleware\LinkHeadersMiddleware::class, - \App\Http\Middleware\LocalhostSessionMiddleware::class, - \App\Http\Middleware\CSPHeader::class, - ], - - 'api' => [ - // \Laravel\Sanctum\Http\Middleware\EnsureFrontendRequestsAreStateful::class, - \Illuminate\Routing\Middleware\ThrottleRequests::class.':api', - \Illuminate\Routing\Middleware\SubstituteBindings::class, - ], - ]; - - /** - * The application's middleware aliases. - * - * Aliases may be used instead of class names to conveniently assign middleware to routes and groups. - * - * @var array - */ - protected $middlewareAliases = [ - 'auth' => \App\Http\Middleware\Authenticate::class, - 'auth.basic' => \Illuminate\Auth\Middleware\AuthenticateWithBasicAuth::class, - 'auth.session' => \Illuminate\Session\Middleware\AuthenticateSession::class, - 'cache.headers' => \Illuminate\Http\Middleware\SetCacheHeaders::class, - 'can' => \Illuminate\Auth\Middleware\Authorize::class, - 'guest' => \App\Http\Middleware\RedirectIfAuthenticated::class, - 'password.confirm' => \Illuminate\Auth\Middleware\RequirePassword::class, - 'precognitive' => \Illuminate\Foundation\Http\Middleware\HandlePrecognitiveRequests::class, - 'signed' => \App\Http\Middleware\ValidateSignature::class, - 'throttle' => \Illuminate\Routing\Middleware\ThrottleRequests::class, - 'verified' => \Illuminate\Auth\Middleware\EnsureEmailIsVerified::class, - 'micropub.token' => \App\Http\Middleware\VerifyMicropubToken::class, - 'myauth' => \App\Http\Middleware\MyAuthMiddleware::class, - 'cors' => \App\Http\Middleware\CorsHeaders::class, - ]; -} diff --git a/app/Http/Middleware/CSPHeader.php b/app/Http/Middleware/CSPHeader.php deleted file mode 100644 index b5c6ee25..00000000 --- a/app/Http/Middleware/CSPHeader.php +++ /dev/null @@ -1,48 +0,0 @@ -header( - 'Content-Security-Policy', - "default-src 'self'; " . - "style-src 'self' 'unsafe-inline' cloud.typography.com jonnybarnes.uk; " . - "img-src 'self' data: blob: https://pbs.twimg.com https://jbuk-media.s3-eu-west-1.amazonaws.com https://jbuk-media-dev.s3-eu-west-1.amazonaws.com https://secure.gravatar.com https://graph.facebook.com *.fbcdn.net https://*.cdninstagram.com https://*.4sqi.net https://upload.wikimedia.org; " . - "font-src 'self' data:; " . - "frame-src 'self' https://www.youtube.com blob:; " . - 'upgrade-insecure-requests; ' . - 'block-all-mixed-content; ' . - 'report-to csp-endpoint; ' . - 'report-uri https://jonnybarnes.report-uri.io/r/default/csp/enforce;' - )->header( - 'Report-To', - '{' . - "'url': 'https://jonnybarnes.report-uri.io/r/default/csp/enforce', " . - "'group': 'csp-endpoint', " . - "'max-age': 10886400" . - '}' - ); - // phpcs:enable Generic.Files.LineLength.TooLong - } -} diff --git a/app/Http/Middleware/CorsHeaders.php b/app/Http/Middleware/CorsHeaders.php index eae6c51d..cacf9188 100644 --- a/app/Http/Middleware/CorsHeaders.php +++ b/app/Http/Middleware/CorsHeaders.php @@ -10,8 +10,6 @@ class CorsHeaders { /** * Handle an incoming request. - * - * @psalm-suppress PossiblyUnusedMethod */ public function handle(Request $request, Closure $next): Response { diff --git a/app/Http/Middleware/LinkHeadersMiddleware.php b/app/Http/Middleware/LinkHeadersMiddleware.php index 66896428..467283db 100644 --- a/app/Http/Middleware/LinkHeadersMiddleware.php +++ b/app/Http/Middleware/LinkHeadersMiddleware.php @@ -10,16 +10,15 @@ class LinkHeadersMiddleware { /** * Handle an incoming request. - * - * @psalm-suppress PossiblyUnusedMethod */ public function handle(Request $request, Closure $next): Response { $response = $next($request); - $response->header('Link', '; rel="authorization_endpoint"', false); - $response->header('Link', '<' . config('app.url') . '/api/token>; rel="token_endpoint"', false); - $response->header('Link', '<' . config('app.url') . '/api/post>; rel="micropub"', false); - $response->header('Link', '<' . config('app.url') . '/webmention>; rel="webmention"', false); + $response->header('Link', '<' . route('indieauth.metadata') . '>; rel="indieauth-metadata"', false); + $response->header('Link', '<' . route('indieauth.start') . '>; rel="authorization_endpoint"', false); + $response->header('Link', '<' . route('indieauth.token') . '>; rel="token_endpoint"', false); + $response->header('Link', '<' . route('micropub-endpoint') . '>; rel="micropub"', false); + $response->header('Link', '<' . route('webmention-endpoint') . '>; rel="webmention"', false); return $response; } diff --git a/app/Http/Middleware/LocalhostSessionMiddleware.php b/app/Http/Middleware/LocalhostSessionMiddleware.php index c7d8ac4c..060682d5 100644 --- a/app/Http/Middleware/LocalhostSessionMiddleware.php +++ b/app/Http/Middleware/LocalhostSessionMiddleware.php @@ -14,8 +14,6 @@ class LocalhostSessionMiddleware * Whilst we are developing locally, automatically log in as * `['me' => config('app.url')]` as I can’t manually log in as * a .localhost domain. - * - * @psalm-suppress PossiblyUnusedMethod */ public function handle(Request $request, Closure $next): Response { diff --git a/app/Http/Middleware/LogMicropubRequest.php b/app/Http/Middleware/LogMicropubRequest.php new file mode 100644 index 00000000..a04e80de --- /dev/null +++ b/app/Http/Middleware/LogMicropubRequest.php @@ -0,0 +1,24 @@ +pushHandler(new StreamHandler(storage_path('logs/micropub.log'))); + $logger->debug('MicropubLog', $request->all()); + + return $next($request); + } +} diff --git a/app/Http/Middleware/MyAuthMiddleware.php b/app/Http/Middleware/MyAuthMiddleware.php index 26c8315f..b22e2b33 100644 --- a/app/Http/Middleware/MyAuthMiddleware.php +++ b/app/Http/Middleware/MyAuthMiddleware.php @@ -13,13 +13,13 @@ class MyAuthMiddleware { /** * Check the user is logged in. - * - * @psalm-suppress PossiblyUnusedMethod */ public function handle(Request $request, Closure $next): Response { if (Auth::check() === false) { // they’re not logged in, so send them to login form + redirect()->setIntendedUrl($request->fullUrl()); + return redirect()->route('login'); } diff --git a/app/Http/Middleware/ValidateSignature.php b/app/Http/Middleware/ValidateSignature.php index 2beb3c93..093bf64a 100644 --- a/app/Http/Middleware/ValidateSignature.php +++ b/app/Http/Middleware/ValidateSignature.php @@ -10,8 +10,6 @@ class ValidateSignature extends Middleware * The names of the query string parameters that should be ignored. * * @var array - * - * @psalm-suppress PossiblyUnusedProperty */ protected $except = [ // 'fbclid', diff --git a/app/Http/Middleware/VerifyMicropubToken.php b/app/Http/Middleware/VerifyMicropubToken.php index b68e999b..33d2cb12 100644 --- a/app/Http/Middleware/VerifyMicropubToken.php +++ b/app/Http/Middleware/VerifyMicropubToken.php @@ -4,8 +4,14 @@ declare(strict_types=1); namespace App\Http\Middleware; +use App\Http\Responses\MicropubResponses; use Closure; use Illuminate\Http\Request; +use Lcobucci\JWT\Configuration; +use Lcobucci\JWT\Encoding\CannotDecodeContent; +use Lcobucci\JWT\Token; +use Lcobucci\JWT\Token\InvalidTokenStructure; +use Lcobucci\JWT\Validation\RequiredConstraintsViolated; use Symfony\Component\HttpFoundation\Response; class VerifyMicropubToken @@ -13,24 +19,63 @@ class VerifyMicropubToken /** * Handle an incoming request. * - * @psalm-suppress PossiblyUnusedMethod + * @param Closure(Request): (Response) $next */ public function handle(Request $request, Closure $next): Response { + $rawToken = null; + if ($request->input('access_token')) { - return $next($request); + $rawToken = $request->input('access_token'); + } elseif ($request->bearerToken()) { + $rawToken = $request->bearerToken(); } - if ($request->bearerToken()) { - return $next($request->merge([ - 'access_token' => $request->bearerToken(), - ])); + if (! $rawToken) { + return response()->json([ + 'response' => 'error', + 'error' => 'unauthorized', + 'error_description' => 'No access token was provided in the request', + ], 401); } - return response()->json([ - 'response' => 'error', - 'error' => 'unauthorized', - 'error_description' => 'No access token was provided in the request', - ], 401); + try { + $tokenData = $this->validateToken($rawToken); + } catch (RequiredConstraintsViolated|InvalidTokenStructure|CannotDecodeContent) { + $micropubResponses = new MicropubResponses; + + return $micropubResponses->invalidTokenResponse(); + } + + if ($tokenData->claims()->has('scope') === false) { + $micropubResponses = new MicropubResponses; + + return $micropubResponses->tokenHasNoScopeResponse(); + } + + return $next($request->merge([ + 'access_token' => $rawToken, + 'token_data' => [ + 'me' => $tokenData->claims()->get('me'), + 'scope' => $tokenData->claims()->get('scope'), + 'client_id' => $tokenData->claims()->get('client_id'), + ], + ])); + } + + /** + * Check the token signature is valid. + */ + private function validateToken(string $bearerToken): Token + { + $config = resolve(Configuration::class); + + $token = $config->parser()->parse($bearerToken); + + $constraints = $config->validationConstraints(); + + $config->validator()->assert($token, ...$constraints); + + return $token; } } diff --git a/app/Http/Requests/MicropubRequest.php b/app/Http/Requests/MicropubRequest.php new file mode 100644 index 00000000..d931f139 --- /dev/null +++ b/app/Http/Requests/MicropubRequest.php @@ -0,0 +1,106 @@ +micropubData; + } + + public function getType(): ?string + { + // Return consistent type regardless of input format + return $this->micropubData['type'] ?? null; + } + + protected function prepareForValidation(): void + { + // Normalize the request data based on content type + if ($this->isJson()) { + $this->normalizeMicropubJson(); + } else { + $this->normalizeMicropubForm(); + } + } + + private function normalizeMicropubJson(): void + { + $json = $this->json(); + if ($json === null) { + throw new \InvalidArgumentException('`isJson()` passed but there is no json data'); + } + + $data = $json->all(); + + // Convert JSON type (h-entry) to simple type (entry) + if (isset($data['type']) && is_array($data['type'])) { + $type = current($data['type']); + if (strpos($type, 'h-') === 0) { + $this->micropubData['type'] = substr($type, 2); + } + } + // Or set the type to update + elseif (isset($data['action']) && $data['action'] === 'update') { + $this->micropubData['type'] = 'update'; + } + + // Add in the token data + $this->micropubData['token_data'] = $data['token_data']; + + // Add h-entry values + $this->micropubData['content'] = Arr::get($data, 'properties.content.0'); + $this->micropubData['in-reply-to'] = Arr::get($data, 'properties.in-reply-to.0'); + $this->micropubData['published'] = Arr::get($data, 'properties.published.0'); + $this->micropubData['location'] = Arr::get($data, 'location'); + $this->micropubData['bookmark-of'] = Arr::get($data, 'properties.bookmark-of.0'); + $this->micropubData['like-of'] = Arr::get($data, 'properties.like-of.0'); + $this->micropubData['mp-syndicate-to'] = Arr::get($data, 'properties.mp-syndicate-to'); + + // Add h-card values + $this->micropubData['name'] = Arr::get($data, 'properties.name.0'); + $this->micropubData['description'] = Arr::get($data, 'properties.description.0'); + $this->micropubData['geo'] = Arr::get($data, 'properties.geo.0'); + + // Add checkin value + $this->micropubData['checkin'] = Arr::get($data, 'checkin'); + $this->micropubData['syndication'] = Arr::get($data, 'properties.syndication.0'); + } + + private function normalizeMicropubForm(): void + { + // Convert form h=entry to type=entry + if ($h = $this->input('h')) { + $this->micropubData['type'] = $h; + } + + // Add some fields to the micropub data with default null values + $this->micropubData['in-reply-to'] = null; + $this->micropubData['published'] = null; + $this->micropubData['location'] = null; + $this->micropubData['description'] = null; + $this->micropubData['geo'] = null; + $this->micropubData['latitude'] = null; + $this->micropubData['longitude'] = null; + + // Map form fields to micropub data + foreach ($this->except(['h', 'access_token']) as $key => $value) { + $this->micropubData[$key] = $value; + } + } +} diff --git a/app/Jobs/DownloadWebMention.php b/app/Jobs/DownloadWebMention.php index 72f469e5..3c187dd4 100644 --- a/app/Jobs/DownloadWebMention.php +++ b/app/Jobs/DownloadWebMention.php @@ -24,8 +24,7 @@ class DownloadWebMention implements ShouldQueue */ public function __construct( protected string $source - ) { - } + ) {} /** * Execute the job. @@ -36,30 +35,30 @@ class DownloadWebMention implements ShouldQueue public function handle(Client $guzzle): void { $response = $guzzle->request('GET', $this->source); - //4XX and 5XX responses should get Guzzle to throw an exception, - //Laravel should catch and retry these automatically. + // 4XX and 5XX responses should get Guzzle to throw an exception, + // Laravel should catch and retry these automatically. if ($response->getStatusCode() === 200) { - $filesystem = new FileSystem(); + $filesystem = new FileSystem; $filename = storage_path('HTML') . '/' . $this->createFilenameFromURL($this->source); - //backup file first + // backup file first $filenameBackup = $filename . '.' . date('Y-m-d') . '.backup'; if ($filesystem->exists($filename)) { $filesystem->copy($filename, $filenameBackup); } - //check if base directory exists + // check if base directory exists if (! $filesystem->exists($filesystem->dirname($filename))) { $filesystem->makeDirectory( $filesystem->dirname($filename), - 0755, //mode - true //recursive + 0755, // mode + true // recursive ); } - //save new HTML + // save new HTML $filesystem->put( $filename, (string) $response->getBody() ); - //remove backup if the same + // remove backup if the same if ($filesystem->exists($filenameBackup)) { if ($filesystem->get($filename) === $filesystem->get($filenameBackup)) { $filesystem->delete($filenameBackup); diff --git a/app/Jobs/ProcessBookmark.php b/app/Jobs/ProcessBookmark.php index b1dffe8a..96f65e87 100644 --- a/app/Jobs/ProcessBookmark.php +++ b/app/Jobs/ProcessBookmark.php @@ -25,8 +25,7 @@ class ProcessBookmark implements ShouldQueue */ public function __construct( protected Bookmark $bookmark - ) { - } + ) {} /** * Execute the job. diff --git a/app/Jobs/ProcessLike.php b/app/Jobs/ProcessLike.php index 3a2d6f62..3c6028a9 100644 --- a/app/Jobs/ProcessLike.php +++ b/app/Jobs/ProcessLike.php @@ -30,8 +30,7 @@ class ProcessLike implements ShouldQueue */ public function __construct( protected Like $like - ) { - } + ) {} /** * Execute the job. @@ -50,7 +49,7 @@ class ProcessLike implements ShouldQueue $this->like->content = $tweet->html; $this->like->save(); - //POSSE like + // POSSE like try { $client->request( 'POST', diff --git a/app/Jobs/ProcessMedia.php b/app/Jobs/ProcessMedia.php index cb230c1e..b7f36648 100644 --- a/app/Jobs/ProcessMedia.php +++ b/app/Jobs/ProcessMedia.php @@ -25,43 +25,45 @@ class ProcessMedia implements ShouldQueue */ public function __construct( protected string $filename - ) { - } + ) {} /** * Execute the job. */ public function handle(ImageManager $manager): void { - //open file + // Load file + $file = Storage::disk('local')->get('media/' . $this->filename); + + // Open file try { - $image = $manager->read(storage_path('app') . '/' . $this->filename); + $image = $manager->read($file); } catch (DecoderException) { // not an image; delete file and end job - unlink(storage_path('app') . '/' . $this->filename); + Storage::disk('local')->delete('media/' . $this->filename); return; } - //create smaller versions if necessary + + // Save the file publicly + Storage::disk('public')->put('media/' . $this->filename, $file); + + // Create smaller versions if necessary if ($image->width() > 1000) { $filenameParts = explode('.', $this->filename); $extension = array_pop($filenameParts); // the following achieves this data flow // foo.bar.png => ['foo', 'bar', 'png'] => ['foo', 'bar'] => foo.bar - $basename = ltrim(array_reduce($filenameParts, function ($carry, $item) { - return $carry . '.' . $item; - }, ''), '.'); - $medium = $image->resize(1000, null, function ($constraint) { - $constraint->aspectRatio(); - }); - Storage::disk('s3')->put('media/' . $basename . '-medium.' . $extension, (string) $medium->encode()); - $small = $image->resize(500, null, function ($constraint) { - $constraint->aspectRatio(); - }); - Storage::disk('s3')->put('media/' . $basename . '-small.' . $extension, (string) $small->encode()); + $basename = trim(implode('.', $filenameParts), '.'); + + $medium = $image->resize(width: 1000); + Storage::disk('public')->put('media/' . $basename . '-medium.' . $extension, (string) $medium->encode()); + + $small = $image->resize(width: 500); + Storage::disk('public')->put('media/' . $basename . '-small.' . $extension, (string) $small->encode()); } - // now we can delete the locally saved image - unlink(storage_path('app') . '/' . $this->filename); + // Now we can delete the locally saved image + Storage::disk('local')->delete('media/' . $this->filename); } } diff --git a/app/Jobs/ProcessWebMention.php b/app/Jobs/ProcessWebMention.php index 457ab71d..d92dfa18 100644 --- a/app/Jobs/ProcessWebMention.php +++ b/app/Jobs/ProcessWebMention.php @@ -30,8 +30,7 @@ class ProcessWebMention implements ShouldQueue public function __construct( protected Note $note, protected string $source - ) { - } + ) {} /** * Execute the job. @@ -45,7 +44,7 @@ class ProcessWebMention implements ShouldQueue try { $response = $guzzle->request('GET', $this->source); } catch (RequestException $e) { - throw new RemoteContentNotFoundException(); + throw new RemoteContentNotFoundException; } $this->saveRemoteContent((string) $response->getBody(), $this->source); $microformats = Mf2\parse((string) $response->getBody(), $this->source); @@ -54,7 +53,7 @@ class ProcessWebMention implements ShouldQueue // check webmention still references target // we try each type of mention (reply/like/repost) if ($webmention->type === 'in-reply-to') { - if ($parser->checkInReplyTo($microformats, $this->note->longurl) === false) { + if ($parser->checkInReplyTo($microformats, $this->note->uri) === false) { // it doesn’t so delete $webmention->delete(); @@ -68,7 +67,7 @@ class ProcessWebMention implements ShouldQueue return; } if ($webmention->type === 'like-of') { - if ($parser->checkLikeOf($microformats, $this->note->longurl) === false) { + if ($parser->checkLikeOf($microformats, $this->note->uri) === false) { // it doesn’t so delete $webmention->delete(); @@ -76,7 +75,7 @@ class ProcessWebMention implements ShouldQueue } // note we don’t need to do anything if it still is a like } if ($webmention->type === 'repost-of') { - if ($parser->checkRepostOf($microformats, $this->note->longurl) === false) { + if ($parser->checkRepostOf($microformats, $this->note->uri) === false) { // it doesn’t so delete $webmention->delete(); @@ -86,11 +85,11 @@ class ProcessWebMention implements ShouldQueue }// foreach // no webmention in the db so create new one - $webmention = new WebMention(); + $webmention = new WebMention; $type = $parser->getMentionType($microformats); // throw error here? dispatch(new SaveProfileImage($microformats)); $webmention->source = $this->source; - $webmention->target = $this->note->longurl; + $webmention->target = $this->note->uri; $webmention->commentable_id = $this->note->id; $webmention->commentable_type = Note::class; $webmention->type = $type; diff --git a/app/Jobs/SaveProfileImage.php b/app/Jobs/SaveProfileImage.php index dd5422a9..08152d5b 100644 --- a/app/Jobs/SaveProfileImage.php +++ b/app/Jobs/SaveProfileImage.php @@ -25,8 +25,7 @@ class SaveProfileImage implements ShouldQueue */ public function __construct( protected array $microformats - ) { - } + ) {} /** * Execute the job. @@ -50,7 +49,7 @@ class SaveProfileImage implements ShouldQueue $home = array_shift($home); } - //dont save pbs.twimg.com links + // dont save pbs.twimg.com links if ( $photo && parse_url($photo, PHP_URL_HOST) !== 'pbs.twimg.com' diff --git a/app/Jobs/SaveScreenshot.php b/app/Jobs/SaveScreenshot.php index c086276c..0e07efbd 100755 --- a/app/Jobs/SaveScreenshot.php +++ b/app/Jobs/SaveScreenshot.php @@ -23,8 +23,7 @@ class SaveScreenshot implements ShouldQueue */ public function __construct( protected Bookmark $bookmark - ) { - } + ) {} /** * Execute the job. diff --git a/app/Jobs/SendWebMentions.php b/app/Jobs/SendWebMentions.php index 459b1cd8..2ff5f2c6 100644 --- a/app/Jobs/SendWebMentions.php +++ b/app/Jobs/SendWebMentions.php @@ -27,8 +27,7 @@ class SendWebMentions implements ShouldQueue */ public function __construct( protected Note $note - ) { - } + ) {} /** * Execute the job. @@ -46,7 +45,7 @@ class SendWebMentions implements ShouldQueue $guzzle = resolve(Client::class); $guzzle->post($endpoint, [ 'form_params' => [ - 'source' => $this->note->longurl, + 'source' => $this->note->uri, 'target' => $url, ], ]); @@ -62,7 +61,7 @@ class SendWebMentions implements ShouldQueue public function discoverWebmentionEndpoint(string $url): ?string { // let’s not send webmentions to myself - if (parse_url($url, PHP_URL_HOST) === config('url.longurl')) { + if (parse_url($url, PHP_URL_HOST) === parse_url(config('app.url'), PHP_URL_HOST)) { return null; } if (Str::startsWith($url, '/notes/tagged/')) { @@ -73,7 +72,7 @@ class SendWebMentions implements ShouldQueue $guzzle = resolve(Client::class); $response = $guzzle->get($url); - //check HTTP Headers for webmention endpoint + // check HTTP Headers for webmention endpoint $links = Header::parse($response->getHeader('Link')); foreach ($links as $link) { if (array_key_exists('rel', $link) && mb_stristr($link['rel'], 'webmention')) { @@ -81,7 +80,7 @@ class SendWebMentions implements ShouldQueue } } - //failed to find a header so parse HTML + // failed to find a header so parse HTML $html = (string) $response->getBody(); $mf2 = new \Mf2\Parser($html, $url); @@ -109,7 +108,7 @@ class SendWebMentions implements ShouldQueue } $urls = []; - $dom = new \DOMDocument(); + $dom = new \DOMDocument; $dom->loadHTML($html); $anchors = $dom->getElementsByTagName('a'); foreach ($anchors as $anchor) { diff --git a/app/Jobs/SyndicateNoteToBluesky.php b/app/Jobs/SyndicateNoteToBluesky.php new file mode 100644 index 00000000..e815be34 --- /dev/null +++ b/app/Jobs/SyndicateNoteToBluesky.php @@ -0,0 +1,62 @@ +request( + 'POST', + 'https://brid.gy/micropub', + [ + 'headers' => [ + 'Authorization' => 'Bearer ' . config('bridgy.bluesky_token'), + ], + 'json' => [ + 'type' => ['h-entry'], + 'properties' => [ + 'content' => [$this->note->getRawOriginal('note')], + ], + ], + ] + ); + + // Parse for syndication URL + if ($response->getStatusCode() === 201) { + $this->note->bluesky_url = $response->getHeader('Location')[0]; + $this->note->save(); + } + } +} diff --git a/app/Jobs/SyndicateNoteToMastodon.php b/app/Jobs/SyndicateNoteToMastodon.php index 557006a4..b79c092c 100644 --- a/app/Jobs/SyndicateNoteToMastodon.php +++ b/app/Jobs/SyndicateNoteToMastodon.php @@ -22,8 +22,7 @@ class SyndicateNoteToMastodon implements ShouldQueue */ public function __construct( protected Note $note - ) { - } + ) {} /** * Execute the job. diff --git a/app/Models/Article.php b/app/Models/Article.php index 42895f8d..bfbd5d51 100644 --- a/app/Models/Article.php +++ b/app/Models/Article.php @@ -58,10 +58,10 @@ class Article extends Model { return Attribute::get( get: function () { - $environment = new Environment(); - $environment->addExtension(new CommonMarkCoreExtension()); - $environment->addRenderer(FencedCode::class, new FencedCodeRenderer()); - $environment->addRenderer(IndentedCode::class, new IndentedCodeRenderer()); + $environment = new Environment; + $environment->addExtension(new CommonMarkCoreExtension); + $environment->addRenderer(FencedCode::class, new FencedCodeRenderer); + $environment->addRenderer(IndentedCode::class, new IndentedCodeRenderer); $markdownConverter = new MarkdownConverter($environment); return $markdownConverter->convert($this->main)->getContent(); diff --git a/app/Models/Bookmark.php b/app/Models/Bookmark.php index 29bd25ad..37027e40 100644 --- a/app/Models/Bookmark.php +++ b/app/Models/Bookmark.php @@ -26,7 +26,7 @@ class Bookmark extends Model return $this->belongsToMany('App\Models\Tag'); } - protected function longurl(): Attribute + protected function local_uri(): Attribute { return Attribute::get( get: fn () => config('app.url') . '/bookmarks/' . $this->id, diff --git a/app/Models/Media.php b/app/Models/Media.php index c4dd6d5c..3d923bed 100644 --- a/app/Models/Media.php +++ b/app/Models/Media.php @@ -33,7 +33,7 @@ class Media extends Model return $attributes['path']; } - return config('filesystems.disks.s3.url') . '/' . $attributes['path']; + return config('app.url') . '/storage/' . $attributes['path']; } ); } @@ -78,7 +78,7 @@ class Media extends Model $basename = $this->getBasename($path); $extension = $this->getExtension($path); - return config('filesystems.disks.s3.url') . '/' . $basename . '-' . $size . '.' . $extension; + return config('app.url') . '/storage/' . $basename . '-' . $size . '.' . $extension; } private function getBasename(string $path): string diff --git a/app/Models/Note.php b/app/Models/Note.php index f854b598..74533443 100644 --- a/app/Models/Note.php +++ b/app/Models/Note.php @@ -111,7 +111,7 @@ class Note extends Model { if ($value !== null) { $normalized = normalizer_normalize($value, Normalizer::FORM_C); - if ($normalized === '') { //we don’t want to save empty strings to the db + if ($normalized === '') { // we don’t want to save empty strings to the db $normalized = null; } $this->attributes['note'] = $normalized; @@ -124,7 +124,7 @@ class Note extends Model public function getNoteAttribute(?string $value): ?string { if ($value === null && $this->place !== null) { - $value = '📍: ' . $this->place->name . ''; + $value = '📍: ' . $this->place->name . ''; } // if $value is still null, just return null @@ -172,16 +172,11 @@ class Note extends Model return (string) resolve(Numbers::class)->numto60($this->id); } - public function getLongurlAttribute(): string + public function getUriAttribute(): string { return config('app.url') . '/notes/' . $this->nb60id; } - public function getShorturlAttribute(): string - { - return config('url.shorturl') . '/notes/' . $this->nb60id; - } - public function getIso8601Attribute(): string { return $this->updated_at->toISO8601String(); @@ -271,7 +266,7 @@ class Note extends Model ]); if ($oEmbed->httpstatus >= 400) { - throw new Exception(); + throw new Exception; } } catch (Exception $e) { return null; @@ -388,18 +383,18 @@ class Note extends Model 'mentions_handle' => [ 'prefix' => '@', 'pattern' => '([\w@.])+(\b)', - 'generator' => new MentionGenerator(), + 'generator' => new MentionGenerator, ], ], ]; $environment = new Environment($config); - $environment->addExtension(new CommonMarkCoreExtension()); - $environment->addExtension(new AutolinkExtension()); - $environment->addExtension(new MentionExtension()); - $environment->addRenderer(Mention::class, new MentionRenderer()); - $environment->addRenderer(FencedCode::class, new FencedCodeRenderer()); - $environment->addRenderer(IndentedCode::class, new IndentedCodeRenderer()); + $environment->addExtension(new CommonMarkCoreExtension); + $environment->addExtension(new AutolinkExtension); + $environment->addExtension(new MentionExtension); + $environment->addRenderer(Mention::class, new MentionRenderer); + $environment->addRenderer(FencedCode::class, new FencedCodeRenderer); + $environment->addRenderer(IndentedCode::class, new IndentedCodeRenderer); $markdownConverter = new MarkdownConverter($environment); return $markdownConverter->convert($note)->getContent(); diff --git a/app/Models/Place.php b/app/Models/Place.php index 2a36aa32..550f234d 100644 --- a/app/Models/Place.php +++ b/app/Models/Place.php @@ -59,7 +59,7 @@ class Place extends Model * sin(radians(places.latitude))))"; return $query - ->select() //pick the columns you want here. + ->select() // pick the columns you want here. ->selectRaw("{$haversine} AS distance") ->whereRaw("{$haversine} < ?", [$distance]); } @@ -74,24 +74,10 @@ class Place extends Model ])); } - protected function longurl(): Attribute - { - return Attribute::get( - get: fn ($value, $attributes) => config('app.url') . '/places/' . $attributes['slug'], - ); - } - - protected function shorturl(): Attribute - { - return Attribute::get( - get: fn ($value, $attributes) => config('url.shorturl') . '/places/' . $attributes['slug'], - ); - } - protected function uri(): Attribute { return Attribute::get( - get: fn () => $this->longurl, + get: static fn ($value, $attributes) => config('app.url') . '/places/' . $attributes['slug'], ); } diff --git a/app/Models/WebMention.php b/app/Models/WebMention.php index cf418b90..bd717aa6 100644 --- a/app/Models/WebMention.php +++ b/app/Models/WebMention.php @@ -42,7 +42,7 @@ class WebMention extends Model return null; } - $authorship = new Authorship(); + $authorship = new Authorship; $hCard = $authorship->findAuthor(json_decode($attributes['mf2'], true)); if ($hCard === false) { @@ -123,7 +123,7 @@ class WebMention extends Model $host = parse_url($url, PHP_URL_HOST); if ($host === 'pbs.twimg.com') { - //make sure we use HTTPS, we know twitter supports it + // make sure we use HTTPS, we know twitter supports it return str_replace('http://', 'https://', $url); } @@ -135,12 +135,12 @@ class WebMention extends Model $codebird = resolve(Codebird::class); $info = $codebird->users_show(['screen_name' => $username]); $profile_image = $info->profile_image_url_https; - Cache::put($url, $profile_image, 10080); //1 week + Cache::put($url, $profile_image, 10080); // 1 week return $profile_image; } - $filesystem = new Filesystem(); + $filesystem = new Filesystem; if ($filesystem->exists(public_path() . '/assets/profile-images/' . $host . '/image')) { return '/assets/profile-images/' . $host . '/image'; } diff --git a/app/Observers/NoteObserver.php b/app/Observers/NoteObserver.php index 935fb27f..95288b01 100644 --- a/app/Observers/NoteObserver.php +++ b/app/Observers/NoteObserver.php @@ -9,15 +9,10 @@ use App\Models\Tag; use Illuminate\Support\Arr; use Illuminate\Support\Collection; -/** - * @todo Do we need psalm-suppress for these observer methods? - */ class NoteObserver { /** - * Listen to the Note created event. - * - * @psalm-suppress PossiblyUnusedMethod + * Listen to the Note created event.= */ public function created(Note $note): void { @@ -39,9 +34,7 @@ class NoteObserver } /** - * Listen to the Note updated event. - * - * @psalm-suppress PossiblyUnusedMethod + * Listen to the Note updated event.= */ public function updated(Note $note): void { @@ -65,9 +58,7 @@ class NoteObserver } /** - * Listen to the Note deleting event. - * - * @psalm-suppress PossiblyUnusedMethod + * Listen to the Note deleting event.= */ public function deleting(Note $note): void { diff --git a/app/Providers/AppServiceProvider.php b/app/Providers/AppServiceProvider.php index d073e1d1..4c9573b2 100644 --- a/app/Providers/AppServiceProvider.php +++ b/app/Providers/AppServiceProvider.php @@ -88,9 +88,9 @@ class AppServiceProvider extends ServiceProvider $this->app->bind('Lcobucci\JWT\Configuration', function () { $key = InMemory::plainText(config('app.key')); - $config = Configuration::forSymmetricSigner(new Sha256(), $key); + $config = Configuration::forSymmetricSigner(new Sha256, $key); - $config->setValidationConstraints(new SignedWith(new Sha256(), $key)); + $config->setValidationConstraints(new SignedWith(new Sha256, $key)); return $config; }); @@ -98,7 +98,7 @@ class AppServiceProvider extends ServiceProvider // Configure HtmlSanitizer $this->app->bind(HtmlSanitizer::class, function () { return new HtmlSanitizer( - (new HtmlSanitizerConfig()) + (new HtmlSanitizerConfig) ->allowSafeElements() ->forceAttribute('a', 'rel', 'noopener nofollow') ); diff --git a/app/Providers/HorizonServiceProvider.php b/app/Providers/HorizonServiceProvider.php index 94c76a5a..bf4280ef 100644 --- a/app/Providers/HorizonServiceProvider.php +++ b/app/Providers/HorizonServiceProvider.php @@ -5,9 +5,6 @@ namespace App\Providers; use Illuminate\Support\Facades\Gate; use Laravel\Horizon\HorizonApplicationServiceProvider; -/** - * @psalm-suppress UnusedClass - */ class HorizonServiceProvider extends HorizonApplicationServiceProvider { /** diff --git a/app/Providers/MicropubServiceProvider.php b/app/Providers/MicropubServiceProvider.php new file mode 100644 index 00000000..1002a26d --- /dev/null +++ b/app/Providers/MicropubServiceProvider.php @@ -0,0 +1,26 @@ +app->singleton(MicropubHandlerRegistry::class, function () { + $registry = new MicropubHandlerRegistry; + + // Register handlers + $registry->register('card', new CardHandler); + $registry->register('entry', new EntryHandler); + + return $registry; + }); + } +} diff --git a/app/Services/ArticleService.php b/app/Services/ArticleService.php index 195f7051..3d5dcc56 100644 --- a/app/Services/ArticleService.php +++ b/app/Services/ArticleService.php @@ -6,13 +6,13 @@ namespace App\Services; use App\Models\Article; -class ArticleService extends Service +class ArticleService { - public function create(array $request, ?string $client = null): Article + public function create(array $data): Article { return Article::create([ - 'title' => $this->getDataByKey($request, 'name'), - 'main' => $this->getDataByKey($request, 'content'), + 'title' => $data['name'], + 'main' => $data['content'], 'published' => true, ]); } diff --git a/app/Services/BookmarkService.php b/app/Services/BookmarkService.php index 792cb81c..9cbc0714 100644 --- a/app/Services/BookmarkService.php +++ b/app/Services/BookmarkService.php @@ -10,28 +10,29 @@ use App\Models\Bookmark; use App\Models\Tag; use GuzzleHttp\Client; use GuzzleHttp\Exception\ClientException; +use GuzzleHttp\Exception\GuzzleException; use Illuminate\Support\Arr; use Illuminate\Support\Str; -class BookmarkService extends Service +class BookmarkService { /** * Create a new Bookmark. */ - public function create(array $request, ?string $client = null): Bookmark + public function create(array $data): Bookmark { - if (Arr::get($request, 'properties.bookmark-of.0')) { - //micropub request - $url = normalize_url(Arr::get($request, 'properties.bookmark-of.0')); - $name = Arr::get($request, 'properties.name.0'); - $content = Arr::get($request, 'properties.content.0'); - $categories = Arr::get($request, 'properties.category'); + if (Arr::get($data, 'properties.bookmark-of.0')) { + // micropub request + $url = normalize_url(Arr::get($data, 'properties.bookmark-of.0')); + $name = Arr::get($data, 'properties.name.0'); + $content = Arr::get($data, 'properties.content.0'); + $categories = Arr::get($data, 'properties.category'); } - if (Arr::get($request, 'bookmark-of')) { - $url = normalize_url(Arr::get($request, 'bookmark-of')); - $name = Arr::get($request, 'name'); - $content = Arr::get($request, 'content'); - $categories = Arr::get($request, 'category'); + if (Arr::get($data, 'bookmark-of')) { + $url = normalize_url(Arr::get($data, 'bookmark-of')); + $name = Arr::get($data, 'name'); + $content = Arr::get($data, 'content'); + $categories = Arr::get($data, 'category'); } $bookmark = Bookmark::create([ @@ -54,6 +55,7 @@ class BookmarkService extends Service * Given a URL, attempt to save it to the Internet Archive. * * @throws InternetArchiveException + * @throws GuzzleException */ public function getArchiveLink(string $url): string { @@ -61,8 +63,8 @@ class BookmarkService extends Service try { $response = $client->request('GET', 'https://web.archive.org/save/' . $url); } catch (ClientException $e) { - //throw an exception to be caught - throw new InternetArchiveException(); + // throw an exception to be caught + throw new InternetArchiveException; } if ($response->hasHeader('Content-Location')) { if (Str::startsWith(Arr::get($response->getHeader('Content-Location'), 0), '/web')) { @@ -70,7 +72,7 @@ class BookmarkService extends Service } } - //throw an exception to be caught - throw new InternetArchiveException(); + // throw an exception to be caught + throw new InternetArchiveException; } } diff --git a/app/Services/LikeService.php b/app/Services/LikeService.php index efd2216b..e688561d 100644 --- a/app/Services/LikeService.php +++ b/app/Services/LikeService.php @@ -8,19 +8,19 @@ use App\Jobs\ProcessLike; use App\Models\Like; use Illuminate\Support\Arr; -class LikeService extends Service +class LikeService { /** * Create a new Like. */ - public function create(array $request, ?string $client = null): Like + public function create(array $data): Like { - if (Arr::get($request, 'properties.like-of.0')) { - //micropub request - $url = normalize_url(Arr::get($request, 'properties.like-of.0')); + if (Arr::get($data, 'properties.like-of.0')) { + // micropub request + $url = normalize_url(Arr::get($data, 'properties.like-of.0')); } - if (Arr::get($request, 'like-of')) { - $url = normalize_url(Arr::get($request, 'like-of')); + if (Arr::get($data, 'like-of')) { + $url = normalize_url(Arr::get($data, 'like-of')); } $like = Like::create(['url' => $url]); diff --git a/app/Services/Micropub/CardHandler.php b/app/Services/Micropub/CardHandler.php new file mode 100644 index 00000000..12e283be --- /dev/null +++ b/app/Services/Micropub/CardHandler.php @@ -0,0 +1,34 @@ +createPlace($data)->uri; + + return [ + 'response' => 'created', + 'url' => $location, + ]; + } +} diff --git a/app/Services/Micropub/EntryHandler.php b/app/Services/Micropub/EntryHandler.php new file mode 100644 index 00000000..9cdbe789 --- /dev/null +++ b/app/Services/Micropub/EntryHandler.php @@ -0,0 +1,41 @@ + resolve(LikeService::class)->create($data)->url, + isset($data['bookmark-of']) => resolve(BookmarkService::class)->create($data)->uri, + isset($data['name']) => resolve(ArticleService::class)->create($data)->link, + default => resolve(NoteService::class)->create($data)->uri, + }; + + return [ + 'response' => 'created', + 'url' => $location, + ]; + } +} diff --git a/app/Services/Micropub/HCardService.php b/app/Services/Micropub/HCardService.php deleted file mode 100644 index 7ab57a4e..00000000 --- a/app/Services/Micropub/HCardService.php +++ /dev/null @@ -1,32 +0,0 @@ -createPlace($data)->longurl; - } -} diff --git a/app/Services/Micropub/HEntryService.php b/app/Services/Micropub/HEntryService.php deleted file mode 100644 index 807e6327..00000000 --- a/app/Services/Micropub/HEntryService.php +++ /dev/null @@ -1,34 +0,0 @@ -create($request)->longurl; - } - - if (Arr::get($request, 'properties.bookmark-of') || Arr::get($request, 'bookmark-of')) { - return resolve(BookmarkService::class)->create($request)->longurl; - } - - if (Arr::get($request, 'properties.name') || Arr::get($request, 'name')) { - return resolve(ArticleService::class)->create($request)->longurl; - } - - return resolve(NoteService::class)->create($request, $client)->longurl; - } -} diff --git a/app/Services/Micropub/MicropubHandlerInterface.php b/app/Services/Micropub/MicropubHandlerInterface.php new file mode 100644 index 00000000..82040be9 --- /dev/null +++ b/app/Services/Micropub/MicropubHandlerInterface.php @@ -0,0 +1,10 @@ +handlers[$type] = $handler; + + return $this; + } + + /** + * @throws MicropubHandlerException + */ + public function getHandler(string $type): MicropubHandlerInterface + { + if (! isset($this->handlers[$type])) { + throw new MicropubHandlerException("No handler registered for '{$type}'"); + } + + return $this->handlers[$type]; + } +} diff --git a/app/Services/Micropub/UpdateService.php b/app/Services/Micropub/UpdateHandler.php similarity index 75% rename from app/Services/Micropub/UpdateService.php rename to app/Services/Micropub/UpdateHandler.php index ac9d360a..ee018f19 100644 --- a/app/Services/Micropub/UpdateService.php +++ b/app/Services/Micropub/UpdateHandler.php @@ -4,23 +4,35 @@ declare(strict_types=1); namespace App\Services\Micropub; +use App\Exceptions\InvalidTokenScopeException; use App\Models\Media; use App\Models\Note; use Illuminate\Database\Eloquent\ModelNotFoundException; -use Illuminate\Http\JsonResponse; use Illuminate\Support\Arr; use Illuminate\Support\Str; -class UpdateService +/* + * @todo Implement this properly + */ +class UpdateHandler implements MicropubHandlerInterface { /** - * Process a micropub request to update an entry. + * @throws InvalidTokenScopeException */ - public function process(array $request): JsonResponse + public function handle(array $data) { - $urlPath = parse_url(Arr::get($request, 'url'), PHP_URL_PATH); + $scopes = $data['token_data']['scope']; + if (is_string($scopes)) { + $scopes = explode(' ', $scopes); + } - //is it a note we are updating? + if (! in_array('update', $scopes, true)) { + throw new InvalidTokenScopeException; + } + + $urlPath = parse_url(Arr::get($data, 'url'), PHP_URL_PATH); + + // is it a note we are updating? if (mb_substr($urlPath, 1, 5) !== 'notes') { return response()->json([ 'error' => 'invalid', @@ -30,16 +42,16 @@ class UpdateService try { $note = Note::nb60(basename($urlPath))->firstOrFail(); - } catch (ModelNotFoundException $exception) { + } catch (ModelNotFoundException) { return response()->json([ 'error' => 'invalid_request', 'error_description' => 'No known note with given ID', ], 404); } - //got the note, are we dealing with a “replace” request? - if (Arr::get($request, 'replace')) { - foreach (Arr::get($request, 'replace') as $property => $value) { + // got the note, are we dealing with a “replace” request? + if (Arr::get($data, 'replace')) { + foreach (Arr::get($data, 'replace') as $property => $value) { if ($property === 'content') { $note->note = $value[0]; } @@ -59,14 +71,14 @@ class UpdateService } $note->save(); - return response()->json([ + return [ 'response' => 'updated', - ]); + ]; } - //how about “add” - if (Arr::get($request, 'add')) { - foreach (Arr::get($request, 'add') as $property => $value) { + // how about “add” + if (Arr::get($data, 'add')) { + foreach (Arr::get($data, 'add') as $property => $value) { if ($property === 'syndication') { foreach ($value as $syndicationURL) { if (Str::startsWith($syndicationURL, 'https://www.facebook.com')) { @@ -83,7 +95,7 @@ class UpdateService if ($property === 'photo') { foreach ($value as $photoURL) { if (Str::startsWith($photoURL, 'https://')) { - $media = new Media(); + $media = new Media; $media->path = $photoURL; $media->type = 'image'; $media->save(); diff --git a/app/Services/NoteService.php b/app/Services/NoteService.php index 1238b804..d8c55507 100644 --- a/app/Services/NoteService.php +++ b/app/Services/NoteService.php @@ -5,6 +5,7 @@ declare(strict_types=1); namespace App\Services; use App\Jobs\SendWebMentions; +use App\Jobs\SyndicateNoteToBluesky; use App\Jobs\SyndicateNoteToMastodon; use App\Models\Media; use App\Models\Note; @@ -13,45 +14,52 @@ use App\Models\SyndicationTarget; use Illuminate\Support\Arr; use Illuminate\Support\Str; -class NoteService extends Service +class NoteService { /** * Create a new note. */ - public function create(array $request, ?string $client = null): Note + public function create(array $data): Note { + // Get the content we want to save + if (is_string($data['content'])) { + $content = $data['content']; + } elseif (isset($data['content']['html'])) { + $content = $data['content']['html']; + } else { + $content = null; + } + $note = Note::create( [ - 'note' => $this->getDataByKey($request, 'content'), - 'in_reply_to' => $this->getDataByKey($request, 'in-reply-to'), - 'client_id' => $client, + 'note' => $content, + 'in_reply_to' => $data['in-reply-to'], + 'client_id' => $data['token_data']['client_id'], ] ); - if ($this->getPublished($request)) { - $note->created_at = $note->updated_at = $this->getPublished($request); + if ($published = $this->getPublished($data)) { + $note->created_at = $note->updated_at = $published; } - $note->location = $this->getLocation($request); + $note->location = $this->getLocation($data); - if ($this->getCheckin($request)) { - $note->place()->associate($this->getCheckin($request)); - $note->swarm_url = $this->getSwarmUrl($request); - } - - $note->instagram_url = $this->getInstagramUrl($request); - - foreach ($this->getMedia($request) as $media) { - $note->media()->save($media); + if ($this->getCheckin($data)) { + $note->place()->associate($this->getCheckin($data)); + $note->swarm_url = $this->getSwarmUrl($data); } + // + // $note->instagram_url = $this->getInstagramUrl($request); + // + // foreach ($this->getMedia($request) as $media) { + // $note->media()->save($media); + // } $note->save(); dispatch(new SendWebMentions($note)); - if (in_array('mastodon', $this->getSyndicationTargets($request), true)) { - dispatch(new SyndicateNoteToMastodon($note)); - } + $this->dispatchSyndicationJobs($note, $data); return $note; } @@ -59,14 +67,10 @@ class NoteService extends Service /** * Get the published time from the request to create a new note. */ - private function getPublished(array $request): ?string + private function getPublished(array $data): ?string { - if (Arr::get($request, 'properties.published.0')) { - return carbon(Arr::get($request, 'properties.published.0')) - ->toDateTimeString(); - } - if (Arr::get($request, 'published')) { - return carbon(Arr::get($request, 'published'))->toDateTimeString(); + if ($data['published']) { + return carbon($data['published'])->toDateTimeString(); } return null; @@ -75,12 +79,13 @@ class NoteService extends Service /** * Get the location data from the request to create a new note. */ - private function getLocation(array $request): ?string + private function getLocation(array $data): ?string { - $location = Arr::get($request, 'properties.location.0') ?? Arr::get($request, 'location'); + $location = Arr::get($data, 'location'); + if (is_string($location) && str_starts_with($location, 'geo:')) { preg_match_all( - '/([0-9\.\-]+)/', + '/([0-9.\-]+)/', $location, $matches ); @@ -94,9 +99,9 @@ class NoteService extends Service /** * Get the checkin data from the request to create a new note. This will be a Place. */ - private function getCheckin(array $request): ?Place + private function getCheckin(array $data): ?Place { - $location = Arr::get($request, 'location'); + $location = Arr::get($data, 'location'); if (is_string($location) && Str::startsWith($location, config('app.url'))) { return Place::where( 'slug', @@ -108,12 +113,12 @@ class NoteService extends Service ) )->first(); } - if (Arr::get($request, 'checkin')) { + if (Arr::get($data, 'checkin')) { try { $place = resolve(PlaceService::class)->createPlaceFromCheckin( - Arr::get($request, 'checkin') + Arr::get($data, 'checkin') ); - } catch (\InvalidArgumentException $e) { + } catch (\InvalidArgumentException) { return null; } @@ -137,34 +142,47 @@ class NoteService extends Service /** * Get the Swarm URL from the syndication data in the request to create a new note. */ - private function getSwarmUrl(array $request): ?string + private function getSwarmUrl(array $data): ?string { - if (str_contains(Arr::get($request, 'properties.syndication.0', ''), 'swarmapp')) { - return Arr::get($request, 'properties.syndication.0'); + $syndication = Arr::get($data, 'syndication'); + if ($syndication === null) { + return null; + } + + if (str_contains($syndication, 'swarmapp')) { + return $syndication; } return null; } /** - * Get the syndication targets from the request to create a new note. + * Dispatch syndication jobs based on the request data. */ - private function getSyndicationTargets(array $request): array + private function dispatchSyndicationJobs(Note $note, array $request): void { - $syndication = []; - $mpSyndicateTo = Arr::get($request, 'mp-syndicate-to') ?? Arr::get($request, 'properties.mp-syndicate-to'); - $mpSyndicateTo = Arr::wrap($mpSyndicateTo); - foreach ($mpSyndicateTo as $uid) { - $target = SyndicationTarget::where('uid', $uid)->first(); - if ($target && $target->service_name === 'Twitter') { - $syndication[] = 'twitter'; - } - if ($target && $target->service_name === 'Mastodon') { - $syndication[] = 'mastodon'; - } + // If no syndication targets are specified, return early + if (empty($request['mp-syndicate-to'])) { + return; } - return $syndication; + // Get the configured syndication targets + $syndicationTargets = SyndicationTarget::all(); + + foreach ($syndicationTargets as $target) { + // Check if the target is in the request data + if (in_array($target->uid, $request['mp-syndicate-to'], true)) { + // Dispatch the appropriate job based on the target service name + switch ($target->service_name) { + case 'Mastodon': + dispatch(new SyndicateNoteToMastodon($note)); + break; + case 'Bluesky': + dispatch(new SyndicateNoteToBluesky($note)); + break; + } + } + } } /** diff --git a/app/Services/PlaceService.php b/app/Services/PlaceService.php index d3756253..cd9b4b9f 100644 --- a/app/Services/PlaceService.php +++ b/app/Services/PlaceService.php @@ -14,8 +14,8 @@ class PlaceService */ public function createPlace(array $data): Place { - //obviously a place needs a lat/lng, but this could be sent in a geo-url - //if no geo array key, we assume the array already has lat/lng values + // obviously a place needs a lat/lng, but this could be sent in a geo-url + // if no geo array key, we assume the array already has lat/lng values if (array_key_exists('geo', $data) && $data['geo'] !== null) { preg_match_all( '/([0-9\.\-]+)/', @@ -25,7 +25,7 @@ class PlaceService $data['latitude'] = $matches[0][0]; $data['longitude'] = $matches[0][1]; } - $place = new Place(); + $place = new Place; $place->name = $data['name']; $place->description = $data['description']; $place->latitude = $data['latitude']; @@ -40,7 +40,7 @@ class PlaceService */ public function createPlaceFromCheckin(array $checkin): Place { - //check if the place exists if from swarm + // check if the place exists if from swarm if (Arr::has($checkin, 'properties.url')) { $place = Place::whereExternalURL(Arr::get($checkin, 'properties.url.0'))->get(); if (count($place) === 1) { @@ -53,7 +53,7 @@ class PlaceService if (Arr::has($checkin, 'properties.latitude') === false) { throw new \InvalidArgumentException('Missing required longitude/latitude'); } - $place = new Place(); + $place = new Place; $place->name = Arr::get($checkin, 'properties.name.0'); $place->external_urls = Arr::get($checkin, 'properties.url.0'); $place->latitude = Arr::get($checkin, 'properties.latitude.0'); diff --git a/app/Services/Service.php b/app/Services/Service.php deleted file mode 100644 index cb480d7c..00000000 --- a/app/Services/Service.php +++ /dev/null @@ -1,30 +0,0 @@ -builder() - ->issuedAt(new DateTimeImmutable()) + ->issuedAt(new DateTimeImmutable) ->withClaim('client_id', $data['client_id']) ->withClaim('me', $data['me']) ->withClaim('scope', $data['scope']) @@ -30,20 +29,4 @@ class TokenService return $token->toString(); } - - /** - * Check the token signature is valid. - */ - public function validateToken(string $bearerToken): Token - { - $config = resolve('Lcobucci\JWT\Configuration'); - - $token = $config->parser()->parse($bearerToken); - - $constraints = $config->validationConstraints(); - - $config->validator()->assert($token, ...$constraints); - - return $token; - } } diff --git a/bootstrap/app.php b/bootstrap/app.php index 860af52f..6137bc86 100644 --- a/bootstrap/app.php +++ b/bootstrap/app.php @@ -1,6 +1,6 @@ withMiddleware(function (Middleware $middleware) { - $middleware->append(CSPHeader::class); + $middleware + ->append(LinkHeadersMiddleware::class) + ->validateCsrfTokens(except: [ + 'auth', // This is the IndieAuth auth endpoint + 'token', // This is the IndieAuth token endpoint + 'api/post', + 'api/media', + 'micropub/places', + 'webmention', + ]); }) ->withExceptions(function (Exceptions $exceptions) { // diff --git a/bootstrap/providers.php b/bootstrap/providers.php index 4e3b4407..24821d29 100644 --- a/bootstrap/providers.php +++ b/bootstrap/providers.php @@ -3,4 +3,5 @@ return [ App\Providers\AppServiceProvider::class, App\Providers\HorizonServiceProvider::class, + App\Providers\MicropubServiceProvider::class, ]; diff --git a/composer.json b/composer.json index 3d0f9aca..063e895a 100644 --- a/composer.json +++ b/composer.json @@ -1,7 +1,8 @@ { + "$schema": "https://getcomposer.org/schema.json", "name": "jonnybarnes/jonnybarnes.uk", "type": "project", - "description": "The code for jonnybarnes.uk, based on Laravel 10", + "description": "The code for jonnybarnes.uk, based on Laravel 11", "keywords": ["laravel", "framework", "indieweb"], "license": "CC0-1.0", "require": { @@ -10,14 +11,15 @@ "ext-intl": "*", "ext-json": "*", "ext-pgsql": "*", - "cviebrock/eloquent-sluggable": "^11.0", + "ext-sodium": "*", + "cviebrock/eloquent-sluggable": "^12.0", "guzzlehttp/guzzle": "^7.2", "indieauth/client": "^1.1", "intervention/image": "^3", "jonnybarnes/indieweb": "~0.2", "jonnybarnes/webmentions-parser": "~0.5", "jublonet/codebird-php": "4.0.0-beta.1", - "laravel/framework": "^11.0", + "laravel/framework": "^12.0", "laravel/horizon": "^5.0", "laravel/sanctum": "^4.0", "laravel/scout": "^10.1", @@ -26,26 +28,29 @@ "league/commonmark": "^2.0", "league/flysystem-aws-s3-v3": "^3.0", "mf2/mf2": "~0.3", + "phpdocumentor/reflection-docblock": "^5.3", "spatie/commonmark-highlighter": "^3.0", "spatie/laravel-ignition": "^2.1", "symfony/html-sanitizer": "^7.0", - "web-auth/webauthn-lib": "^4.7" + "symfony/property-access": "^7.0", + "symfony/serializer": "^7.0", + "web-auth/webauthn-lib": "^5.0" }, "require-dev": { "barryvdh/laravel-debugbar": "^3.0", "barryvdh/laravel-ide-helper": "^3.0", "fakerphp/faker": "^1.9.2", "laravel/dusk": "^8.0", + "laravel/pail": "^1.2", "laravel/pint": "^1.0", "laravel/sail": "^1.18", "mockery/mockery": "^1.4.4", "nunomaduro/collision": "^8.1", - "openai-php/client": "^0.8.0", - "phpunit/php-code-coverage": "^10.0", - "phpunit/phpunit": "^10.1", - "psalm/plugin-laravel": "^2.8", + "openai-php/client": "^0.10.1", + "phpunit/php-code-coverage": "^11.0", + "phpunit/phpunit": "^11.0", "spatie/laravel-ray": "^1.12", - "vimeo/psalm": "^5.0" + "spatie/x-ray": "^1.2" }, "autoload": { "psr-4": { @@ -74,7 +79,13 @@ "@php -r \"file_exists('.env') || copy('.env.example', '.env');\"" ], "post-create-project-cmd": [ - "@php artisan key:generate --ansi" + "@php artisan key:generate --ansi", + "@php -r \"file_exists('database/database.sqlite') || touch('database/database.sqlite');\"", + "@php artisan migrate --graceful --ansi" + ], + "dev": [ + "Composer\\Config::disableProcessTimeout", + "npx concurrently -c \"#93c5fd,#c4b5fd,#fb7185,#fdba74\" \"php artisan serve\" \"php artisan queue:listen --tries=1\" \"php artisan pail --timeout=0\" \"npm run dev\" --names=server,queue,logs,vite" ] }, "extra": { diff --git a/composer.lock b/composer.lock index d0d55e7d..e2913194 100644 --- a/composer.lock +++ b/composer.lock @@ -4,20 +4,20 @@ "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies", "This file is @generated automatically" ], - "content-hash": "8d335e0fa1848b7448208fc90ead613e", + "content-hash": "1076b46fccbfe2c22f51fa6e904cfedf", "packages": [ { "name": "aws/aws-crt-php", - "version": "v1.2.4", + "version": "v1.2.7", "source": { "type": "git", "url": "https://github.com/awslabs/aws-crt-php.git", - "reference": "eb0c6e4e142224a10b08f49ebf87f32611d162b2" + "reference": "d71d9906c7bb63a28295447ba12e74723bd3730e" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/awslabs/aws-crt-php/zipball/eb0c6e4e142224a10b08f49ebf87f32611d162b2", - "reference": "eb0c6e4e142224a10b08f49ebf87f32611d162b2", + "url": "https://api.github.com/repos/awslabs/aws-crt-php/zipball/d71d9906c7bb63a28295447ba12e74723bd3730e", + "reference": "d71d9906c7bb63a28295447ba12e74723bd3730e", "shasum": "" }, "require": { @@ -56,22 +56,22 @@ ], "support": { "issues": "https://github.com/awslabs/aws-crt-php/issues", - "source": "https://github.com/awslabs/aws-crt-php/tree/v1.2.4" + "source": "https://github.com/awslabs/aws-crt-php/tree/v1.2.7" }, - "time": "2023-11-08T00:42:13+00:00" + "time": "2024-10-18T22:15:13+00:00" }, { "name": "aws/aws-sdk-php", - "version": "3.301.3", + "version": "3.348.2", "source": { "type": "git", "url": "https://github.com/aws/aws-sdk-php.git", - "reference": "6b21e34d24a73ea66492869be90443069034fdb3" + "reference": "6acc8e4f8b7468e604d6f0442284937398c2959a" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/aws/aws-sdk-php/zipball/6b21e34d24a73ea66492869be90443069034fdb3", - "reference": "6b21e34d24a73ea66492869be90443069034fdb3", + "url": "https://api.github.com/repos/aws/aws-sdk-php/zipball/6acc8e4f8b7468e604d6f0442284937398c2959a", + "reference": "6acc8e4f8b7468e604d6f0442284937398c2959a", "shasum": "" }, "require": { @@ -79,31 +79,30 @@ "ext-json": "*", "ext-pcre": "*", "ext-simplexml": "*", - "guzzlehttp/guzzle": "^6.5.8 || ^7.4.5", - "guzzlehttp/promises": "^1.4.0 || ^2.0", - "guzzlehttp/psr7": "^1.9.1 || ^2.4.5", - "mtdowling/jmespath.php": "^2.6", - "php": ">=7.2.5", - "psr/http-message": "^1.0 || ^2.0" + "guzzlehttp/guzzle": "^7.4.5", + "guzzlehttp/promises": "^2.0", + "guzzlehttp/psr7": "^2.4.5", + "mtdowling/jmespath.php": "^2.8.0", + "php": ">=8.1", + "psr/http-message": "^2.0" }, "require-dev": { "andrewsville/php-token-reflection": "^1.4", "aws/aws-php-sns-message-validator": "~1.0", "behat/behat": "~3.0", - "composer/composer": "^1.10.22", + "composer/composer": "^2.7.8", "dms/phpunit-arraysubset-asserts": "^0.4.0", "doctrine/cache": "~1.4", "ext-dom": "*", "ext-openssl": "*", "ext-pcntl": "*", "ext-sockets": "*", - "nette/neon": "^2.3", - "paragonie/random_compat": ">= 2", "phpunit/phpunit": "^5.6.3 || ^8.5 || ^9.5", - "psr/cache": "^1.0", - "psr/simple-cache": "^1.0", - "sebastian/comparator": "^1.2.3 || ^4.0", - "yoast/phpunit-polyfills": "^1.0" + "psr/cache": "^2.0 || ^3.0", + "psr/simple-cache": "^2.0 || ^3.0", + "sebastian/comparator": "^1.2.3 || ^4.0 || ^5.0", + "symfony/filesystem": "^v6.4.0 || ^v7.1.0", + "yoast/phpunit-polyfills": "^2.0" }, "suggest": { "aws/aws-php-sns-message-validator": "To validate incoming SNS notifications", @@ -124,7 +123,10 @@ ], "psr-4": { "Aws\\": "src/" - } + }, + "exclude-from-classmap": [ + "src/data/" + ] }, "notification-url": "https://packagist.org/downloads/", "license": [ @@ -149,33 +151,33 @@ "sdk" ], "support": { - "forum": "https://forums.aws.amazon.com/forum.jspa?forumID=80", + "forum": "https://github.com/aws/aws-sdk-php/discussions", "issues": "https://github.com/aws/aws-sdk-php/issues", - "source": "https://github.com/aws/aws-sdk-php/tree/3.301.3" + "source": "https://github.com/aws/aws-sdk-php/tree/3.348.2" }, - "time": "2024-03-19T18:05:04+00:00" + "time": "2025-06-30T18:12:03+00:00" }, { "name": "brick/math", - "version": "0.11.0", + "version": "0.13.1", "source": { "type": "git", "url": "https://github.com/brick/math.git", - "reference": "0ad82ce168c82ba30d1c01ec86116ab52f589478" + "reference": "fc7ed316430118cc7836bf45faff18d5dfc8de04" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/brick/math/zipball/0ad82ce168c82ba30d1c01ec86116ab52f589478", - "reference": "0ad82ce168c82ba30d1c01ec86116ab52f589478", + "url": "https://api.github.com/repos/brick/math/zipball/fc7ed316430118cc7836bf45faff18d5dfc8de04", + "reference": "fc7ed316430118cc7836bf45faff18d5dfc8de04", "shasum": "" }, "require": { - "php": "^8.0" + "php": "^8.1" }, "require-dev": { "php-coveralls/php-coveralls": "^2.2", - "phpunit/phpunit": "^9.0", - "vimeo/psalm": "5.0.0" + "phpunit/phpunit": "^10.1", + "vimeo/psalm": "6.8.8" }, "type": "library", "autoload": { @@ -195,12 +197,17 @@ "arithmetic", "bigdecimal", "bignum", + "bignumber", "brick", - "math" + "decimal", + "integer", + "math", + "mathematics", + "rational" ], "support": { "issues": "https://github.com/brick/math/issues", - "source": "https://github.com/brick/math/tree/0.11.0" + "source": "https://github.com/brick/math/tree/0.13.1" }, "funding": [ { @@ -208,7 +215,7 @@ "type": "github" } ], - "time": "2023-01-15T23:15:59+00:00" + "time": "2025-03-29T13:50:30+00:00" }, { "name": "carbonphp/carbon-doctrine-types", @@ -281,21 +288,21 @@ }, { "name": "cocur/slugify", - "version": "v4.5.1", + "version": "v4.6.0", "source": { "type": "git", "url": "https://github.com/cocur/slugify.git", - "reference": "7c6e088228b9f082050876ae8b0cd287b117b840" + "reference": "1d674022e9cbefa80b4f51aa3e2375b6e3c14fdb" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/cocur/slugify/zipball/7c6e088228b9f082050876ae8b0cd287b117b840", - "reference": "7c6e088228b9f082050876ae8b0cd287b117b840", + "url": "https://api.github.com/repos/cocur/slugify/zipball/1d674022e9cbefa80b4f51aa3e2375b6e3c14fdb", + "reference": "1d674022e9cbefa80b4f51aa3e2375b6e3c14fdb", "shasum": "" }, "require": { "ext-mbstring": "*", - "php": "~8.0.0 || ~8.1.0 || ~8.2.0 || ~8.3.0" + "php": "~8.0.0 || ~8.1.0 || ~8.2.0 || ~8.3.0 || ~8.4.0" }, "conflict": { "symfony/config": "<3.4 || >=4,<4.3", @@ -349,9 +356,9 @@ ], "support": { "issues": "https://github.com/cocur/slugify/issues", - "source": "https://github.com/cocur/slugify/tree/v4.5.1" + "source": "https://github.com/cocur/slugify/tree/v4.6.0" }, - "time": "2023-09-17T07:26:20+00:00" + "time": "2024-09-10T14:09:25+00:00" }, { "name": "composer/installers", @@ -506,29 +513,32 @@ }, { "name": "cviebrock/eloquent-sluggable", - "version": "11.0.0", + "version": "12.0.0", "source": { "type": "git", "url": "https://github.com/cviebrock/eloquent-sluggable.git", - "reference": "8fafec4b3c61e1b87ec9cbe728a75ce3b6ca1c06" + "reference": "50d0c8a508cb5d6193ff6668518930ba8ec8ef24" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/cviebrock/eloquent-sluggable/zipball/8fafec4b3c61e1b87ec9cbe728a75ce3b6ca1c06", - "reference": "8fafec4b3c61e1b87ec9cbe728a75ce3b6ca1c06", + "url": "https://api.github.com/repos/cviebrock/eloquent-sluggable/zipball/50d0c8a508cb5d6193ff6668518930ba8ec8ef24", + "reference": "50d0c8a508cb5d6193ff6668518930ba8ec8ef24", "shasum": "" }, "require": { "cocur/slugify": "^4.3", - "illuminate/config": "^11.0", - "illuminate/database": "^11.0", - "illuminate/support": "^11.0", + "illuminate/config": "^12.0", + "illuminate/database": "^12.0", + "illuminate/support": "^12.0", "php": "^8.2" }, "require-dev": { + "friendsofphp/php-cs-fixer": "^3.65", + "larastan/larastan": "^3.0", "mockery/mockery": "^1.4.4", - "orchestra/testbench": "^9.0", - "pestphp/pest": "^2.28" + "orchestra/testbench": "^10.0", + "pestphp/pest": "^3.7", + "phpstan/phpstan": "^2.0" }, "type": "library", "extra": { @@ -536,9 +546,6 @@ "providers": [ "Cviebrock\\EloquentSluggable\\ServiceProvider" ] - }, - "branch-alias": { - "dev-master": "11.0.x-dev" } }, "autoload": { @@ -562,13 +569,12 @@ "eloquent", "eloquent-sluggable", "laravel", - "lumen", "slug", "sluggable" ], "support": { "issues": "https://github.com/cviebrock/eloquent-sluggable/issues", - "source": "https://github.com/cviebrock/eloquent-sluggable/tree/11.0.0" + "source": "https://github.com/cviebrock/eloquent-sluggable/tree/12.0.0" }, "funding": [ { @@ -576,20 +582,20 @@ "type": "github" } ], - "time": "2024-03-13T02:44:01+00:00" + "time": "2025-02-26T22:53:32+00:00" }, { "name": "dflydev/dot-access-data", - "version": "v3.0.2", + "version": "v3.0.3", "source": { "type": "git", "url": "https://github.com/dflydev/dflydev-dot-access-data.git", - "reference": "f41715465d65213d644d3141a6a93081be5d3549" + "reference": "a23a2bf4f31d3518f3ecb38660c95715dfead60f" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/dflydev/dflydev-dot-access-data/zipball/f41715465d65213d644d3141a6a93081be5d3549", - "reference": "f41715465d65213d644d3141a6a93081be5d3549", + "url": "https://api.github.com/repos/dflydev/dflydev-dot-access-data/zipball/a23a2bf4f31d3518f3ecb38660c95715dfead60f", + "reference": "a23a2bf4f31d3518f3ecb38660c95715dfead60f", "shasum": "" }, "require": { @@ -649,9 +655,57 @@ ], "support": { "issues": "https://github.com/dflydev/dflydev-dot-access-data/issues", - "source": "https://github.com/dflydev/dflydev-dot-access-data/tree/v3.0.2" + "source": "https://github.com/dflydev/dflydev-dot-access-data/tree/v3.0.3" }, - "time": "2022-10-27T11:44:00+00:00" + "time": "2024-07-08T12:26:09+00:00" + }, + { + "name": "doctrine/deprecations", + "version": "1.1.5", + "source": { + "type": "git", + "url": "https://github.com/doctrine/deprecations.git", + "reference": "459c2f5dd3d6a4633d3b5f46ee2b1c40f57d3f38" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/doctrine/deprecations/zipball/459c2f5dd3d6a4633d3b5f46ee2b1c40f57d3f38", + "reference": "459c2f5dd3d6a4633d3b5f46ee2b1c40f57d3f38", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0" + }, + "conflict": { + "phpunit/phpunit": "<=7.5 || >=13" + }, + "require-dev": { + "doctrine/coding-standard": "^9 || ^12 || ^13", + "phpstan/phpstan": "1.4.10 || 2.1.11", + "phpstan/phpstan-phpunit": "^1.0 || ^2", + "phpunit/phpunit": "^7.5 || ^8.5 || ^9.6 || ^10.5 || ^11.5 || ^12", + "psr/log": "^1 || ^2 || ^3" + }, + "suggest": { + "psr/log": "Allows logging deprecations via PSR-3 logger implementation" + }, + "type": "library", + "autoload": { + "psr-4": { + "Doctrine\\Deprecations\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "A small layer on top of trigger_error(E_USER_DEPRECATED) or PSR-3 logging with options to disable all deprecations or selectively for packages.", + "homepage": "https://www.doctrine-project.org/", + "support": { + "issues": "https://github.com/doctrine/deprecations/issues", + "source": "https://github.com/doctrine/deprecations/tree/1.1.5" + }, + "time": "2025-04-07T20:06:18+00:00" }, { "name": "doctrine/inflector", @@ -823,16 +877,16 @@ }, { "name": "dragonmantank/cron-expression", - "version": "v3.3.3", + "version": "v3.4.0", "source": { "type": "git", "url": "https://github.com/dragonmantank/cron-expression.git", - "reference": "adfb1f505deb6384dc8b39804c5065dd3c8c8c0a" + "reference": "8c784d071debd117328803d86b2097615b457500" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/dragonmantank/cron-expression/zipball/adfb1f505deb6384dc8b39804c5065dd3c8c8c0a", - "reference": "adfb1f505deb6384dc8b39804c5065dd3c8c8c0a", + "url": "https://api.github.com/repos/dragonmantank/cron-expression/zipball/8c784d071debd117328803d86b2097615b457500", + "reference": "8c784d071debd117328803d86b2097615b457500", "shasum": "" }, "require": { @@ -845,10 +899,14 @@ "require-dev": { "phpstan/extension-installer": "^1.0", "phpstan/phpstan": "^1.0", - "phpstan/phpstan-webmozart-assert": "^1.0", "phpunit/phpunit": "^7.0|^8.0|^9.0" }, "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.x-dev" + } + }, "autoload": { "psr-4": { "Cron\\": "src/Cron/" @@ -872,7 +930,7 @@ ], "support": { "issues": "https://github.com/dragonmantank/cron-expression/issues", - "source": "https://github.com/dragonmantank/cron-expression/tree/v3.3.3" + "source": "https://github.com/dragonmantank/cron-expression/tree/v3.4.0" }, "funding": [ { @@ -880,20 +938,20 @@ "type": "github" } ], - "time": "2023-08-10T19:36:49+00:00" + "time": "2024-10-09T13:47:03+00:00" }, { "name": "egulias/email-validator", - "version": "4.0.2", + "version": "4.0.4", "source": { "type": "git", "url": "https://github.com/egulias/EmailValidator.git", - "reference": "ebaaf5be6c0286928352e054f2d5125608e5405e" + "reference": "d42c8731f0624ad6bdc8d3e5e9a4524f68801cfa" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/egulias/EmailValidator/zipball/ebaaf5be6c0286928352e054f2d5125608e5405e", - "reference": "ebaaf5be6c0286928352e054f2d5125608e5405e", + "url": "https://api.github.com/repos/egulias/EmailValidator/zipball/d42c8731f0624ad6bdc8d3e5e9a4524f68801cfa", + "reference": "d42c8731f0624ad6bdc8d3e5e9a4524f68801cfa", "shasum": "" }, "require": { @@ -939,7 +997,7 @@ ], "support": { "issues": "https://github.com/egulias/EmailValidator/issues", - "source": "https://github.com/egulias/EmailValidator/tree/4.0.2" + "source": "https://github.com/egulias/EmailValidator/tree/4.0.4" }, "funding": [ { @@ -947,7 +1005,7 @@ "type": "github" } ], - "time": "2023-10-06T06:47:41+00:00" + "time": "2025-03-06T22:45:56+00:00" }, { "name": "fruitcake/php-cors", @@ -1022,24 +1080,24 @@ }, { "name": "graham-campbell/result-type", - "version": "v1.1.2", + "version": "v1.1.3", "source": { "type": "git", "url": "https://github.com/GrahamCampbell/Result-Type.git", - "reference": "fbd48bce38f73f8a4ec8583362e732e4095e5862" + "reference": "3ba905c11371512af9d9bdd27d99b782216b6945" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/GrahamCampbell/Result-Type/zipball/fbd48bce38f73f8a4ec8583362e732e4095e5862", - "reference": "fbd48bce38f73f8a4ec8583362e732e4095e5862", + "url": "https://api.github.com/repos/GrahamCampbell/Result-Type/zipball/3ba905c11371512af9d9bdd27d99b782216b6945", + "reference": "3ba905c11371512af9d9bdd27d99b782216b6945", "shasum": "" }, "require": { "php": "^7.2.5 || ^8.0", - "phpoption/phpoption": "^1.9.2" + "phpoption/phpoption": "^1.9.3" }, "require-dev": { - "phpunit/phpunit": "^8.5.34 || ^9.6.13 || ^10.4.2" + "phpunit/phpunit": "^8.5.39 || ^9.6.20 || ^10.5.28" }, "type": "library", "autoload": { @@ -1068,7 +1126,7 @@ ], "support": { "issues": "https://github.com/GrahamCampbell/Result-Type/issues", - "source": "https://github.com/GrahamCampbell/Result-Type/tree/v1.1.2" + "source": "https://github.com/GrahamCampbell/Result-Type/tree/v1.1.3" }, "funding": [ { @@ -1080,26 +1138,26 @@ "type": "tidelift" } ], - "time": "2023-11-12T22:16:48+00:00" + "time": "2024-07-20T21:45:45+00:00" }, { "name": "guzzlehttp/guzzle", - "version": "7.8.1", + "version": "7.9.3", "source": { "type": "git", "url": "https://github.com/guzzle/guzzle.git", - "reference": "41042bc7ab002487b876a0683fc8dce04ddce104" + "reference": "7b2f29fe81dc4da0ca0ea7d42107a0845946ea77" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/guzzle/guzzle/zipball/41042bc7ab002487b876a0683fc8dce04ddce104", - "reference": "41042bc7ab002487b876a0683fc8dce04ddce104", + "url": "https://api.github.com/repos/guzzle/guzzle/zipball/7b2f29fe81dc4da0ca0ea7d42107a0845946ea77", + "reference": "7b2f29fe81dc4da0ca0ea7d42107a0845946ea77", "shasum": "" }, "require": { "ext-json": "*", - "guzzlehttp/promises": "^1.5.3 || ^2.0.1", - "guzzlehttp/psr7": "^1.9.1 || ^2.5.1", + "guzzlehttp/promises": "^1.5.3 || ^2.0.3", + "guzzlehttp/psr7": "^2.7.0", "php": "^7.2.5 || ^8.0", "psr/http-client": "^1.0", "symfony/deprecation-contracts": "^2.2 || ^3.0" @@ -1110,9 +1168,9 @@ "require-dev": { "bamarni/composer-bin-plugin": "^1.8.2", "ext-curl": "*", - "php-http/client-integration-tests": "dev-master#2c025848417c1135031fdf9c728ee53d0a7ceaee as 3.0.999", + "guzzle/client-integration-tests": "3.0.2", "php-http/message-factory": "^1.1", - "phpunit/phpunit": "^8.5.36 || ^9.6.15", + "phpunit/phpunit": "^8.5.39 || ^9.6.20", "psr/log": "^1.1 || ^2.0 || ^3.0" }, "suggest": { @@ -1190,7 +1248,7 @@ ], "support": { "issues": "https://github.com/guzzle/guzzle/issues", - "source": "https://github.com/guzzle/guzzle/tree/7.8.1" + "source": "https://github.com/guzzle/guzzle/tree/7.9.3" }, "funding": [ { @@ -1206,20 +1264,20 @@ "type": "tidelift" } ], - "time": "2023-12-03T20:35:24+00:00" + "time": "2025-03-27T13:37:11+00:00" }, { "name": "guzzlehttp/promises", - "version": "2.0.2", + "version": "2.2.0", "source": { "type": "git", "url": "https://github.com/guzzle/promises.git", - "reference": "bbff78d96034045e58e13dedd6ad91b5d1253223" + "reference": "7c69f28996b0a6920945dd20b3857e499d9ca96c" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/guzzle/promises/zipball/bbff78d96034045e58e13dedd6ad91b5d1253223", - "reference": "bbff78d96034045e58e13dedd6ad91b5d1253223", + "url": "https://api.github.com/repos/guzzle/promises/zipball/7c69f28996b0a6920945dd20b3857e499d9ca96c", + "reference": "7c69f28996b0a6920945dd20b3857e499d9ca96c", "shasum": "" }, "require": { @@ -1227,7 +1285,7 @@ }, "require-dev": { "bamarni/composer-bin-plugin": "^1.8.2", - "phpunit/phpunit": "^8.5.36 || ^9.6.15" + "phpunit/phpunit": "^8.5.39 || ^9.6.20" }, "type": "library", "extra": { @@ -1273,7 +1331,7 @@ ], "support": { "issues": "https://github.com/guzzle/promises/issues", - "source": "https://github.com/guzzle/promises/tree/2.0.2" + "source": "https://github.com/guzzle/promises/tree/2.2.0" }, "funding": [ { @@ -1289,20 +1347,20 @@ "type": "tidelift" } ], - "time": "2023-12-03T20:19:20+00:00" + "time": "2025-03-27T13:27:01+00:00" }, { "name": "guzzlehttp/psr7", - "version": "2.6.2", + "version": "2.7.1", "source": { "type": "git", "url": "https://github.com/guzzle/psr7.git", - "reference": "45b30f99ac27b5ca93cb4831afe16285f57b8221" + "reference": "c2270caaabe631b3b44c85f99e5a04bbb8060d16" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/guzzle/psr7/zipball/45b30f99ac27b5ca93cb4831afe16285f57b8221", - "reference": "45b30f99ac27b5ca93cb4831afe16285f57b8221", + "url": "https://api.github.com/repos/guzzle/psr7/zipball/c2270caaabe631b3b44c85f99e5a04bbb8060d16", + "reference": "c2270caaabe631b3b44c85f99e5a04bbb8060d16", "shasum": "" }, "require": { @@ -1317,8 +1375,8 @@ }, "require-dev": { "bamarni/composer-bin-plugin": "^1.8.2", - "http-interop/http-factory-tests": "^0.9", - "phpunit/phpunit": "^8.5.36 || ^9.6.15" + "http-interop/http-factory-tests": "0.9.0", + "phpunit/phpunit": "^8.5.39 || ^9.6.20" }, "suggest": { "laminas/laminas-httphandlerrunner": "Emit PSR-7 responses" @@ -1389,7 +1447,7 @@ ], "support": { "issues": "https://github.com/guzzle/psr7/issues", - "source": "https://github.com/guzzle/psr7/tree/2.6.2" + "source": "https://github.com/guzzle/psr7/tree/2.7.1" }, "funding": [ { @@ -1405,20 +1463,20 @@ "type": "tidelift" } ], - "time": "2023-12-03T20:05:35+00:00" + "time": "2025-03-27T12:30:47+00:00" }, { "name": "guzzlehttp/uri-template", - "version": "v1.0.3", + "version": "v1.0.4", "source": { "type": "git", "url": "https://github.com/guzzle/uri-template.git", - "reference": "ecea8feef63bd4fef1f037ecb288386999ecc11c" + "reference": "30e286560c137526eccd4ce21b2de477ab0676d2" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/guzzle/uri-template/zipball/ecea8feef63bd4fef1f037ecb288386999ecc11c", - "reference": "ecea8feef63bd4fef1f037ecb288386999ecc11c", + "url": "https://api.github.com/repos/guzzle/uri-template/zipball/30e286560c137526eccd4ce21b2de477ab0676d2", + "reference": "30e286560c137526eccd4ce21b2de477ab0676d2", "shasum": "" }, "require": { @@ -1475,7 +1533,7 @@ ], "support": { "issues": "https://github.com/guzzle/uri-template/issues", - "source": "https://github.com/guzzle/uri-template/tree/v1.0.3" + "source": "https://github.com/guzzle/uri-template/tree/v1.0.4" }, "funding": [ { @@ -1491,7 +1549,7 @@ "type": "tidelift" } ], - "time": "2023-12-03T19:50:20+00:00" + "time": "2025-02-03T10:55:03+00:00" }, { "name": "indieauth/client", @@ -1646,24 +1704,24 @@ }, { "name": "intervention/gif", - "version": "4.0.2", + "version": "4.2.2", "source": { "type": "git", "url": "https://github.com/Intervention/gif.git", - "reference": "c2b07d1f69709e196c8b4ced423449a7e0f3b925" + "reference": "5999eac6a39aa760fb803bc809e8909ee67b451a" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/Intervention/gif/zipball/c2b07d1f69709e196c8b4ced423449a7e0f3b925", - "reference": "c2b07d1f69709e196c8b4ced423449a7e0f3b925", + "url": "https://api.github.com/repos/Intervention/gif/zipball/5999eac6a39aa760fb803bc809e8909ee67b451a", + "reference": "5999eac6a39aa760fb803bc809e8909ee67b451a", "shasum": "" }, "require": { "php": "^8.1" }, "require-dev": { - "phpstan/phpstan": "^1", - "phpunit/phpunit": "^9", + "phpstan/phpstan": "^2.1", + "phpunit/phpunit": "^10.0 || ^11.0 || ^12.0", "slevomat/coding-standard": "~8.0", "squizlabs/php_codesniffer": "^3.8" }, @@ -1694,7 +1752,7 @@ ], "support": { "issues": "https://github.com/Intervention/gif/issues", - "source": "https://github.com/Intervention/gif/tree/4.0.2" + "source": "https://github.com/Intervention/gif/tree/4.2.2" }, "funding": [ { @@ -1704,33 +1762,37 @@ { "url": "https://github.com/Intervention", "type": "github" + }, + { + "url": "https://ko-fi.com/interventionphp", + "type": "ko_fi" } ], - "time": "2024-02-18T15:36:58+00:00" + "time": "2025-03-29T07:46:21+00:00" }, { "name": "intervention/image", - "version": "3.5.0", + "version": "3.11.3", "source": { "type": "git", "url": "https://github.com/Intervention/image.git", - "reference": "408d3655c7705339e8c79731ea7efb51546cfa10" + "reference": "d0f097b8a3fa8fb758efc9440b513aa3833cda17" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/Intervention/image/zipball/408d3655c7705339e8c79731ea7efb51546cfa10", - "reference": "408d3655c7705339e8c79731ea7efb51546cfa10", + "url": "https://api.github.com/repos/Intervention/image/zipball/d0f097b8a3fa8fb758efc9440b513aa3833cda17", + "reference": "d0f097b8a3fa8fb758efc9440b513aa3833cda17", "shasum": "" }, "require": { "ext-mbstring": "*", - "intervention/gif": "^4.0.1", + "intervention/gif": "^4.2", "php": "^8.1" }, "require-dev": { "mockery/mockery": "^1.6", - "phpstan/phpstan": "^1", - "phpunit/phpunit": "^10.0", + "phpstan/phpstan": "^2.1", + "phpunit/phpunit": "^10.0 || ^11.0 || ^12.0", "slevomat/coding-standard": "~8.0", "squizlabs/php_codesniffer": "^3.8" }, @@ -1766,7 +1828,7 @@ ], "support": { "issues": "https://github.com/Intervention/image/issues", - "source": "https://github.com/Intervention/image/tree/3.5.0" + "source": "https://github.com/Intervention/image/tree/3.11.3" }, "funding": [ { @@ -1776,9 +1838,13 @@ { "url": "https://github.com/Intervention", "type": "github" + }, + { + "url": "https://ko-fi.com/interventionphp", + "type": "ko_fi" } ], - "time": "2024-03-13T16:26:15+00:00" + "time": "2025-05-22T17:26:23+00:00" }, { "name": "jonnybarnes/indieweb", @@ -1947,23 +2013,23 @@ }, { "name": "laravel/framework", - "version": "v11.0.8", + "version": "v12.19.3", "source": { "type": "git", "url": "https://github.com/laravel/framework.git", - "reference": "0379a7ccb77e2029c43ce508fa76e251a0d68fce" + "reference": "4e6ec689ef704bb4bd282f29d9dd658dfb4fb262" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/framework/zipball/0379a7ccb77e2029c43ce508fa76e251a0d68fce", - "reference": "0379a7ccb77e2029c43ce508fa76e251a0d68fce", + "url": "https://api.github.com/repos/laravel/framework/zipball/4e6ec689ef704bb4bd282f29d9dd658dfb4fb262", + "reference": "4e6ec689ef704bb4bd282f29d9dd658dfb4fb262", "shasum": "" }, "require": { - "brick/math": "^0.9.3|^0.10.2|^0.11|^0.12", + "brick/math": "^0.11|^0.12|^0.13", "composer-runtime-api": "^2.2", "doctrine/inflector": "^2.0.5", - "dragonmantank/cron-expression": "^3.3.2", + "dragonmantank/cron-expression": "^3.4", "egulias/email-validator": "^3.2.1|^4.0", "ext-ctype": "*", "ext-filter": "*", @@ -1973,42 +2039,44 @@ "ext-session": "*", "ext-tokenizer": "*", "fruitcake/php-cors": "^1.3", - "guzzlehttp/guzzle": "^7.8", + "guzzlehttp/guzzle": "^7.8.2", "guzzlehttp/uri-template": "^1.0", - "laravel/prompts": "^0.1.15", - "laravel/serializable-closure": "^1.3", - "league/commonmark": "^2.2.1", - "league/flysystem": "^3.8.0", + "laravel/prompts": "^0.3.0", + "laravel/serializable-closure": "^1.3|^2.0", + "league/commonmark": "^2.7", + "league/flysystem": "^3.25.1", + "league/flysystem-local": "^3.25.1", + "league/uri": "^7.5.1", "monolog/monolog": "^3.0", - "nesbot/carbon": "^2.72.2|^3.0", + "nesbot/carbon": "^3.8.4", "nunomaduro/termwind": "^2.0", "php": "^8.2", "psr/container": "^1.1.1|^2.0.1", "psr/log": "^1.0|^2.0|^3.0", "psr/simple-cache": "^1.0|^2.0|^3.0", "ramsey/uuid": "^4.7", - "symfony/console": "^7.0", - "symfony/error-handler": "^7.0", - "symfony/finder": "^7.0", - "symfony/http-foundation": "^7.0", - "symfony/http-kernel": "^7.0", - "symfony/mailer": "^7.0", - "symfony/mime": "^7.0", - "symfony/polyfill-php83": "^1.28", - "symfony/process": "^7.0", - "symfony/routing": "^7.0", - "symfony/uid": "^7.0", - "symfony/var-dumper": "^7.0", + "symfony/console": "^7.2.0", + "symfony/error-handler": "^7.2.0", + "symfony/finder": "^7.2.0", + "symfony/http-foundation": "^7.2.0", + "symfony/http-kernel": "^7.2.0", + "symfony/mailer": "^7.2.0", + "symfony/mime": "^7.2.0", + "symfony/polyfill-php83": "^1.31", + "symfony/process": "^7.2.0", + "symfony/routing": "^7.2.0", + "symfony/uid": "^7.2.0", + "symfony/var-dumper": "^7.2.0", "tijsverkoyen/css-to-inline-styles": "^2.2.5", - "vlucas/phpdotenv": "^5.4.1", - "voku/portable-ascii": "^2.0" + "vlucas/phpdotenv": "^5.6.1", + "voku/portable-ascii": "^2.0.2" }, "conflict": { - "mockery/mockery": "1.6.8", "tightenco/collect": "<5.5.33" }, "provide": { "psr/container-implementation": "1.1|2.0", + "psr/log-implementation": "1.0|2.0|3.0", "psr/simple-cache-implementation": "1.0|2.0|3.0" }, "replace": { @@ -2017,6 +2085,7 @@ "illuminate/bus": "self.version", "illuminate/cache": "self.version", "illuminate/collections": "self.version", + "illuminate/concurrency": "self.version", "illuminate/conditionable": "self.version", "illuminate/config": "self.version", "illuminate/console": "self.version", @@ -2049,29 +2118,33 @@ }, "require-dev": { "ably/ably-php": "^1.0", - "aws/aws-sdk-php": "^3.235.5", + "aws/aws-sdk-php": "^3.322.9", "ext-gmp": "*", - "fakerphp/faker": "^1.23", - "league/flysystem-aws-s3-v3": "^3.0", - "league/flysystem-ftp": "^3.0", - "league/flysystem-path-prefixing": "^3.3", - "league/flysystem-read-only": "^3.3", - "league/flysystem-sftp-v3": "^3.0", - "mockery/mockery": "^1.6", - "nyholm/psr7": "^1.2", - "orchestra/testbench-core": "^9.0.6", - "pda/pheanstalk": "^5.0", - "phpstan/phpstan": "^1.4.7", - "phpunit/phpunit": "^10.5|^11.0", - "predis/predis": "^2.0.2", + "fakerphp/faker": "^1.24", + "guzzlehttp/promises": "^2.0.3", + "guzzlehttp/psr7": "^2.4", + "laravel/pint": "^1.18", + "league/flysystem-aws-s3-v3": "^3.25.1", + "league/flysystem-ftp": "^3.25.1", + "league/flysystem-path-prefixing": "^3.25.1", + "league/flysystem-read-only": "^3.25.1", + "league/flysystem-sftp-v3": "^3.25.1", + "mockery/mockery": "^1.6.10", + "orchestra/testbench-core": "^10.0.0", + "pda/pheanstalk": "^5.0.6|^7.0.0", + "php-http/discovery": "^1.15", + "phpstan/phpstan": "^2.0", + "phpunit/phpunit": "^10.5.35|^11.5.3|^12.0.1", + "predis/predis": "^2.3|^3.0", "resend/resend-php": "^0.10.0", - "symfony/cache": "^7.0", - "symfony/http-client": "^7.0", - "symfony/psr-http-message-bridge": "^7.0" + "symfony/cache": "^7.2.0", + "symfony/http-client": "^7.2.0", + "symfony/psr-http-message-bridge": "^7.2.0", + "symfony/translation": "^7.2.0" }, "suggest": { "ably/ably-php": "Required to use the Ably broadcast driver (^1.0).", - "aws/aws-sdk-php": "Required to use the SQS queue driver, DynamoDb failed job storage, and SES mail driver (^3.235.5).", + "aws/aws-sdk-php": "Required to use the SQS queue driver, DynamoDb failed job storage, and SES mail driver (^3.322.9).", "brianium/paratest": "Required to run tests in parallel (^7.0|^8.0).", "ext-apcu": "Required to use the APC cache driver.", "ext-fileinfo": "Required to use the Filesystem class.", @@ -2081,42 +2154,45 @@ "ext-pcntl": "Required to use all features of the queue worker and console signal trapping.", "ext-pdo": "Required to use all database features.", "ext-posix": "Required to use all features of the queue worker.", - "ext-redis": "Required to use the Redis cache and queue drivers (^4.0|^5.0).", + "ext-redis": "Required to use the Redis cache and queue drivers (^4.0|^5.0|^6.0).", "fakerphp/faker": "Required to use the eloquent factory builder (^1.9.1).", "filp/whoops": "Required for friendly error pages in development (^2.14.3).", "laravel/tinker": "Required to use the tinker console command (^2.0).", - "league/flysystem-aws-s3-v3": "Required to use the Flysystem S3 driver (^3.0).", - "league/flysystem-ftp": "Required to use the Flysystem FTP driver (^3.0).", - "league/flysystem-path-prefixing": "Required to use the scoped driver (^3.3).", - "league/flysystem-read-only": "Required to use read-only disks (^3.3)", - "league/flysystem-sftp-v3": "Required to use the Flysystem SFTP driver (^3.0).", + "league/flysystem-aws-s3-v3": "Required to use the Flysystem S3 driver (^3.25.1).", + "league/flysystem-ftp": "Required to use the Flysystem FTP driver (^3.25.1).", + "league/flysystem-path-prefixing": "Required to use the scoped driver (^3.25.1).", + "league/flysystem-read-only": "Required to use read-only disks (^3.25.1)", + "league/flysystem-sftp-v3": "Required to use the Flysystem SFTP driver (^3.25.1).", "mockery/mockery": "Required to use mocking (^1.6).", - "nyholm/psr7": "Required to use PSR-7 bridging features (^1.2).", "pda/pheanstalk": "Required to use the beanstalk queue driver (^5.0).", - "phpunit/phpunit": "Required to use assertions and run tests (^10.5|^11.0).", - "predis/predis": "Required to use the predis connector (^2.0.2).", + "php-http/discovery": "Required to use PSR-7 bridging features (^1.15).", + "phpunit/phpunit": "Required to use assertions and run tests (^10.5.35|^11.5.3|^12.0.1).", + "predis/predis": "Required to use the predis connector (^2.3|^3.0).", "psr/http-message": "Required to allow Storage::put to accept a StreamInterface (^1.0).", "pusher/pusher-php-server": "Required to use the Pusher broadcast driver (^6.0|^7.0).", "resend/resend-php": "Required to enable support for the Resend mail transport (^0.10.0).", - "symfony/cache": "Required to PSR-6 cache bridge (^7.0).", - "symfony/filesystem": "Required to enable support for relative symbolic links (^7.0).", - "symfony/http-client": "Required to enable support for the Symfony API mail transports (^7.0).", - "symfony/mailgun-mailer": "Required to enable support for the Mailgun mail transport (^7.0).", - "symfony/postmark-mailer": "Required to enable support for the Postmark mail transport (^7.0).", - "symfony/psr-http-message-bridge": "Required to use PSR-7 bridging features (^7.0)." + "symfony/cache": "Required to PSR-6 cache bridge (^7.2).", + "symfony/filesystem": "Required to enable support for relative symbolic links (^7.2).", + "symfony/http-client": "Required to enable support for the Symfony API mail transports (^7.2).", + "symfony/mailgun-mailer": "Required to enable support for the Mailgun mail transport (^7.2).", + "symfony/postmark-mailer": "Required to enable support for the Postmark mail transport (^7.2).", + "symfony/psr-http-message-bridge": "Required to use PSR-7 bridging features (^7.2)." }, "type": "library", "extra": { "branch-alias": { - "dev-master": "11.x-dev" + "dev-master": "12.x-dev" } }, "autoload": { "files": [ + "src/Illuminate/Collections/functions.php", "src/Illuminate/Collections/helpers.php", "src/Illuminate/Events/functions.php", "src/Illuminate/Filesystem/functions.php", "src/Illuminate/Foundation/helpers.php", + "src/Illuminate/Log/functions.php", + "src/Illuminate/Support/functions.php", "src/Illuminate/Support/helpers.php" ], "psr-4": { @@ -2148,40 +2224,42 @@ "issues": "https://github.com/laravel/framework/issues", "source": "https://github.com/laravel/framework" }, - "time": "2024-03-21T14:15:49+00:00" + "time": "2025-06-18T12:56:23+00:00" }, { "name": "laravel/horizon", - "version": "v5.23.1", + "version": "v5.33.1", "source": { "type": "git", "url": "https://github.com/laravel/horizon.git", - "reference": "7475de7eb5b465c2da84218002fe1a62b8175da0" + "reference": "50057bca1f1dcc9fbd5ff6d65143833babd784b3" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/horizon/zipball/7475de7eb5b465c2da84218002fe1a62b8175da0", - "reference": "7475de7eb5b465c2da84218002fe1a62b8175da0", + "url": "https://api.github.com/repos/laravel/horizon/zipball/50057bca1f1dcc9fbd5ff6d65143833babd784b3", + "reference": "50057bca1f1dcc9fbd5ff6d65143833babd784b3", "shasum": "" }, "require": { "ext-json": "*", "ext-pcntl": "*", "ext-posix": "*", - "illuminate/contracts": "^9.21|^10.0|^11.0", - "illuminate/queue": "^9.21|^10.0|^11.0", - "illuminate/support": "^9.21|^10.0|^11.0", + "illuminate/contracts": "^9.21|^10.0|^11.0|^12.0", + "illuminate/queue": "^9.21|^10.0|^11.0|^12.0", + "illuminate/support": "^9.21|^10.0|^11.0|^12.0", "nesbot/carbon": "^2.17|^3.0", "php": "^8.0", "ramsey/uuid": "^4.0", + "symfony/console": "^6.0|^7.0", "symfony/error-handler": "^6.0|^7.0", + "symfony/polyfill-php83": "^1.28", "symfony/process": "^6.0|^7.0" }, "require-dev": { "mockery/mockery": "^1.0", - "orchestra/testbench": "^7.0|^8.0|^9.0", + "orchestra/testbench": "^7.0|^8.0|^9.0|^10.0", "phpstan/phpstan": "^1.10", - "phpunit/phpunit": "^9.0|^10.4", + "phpunit/phpunit": "^9.0|^10.4|^11.5", "predis/predis": "^1.1|^2.0" }, "suggest": { @@ -2190,16 +2268,16 @@ }, "type": "library", "extra": { - "branch-alias": { - "dev-master": "5.x-dev" - }, "laravel": { - "providers": [ - "Laravel\\Horizon\\HorizonServiceProvider" - ], "aliases": { "Horizon": "Laravel\\Horizon\\Horizon" - } + }, + "providers": [ + "Laravel\\Horizon\\HorizonServiceProvider" + ] + }, + "branch-alias": { + "dev-master": "6.x-dev" } }, "autoload": { @@ -2224,27 +2302,27 @@ ], "support": { "issues": "https://github.com/laravel/horizon/issues", - "source": "https://github.com/laravel/horizon/tree/v5.23.1" + "source": "https://github.com/laravel/horizon/tree/v5.33.1" }, - "time": "2024-02-20T15:14:10+00:00" + "time": "2025-06-16T13:48:30+00:00" }, { "name": "laravel/prompts", - "version": "v0.1.16", + "version": "v0.3.5", "source": { "type": "git", "url": "https://github.com/laravel/prompts.git", - "reference": "ca6872ab6aec3ab61db3a61f83a6caf764ec7781" + "reference": "57b8f7efe40333cdb925700891c7d7465325d3b1" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/prompts/zipball/ca6872ab6aec3ab61db3a61f83a6caf764ec7781", - "reference": "ca6872ab6aec3ab61db3a61f83a6caf764ec7781", + "url": "https://api.github.com/repos/laravel/prompts/zipball/57b8f7efe40333cdb925700891c7d7465325d3b1", + "reference": "57b8f7efe40333cdb925700891c7d7465325d3b1", "shasum": "" }, "require": { + "composer-runtime-api": "^2.2", "ext-mbstring": "*", - "illuminate/collections": "^10.0|^11.0", "php": "^8.1", "symfony/console": "^6.2|^7.0" }, @@ -2253,8 +2331,9 @@ "laravel/framework": ">=10.17.0 <10.25.0" }, "require-dev": { + "illuminate/collections": "^10.0|^11.0|^12.0", "mockery/mockery": "^1.5", - "pestphp/pest": "^2.3", + "pestphp/pest": "^2.3|^3.4", "phpstan/phpstan": "^1.11", "phpstan/phpstan-mockery": "^1.1" }, @@ -2264,7 +2343,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-main": "0.1.x-dev" + "dev-main": "0.3.x-dev" } }, "autoload": { @@ -2279,39 +2358,41 @@ "license": [ "MIT" ], + "description": "Add beautiful and user-friendly forms to your command-line applications.", "support": { "issues": "https://github.com/laravel/prompts/issues", - "source": "https://github.com/laravel/prompts/tree/v0.1.16" + "source": "https://github.com/laravel/prompts/tree/v0.3.5" }, - "time": "2024-02-21T19:25:27+00:00" + "time": "2025-02-11T13:34:40+00:00" }, { "name": "laravel/sanctum", - "version": "v4.0.0", + "version": "v4.1.1", "source": { "type": "git", "url": "https://github.com/laravel/sanctum.git", - "reference": "9e6e561308cace166de9ceae4ced820309fa8e13" + "reference": "a360a6a1fd2400ead4eb9b6a9c1bb272939194f5" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/sanctum/zipball/9e6e561308cace166de9ceae4ced820309fa8e13", - "reference": "9e6e561308cace166de9ceae4ced820309fa8e13", + "url": "https://api.github.com/repos/laravel/sanctum/zipball/a360a6a1fd2400ead4eb9b6a9c1bb272939194f5", + "reference": "a360a6a1fd2400ead4eb9b6a9c1bb272939194f5", "shasum": "" }, "require": { "ext-json": "*", - "illuminate/console": "^11.0", - "illuminate/contracts": "^11.0", - "illuminate/database": "^11.0", - "illuminate/support": "^11.0", - "php": "^8.2" + "illuminate/console": "^11.0|^12.0", + "illuminate/contracts": "^11.0|^12.0", + "illuminate/database": "^11.0|^12.0", + "illuminate/support": "^11.0|^12.0", + "php": "^8.2", + "symfony/console": "^7.0" }, "require-dev": { "mockery/mockery": "^1.6", - "orchestra/testbench": "^9.0", + "orchestra/testbench": "^9.0|^10.0", "phpstan/phpstan": "^1.10", - "phpunit/phpunit": "^10.5" + "phpunit/phpunit": "^11.3" }, "type": "library", "extra": { @@ -2346,41 +2427,45 @@ "issues": "https://github.com/laravel/sanctum/issues", "source": "https://github.com/laravel/sanctum" }, - "time": "2024-03-12T14:07:05+00:00" + "time": "2025-04-23T13:03:38+00:00" }, { "name": "laravel/scout", - "version": "v10.8.3", + "version": "v10.15.0", "source": { "type": "git", "url": "https://github.com/laravel/scout.git", - "reference": "f2e20b0eb3355b555038581b52aec4bfe814c700" + "reference": "102fe09ae1c045c6f9cf1b3a2234e1fadb2198f2" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/scout/zipball/f2e20b0eb3355b555038581b52aec4bfe814c700", - "reference": "f2e20b0eb3355b555038581b52aec4bfe814c700", + "url": "https://api.github.com/repos/laravel/scout/zipball/102fe09ae1c045c6f9cf1b3a2234e1fadb2198f2", + "reference": "102fe09ae1c045c6f9cf1b3a2234e1fadb2198f2", "shasum": "" }, "require": { - "illuminate/bus": "^9.0|^10.0|^11.0", - "illuminate/contracts": "^9.0|^10.0|^11.0", - "illuminate/database": "^9.0|^10.0|^11.0", - "illuminate/http": "^9.0|^10.0|^11.0", - "illuminate/pagination": "^9.0|^10.0|^11.0", - "illuminate/queue": "^9.0|^10.0|^11.0", - "illuminate/support": "^9.0|^10.0|^11.0", - "php": "^8.0" + "illuminate/bus": "^9.0|^10.0|^11.0|^12.0", + "illuminate/contracts": "^9.0|^10.0|^11.0|^12.0", + "illuminate/database": "^9.0|^10.0|^11.0|^12.0", + "illuminate/http": "^9.0|^10.0|^11.0|^12.0", + "illuminate/pagination": "^9.0|^10.0|^11.0|^12.0", + "illuminate/queue": "^9.0|^10.0|^11.0|^12.0", + "illuminate/support": "^9.0|^10.0|^11.0|^12.0", + "php": "^8.0", + "symfony/console": "^6.0|^7.0" + }, + "conflict": { + "algolia/algoliasearch-client-php": "<3.2.0|>=5.0.0" }, "require-dev": { - "algolia/algoliasearch-client-php": "^3.2", + "algolia/algoliasearch-client-php": "^3.2|^4.0", "meilisearch/meilisearch-php": "^1.0", "mockery/mockery": "^1.0", - "orchestra/testbench": "^7.31|^8.11|^9.0", + "orchestra/testbench": "^7.31|^8.11|^9.0|^10.0", "php-http/guzzle7-adapter": "^1.0", "phpstan/phpstan": "^1.10", "phpunit/phpunit": "^9.3|^10.4", - "typesense/typesense-php": "^4.9" + "typesense/typesense-php": "^4.9.3" }, "suggest": { "algolia/algoliasearch-client-php": "Required to use the Algolia engine (^3.2).", @@ -2389,13 +2474,13 @@ }, "type": "library", "extra": { - "branch-alias": { - "dev-master": "10.x-dev" - }, "laravel": { "providers": [ "Laravel\\Scout\\ScoutServiceProvider" ] + }, + "branch-alias": { + "dev-master": "10.x-dev" } }, "autoload": { @@ -2423,35 +2508,36 @@ "issues": "https://github.com/laravel/scout/issues", "source": "https://github.com/laravel/scout" }, - "time": "2024-02-13T17:22:36+00:00" + "time": "2025-05-13T13:34:05+00:00" }, { "name": "laravel/serializable-closure", - "version": "v1.3.3", + "version": "v2.0.4", "source": { "type": "git", "url": "https://github.com/laravel/serializable-closure.git", - "reference": "3dbf8a8e914634c48d389c1234552666b3d43754" + "reference": "b352cf0534aa1ae6b4d825d1e762e35d43f8a841" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/serializable-closure/zipball/3dbf8a8e914634c48d389c1234552666b3d43754", - "reference": "3dbf8a8e914634c48d389c1234552666b3d43754", + "url": "https://api.github.com/repos/laravel/serializable-closure/zipball/b352cf0534aa1ae6b4d825d1e762e35d43f8a841", + "reference": "b352cf0534aa1ae6b4d825d1e762e35d43f8a841", "shasum": "" }, "require": { - "php": "^7.3|^8.0" + "php": "^8.1" }, "require-dev": { - "nesbot/carbon": "^2.61", - "pestphp/pest": "^1.21.3", - "phpstan/phpstan": "^1.8.2", - "symfony/var-dumper": "^5.4.11" + "illuminate/support": "^10.0|^11.0|^12.0", + "nesbot/carbon": "^2.67|^3.0", + "pestphp/pest": "^2.36|^3.0", + "phpstan/phpstan": "^2.0", + "symfony/var-dumper": "^6.2.0|^7.0.0" }, "type": "library", "extra": { "branch-alias": { - "dev-master": "1.x-dev" + "dev-master": "2.x-dev" } }, "autoload": { @@ -2483,26 +2569,26 @@ "issues": "https://github.com/laravel/serializable-closure/issues", "source": "https://github.com/laravel/serializable-closure" }, - "time": "2023-11-08T14:08:06+00:00" + "time": "2025-03-19T13:51:03+00:00" }, { "name": "laravel/tinker", - "version": "v2.9.0", + "version": "v2.10.1", "source": { "type": "git", "url": "https://github.com/laravel/tinker.git", - "reference": "502e0fe3f0415d06d5db1f83a472f0f3b754bafe" + "reference": "22177cc71807d38f2810c6204d8f7183d88a57d3" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/tinker/zipball/502e0fe3f0415d06d5db1f83a472f0f3b754bafe", - "reference": "502e0fe3f0415d06d5db1f83a472f0f3b754bafe", + "url": "https://api.github.com/repos/laravel/tinker/zipball/22177cc71807d38f2810c6204d8f7183d88a57d3", + "reference": "22177cc71807d38f2810c6204d8f7183d88a57d3", "shasum": "" }, "require": { - "illuminate/console": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0", - "illuminate/contracts": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0", - "illuminate/support": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0", + "illuminate/console": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0|^12.0", + "illuminate/contracts": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0|^12.0", + "illuminate/support": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0|^12.0", "php": "^7.2.5|^8.0", "psy/psysh": "^0.11.1|^0.12.0", "symfony/var-dumper": "^4.3.4|^5.0|^6.0|^7.0" @@ -2510,10 +2596,10 @@ "require-dev": { "mockery/mockery": "~1.3.3|^1.4.2", "phpstan/phpstan": "^1.10", - "phpunit/phpunit": "^8.5.8|^9.3.3" + "phpunit/phpunit": "^8.5.8|^9.3.3|^10.0" }, "suggest": { - "illuminate/database": "The Illuminate Database package (^6.0|^7.0|^8.0|^9.0|^10.0|^11.0)." + "illuminate/database": "The Illuminate Database package (^6.0|^7.0|^8.0|^9.0|^10.0|^11.0|^12.0)." }, "type": "library", "extra": { @@ -2547,108 +2633,44 @@ ], "support": { "issues": "https://github.com/laravel/tinker/issues", - "source": "https://github.com/laravel/tinker/tree/v2.9.0" + "source": "https://github.com/laravel/tinker/tree/v2.10.1" }, - "time": "2024-01-04T16:10:04+00:00" - }, - { - "name": "lcobucci/clock", - "version": "3.2.0", - "source": { - "type": "git", - "url": "https://github.com/lcobucci/clock.git", - "reference": "6f28b826ea01306b07980cb8320ab30b966cd715" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/lcobucci/clock/zipball/6f28b826ea01306b07980cb8320ab30b966cd715", - "reference": "6f28b826ea01306b07980cb8320ab30b966cd715", - "shasum": "" - }, - "require": { - "php": "~8.2.0 || ~8.3.0", - "psr/clock": "^1.0" - }, - "provide": { - "psr/clock-implementation": "1.0" - }, - "require-dev": { - "infection/infection": "^0.27", - "lcobucci/coding-standard": "^11.0.0", - "phpstan/extension-installer": "^1.3.1", - "phpstan/phpstan": "^1.10.25", - "phpstan/phpstan-deprecation-rules": "^1.1.3", - "phpstan/phpstan-phpunit": "^1.3.13", - "phpstan/phpstan-strict-rules": "^1.5.1", - "phpunit/phpunit": "^10.2.3" - }, - "type": "library", - "autoload": { - "psr-4": { - "Lcobucci\\Clock\\": "src" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Luís Cobucci", - "email": "lcobucci@gmail.com" - } - ], - "description": "Yet another clock abstraction", - "support": { - "issues": "https://github.com/lcobucci/clock/issues", - "source": "https://github.com/lcobucci/clock/tree/3.2.0" - }, - "funding": [ - { - "url": "https://github.com/lcobucci", - "type": "github" - }, - { - "url": "https://www.patreon.com/lcobucci", - "type": "patreon" - } - ], - "time": "2023-11-17T17:00:27+00:00" + "time": "2025-01-27T14:24:01+00:00" }, { "name": "lcobucci/jwt", - "version": "5.2.0", + "version": "5.5.0", "source": { "type": "git", "url": "https://github.com/lcobucci/jwt.git", - "reference": "0ba88aed12c04bd2ed9924f500673f32b67a6211" + "reference": "a835af59b030d3f2967725697cf88300f579088e" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/lcobucci/jwt/zipball/0ba88aed12c04bd2ed9924f500673f32b67a6211", - "reference": "0ba88aed12c04bd2ed9924f500673f32b67a6211", + "url": "https://api.github.com/repos/lcobucci/jwt/zipball/a835af59b030d3f2967725697cf88300f579088e", + "reference": "a835af59b030d3f2967725697cf88300f579088e", "shasum": "" }, "require": { "ext-openssl": "*", "ext-sodium": "*", - "php": "~8.1.0 || ~8.2.0 || ~8.3.0", + "php": "~8.2.0 || ~8.3.0 || ~8.4.0", "psr/clock": "^1.0" }, "require-dev": { - "infection/infection": "^0.27.0", - "lcobucci/clock": "^3.0", + "infection/infection": "^0.29", + "lcobucci/clock": "^3.2", "lcobucci/coding-standard": "^11.0", - "phpbench/phpbench": "^1.2.9", + "phpbench/phpbench": "^1.2", "phpstan/extension-installer": "^1.2", "phpstan/phpstan": "^1.10.7", "phpstan/phpstan-deprecation-rules": "^1.1.3", "phpstan/phpstan-phpunit": "^1.3.10", "phpstan/phpstan-strict-rules": "^1.5.0", - "phpunit/phpunit": "^10.2.6" + "phpunit/phpunit": "^11.1" }, "suggest": { - "lcobucci/clock": ">= 3.0" + "lcobucci/clock": ">= 3.2" }, "type": "library", "autoload": { @@ -2674,7 +2696,7 @@ ], "support": { "issues": "https://github.com/lcobucci/jwt/issues", - "source": "https://github.com/lcobucci/jwt/tree/5.2.0" + "source": "https://github.com/lcobucci/jwt/tree/5.5.0" }, "funding": [ { @@ -2686,20 +2708,20 @@ "type": "patreon" } ], - "time": "2023-11-20T21:17:42+00:00" + "time": "2025-01-26T21:29:45+00:00" }, { "name": "league/commonmark", - "version": "2.4.2", + "version": "2.7.0", "source": { "type": "git", "url": "https://github.com/thephpleague/commonmark.git", - "reference": "91c24291965bd6d7c46c46a12ba7492f83b1cadf" + "reference": "6fbb36d44824ed4091adbcf4c7d4a3923cdb3405" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/thephpleague/commonmark/zipball/91c24291965bd6d7c46c46a12ba7492f83b1cadf", - "reference": "91c24291965bd6d7c46c46a12ba7492f83b1cadf", + "url": "https://api.github.com/repos/thephpleague/commonmark/zipball/6fbb36d44824ed4091adbcf4c7d4a3923cdb3405", + "reference": "6fbb36d44824ed4091adbcf4c7d4a3923cdb3405", "shasum": "" }, "require": { @@ -2712,8 +2734,8 @@ }, "require-dev": { "cebe/markdown": "^1.0", - "commonmark/cmark": "0.30.3", - "commonmark/commonmark.js": "0.30.0", + "commonmark/cmark": "0.31.1", + "commonmark/commonmark.js": "0.31.1", "composer/package-versions-deprecated": "^1.8", "embed/embed": "^4.4", "erusev/parsedown": "^1.0", @@ -2724,8 +2746,9 @@ "phpstan/phpstan": "^1.8.2", "phpunit/phpunit": "^9.5.21 || ^10.5.9 || ^11.0.0", "scrutinizer/ocular": "^1.8.1", - "symfony/finder": "^5.3 | ^6.0 || ^7.0", - "symfony/yaml": "^2.3 | ^3.0 | ^4.0 | ^5.0 | ^6.0 || ^7.0", + "symfony/finder": "^5.3 | ^6.0 | ^7.0", + "symfony/process": "^5.4 | ^6.0 | ^7.0", + "symfony/yaml": "^2.3 | ^3.0 | ^4.0 | ^5.0 | ^6.0 | ^7.0", "unleashedtech/php-coding-standard": "^3.1.1", "vimeo/psalm": "^4.24.0 || ^5.0.0" }, @@ -2735,7 +2758,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-main": "2.5-dev" + "dev-main": "2.8-dev" } }, "autoload": { @@ -2792,7 +2815,7 @@ "type": "tidelift" } ], - "time": "2024-02-02T11:59:32+00:00" + "time": "2025-05-05T12:20:28+00:00" }, { "name": "league/config", @@ -2878,16 +2901,16 @@ }, { "name": "league/flysystem", - "version": "3.25.1", + "version": "3.30.0", "source": { "type": "git", "url": "https://github.com/thephpleague/flysystem.git", - "reference": "abbd664eb4381102c559d358420989f835208f18" + "reference": "2203e3151755d874bb2943649dae1eb8533ac93e" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/thephpleague/flysystem/zipball/abbd664eb4381102c559d358420989f835208f18", - "reference": "abbd664eb4381102c559d358420989f835208f18", + "url": "https://api.github.com/repos/thephpleague/flysystem/zipball/2203e3151755d874bb2943649dae1eb8533ac93e", + "reference": "2203e3151755d874bb2943649dae1eb8533ac93e", "shasum": "" }, "require": { @@ -2911,10 +2934,13 @@ "composer/semver": "^3.0", "ext-fileinfo": "*", "ext-ftp": "*", + "ext-mongodb": "^1.3|^2", "ext-zip": "*", "friendsofphp/php-cs-fixer": "^3.5", "google/cloud-storage": "^1.23", + "guzzlehttp/psr7": "^2.6", "microsoft/azure-storage-blob": "^1.1", + "mongodb/mongodb": "^1.2|^2", "phpseclib/phpseclib": "^3.0.36", "phpstan/phpstan": "^1.10", "phpunit/phpunit": "^9.5.11|^10.0", @@ -2952,32 +2978,22 @@ ], "support": { "issues": "https://github.com/thephpleague/flysystem/issues", - "source": "https://github.com/thephpleague/flysystem/tree/3.25.1" + "source": "https://github.com/thephpleague/flysystem/tree/3.30.0" }, - "funding": [ - { - "url": "https://ecologi.com/frankdejonge", - "type": "custom" - }, - { - "url": "https://github.com/frankdejonge", - "type": "github" - } - ], - "time": "2024-03-16T12:53:19+00:00" + "time": "2025-06-25T13:29:59+00:00" }, { "name": "league/flysystem-aws-s3-v3", - "version": "3.25.1", + "version": "3.29.0", "source": { "type": "git", "url": "https://github.com/thephpleague/flysystem-aws-s3-v3.git", - "reference": "6a5be0e6d6a93574e80805c9cc108a4b63c824d8" + "reference": "c6ff6d4606e48249b63f269eba7fabdb584e76a9" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/thephpleague/flysystem-aws-s3-v3/zipball/6a5be0e6d6a93574e80805c9cc108a4b63c824d8", - "reference": "6a5be0e6d6a93574e80805c9cc108a4b63c824d8", + "url": "https://api.github.com/repos/thephpleague/flysystem-aws-s3-v3/zipball/c6ff6d4606e48249b63f269eba7fabdb584e76a9", + "reference": "c6ff6d4606e48249b63f269eba7fabdb584e76a9", "shasum": "" }, "require": { @@ -3017,32 +3033,22 @@ "storage" ], "support": { - "source": "https://github.com/thephpleague/flysystem-aws-s3-v3/tree/3.25.1" + "source": "https://github.com/thephpleague/flysystem-aws-s3-v3/tree/3.29.0" }, - "funding": [ - { - "url": "https://ecologi.com/frankdejonge", - "type": "custom" - }, - { - "url": "https://github.com/frankdejonge", - "type": "github" - } - ], - "time": "2024-03-15T19:58:44+00:00" + "time": "2024-08-17T13:10:48+00:00" }, { "name": "league/flysystem-local", - "version": "3.25.1", + "version": "3.30.0", "source": { "type": "git", "url": "https://github.com/thephpleague/flysystem-local.git", - "reference": "61a6a90d6e999e4ddd9ce5adb356de0939060b92" + "reference": "6691915f77c7fb69adfb87dcd550052dc184ee10" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/thephpleague/flysystem-local/zipball/61a6a90d6e999e4ddd9ce5adb356de0939060b92", - "reference": "61a6a90d6e999e4ddd9ce5adb356de0939060b92", + "url": "https://api.github.com/repos/thephpleague/flysystem-local/zipball/6691915f77c7fb69adfb87dcd550052dc184ee10", + "reference": "6691915f77c7fb69adfb87dcd550052dc184ee10", "shasum": "" }, "require": { @@ -3076,32 +3082,22 @@ "local" ], "support": { - "source": "https://github.com/thephpleague/flysystem-local/tree/3.25.1" + "source": "https://github.com/thephpleague/flysystem-local/tree/3.30.0" }, - "funding": [ - { - "url": "https://ecologi.com/frankdejonge", - "type": "custom" - }, - { - "url": "https://github.com/frankdejonge", - "type": "github" - } - ], - "time": "2024-03-15T19:58:44+00:00" + "time": "2025-05-21T10:34:19+00:00" }, { "name": "league/mime-type-detection", - "version": "1.15.0", + "version": "1.16.0", "source": { "type": "git", "url": "https://github.com/thephpleague/mime-type-detection.git", - "reference": "ce0f4d1e8a6f4eb0ddff33f57c69c50fd09f4301" + "reference": "2d6702ff215bf922936ccc1ad31007edc76451b9" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/thephpleague/mime-type-detection/zipball/ce0f4d1e8a6f4eb0ddff33f57c69c50fd09f4301", - "reference": "ce0f4d1e8a6f4eb0ddff33f57c69c50fd09f4301", + "url": "https://api.github.com/repos/thephpleague/mime-type-detection/zipball/2d6702ff215bf922936ccc1ad31007edc76451b9", + "reference": "2d6702ff215bf922936ccc1ad31007edc76451b9", "shasum": "" }, "require": { @@ -3132,7 +3128,7 @@ "description": "Mime-type detection for Flysystem", "support": { "issues": "https://github.com/thephpleague/mime-type-detection/issues", - "source": "https://github.com/thephpleague/mime-type-detection/tree/1.15.0" + "source": "https://github.com/thephpleague/mime-type-detection/tree/1.16.0" }, "funding": [ { @@ -3144,24 +3140,24 @@ "type": "tidelift" } ], - "time": "2024-01-28T23:22:08+00:00" + "time": "2024-09-21T08:32:55+00:00" }, { "name": "league/uri", - "version": "7.4.0", + "version": "7.5.1", "source": { "type": "git", "url": "https://github.com/thephpleague/uri.git", - "reference": "bf414ba956d902f5d98bf9385fcf63954f09dce5" + "reference": "81fb5145d2644324614cc532b28efd0215bda430" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/thephpleague/uri/zipball/bf414ba956d902f5d98bf9385fcf63954f09dce5", - "reference": "bf414ba956d902f5d98bf9385fcf63954f09dce5", + "url": "https://api.github.com/repos/thephpleague/uri/zipball/81fb5145d2644324614cc532b28efd0215bda430", + "reference": "81fb5145d2644324614cc532b28efd0215bda430", "shasum": "" }, "require": { - "league/uri-interfaces": "^7.3", + "league/uri-interfaces": "^7.5", "php": "^8.1" }, "conflict": { @@ -3226,7 +3222,7 @@ "docs": "https://uri.thephpleague.com", "forum": "https://thephpleague.slack.com", "issues": "https://github.com/thephpleague/uri-src/issues", - "source": "https://github.com/thephpleague/uri/tree/7.4.0" + "source": "https://github.com/thephpleague/uri/tree/7.5.1" }, "funding": [ { @@ -3234,20 +3230,20 @@ "type": "github" } ], - "time": "2023-12-01T06:24:25+00:00" + "time": "2024-12-08T08:40:02+00:00" }, { "name": "league/uri-interfaces", - "version": "7.4.0", + "version": "7.5.0", "source": { "type": "git", "url": "https://github.com/thephpleague/uri-interfaces.git", - "reference": "bd8c487ec236930f7bbc42b8d374fa882fbba0f3" + "reference": "08cfc6c4f3d811584fb09c37e2849e6a7f9b0742" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/thephpleague/uri-interfaces/zipball/bd8c487ec236930f7bbc42b8d374fa882fbba0f3", - "reference": "bd8c487ec236930f7bbc42b8d374fa882fbba0f3", + "url": "https://api.github.com/repos/thephpleague/uri-interfaces/zipball/08cfc6c4f3d811584fb09c37e2849e6a7f9b0742", + "reference": "08cfc6c4f3d811584fb09c37e2849e6a7f9b0742", "shasum": "" }, "require": { @@ -3310,7 +3306,7 @@ "docs": "https://uri.thephpleague.com", "forum": "https://thephpleague.slack.com", "issues": "https://github.com/thephpleague/uri-src/issues", - "source": "https://github.com/thephpleague/uri-interfaces/tree/7.4.0" + "source": "https://github.com/thephpleague/uri-interfaces/tree/7.5.0" }, "funding": [ { @@ -3318,20 +3314,20 @@ "type": "github" } ], - "time": "2023-11-24T15:40:42+00:00" + "time": "2024-12-08T08:18:47+00:00" }, { "name": "masterminds/html5", - "version": "2.8.1", + "version": "2.9.0", "source": { "type": "git", "url": "https://github.com/Masterminds/html5-php.git", - "reference": "f47dcf3c70c584de14f21143c55d9939631bc6cf" + "reference": "f5ac2c0b0a2eefca70b2ce32a5809992227e75a6" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/Masterminds/html5-php/zipball/f47dcf3c70c584de14f21143c55d9939631bc6cf", - "reference": "f47dcf3c70c584de14f21143c55d9939631bc6cf", + "url": "https://api.github.com/repos/Masterminds/html5-php/zipball/f5ac2c0b0a2eefca70b2ce32a5809992227e75a6", + "reference": "f5ac2c0b0a2eefca70b2ce32a5809992227e75a6", "shasum": "" }, "require": { @@ -3339,7 +3335,7 @@ "php": ">=5.3.0" }, "require-dev": { - "phpunit/phpunit": "^4.8.35 || ^5.7.21 || ^6 || ^7 || ^8" + "phpunit/phpunit": "^4.8.35 || ^5.7.21 || ^6 || ^7 || ^8 || ^9" }, "type": "library", "extra": { @@ -3383,9 +3379,9 @@ ], "support": { "issues": "https://github.com/Masterminds/html5-php/issues", - "source": "https://github.com/Masterminds/html5-php/tree/2.8.1" + "source": "https://github.com/Masterminds/html5-php/tree/2.9.0" }, - "time": "2023-05-10T11:58:31+00:00" + "time": "2024-03-31T07:05:07+00:00" }, { "name": "mf2/mf2", @@ -3451,16 +3447,16 @@ }, { "name": "monolog/monolog", - "version": "3.5.0", + "version": "3.9.0", "source": { "type": "git", "url": "https://github.com/Seldaek/monolog.git", - "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448" + "reference": "10d85740180ecba7896c87e06a166e0c95a0e3b6" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/Seldaek/monolog/zipball/c915e2634718dbc8a4a15c61b0e62e7a44e14448", - "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448", + "url": "https://api.github.com/repos/Seldaek/monolog/zipball/10d85740180ecba7896c87e06a166e0c95a0e3b6", + "reference": "10d85740180ecba7896c87e06a166e0c95a0e3b6", "shasum": "" }, "require": { @@ -3480,12 +3476,14 @@ "guzzlehttp/psr7": "^2.2", "mongodb/mongodb": "^1.8", "php-amqplib/php-amqplib": "~2.4 || ^3", - "phpstan/phpstan": "^1.9", - "phpstan/phpstan-deprecation-rules": "^1.0", - "phpstan/phpstan-strict-rules": "^1.4", - "phpunit/phpunit": "^10.1", + "php-console/php-console": "^3.1.8", + "phpstan/phpstan": "^2", + "phpstan/phpstan-deprecation-rules": "^2", + "phpstan/phpstan-strict-rules": "^2", + "phpunit/phpunit": "^10.5.17 || ^11.0.7", "predis/predis": "^1.1 || ^2", - "ruflin/elastica": "^7", + "rollbar/rollbar": "^4.0", + "ruflin/elastica": "^7 || ^8", "symfony/mailer": "^5.4 || ^6", "symfony/mime": "^5.4 || ^6" }, @@ -3536,7 +3534,7 @@ ], "support": { "issues": "https://github.com/Seldaek/monolog/issues", - "source": "https://github.com/Seldaek/monolog/tree/3.5.0" + "source": "https://github.com/Seldaek/monolog/tree/3.9.0" }, "funding": [ { @@ -3548,20 +3546,20 @@ "type": "tidelift" } ], - "time": "2023-10-27T15:32:31+00:00" + "time": "2025-03-24T10:02:05+00:00" }, { "name": "mtdowling/jmespath.php", - "version": "2.7.0", + "version": "2.8.0", "source": { "type": "git", "url": "https://github.com/jmespath/jmespath.php.git", - "reference": "bbb69a935c2cbb0c03d7f481a238027430f6440b" + "reference": "a2a865e05d5f420b50cc2f85bb78d565db12a6bc" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/jmespath/jmespath.php/zipball/bbb69a935c2cbb0c03d7f481a238027430f6440b", - "reference": "bbb69a935c2cbb0c03d7f481a238027430f6440b", + "url": "https://api.github.com/repos/jmespath/jmespath.php/zipball/a2a865e05d5f420b50cc2f85bb78d565db12a6bc", + "reference": "a2a865e05d5f420b50cc2f85bb78d565db12a6bc", "shasum": "" }, "require": { @@ -3578,7 +3576,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-master": "2.7-dev" + "dev-master": "2.8-dev" } }, "autoload": { @@ -3612,32 +3610,32 @@ ], "support": { "issues": "https://github.com/jmespath/jmespath.php/issues", - "source": "https://github.com/jmespath/jmespath.php/tree/2.7.0" + "source": "https://github.com/jmespath/jmespath.php/tree/2.8.0" }, - "time": "2023-08-25T10:54:48+00:00" + "time": "2024-09-04T18:46:31+00:00" }, { "name": "nesbot/carbon", - "version": "3.1.1", + "version": "3.10.1", "source": { "type": "git", - "url": "https://github.com/briannesbitt/Carbon.git", - "reference": "34ccf6f6b49c915421c7886c88c0cb77f3ebbfd2" + "url": "https://github.com/CarbonPHP/carbon.git", + "reference": "1fd1935b2d90aef2f093c5e35f7ae1257c448d00" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/briannesbitt/Carbon/zipball/34ccf6f6b49c915421c7886c88c0cb77f3ebbfd2", - "reference": "34ccf6f6b49c915421c7886c88c0cb77f3ebbfd2", + "url": "https://api.github.com/repos/CarbonPHP/carbon/zipball/1fd1935b2d90aef2f093c5e35f7ae1257c448d00", + "reference": "1fd1935b2d90aef2f093c5e35f7ae1257c448d00", "shasum": "" }, "require": { - "carbonphp/carbon-doctrine-types": "*", + "carbonphp/carbon-doctrine-types": "<100.0", "ext-json": "*", "php": "^8.1", "psr/clock": "^1.0", - "symfony/clock": "^6.3 || ^7.0", + "symfony/clock": "^6.3.12 || ^7.0", "symfony/polyfill-mbstring": "^1.0", - "symfony/translation": "^4.4.18 || ^5.2.1|| ^6.0 || ^7.0" + "symfony/translation": "^4.4.18 || ^5.2.1 || ^6.0 || ^7.0" }, "provide": { "psr/clock-implementation": "1.0" @@ -3645,24 +3643,19 @@ "require-dev": { "doctrine/dbal": "^3.6.3 || ^4.0", "doctrine/orm": "^2.15.2 || ^3.0", - "friendsofphp/php-cs-fixer": "^3.18.0", - "kylekatarnls/multi-tester": "^2.2.0", - "ondrejmirtes/better-reflection": "^6.11.0.0", - "phpmd/phpmd": "^2.13.0", - "phpstan/extension-installer": "^1.3.0", - "phpstan/phpstan": "^1.10.20", - "phpunit/phpunit": "^10.2.2", - "squizlabs/php_codesniffer": "^3.7.2" + "friendsofphp/php-cs-fixer": "^3.75.0", + "kylekatarnls/multi-tester": "^2.5.3", + "phpmd/phpmd": "^2.15.0", + "phpstan/extension-installer": "^1.4.3", + "phpstan/phpstan": "^2.1.17", + "phpunit/phpunit": "^10.5.46", + "squizlabs/php_codesniffer": "^3.13.0" }, "bin": [ "bin/carbon" ], "type": "library", "extra": { - "branch-alias": { - "dev-master": "3.x-dev", - "dev-2.x": "2.x-dev" - }, "laravel": { "providers": [ "Carbon\\Laravel\\ServiceProvider" @@ -3672,6 +3665,10 @@ "includes": [ "extension.neon" ] + }, + "branch-alias": { + "dev-2.x": "2.x-dev", + "dev-master": "3.x-dev" } }, "autoload": { @@ -3703,8 +3700,8 @@ ], "support": { "docs": "https://carbon.nesbot.com/docs", - "issues": "https://github.com/briannesbitt/Carbon/issues", - "source": "https://github.com/briannesbitt/Carbon" + "issues": "https://github.com/CarbonPHP/carbon/issues", + "source": "https://github.com/CarbonPHP/carbon" }, "funding": [ { @@ -3720,28 +3717,28 @@ "type": "tidelift" } ], - "time": "2024-03-13T12:42:37+00:00" + "time": "2025-06-21T15:19:35+00:00" }, { "name": "nette/schema", - "version": "v1.3.0", + "version": "v1.3.2", "source": { "type": "git", "url": "https://github.com/nette/schema.git", - "reference": "a6d3a6d1f545f01ef38e60f375d1cf1f4de98188" + "reference": "da801d52f0354f70a638673c4a0f04e16529431d" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/nette/schema/zipball/a6d3a6d1f545f01ef38e60f375d1cf1f4de98188", - "reference": "a6d3a6d1f545f01ef38e60f375d1cf1f4de98188", + "url": "https://api.github.com/repos/nette/schema/zipball/da801d52f0354f70a638673c4a0f04e16529431d", + "reference": "da801d52f0354f70a638673c4a0f04e16529431d", "shasum": "" }, "require": { "nette/utils": "^4.0", - "php": "8.1 - 8.3" + "php": "8.1 - 8.4" }, "require-dev": { - "nette/tester": "^2.4", + "nette/tester": "^2.5.2", "phpstan/phpstan-nette": "^1.0", "tracy/tracy": "^2.8" }, @@ -3780,26 +3777,26 @@ ], "support": { "issues": "https://github.com/nette/schema/issues", - "source": "https://github.com/nette/schema/tree/v1.3.0" + "source": "https://github.com/nette/schema/tree/v1.3.2" }, - "time": "2023-12-11T11:54:22+00:00" + "time": "2024-10-06T23:10:23+00:00" }, { "name": "nette/utils", - "version": "v4.0.4", + "version": "v4.0.7", "source": { "type": "git", "url": "https://github.com/nette/utils.git", - "reference": "d3ad0aa3b9f934602cb3e3902ebccf10be34d218" + "reference": "e67c4061eb40b9c113b218214e42cb5a0dda28f2" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/nette/utils/zipball/d3ad0aa3b9f934602cb3e3902ebccf10be34d218", - "reference": "d3ad0aa3b9f934602cb3e3902ebccf10be34d218", + "url": "https://api.github.com/repos/nette/utils/zipball/e67c4061eb40b9c113b218214e42cb5a0dda28f2", + "reference": "e67c4061eb40b9c113b218214e42cb5a0dda28f2", "shasum": "" }, "require": { - "php": ">=8.0 <8.4" + "php": "8.0 - 8.4" }, "conflict": { "nette/finder": "<3", @@ -3866,31 +3863,33 @@ ], "support": { "issues": "https://github.com/nette/utils/issues", - "source": "https://github.com/nette/utils/tree/v4.0.4" + "source": "https://github.com/nette/utils/tree/v4.0.7" }, - "time": "2024-01-17T16:50:36+00:00" + "time": "2025-06-03T04:55:08+00:00" }, { "name": "nikic/php-parser", - "version": "v4.19.1", + "version": "v5.5.0", "source": { "type": "git", "url": "https://github.com/nikic/PHP-Parser.git", - "reference": "4e1b88d21c69391150ace211e9eaf05810858d0b" + "reference": "ae59794362fe85e051a58ad36b289443f57be7a9" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/4e1b88d21c69391150ace211e9eaf05810858d0b", - "reference": "4e1b88d21c69391150ace211e9eaf05810858d0b", + "url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/ae59794362fe85e051a58ad36b289443f57be7a9", + "reference": "ae59794362fe85e051a58ad36b289443f57be7a9", "shasum": "" }, "require": { + "ext-ctype": "*", + "ext-json": "*", "ext-tokenizer": "*", - "php": ">=7.1" + "php": ">=7.4" }, "require-dev": { "ircmaxell/php-yacc": "^0.0.7", - "phpunit/phpunit": "^6.5 || ^7.0 || ^8.0 || ^9.0" + "phpunit/phpunit": "^9.0" }, "bin": [ "bin/php-parse" @@ -3898,7 +3897,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-master": "4.9-dev" + "dev-master": "5.0-dev" } }, "autoload": { @@ -3922,38 +3921,37 @@ ], "support": { "issues": "https://github.com/nikic/PHP-Parser/issues", - "source": "https://github.com/nikic/PHP-Parser/tree/v4.19.1" + "source": "https://github.com/nikic/PHP-Parser/tree/v5.5.0" }, - "time": "2024-03-17T08:10:35+00:00" + "time": "2025-05-31T08:24:38+00:00" }, { "name": "nunomaduro/termwind", - "version": "v2.0.1", + "version": "v2.3.1", "source": { "type": "git", "url": "https://github.com/nunomaduro/termwind.git", - "reference": "58c4c58cf23df7f498daeb97092e34f5259feb6a" + "reference": "dfa08f390e509967a15c22493dc0bac5733d9123" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/nunomaduro/termwind/zipball/58c4c58cf23df7f498daeb97092e34f5259feb6a", - "reference": "58c4c58cf23df7f498daeb97092e34f5259feb6a", + "url": "https://api.github.com/repos/nunomaduro/termwind/zipball/dfa08f390e509967a15c22493dc0bac5733d9123", + "reference": "dfa08f390e509967a15c22493dc0bac5733d9123", "shasum": "" }, "require": { "ext-mbstring": "*", "php": "^8.2", - "symfony/console": "^7.0.4" + "symfony/console": "^7.2.6" }, "require-dev": { - "ergebnis/phpstan-rules": "^2.2.0", - "illuminate/console": "^11.0.0", - "laravel/pint": "^1.14.0", - "mockery/mockery": "^1.6.7", - "pestphp/pest": "^2.34.1", - "phpstan/phpstan": "^1.10.59", - "phpstan/phpstan-strict-rules": "^1.5.2", - "symfony/var-dumper": "^7.0.4", + "illuminate/console": "^11.44.7", + "laravel/pint": "^1.22.0", + "mockery/mockery": "^1.6.12", + "pestphp/pest": "^2.36.0 || ^3.8.2", + "phpstan/phpstan": "^1.12.25", + "phpstan/phpstan-strict-rules": "^1.6.2", + "symfony/var-dumper": "^7.2.6", "thecodingmachine/phpstan-strict-rules": "^1.0.0" }, "type": "library", @@ -3996,7 +3994,7 @@ ], "support": { "issues": "https://github.com/nunomaduro/termwind/issues", - "source": "https://github.com/nunomaduro/termwind/tree/v2.0.1" + "source": "https://github.com/nunomaduro/termwind/tree/v2.3.1" }, "funding": [ { @@ -4012,20 +4010,20 @@ "type": "github" } ], - "time": "2024-03-06T16:17:14+00:00" + "time": "2025-05-08T08:14:37+00:00" }, { "name": "p3k/http", - "version": "0.1.12", + "version": "0.1.13", "source": { "type": "git", "url": "https://github.com/aaronpk/p3k-http.git", - "reference": "cf9c5b7cdbe1800bfb9587a20953ed8d20322e0b" + "reference": "ae4988ba19f4bc57ca3fe1f6dcd2087478fea53a" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/aaronpk/p3k-http/zipball/cf9c5b7cdbe1800bfb9587a20953ed8d20322e0b", - "reference": "cf9c5b7cdbe1800bfb9587a20953ed8d20322e0b", + "url": "https://api.github.com/repos/aaronpk/p3k-http/zipball/ae4988ba19f4bc57ca3fe1f6dcd2087478fea53a", + "reference": "ae4988ba19f4bc57ca3fe1f6dcd2087478fea53a", "shasum": "" }, "require": { @@ -4052,30 +4050,30 @@ "homepage": "https://github.com/aaronpk/p3k-http", "support": { "issues": "https://github.com/aaronpk/p3k-http/issues", - "source": "https://github.com/aaronpk/p3k-http/tree/0.1.12" + "source": "https://github.com/aaronpk/p3k-http/tree/0.1.13" }, - "time": "2021-10-12T14:12:29+00:00" + "time": "2024-10-20T19:46:46+00:00" }, { "name": "paragonie/constant_time_encoding", - "version": "v2.6.3", + "version": "v3.0.0", "source": { "type": "git", "url": "https://github.com/paragonie/constant_time_encoding.git", - "reference": "58c3f47f650c94ec05a151692652a868995d2938" + "reference": "df1e7fde177501eee2037dd159cf04f5f301a512" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/paragonie/constant_time_encoding/zipball/58c3f47f650c94ec05a151692652a868995d2938", - "reference": "58c3f47f650c94ec05a151692652a868995d2938", + "url": "https://api.github.com/repos/paragonie/constant_time_encoding/zipball/df1e7fde177501eee2037dd159cf04f5f301a512", + "reference": "df1e7fde177501eee2037dd159cf04f5f301a512", "shasum": "" }, "require": { - "php": "^7|^8" + "php": "^8" }, "require-dev": { - "phpunit/phpunit": "^6|^7|^8|^9", - "vimeo/psalm": "^1|^2|^3|^4" + "phpunit/phpunit": "^9", + "vimeo/psalm": "^4|^5" }, "type": "library", "autoload": { @@ -4121,20 +4119,195 @@ "issues": "https://github.com/paragonie/constant_time_encoding/issues", "source": "https://github.com/paragonie/constant_time_encoding" }, - "time": "2022-06-14T06:56:20+00:00" + "time": "2024-05-08T12:36:18+00:00" }, { - "name": "phpoption/phpoption", - "version": "1.9.2", + "name": "phpdocumentor/reflection-common", + "version": "2.2.0", "source": { "type": "git", - "url": "https://github.com/schmittjoh/php-option.git", - "reference": "80735db690fe4fc5c76dfa7f9b770634285fa820" + "url": "https://github.com/phpDocumentor/ReflectionCommon.git", + "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/schmittjoh/php-option/zipball/80735db690fe4fc5c76dfa7f9b770634285fa820", - "reference": "80735db690fe4fc5c76dfa7f9b770634285fa820", + "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/1d01c49d4ed62f25aa84a747ad35d5a16924662b", + "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-2.x": "2.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jaap van Otterdijk", + "email": "opensource@ijaap.nl" + } + ], + "description": "Common reflection classes used by phpdocumentor to reflect the code structure", + "homepage": "http://www.phpdoc.org", + "keywords": [ + "FQSEN", + "phpDocumentor", + "phpdoc", + "reflection", + "static analysis" + ], + "support": { + "issues": "https://github.com/phpDocumentor/ReflectionCommon/issues", + "source": "https://github.com/phpDocumentor/ReflectionCommon/tree/2.x" + }, + "time": "2020-06-27T09:03:43+00:00" + }, + { + "name": "phpdocumentor/reflection-docblock", + "version": "5.6.2", + "source": { + "type": "git", + "url": "https://github.com/phpDocumentor/ReflectionDocBlock.git", + "reference": "92dde6a5919e34835c506ac8c523ef095a95ed62" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpDocumentor/ReflectionDocBlock/zipball/92dde6a5919e34835c506ac8c523ef095a95ed62", + "reference": "92dde6a5919e34835c506ac8c523ef095a95ed62", + "shasum": "" + }, + "require": { + "doctrine/deprecations": "^1.1", + "ext-filter": "*", + "php": "^7.4 || ^8.0", + "phpdocumentor/reflection-common": "^2.2", + "phpdocumentor/type-resolver": "^1.7", + "phpstan/phpdoc-parser": "^1.7|^2.0", + "webmozart/assert": "^1.9.1" + }, + "require-dev": { + "mockery/mockery": "~1.3.5 || ~1.6.0", + "phpstan/extension-installer": "^1.1", + "phpstan/phpstan": "^1.8", + "phpstan/phpstan-mockery": "^1.1", + "phpstan/phpstan-webmozart-assert": "^1.2", + "phpunit/phpunit": "^9.5", + "psalm/phar": "^5.26" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Mike van Riel", + "email": "me@mikevanriel.com" + }, + { + "name": "Jaap van Otterdijk", + "email": "opensource@ijaap.nl" + } + ], + "description": "With this component, a library can provide support for annotations via DocBlocks or otherwise retrieve information that is embedded in a DocBlock.", + "support": { + "issues": "https://github.com/phpDocumentor/ReflectionDocBlock/issues", + "source": "https://github.com/phpDocumentor/ReflectionDocBlock/tree/5.6.2" + }, + "time": "2025-04-13T19:20:35+00:00" + }, + { + "name": "phpdocumentor/type-resolver", + "version": "1.10.0", + "source": { + "type": "git", + "url": "https://github.com/phpDocumentor/TypeResolver.git", + "reference": "679e3ce485b99e84c775d28e2e96fade9a7fb50a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/679e3ce485b99e84c775d28e2e96fade9a7fb50a", + "reference": "679e3ce485b99e84c775d28e2e96fade9a7fb50a", + "shasum": "" + }, + "require": { + "doctrine/deprecations": "^1.0", + "php": "^7.3 || ^8.0", + "phpdocumentor/reflection-common": "^2.0", + "phpstan/phpdoc-parser": "^1.18|^2.0" + }, + "require-dev": { + "ext-tokenizer": "*", + "phpbench/phpbench": "^1.2", + "phpstan/extension-installer": "^1.1", + "phpstan/phpstan": "^1.8", + "phpstan/phpstan-phpunit": "^1.1", + "phpunit/phpunit": "^9.5", + "rector/rector": "^0.13.9", + "vimeo/psalm": "^4.25" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-1.x": "1.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Mike van Riel", + "email": "me@mikevanriel.com" + } + ], + "description": "A PSR-5 based resolver of Class names, Types and Structural Element Names", + "support": { + "issues": "https://github.com/phpDocumentor/TypeResolver/issues", + "source": "https://github.com/phpDocumentor/TypeResolver/tree/1.10.0" + }, + "time": "2024-11-09T15:12:26+00:00" + }, + { + "name": "phpoption/phpoption", + "version": "1.9.3", + "source": { + "type": "git", + "url": "https://github.com/schmittjoh/php-option.git", + "reference": "e3fac8b24f56113f7cb96af14958c0dd16330f54" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/schmittjoh/php-option/zipball/e3fac8b24f56113f7cb96af14958c0dd16330f54", + "reference": "e3fac8b24f56113f7cb96af14958c0dd16330f54", "shasum": "" }, "require": { @@ -4142,13 +4315,13 @@ }, "require-dev": { "bamarni/composer-bin-plugin": "^1.8.2", - "phpunit/phpunit": "^8.5.34 || ^9.6.13 || ^10.4.2" + "phpunit/phpunit": "^8.5.39 || ^9.6.20 || ^10.5.28" }, "type": "library", "extra": { "bamarni-bin": { "bin-links": true, - "forward-command": true + "forward-command": false }, "branch-alias": { "dev-master": "1.9-dev" @@ -4184,7 +4357,7 @@ ], "support": { "issues": "https://github.com/schmittjoh/php-option/issues", - "source": "https://github.com/schmittjoh/php-option/tree/1.9.2" + "source": "https://github.com/schmittjoh/php-option/tree/1.9.3" }, "funding": [ { @@ -4196,7 +4369,54 @@ "type": "tidelift" } ], - "time": "2023-11-12T21:59:55+00:00" + "time": "2024-07-20T21:41:07+00:00" + }, + { + "name": "phpstan/phpdoc-parser", + "version": "2.1.0", + "source": { + "type": "git", + "url": "https://github.com/phpstan/phpdoc-parser.git", + "reference": "9b30d6fd026b2c132b3985ce6b23bec09ab3aa68" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpstan/phpdoc-parser/zipball/9b30d6fd026b2c132b3985ce6b23bec09ab3aa68", + "reference": "9b30d6fd026b2c132b3985ce6b23bec09ab3aa68", + "shasum": "" + }, + "require": { + "php": "^7.4 || ^8.0" + }, + "require-dev": { + "doctrine/annotations": "^2.0", + "nikic/php-parser": "^5.3.0", + "php-parallel-lint/php-parallel-lint": "^1.2", + "phpstan/extension-installer": "^1.0", + "phpstan/phpstan": "^2.0", + "phpstan/phpstan-phpunit": "^2.0", + "phpstan/phpstan-strict-rules": "^2.0", + "phpunit/phpunit": "^9.6", + "symfony/process": "^5.2" + }, + "type": "library", + "autoload": { + "psr-4": { + "PHPStan\\PhpDocParser\\": [ + "src/" + ] + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "PHPDoc parser with support for nullable, intersection and generic types", + "support": { + "issues": "https://github.com/phpstan/phpdoc-parser/issues", + "source": "https://github.com/phpstan/phpdoc-parser/tree/2.1.0" + }, + "time": "2025-02-19T13:28:12+00:00" }, { "name": "psr/clock", @@ -4403,20 +4623,20 @@ }, { "name": "psr/http-factory", - "version": "1.0.2", + "version": "1.1.0", "source": { "type": "git", "url": "https://github.com/php-fig/http-factory.git", - "reference": "e616d01114759c4c489f93b099585439f795fe35" + "reference": "2b4765fddfe3b508ac62f829e852b1501d3f6e8a" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/php-fig/http-factory/zipball/e616d01114759c4c489f93b099585439f795fe35", - "reference": "e616d01114759c4c489f93b099585439f795fe35", + "url": "https://api.github.com/repos/php-fig/http-factory/zipball/2b4765fddfe3b508ac62f829e852b1501d3f6e8a", + "reference": "2b4765fddfe3b508ac62f829e852b1501d3f6e8a", "shasum": "" }, "require": { - "php": ">=7.0.0", + "php": ">=7.1", "psr/http-message": "^1.0 || ^2.0" }, "type": "library", @@ -4440,7 +4660,7 @@ "homepage": "https://www.php-fig.org/" } ], - "description": "Common interfaces for PSR-7 HTTP message factories", + "description": "PSR-17: Common interfaces for PSR-7 HTTP message factories", "keywords": [ "factory", "http", @@ -4452,9 +4672,9 @@ "response" ], "support": { - "source": "https://github.com/php-fig/http-factory/tree/1.0.2" + "source": "https://github.com/php-fig/http-factory" }, - "time": "2023-04-10T20:10:41+00:00" + "time": "2024-04-15T12:06:14+00:00" }, { "name": "psr/http-message", @@ -4511,16 +4731,16 @@ }, { "name": "psr/log", - "version": "3.0.0", + "version": "3.0.2", "source": { "type": "git", "url": "https://github.com/php-fig/log.git", - "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001" + "reference": "f16e1d5863e37f8d8c2a01719f5b34baa2b714d3" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/php-fig/log/zipball/fe5ea303b0887d5caefd3d431c3e61ad47037001", - "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001", + "url": "https://api.github.com/repos/php-fig/log/zipball/f16e1d5863e37f8d8c2a01719f5b34baa2b714d3", + "reference": "f16e1d5863e37f8d8c2a01719f5b34baa2b714d3", "shasum": "" }, "require": { @@ -4555,9 +4775,9 @@ "psr-3" ], "support": { - "source": "https://github.com/php-fig/log/tree/3.0.0" + "source": "https://github.com/php-fig/log/tree/3.0.2" }, - "time": "2021-07-14T16:46:02+00:00" + "time": "2024-09-11T13:17:53+00:00" }, { "name": "psr/simple-cache", @@ -4612,16 +4832,16 @@ }, { "name": "psy/psysh", - "version": "v0.12.2", + "version": "v0.12.9", "source": { "type": "git", "url": "https://github.com/bobthecow/psysh.git", - "reference": "9185c66c2165bbf4d71de78a69dccf4974f9538d" + "reference": "1b801844becfe648985372cb4b12ad6840245ace" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/bobthecow/psysh/zipball/9185c66c2165bbf4d71de78a69dccf4974f9538d", - "reference": "9185c66c2165bbf4d71de78a69dccf4974f9538d", + "url": "https://api.github.com/repos/bobthecow/psysh/zipball/1b801844becfe648985372cb4b12ad6840245ace", + "reference": "1b801844becfe648985372cb4b12ad6840245ace", "shasum": "" }, "require": { @@ -4648,12 +4868,12 @@ ], "type": "library", "extra": { - "branch-alias": { - "dev-main": "0.12.x-dev" - }, "bamarni-bin": { "bin-links": false, "forward-command": false + }, + "branch-alias": { + "dev-main": "0.12.x-dev" } }, "autoload": { @@ -4685,9 +4905,9 @@ ], "support": { "issues": "https://github.com/bobthecow/psysh/issues", - "source": "https://github.com/bobthecow/psysh/tree/v0.12.2" + "source": "https://github.com/bobthecow/psysh/tree/v0.12.9" }, - "time": "2024-03-17T01:53:00+00:00" + "time": "2025-06-23T02:35:06+00:00" }, { "name": "ralouphie/getallheaders", @@ -4735,16 +4955,16 @@ }, { "name": "ramsey/collection", - "version": "2.0.0", + "version": "2.1.1", "source": { "type": "git", "url": "https://github.com/ramsey/collection.git", - "reference": "a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5" + "reference": "344572933ad0181accbf4ba763e85a0306a8c5e2" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/ramsey/collection/zipball/a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5", - "reference": "a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5", + "url": "https://api.github.com/repos/ramsey/collection/zipball/344572933ad0181accbf4ba763e85a0306a8c5e2", + "reference": "344572933ad0181accbf4ba763e85a0306a8c5e2", "shasum": "" }, "require": { @@ -4752,25 +4972,22 @@ }, "require-dev": { "captainhook/plugin-composer": "^5.3", - "ergebnis/composer-normalize": "^2.28.3", - "fakerphp/faker": "^1.21", + "ergebnis/composer-normalize": "^2.45", + "fakerphp/faker": "^1.24", "hamcrest/hamcrest-php": "^2.0", - "jangregor/phpstan-prophecy": "^1.0", - "mockery/mockery": "^1.5", + "jangregor/phpstan-prophecy": "^2.1", + "mockery/mockery": "^1.6", "php-parallel-lint/php-console-highlighter": "^1.0", - "php-parallel-lint/php-parallel-lint": "^1.3", - "phpcsstandards/phpcsutils": "^1.0.0-rc1", - "phpspec/prophecy-phpunit": "^2.0", - "phpstan/extension-installer": "^1.2", - "phpstan/phpstan": "^1.9", - "phpstan/phpstan-mockery": "^1.1", - "phpstan/phpstan-phpunit": "^1.3", - "phpunit/phpunit": "^9.5", - "psalm/plugin-mockery": "^1.1", - "psalm/plugin-phpunit": "^0.18.4", - "ramsey/coding-standard": "^2.0.3", - "ramsey/conventional-commits": "^1.3", - "vimeo/psalm": "^5.4" + "php-parallel-lint/php-parallel-lint": "^1.4", + "phpspec/prophecy-phpunit": "^2.3", + "phpstan/extension-installer": "^1.4", + "phpstan/phpstan": "^2.1", + "phpstan/phpstan-mockery": "^2.0", + "phpstan/phpstan-phpunit": "^2.0", + "phpunit/phpunit": "^10.5", + "ramsey/coding-standard": "^2.3", + "ramsey/conventional-commits": "^1.6", + "roave/security-advisories": "dev-latest" }, "type": "library", "extra": { @@ -4808,37 +5025,26 @@ ], "support": { "issues": "https://github.com/ramsey/collection/issues", - "source": "https://github.com/ramsey/collection/tree/2.0.0" + "source": "https://github.com/ramsey/collection/tree/2.1.1" }, - "funding": [ - { - "url": "https://github.com/ramsey", - "type": "github" - }, - { - "url": "https://tidelift.com/funding/github/packagist/ramsey/collection", - "type": "tidelift" - } - ], - "time": "2022-12-31T21:50:55+00:00" + "time": "2025-03-22T05:38:12+00:00" }, { "name": "ramsey/uuid", - "version": "4.7.5", + "version": "4.9.0", "source": { "type": "git", "url": "https://github.com/ramsey/uuid.git", - "reference": "5f0df49ae5ad6efb7afa69e6bfab4e5b1e080d8e" + "reference": "4e0e23cc785f0724a0e838279a9eb03f28b092a0" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/ramsey/uuid/zipball/5f0df49ae5ad6efb7afa69e6bfab4e5b1e080d8e", - "reference": "5f0df49ae5ad6efb7afa69e6bfab4e5b1e080d8e", + "url": "https://api.github.com/repos/ramsey/uuid/zipball/4e0e23cc785f0724a0e838279a9eb03f28b092a0", + "reference": "4e0e23cc785f0724a0e838279a9eb03f28b092a0", "shasum": "" }, "require": { - "brick/math": "^0.8.8 || ^0.9 || ^0.10 || ^0.11", - "ext-json": "*", + "brick/math": "^0.8.8 || ^0.9 || ^0.10 || ^0.11 || ^0.12 || ^0.13", "php": "^8.0", "ramsey/collection": "^1.2 || ^2.0" }, @@ -4846,26 +5052,23 @@ "rhumsaa/uuid": "self.version" }, "require-dev": { - "captainhook/captainhook": "^5.10", + "captainhook/captainhook": "^5.25", "captainhook/plugin-composer": "^5.3", - "dealerdirect/phpcodesniffer-composer-installer": "^0.7.0", - "doctrine/annotations": "^1.8", - "ergebnis/composer-normalize": "^2.15", - "mockery/mockery": "^1.3", + "dealerdirect/phpcodesniffer-composer-installer": "^1.0", + "ergebnis/composer-normalize": "^2.47", + "mockery/mockery": "^1.6", "paragonie/random-lib": "^2", - "php-mock/php-mock": "^2.2", - "php-mock/php-mock-mockery": "^1.3", - "php-parallel-lint/php-parallel-lint": "^1.1", - "phpbench/phpbench": "^1.0", - "phpstan/extension-installer": "^1.1", - "phpstan/phpstan": "^1.8", - "phpstan/phpstan-mockery": "^1.1", - "phpstan/phpstan-phpunit": "^1.1", - "phpunit/phpunit": "^8.5 || ^9", - "ramsey/composer-repl": "^1.4", - "slevomat/coding-standard": "^8.4", - "squizlabs/php_codesniffer": "^3.5", - "vimeo/psalm": "^4.9" + "php-mock/php-mock": "^2.6", + "php-mock/php-mock-mockery": "^1.5", + "php-parallel-lint/php-parallel-lint": "^1.4.0", + "phpbench/phpbench": "^1.2.14", + "phpstan/extension-installer": "^1.4", + "phpstan/phpstan": "^2.1", + "phpstan/phpstan-mockery": "^2.0", + "phpstan/phpstan-phpunit": "^2.0", + "phpunit/phpunit": "^9.6", + "slevomat/coding-standard": "^8.18", + "squizlabs/php_codesniffer": "^3.13" }, "suggest": { "ext-bcmath": "Enables faster math with arbitrary-precision integers using BCMath.", @@ -4900,19 +5103,9 @@ ], "support": { "issues": "https://github.com/ramsey/uuid/issues", - "source": "https://github.com/ramsey/uuid/tree/4.7.5" + "source": "https://github.com/ramsey/uuid/tree/4.9.0" }, - "funding": [ - { - "url": "https://github.com/ramsey", - "type": "github" - }, - { - "url": "https://tidelift.com/funding/github/packagist/ramsey/uuid", - "type": "tidelift" - } - ], - "time": "2023-11-08T05:53:05+00:00" + "time": "2025-06-25T14:20:11+00:00" }, { "name": "scrivo/highlight.php", @@ -4994,26 +5187,27 @@ }, { "name": "spatie/backtrace", - "version": "1.5.3", + "version": "1.7.4", "source": { "type": "git", "url": "https://github.com/spatie/backtrace.git", - "reference": "483f76a82964a0431aa836b6ed0edde0c248e3ab" + "reference": "cd37a49fce7137359ac30ecc44ef3e16404cccbe" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/spatie/backtrace/zipball/483f76a82964a0431aa836b6ed0edde0c248e3ab", - "reference": "483f76a82964a0431aa836b6ed0edde0c248e3ab", + "url": "https://api.github.com/repos/spatie/backtrace/zipball/cd37a49fce7137359ac30ecc44ef3e16404cccbe", + "reference": "cd37a49fce7137359ac30ecc44ef3e16404cccbe", "shasum": "" }, "require": { - "php": "^7.3|^8.0" + "php": "^7.3 || ^8.0" }, "require-dev": { "ext-json": "*", - "phpunit/phpunit": "^9.3", - "spatie/phpunit-snapshot-assertions": "^4.2", - "symfony/var-dumper": "^5.1" + "laravel/serializable-closure": "^1.3 || ^2.0", + "phpunit/phpunit": "^9.3 || ^11.4.3", + "spatie/phpunit-snapshot-assertions": "^4.2 || ^5.1.6", + "symfony/var-dumper": "^5.1 || ^6.0 || ^7.0" }, "type": "library", "autoload": { @@ -5040,7 +5234,7 @@ "spatie" ], "support": { - "source": "https://github.com/spatie/backtrace/tree/1.5.3" + "source": "https://github.com/spatie/backtrace/tree/1.7.4" }, "funding": [ { @@ -5052,7 +5246,7 @@ "type": "other" } ], - "time": "2023-06-28T12:59:17+00:00" + "time": "2025-05-08T15:41:09+00:00" }, { "name": "spatie/commonmark-highlighter", @@ -5109,23 +5303,97 @@ "time": "2021-08-04T18:03:57+00:00" }, { - "name": "spatie/flare-client-php", - "version": "1.4.4", + "name": "spatie/error-solutions", + "version": "1.1.3", "source": { "type": "git", - "url": "https://github.com/spatie/flare-client-php.git", - "reference": "17082e780752d346c2db12ef5d6bee8e835e399c" + "url": "https://github.com/spatie/error-solutions.git", + "reference": "e495d7178ca524f2dd0fe6a1d99a1e608e1c9936" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/spatie/flare-client-php/zipball/17082e780752d346c2db12ef5d6bee8e835e399c", - "reference": "17082e780752d346c2db12ef5d6bee8e835e399c", + "url": "https://api.github.com/repos/spatie/error-solutions/zipball/e495d7178ca524f2dd0fe6a1d99a1e608e1c9936", + "reference": "e495d7178ca524f2dd0fe6a1d99a1e608e1c9936", "shasum": "" }, "require": { - "illuminate/pipeline": "^8.0|^9.0|^10.0|^11.0", + "php": "^8.0" + }, + "require-dev": { + "illuminate/broadcasting": "^10.0|^11.0|^12.0", + "illuminate/cache": "^10.0|^11.0|^12.0", + "illuminate/support": "^10.0|^11.0|^12.0", + "livewire/livewire": "^2.11|^3.5.20", + "openai-php/client": "^0.10.1", + "orchestra/testbench": "8.22.3|^9.0|^10.0", + "pestphp/pest": "^2.20|^3.0", + "phpstan/phpstan": "^2.1", + "psr/simple-cache": "^3.0", + "psr/simple-cache-implementation": "^3.0", + "spatie/ray": "^1.28", + "symfony/cache": "^5.4|^6.0|^7.0", + "symfony/process": "^5.4|^6.0|^7.0", + "vlucas/phpdotenv": "^5.5" + }, + "suggest": { + "openai-php/client": "Require get solutions from OpenAI", + "simple-cache-implementation": "To cache solutions from OpenAI" + }, + "type": "library", + "autoload": { + "psr-4": { + "Spatie\\Ignition\\": "legacy/ignition", + "Spatie\\ErrorSolutions\\": "src", + "Spatie\\LaravelIgnition\\": "legacy/laravel-ignition" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ruben Van Assche", + "email": "ruben@spatie.be", + "role": "Developer" + } + ], + "description": "This is my package error-solutions", + "homepage": "https://github.com/spatie/error-solutions", + "keywords": [ + "error-solutions", + "spatie" + ], + "support": { + "issues": "https://github.com/spatie/error-solutions/issues", + "source": "https://github.com/spatie/error-solutions/tree/1.1.3" + }, + "funding": [ + { + "url": "https://github.com/Spatie", + "type": "github" + } + ], + "time": "2025-02-14T12:29:50+00:00" + }, + { + "name": "spatie/flare-client-php", + "version": "1.10.1", + "source": { + "type": "git", + "url": "https://github.com/spatie/flare-client-php.git", + "reference": "bf1716eb98bd689451b071548ae9e70738dce62f" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/spatie/flare-client-php/zipball/bf1716eb98bd689451b071548ae9e70738dce62f", + "reference": "bf1716eb98bd689451b071548ae9e70738dce62f", + "shasum": "" + }, + "require": { + "illuminate/pipeline": "^8.0|^9.0|^10.0|^11.0|^12.0", "php": "^8.0", - "spatie/backtrace": "^1.5.2", + "spatie/backtrace": "^1.6.1", "symfony/http-foundation": "^5.2|^6.0|^7.0", "symfony/mime": "^5.2|^6.0|^7.0", "symfony/process": "^5.2|^6.0|^7.0", @@ -5137,7 +5405,7 @@ "phpstan/extension-installer": "^1.1", "phpstan/phpstan-deprecation-rules": "^1.0", "phpstan/phpstan-phpunit": "^1.0", - "spatie/phpunit-snapshot-assertions": "^4.0|^5.0" + "spatie/pest-plugin-snapshots": "^1.0|^2.0" }, "type": "library", "extra": { @@ -5167,7 +5435,7 @@ ], "support": { "issues": "https://github.com/spatie/flare-client-php/issues", - "source": "https://github.com/spatie/flare-client-php/tree/1.4.4" + "source": "https://github.com/spatie/flare-client-php/tree/1.10.1" }, "funding": [ { @@ -5175,33 +5443,33 @@ "type": "github" } ], - "time": "2024-01-31T14:18:45+00:00" + "time": "2025-02-14T13:42:06+00:00" }, { "name": "spatie/ignition", - "version": "1.12.0", + "version": "1.15.1", "source": { "type": "git", "url": "https://github.com/spatie/ignition.git", - "reference": "5b6f801c605a593106b623e45ca41496a6e7d56d" + "reference": "31f314153020aee5af3537e507fef892ffbf8c85" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/spatie/ignition/zipball/5b6f801c605a593106b623e45ca41496a6e7d56d", - "reference": "5b6f801c605a593106b623e45ca41496a6e7d56d", + "url": "https://api.github.com/repos/spatie/ignition/zipball/31f314153020aee5af3537e507fef892ffbf8c85", + "reference": "31f314153020aee5af3537e507fef892ffbf8c85", "shasum": "" }, "require": { "ext-json": "*", "ext-mbstring": "*", "php": "^8.0", - "spatie/backtrace": "^1.5.3", - "spatie/flare-client-php": "^1.4.0", + "spatie/error-solutions": "^1.0", + "spatie/flare-client-php": "^1.7", "symfony/console": "^5.4|^6.0|^7.0", "symfony/var-dumper": "^5.4|^6.0|^7.0" }, "require-dev": { - "illuminate/cache": "^9.52|^10.0|^11.0", + "illuminate/cache": "^9.52|^10.0|^11.0|^12.0", "mockery/mockery": "^1.4", "pestphp/pest": "^1.20|^2.0", "phpstan/extension-installer": "^1.1", @@ -5258,42 +5526,41 @@ "type": "github" } ], - "time": "2024-01-03T15:49:39+00:00" + "time": "2025-02-21T14:31:39+00:00" }, { "name": "spatie/laravel-ignition", - "version": "2.4.2", + "version": "2.9.1", "source": { "type": "git", "url": "https://github.com/spatie/laravel-ignition.git", - "reference": "351504f4570e32908839fc5a2dc53bf77d02f85e" + "reference": "1baee07216d6748ebd3a65ba97381b051838707a" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/spatie/laravel-ignition/zipball/351504f4570e32908839fc5a2dc53bf77d02f85e", - "reference": "351504f4570e32908839fc5a2dc53bf77d02f85e", + "url": "https://api.github.com/repos/spatie/laravel-ignition/zipball/1baee07216d6748ebd3a65ba97381b051838707a", + "reference": "1baee07216d6748ebd3a65ba97381b051838707a", "shasum": "" }, "require": { "ext-curl": "*", "ext-json": "*", "ext-mbstring": "*", - "illuminate/support": "^10.0|^11.0", + "illuminate/support": "^10.0|^11.0|^12.0", "php": "^8.1", - "spatie/flare-client-php": "^1.3.5", - "spatie/ignition": "^1.9", + "spatie/ignition": "^1.15", "symfony/console": "^6.2.3|^7.0", "symfony/var-dumper": "^6.2.3|^7.0" }, "require-dev": { "livewire/livewire": "^2.11|^3.3.5", "mockery/mockery": "^1.5.1", - "openai-php/client": "^0.8.1", - "orchestra/testbench": "^8.0|^9.0", - "pestphp/pest": "^2.30", - "phpstan/extension-installer": "^1.2", - "phpstan/phpstan-deprecation-rules": "^1.1.1", - "phpstan/phpstan-phpunit": "^1.3.3", + "openai-php/client": "^0.8.1|^0.10", + "orchestra/testbench": "8.22.3|^9.0|^10.0", + "pestphp/pest": "^2.34|^3.7", + "phpstan/extension-installer": "^1.3.1", + "phpstan/phpstan-deprecation-rules": "^1.1.1|^2.0", + "phpstan/phpstan-phpunit": "^1.3.16|^2.0", "vlucas/phpdotenv": "^5.5" }, "suggest": { @@ -5303,12 +5570,12 @@ "type": "library", "extra": { "laravel": { - "providers": [ - "Spatie\\LaravelIgnition\\IgnitionServiceProvider" - ], "aliases": { "Flare": "Spatie\\LaravelIgnition\\Facades\\Flare" - } + }, + "providers": [ + "Spatie\\LaravelIgnition\\IgnitionServiceProvider" + ] } }, "autoload": { @@ -5350,41 +5617,41 @@ "type": "github" } ], - "time": "2024-02-09T16:08:40+00:00" + "time": "2025-02-20T13:13:55+00:00" }, { "name": "spomky-labs/cbor-php", - "version": "3.0.4", + "version": "3.1.1", "source": { "type": "git", "url": "https://github.com/Spomky-Labs/cbor-php.git", - "reference": "658ed12a85a6b31fa312b89cd92f3a4ce6df4c6b" + "reference": "5404f3e21cbe72f5cf612aa23db2b922fd2f43bf" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/Spomky-Labs/cbor-php/zipball/658ed12a85a6b31fa312b89cd92f3a4ce6df4c6b", - "reference": "658ed12a85a6b31fa312b89cd92f3a4ce6df4c6b", + "url": "https://api.github.com/repos/Spomky-Labs/cbor-php/zipball/5404f3e21cbe72f5cf612aa23db2b922fd2f43bf", + "reference": "5404f3e21cbe72f5cf612aa23db2b922fd2f43bf", "shasum": "" }, "require": { - "brick/math": "^0.9|^0.10|^0.11|^0.12", + "brick/math": "^0.9|^0.10|^0.11|^0.12|^0.13", "ext-mbstring": "*", "php": ">=8.0" }, "require-dev": { - "ekino/phpstan-banned-code": "^1.0", + "deptrac/deptrac": "^3.0", + "ekino/phpstan-banned-code": "^1.0|^2.0|^3.0", "ext-json": "*", - "infection/infection": "^0.27", + "infection/infection": "^0.29", "php-parallel-lint/php-parallel-lint": "^1.3", "phpstan/extension-installer": "^1.1", - "phpstan/phpstan": "^1.0", - "phpstan/phpstan-beberlei-assert": "^1.0", - "phpstan/phpstan-deprecation-rules": "^1.0", - "phpstan/phpstan-phpunit": "^1.0", - "phpstan/phpstan-strict-rules": "^1.0", - "phpunit/phpunit": "^10.1", - "qossmic/deptrac-shim": "^1.0", - "rector/rector": "^0.19", + "phpstan/phpstan": "^1.0|^2.0", + "phpstan/phpstan-beberlei-assert": "^1.0|^2.0", + "phpstan/phpstan-deprecation-rules": "^1.0|^2.0", + "phpstan/phpstan-phpunit": "^1.0|^2.0", + "phpstan/phpstan-strict-rules": "^1.0|^2.0", + "phpunit/phpunit": "^10.1|^11.0|^12.0", + "rector/rector": "^1.0|^2.0", "roave/security-advisories": "dev-latest", "symfony/var-dumper": "^6.0|^7.0", "symplify/easy-coding-standard": "^12.0" @@ -5421,7 +5688,7 @@ ], "support": { "issues": "https://github.com/Spomky-Labs/cbor-php/issues", - "source": "https://github.com/Spomky-Labs/cbor-php/tree/3.0.4" + "source": "https://github.com/Spomky-Labs/cbor-php/tree/3.1.1" }, "funding": [ { @@ -5433,43 +5700,41 @@ "type": "patreon" } ], - "time": "2024-01-29T20:33:48+00:00" + "time": "2025-06-13T11:57:55+00:00" }, { "name": "spomky-labs/pki-framework", - "version": "1.1.1", + "version": "1.3.0", "source": { "type": "git", "url": "https://github.com/Spomky-Labs/pki-framework.git", - "reference": "86102bdd19379b2c6e5b0feb94fd490d40e7d133" + "reference": "eced5b5ce70518b983ff2be486e902bbd15135ae" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/Spomky-Labs/pki-framework/zipball/86102bdd19379b2c6e5b0feb94fd490d40e7d133", - "reference": "86102bdd19379b2c6e5b0feb94fd490d40e7d133", + "url": "https://api.github.com/repos/Spomky-Labs/pki-framework/zipball/eced5b5ce70518b983ff2be486e902bbd15135ae", + "reference": "eced5b5ce70518b983ff2be486e902bbd15135ae", "shasum": "" }, "require": { - "brick/math": "^0.10|^0.11|^0.12", + "brick/math": "^0.10|^0.11|^0.12|^0.13", "ext-mbstring": "*", "php": ">=8.1" }, "require-dev": { - "ekino/phpstan-banned-code": "^1.0", + "ekino/phpstan-banned-code": "^1.0|^2.0|^3.0", "ext-gmp": "*", "ext-openssl": "*", - "infection/infection": "^0.27", + "infection/infection": "^0.28|^0.29", "php-parallel-lint/php-parallel-lint": "^1.3", - "phpstan/extension-installer": "^1.3", - "phpstan/phpstan": "^1.8", - "phpstan/phpstan-beberlei-assert": "^1.0", - "phpstan/phpstan-deprecation-rules": "^1.0", - "phpstan/phpstan-phpunit": "^1.1", - "phpstan/phpstan-strict-rules": "^1.3", - "phpunit/phpunit": "^10.1", - "rector/rector": "^0.19", + "phpstan/extension-installer": "^1.3|^2.0", + "phpstan/phpstan": "^1.8|^2.0", + "phpstan/phpstan-deprecation-rules": "^1.0|^2.0", + "phpstan/phpstan-phpunit": "^1.1|^2.0", + "phpstan/phpstan-strict-rules": "^1.3|^2.0", + "phpunit/phpunit": "^10.1|^11.0|^12.0", + "rector/rector": "^1.0|^2.0", "roave/security-advisories": "dev-latest", - "symfony/phpunit-bridge": "^6.4|^7.0", "symfony/string": "^6.4|^7.0", "symfony/var-dumper": "^6.4|^7.0", "symplify/easy-coding-standard": "^12.0" @@ -5532,7 +5797,7 @@ ], "support": { "issues": "https://github.com/Spomky-Labs/pki-framework/issues", - "source": "https://github.com/Spomky-Labs/pki-framework/tree/1.1.1" + "source": "https://github.com/Spomky-Labs/pki-framework/tree/1.3.0" }, "funding": [ { @@ -5544,20 +5809,20 @@ "type": "patreon" } ], - "time": "2024-02-05T20:37:46+00:00" + "time": "2025-06-13T08:35:04+00:00" }, { "name": "symfony/clock", - "version": "v7.0.5", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/clock.git", - "reference": "8b9d08887353d627d5f6c3bf3373b398b49051c2" + "reference": "b81435fbd6648ea425d1ee96a2d8e68f4ceacd24" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/clock/zipball/8b9d08887353d627d5f6c3bf3373b398b49051c2", - "reference": "8b9d08887353d627d5f6c3bf3373b398b49051c2", + "url": "https://api.github.com/repos/symfony/clock/zipball/b81435fbd6648ea425d1ee96a2d8e68f4ceacd24", + "reference": "b81435fbd6648ea425d1ee96a2d8e68f4ceacd24", "shasum": "" }, "require": { @@ -5602,7 +5867,7 @@ "time" ], "support": { - "source": "https://github.com/symfony/clock/tree/v7.0.5" + "source": "https://github.com/symfony/clock/tree/v7.3.0" }, "funding": [ { @@ -5618,27 +5883,28 @@ "type": "tidelift" } ], - "time": "2024-03-02T12:46:12+00:00" + "time": "2024-09-25T14:21:43+00:00" }, { "name": "symfony/console", - "version": "v7.0.4", + "version": "v7.3.1", "source": { "type": "git", "url": "https://github.com/symfony/console.git", - "reference": "6b099f3306f7c9c2d2786ed736d0026b2903205f" + "reference": "9e27aecde8f506ba0fd1d9989620c04a87697101" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/console/zipball/6b099f3306f7c9c2d2786ed736d0026b2903205f", - "reference": "6b099f3306f7c9c2d2786ed736d0026b2903205f", + "url": "https://api.github.com/repos/symfony/console/zipball/9e27aecde8f506ba0fd1d9989620c04a87697101", + "reference": "9e27aecde8f506ba0fd1d9989620c04a87697101", "shasum": "" }, "require": { "php": ">=8.2", + "symfony/deprecation-contracts": "^2.5|^3", "symfony/polyfill-mbstring": "~1.0", "symfony/service-contracts": "^2.5|^3", - "symfony/string": "^6.4|^7.0" + "symfony/string": "^7.2" }, "conflict": { "symfony/dependency-injection": "<6.4", @@ -5695,7 +5961,7 @@ "terminal" ], "support": { - "source": "https://github.com/symfony/console/tree/v7.0.4" + "source": "https://github.com/symfony/console/tree/v7.3.1" }, "funding": [ { @@ -5711,20 +5977,20 @@ "type": "tidelift" } ], - "time": "2024-02-22T20:27:20+00:00" + "time": "2025-06-27T19:55:54+00:00" }, { "name": "symfony/css-selector", - "version": "v7.0.3", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/css-selector.git", - "reference": "ec60a4edf94e63b0556b6a0888548bb400a3a3be" + "reference": "601a5ce9aaad7bf10797e3663faefce9e26c24e2" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/css-selector/zipball/ec60a4edf94e63b0556b6a0888548bb400a3a3be", - "reference": "ec60a4edf94e63b0556b6a0888548bb400a3a3be", + "url": "https://api.github.com/repos/symfony/css-selector/zipball/601a5ce9aaad7bf10797e3663faefce9e26c24e2", + "reference": "601a5ce9aaad7bf10797e3663faefce9e26c24e2", "shasum": "" }, "require": { @@ -5760,7 +6026,7 @@ "description": "Converts CSS selectors to XPath expressions", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/css-selector/tree/v7.0.3" + "source": "https://github.com/symfony/css-selector/tree/v7.3.0" }, "funding": [ { @@ -5776,20 +6042,20 @@ "type": "tidelift" } ], - "time": "2024-01-23T15:02:46+00:00" + "time": "2024-09-25T14:21:43+00:00" }, { "name": "symfony/deprecation-contracts", - "version": "v3.4.0", + "version": "v3.6.0", "source": { "type": "git", "url": "https://github.com/symfony/deprecation-contracts.git", - "reference": "7c3aff79d10325257a001fcf92d991f24fc967cf" + "reference": "63afe740e99a13ba87ec199bb07bbdee937a5b62" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/deprecation-contracts/zipball/7c3aff79d10325257a001fcf92d991f24fc967cf", - "reference": "7c3aff79d10325257a001fcf92d991f24fc967cf", + "url": "https://api.github.com/repos/symfony/deprecation-contracts/zipball/63afe740e99a13ba87ec199bb07bbdee937a5b62", + "reference": "63afe740e99a13ba87ec199bb07bbdee937a5b62", "shasum": "" }, "require": { @@ -5797,12 +6063,12 @@ }, "type": "library", "extra": { - "branch-alias": { - "dev-main": "3.4-dev" - }, "thanks": { - "name": "symfony/contracts", - "url": "https://github.com/symfony/contracts" + "url": "https://github.com/symfony/contracts", + "name": "symfony/contracts" + }, + "branch-alias": { + "dev-main": "3.6-dev" } }, "autoload": { @@ -5827,7 +6093,7 @@ "description": "A generic function and convention to trigger deprecation notices", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/deprecation-contracts/tree/v3.4.0" + "source": "https://github.com/symfony/deprecation-contracts/tree/v3.6.0" }, "funding": [ { @@ -5843,20 +6109,20 @@ "type": "tidelift" } ], - "time": "2023-05-23T14:45:45+00:00" + "time": "2024-09-25T14:21:43+00:00" }, { "name": "symfony/error-handler", - "version": "v7.0.4", + "version": "v7.3.1", "source": { "type": "git", "url": "https://github.com/symfony/error-handler.git", - "reference": "677b24759decff69e65b1e9d1471d90f95ced880" + "reference": "35b55b166f6752d6aaf21aa042fc5ed280fce235" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/error-handler/zipball/677b24759decff69e65b1e9d1471d90f95ced880", - "reference": "677b24759decff69e65b1e9d1471d90f95ced880", + "url": "https://api.github.com/repos/symfony/error-handler/zipball/35b55b166f6752d6aaf21aa042fc5ed280fce235", + "reference": "35b55b166f6752d6aaf21aa042fc5ed280fce235", "shasum": "" }, "require": { @@ -5869,9 +6135,11 @@ "symfony/http-kernel": "<6.4" }, "require-dev": { + "symfony/console": "^6.4|^7.0", "symfony/deprecation-contracts": "^2.5|^3", "symfony/http-kernel": "^6.4|^7.0", - "symfony/serializer": "^6.4|^7.0" + "symfony/serializer": "^6.4|^7.0", + "symfony/webpack-encore-bundle": "^1.0|^2.0" }, "bin": [ "Resources/bin/patch-type-declarations" @@ -5902,7 +6170,7 @@ "description": "Provides tools to manage errors and ease debugging PHP code", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/error-handler/tree/v7.0.4" + "source": "https://github.com/symfony/error-handler/tree/v7.3.1" }, "funding": [ { @@ -5918,20 +6186,20 @@ "type": "tidelift" } ], - "time": "2024-02-22T20:27:20+00:00" + "time": "2025-06-13T07:48:40+00:00" }, { "name": "symfony/event-dispatcher", - "version": "v7.0.3", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/event-dispatcher.git", - "reference": "834c28d533dd0636f910909d01b9ff45cc094b5e" + "reference": "497f73ac996a598c92409b44ac43b6690c4f666d" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/event-dispatcher/zipball/834c28d533dd0636f910909d01b9ff45cc094b5e", - "reference": "834c28d533dd0636f910909d01b9ff45cc094b5e", + "url": "https://api.github.com/repos/symfony/event-dispatcher/zipball/497f73ac996a598c92409b44ac43b6690c4f666d", + "reference": "497f73ac996a598c92409b44ac43b6690c4f666d", "shasum": "" }, "require": { @@ -5982,7 +6250,7 @@ "description": "Provides tools that allow your application components to communicate with each other by dispatching events and listening to them", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/event-dispatcher/tree/v7.0.3" + "source": "https://github.com/symfony/event-dispatcher/tree/v7.3.0" }, "funding": [ { @@ -5998,20 +6266,20 @@ "type": "tidelift" } ], - "time": "2024-01-23T15:02:46+00:00" + "time": "2025-04-22T09:11:45+00:00" }, { "name": "symfony/event-dispatcher-contracts", - "version": "v3.4.0", + "version": "v3.6.0", "source": { "type": "git", "url": "https://github.com/symfony/event-dispatcher-contracts.git", - "reference": "a76aed96a42d2b521153fb382d418e30d18b59df" + "reference": "59eb412e93815df44f05f342958efa9f46b1e586" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/event-dispatcher-contracts/zipball/a76aed96a42d2b521153fb382d418e30d18b59df", - "reference": "a76aed96a42d2b521153fb382d418e30d18b59df", + "url": "https://api.github.com/repos/symfony/event-dispatcher-contracts/zipball/59eb412e93815df44f05f342958efa9f46b1e586", + "reference": "59eb412e93815df44f05f342958efa9f46b1e586", "shasum": "" }, "require": { @@ -6020,12 +6288,12 @@ }, "type": "library", "extra": { - "branch-alias": { - "dev-main": "3.4-dev" - }, "thanks": { - "name": "symfony/contracts", - "url": "https://github.com/symfony/contracts" + "url": "https://github.com/symfony/contracts", + "name": "symfony/contracts" + }, + "branch-alias": { + "dev-main": "3.6-dev" } }, "autoload": { @@ -6058,7 +6326,7 @@ "standards" ], "support": { - "source": "https://github.com/symfony/event-dispatcher-contracts/tree/v3.4.0" + "source": "https://github.com/symfony/event-dispatcher-contracts/tree/v3.6.0" }, "funding": [ { @@ -6074,20 +6342,20 @@ "type": "tidelift" } ], - "time": "2023-05-23T14:45:45+00:00" + "time": "2024-09-25T14:21:43+00:00" }, { "name": "symfony/finder", - "version": "v7.0.0", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/finder.git", - "reference": "6e5688d69f7cfc4ed4a511e96007e06c2d34ce56" + "reference": "ec2344cf77a48253bbca6939aa3d2477773ea63d" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/finder/zipball/6e5688d69f7cfc4ed4a511e96007e06c2d34ce56", - "reference": "6e5688d69f7cfc4ed4a511e96007e06c2d34ce56", + "url": "https://api.github.com/repos/symfony/finder/zipball/ec2344cf77a48253bbca6939aa3d2477773ea63d", + "reference": "ec2344cf77a48253bbca6939aa3d2477773ea63d", "shasum": "" }, "require": { @@ -6122,7 +6390,7 @@ "description": "Finds files and directories via an intuitive fluent interface", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/finder/tree/v7.0.0" + "source": "https://github.com/symfony/finder/tree/v7.3.0" }, "funding": [ { @@ -6138,20 +6406,20 @@ "type": "tidelift" } ], - "time": "2023-10-31T17:59:56+00:00" + "time": "2024-12-30T19:00:26+00:00" }, { "name": "symfony/html-sanitizer", - "version": "v7.0.4", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/html-sanitizer.git", - "reference": "a8543ad56bc5250378ca44bb3988516fcb073c5d" + "reference": "cf21254e982b12276329940ca4af5e623ee06c58" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/html-sanitizer/zipball/a8543ad56bc5250378ca44bb3988516fcb073c5d", - "reference": "a8543ad56bc5250378ca44bb3988516fcb073c5d", + "url": "https://api.github.com/repos/symfony/html-sanitizer/zipball/cf21254e982b12276329940ca4af5e623ee06c58", + "reference": "cf21254e982b12276329940ca4af5e623ee06c58", "shasum": "" }, "require": { @@ -6191,7 +6459,7 @@ "sanitizer" ], "support": { - "source": "https://github.com/symfony/html-sanitizer/tree/v7.0.4" + "source": "https://github.com/symfony/html-sanitizer/tree/v7.3.0" }, "funding": [ { @@ -6207,35 +6475,37 @@ "type": "tidelift" } ], - "time": "2024-02-15T11:33:06+00:00" + "time": "2025-03-31T08:49:55+00:00" }, { "name": "symfony/http-foundation", - "version": "v7.0.4", + "version": "v7.3.1", "source": { "type": "git", "url": "https://github.com/symfony/http-foundation.git", - "reference": "439fdfdd344943254b1ef6278613e79040548045" + "reference": "23dd60256610c86a3414575b70c596e5deff6ed9" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/http-foundation/zipball/439fdfdd344943254b1ef6278613e79040548045", - "reference": "439fdfdd344943254b1ef6278613e79040548045", + "url": "https://api.github.com/repos/symfony/http-foundation/zipball/23dd60256610c86a3414575b70c596e5deff6ed9", + "reference": "23dd60256610c86a3414575b70c596e5deff6ed9", "shasum": "" }, "require": { "php": ">=8.2", + "symfony/deprecation-contracts": "^2.5|^3.0", "symfony/polyfill-mbstring": "~1.1", "symfony/polyfill-php83": "^1.27" }, "conflict": { "doctrine/dbal": "<3.6", - "symfony/cache": "<6.4" + "symfony/cache": "<6.4.12|>=7.0,<7.1.5" }, "require-dev": { "doctrine/dbal": "^3.6|^4", "predis/predis": "^1.1|^2.0", - "symfony/cache": "^6.4|^7.0", + "symfony/cache": "^6.4.12|^7.1.5", + "symfony/clock": "^6.4|^7.0", "symfony/dependency-injection": "^6.4|^7.0", "symfony/expression-language": "^6.4|^7.0", "symfony/http-kernel": "^6.4|^7.0", @@ -6268,7 +6538,7 @@ "description": "Defines an object-oriented layer for the HTTP specification", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/http-foundation/tree/v7.0.4" + "source": "https://github.com/symfony/http-foundation/tree/v7.3.1" }, "funding": [ { @@ -6284,28 +6554,29 @@ "type": "tidelift" } ], - "time": "2024-02-08T19:22:56+00:00" + "time": "2025-06-23T15:07:14+00:00" }, { "name": "symfony/http-kernel", - "version": "v7.0.5", + "version": "v7.3.1", "source": { "type": "git", "url": "https://github.com/symfony/http-kernel.git", - "reference": "37c24ca28f65e3121a68f3dd4daeb36fb1fa2a72" + "reference": "1644879a66e4aa29c36fe33dfa6c54b450ce1831" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/http-kernel/zipball/37c24ca28f65e3121a68f3dd4daeb36fb1fa2a72", - "reference": "37c24ca28f65e3121a68f3dd4daeb36fb1fa2a72", + "url": "https://api.github.com/repos/symfony/http-kernel/zipball/1644879a66e4aa29c36fe33dfa6c54b450ce1831", + "reference": "1644879a66e4aa29c36fe33dfa6c54b450ce1831", "shasum": "" }, "require": { "php": ">=8.2", "psr/log": "^1|^2|^3", + "symfony/deprecation-contracts": "^2.5|^3", "symfony/error-handler": "^6.4|^7.0", - "symfony/event-dispatcher": "^6.4|^7.0", - "symfony/http-foundation": "^6.4|^7.0", + "symfony/event-dispatcher": "^7.3", + "symfony/http-foundation": "^7.3", "symfony/polyfill-ctype": "^1.8" }, "conflict": { @@ -6325,7 +6596,7 @@ "symfony/twig-bridge": "<6.4", "symfony/validator": "<6.4", "symfony/var-dumper": "<6.4", - "twig/twig": "<3.0.4" + "twig/twig": "<3.12" }, "provide": { "psr/log-implementation": "1.0|2.0|3.0" @@ -6343,16 +6614,17 @@ "symfony/finder": "^6.4|^7.0", "symfony/http-client-contracts": "^2.5|^3", "symfony/process": "^6.4|^7.0", - "symfony/property-access": "^6.4|^7.0", + "symfony/property-access": "^7.1", "symfony/routing": "^6.4|^7.0", - "symfony/serializer": "^6.4.4|^7.0.4", + "symfony/serializer": "^7.1", "symfony/stopwatch": "^6.4|^7.0", "symfony/translation": "^6.4|^7.0", "symfony/translation-contracts": "^2.5|^3", "symfony/uid": "^6.4|^7.0", "symfony/validator": "^6.4|^7.0", + "symfony/var-dumper": "^6.4|^7.0", "symfony/var-exporter": "^6.4|^7.0", - "twig/twig": "^3.0.4" + "twig/twig": "^3.12" }, "type": "library", "autoload": { @@ -6380,7 +6652,7 @@ "description": "Provides a structured process for converting a Request into a Response", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/http-kernel/tree/v7.0.5" + "source": "https://github.com/symfony/http-kernel/tree/v7.3.1" }, "funding": [ { @@ -6396,20 +6668,20 @@ "type": "tidelift" } ], - "time": "2024-03-04T21:05:24+00:00" + "time": "2025-06-28T08:24:55+00:00" }, { "name": "symfony/mailer", - "version": "v7.0.4", + "version": "v7.3.1", "source": { "type": "git", "url": "https://github.com/symfony/mailer.git", - "reference": "72e16d87bf50a3ce195b9470c06bb9d7b816ea85" + "reference": "b5db5105b290bdbea5ab27b89c69effcf1cb3368" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/mailer/zipball/72e16d87bf50a3ce195b9470c06bb9d7b816ea85", - "reference": "72e16d87bf50a3ce195b9470c06bb9d7b816ea85", + "url": "https://api.github.com/repos/symfony/mailer/zipball/b5db5105b290bdbea5ab27b89c69effcf1cb3368", + "reference": "b5db5105b290bdbea5ab27b89c69effcf1cb3368", "shasum": "" }, "require": { @@ -6418,7 +6690,7 @@ "psr/event-dispatcher": "^1", "psr/log": "^1|^2|^3", "symfony/event-dispatcher": "^6.4|^7.0", - "symfony/mime": "^6.4|^7.0", + "symfony/mime": "^7.2", "symfony/service-contracts": "^2.5|^3" }, "conflict": { @@ -6460,7 +6732,7 @@ "description": "Helps sending emails", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/mailer/tree/v7.0.4" + "source": "https://github.com/symfony/mailer/tree/v7.3.1" }, "funding": [ { @@ -6476,20 +6748,20 @@ "type": "tidelift" } ], - "time": "2024-02-03T21:34:19+00:00" + "time": "2025-06-27T19:55:54+00:00" }, { "name": "symfony/mime", - "version": "v7.0.3", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/mime.git", - "reference": "c1ffe24ba6fdc3e3f0f3fcb93519103b326a3716" + "reference": "0e7b19b2f399c31df0cdbe5d8cbf53f02f6cfcd9" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/mime/zipball/c1ffe24ba6fdc3e3f0f3fcb93519103b326a3716", - "reference": "c1ffe24ba6fdc3e3f0f3fcb93519103b326a3716", + "url": "https://api.github.com/repos/symfony/mime/zipball/0e7b19b2f399c31df0cdbe5d8cbf53f02f6cfcd9", + "reference": "0e7b19b2f399c31df0cdbe5d8cbf53f02f6cfcd9", "shasum": "" }, "require": { @@ -6502,16 +6774,17 @@ "phpdocumentor/reflection-docblock": "<3.2.2", "phpdocumentor/type-resolver": "<1.4.0", "symfony/mailer": "<6.4", - "symfony/serializer": "<6.4" + "symfony/serializer": "<6.4.3|>7.0,<7.0.3" }, "require-dev": { "egulias/email-validator": "^2.1.10|^3.1|^4", "league/html-to-markdown": "^5.0", "phpdocumentor/reflection-docblock": "^3.0|^4.0|^5.0", "symfony/dependency-injection": "^6.4|^7.0", + "symfony/process": "^6.4|^7.0", "symfony/property-access": "^6.4|^7.0", "symfony/property-info": "^6.4|^7.0", - "symfony/serializer": "^6.4|^7.0" + "symfony/serializer": "^6.4.3|^7.0.3" }, "type": "library", "autoload": { @@ -6543,7 +6816,7 @@ "mime-type" ], "support": { - "source": "https://github.com/symfony/mime/tree/v7.0.3" + "source": "https://github.com/symfony/mime/tree/v7.3.0" }, "funding": [ { @@ -6559,24 +6832,24 @@ "type": "tidelift" } ], - "time": "2024-01-30T08:34:29+00:00" + "time": "2025-02-19T08:51:26+00:00" }, { "name": "symfony/polyfill-ctype", - "version": "v1.29.0", + "version": "v1.32.0", "source": { "type": "git", "url": "https://github.com/symfony/polyfill-ctype.git", - "reference": "ef4d7e442ca910c4764bce785146269b30cb5fc4" + "reference": "a3cc8b044a6ea513310cbd48ef7333b384945638" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-ctype/zipball/ef4d7e442ca910c4764bce785146269b30cb5fc4", - "reference": "ef4d7e442ca910c4764bce785146269b30cb5fc4", + "url": "https://api.github.com/repos/symfony/polyfill-ctype/zipball/a3cc8b044a6ea513310cbd48ef7333b384945638", + "reference": "a3cc8b044a6ea513310cbd48ef7333b384945638", "shasum": "" }, "require": { - "php": ">=7.1" + "php": ">=7.2" }, "provide": { "ext-ctype": "*" @@ -6587,8 +6860,8 @@ "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -6622,7 +6895,7 @@ "portable" ], "support": { - "source": "https://github.com/symfony/polyfill-ctype/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-ctype/tree/v1.32.0" }, "funding": [ { @@ -6638,24 +6911,24 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2024-09-09T11:45:10+00:00" }, { "name": "symfony/polyfill-intl-grapheme", - "version": "v1.29.0", + "version": "v1.32.0", "source": { "type": "git", "url": "https://github.com/symfony/polyfill-intl-grapheme.git", - "reference": "32a9da87d7b3245e09ac426c83d334ae9f06f80f" + "reference": "b9123926e3b7bc2f98c02ad54f6a4b02b91a8abe" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-intl-grapheme/zipball/32a9da87d7b3245e09ac426c83d334ae9f06f80f", - "reference": "32a9da87d7b3245e09ac426c83d334ae9f06f80f", + "url": "https://api.github.com/repos/symfony/polyfill-intl-grapheme/zipball/b9123926e3b7bc2f98c02ad54f6a4b02b91a8abe", + "reference": "b9123926e3b7bc2f98c02ad54f6a4b02b91a8abe", "shasum": "" }, "require": { - "php": ">=7.1" + "php": ">=7.2" }, "suggest": { "ext-intl": "For best performance" @@ -6663,8 +6936,8 @@ "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -6700,7 +6973,7 @@ "shim" ], "support": { - "source": "https://github.com/symfony/polyfill-intl-grapheme/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-intl-grapheme/tree/v1.32.0" }, "funding": [ { @@ -6716,26 +6989,25 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2024-09-09T11:45:10+00:00" }, { "name": "symfony/polyfill-intl-idn", - "version": "v1.29.0", + "version": "v1.32.0", "source": { "type": "git", "url": "https://github.com/symfony/polyfill-intl-idn.git", - "reference": "a287ed7475f85bf6f61890146edbc932c0fff919" + "reference": "9614ac4d8061dc257ecc64cba1b140873dce8ad3" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-intl-idn/zipball/a287ed7475f85bf6f61890146edbc932c0fff919", - "reference": "a287ed7475f85bf6f61890146edbc932c0fff919", + "url": "https://api.github.com/repos/symfony/polyfill-intl-idn/zipball/9614ac4d8061dc257ecc64cba1b140873dce8ad3", + "reference": "9614ac4d8061dc257ecc64cba1b140873dce8ad3", "shasum": "" }, "require": { - "php": ">=7.1", - "symfony/polyfill-intl-normalizer": "^1.10", - "symfony/polyfill-php72": "^1.10" + "php": ">=7.2", + "symfony/polyfill-intl-normalizer": "^1.10" }, "suggest": { "ext-intl": "For best performance" @@ -6743,8 +7015,8 @@ "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -6784,7 +7056,7 @@ "shim" ], "support": { - "source": "https://github.com/symfony/polyfill-intl-idn/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-intl-idn/tree/v1.32.0" }, "funding": [ { @@ -6800,24 +7072,24 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2024-09-10T14:38:51+00:00" }, { "name": "symfony/polyfill-intl-normalizer", - "version": "v1.29.0", + "version": "v1.32.0", "source": { "type": "git", "url": "https://github.com/symfony/polyfill-intl-normalizer.git", - "reference": "bc45c394692b948b4d383a08d7753968bed9a83d" + "reference": "3833d7255cc303546435cb650316bff708a1c75c" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-intl-normalizer/zipball/bc45c394692b948b4d383a08d7753968bed9a83d", - "reference": "bc45c394692b948b4d383a08d7753968bed9a83d", + "url": "https://api.github.com/repos/symfony/polyfill-intl-normalizer/zipball/3833d7255cc303546435cb650316bff708a1c75c", + "reference": "3833d7255cc303546435cb650316bff708a1c75c", "shasum": "" }, "require": { - "php": ">=7.1" + "php": ">=7.2" }, "suggest": { "ext-intl": "For best performance" @@ -6825,8 +7097,8 @@ "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -6865,7 +7137,7 @@ "shim" ], "support": { - "source": "https://github.com/symfony/polyfill-intl-normalizer/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-intl-normalizer/tree/v1.32.0" }, "funding": [ { @@ -6881,24 +7153,25 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2024-09-09T11:45:10+00:00" }, { "name": "symfony/polyfill-mbstring", - "version": "v1.29.0", + "version": "v1.32.0", "source": { "type": "git", "url": "https://github.com/symfony/polyfill-mbstring.git", - "reference": "9773676c8a1bb1f8d4340a62efe641cf76eda7ec" + "reference": "6d857f4d76bd4b343eac26d6b539585d2bc56493" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/9773676c8a1bb1f8d4340a62efe641cf76eda7ec", - "reference": "9773676c8a1bb1f8d4340a62efe641cf76eda7ec", + "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/6d857f4d76bd4b343eac26d6b539585d2bc56493", + "reference": "6d857f4d76bd4b343eac26d6b539585d2bc56493", "shasum": "" }, "require": { - "php": ">=7.1" + "ext-iconv": "*", + "php": ">=7.2" }, "provide": { "ext-mbstring": "*" @@ -6909,8 +7182,8 @@ "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -6945,7 +7218,7 @@ "shim" ], "support": { - "source": "https://github.com/symfony/polyfill-mbstring/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-mbstring/tree/v1.32.0" }, "funding": [ { @@ -6961,103 +7234,30 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" - }, - { - "name": "symfony/polyfill-php72", - "version": "v1.29.0", - "source": { - "type": "git", - "url": "https://github.com/symfony/polyfill-php72.git", - "reference": "861391a8da9a04cbad2d232ddd9e4893220d6e25" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-php72/zipball/861391a8da9a04cbad2d232ddd9e4893220d6e25", - "reference": "861391a8da9a04cbad2d232ddd9e4893220d6e25", - "shasum": "" - }, - "require": { - "php": ">=7.1" - }, - "type": "library", - "extra": { - "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" - } - }, - "autoload": { - "files": [ - "bootstrap.php" - ], - "psr-4": { - "Symfony\\Polyfill\\Php72\\": "" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Nicolas Grekas", - "email": "p@tchwork.com" - }, - { - "name": "Symfony Community", - "homepage": "https://symfony.com/contributors" - } - ], - "description": "Symfony polyfill backporting some PHP 7.2+ features to lower PHP versions", - "homepage": "https://symfony.com", - "keywords": [ - "compatibility", - "polyfill", - "portable", - "shim" - ], - "support": { - "source": "https://github.com/symfony/polyfill-php72/tree/v1.29.0" - }, - "funding": [ - { - "url": "https://symfony.com/sponsor", - "type": "custom" - }, - { - "url": "https://github.com/fabpot", - "type": "github" - }, - { - "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", - "type": "tidelift" - } - ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2024-12-23T08:48:59+00:00" }, { "name": "symfony/polyfill-php80", - "version": "v1.29.0", + "version": "v1.32.0", "source": { "type": "git", "url": "https://github.com/symfony/polyfill-php80.git", - "reference": "87b68208d5c1188808dd7839ee1e6c8ec3b02f1b" + "reference": "0cc9dd0f17f61d8131e7df6b84bd344899fe2608" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-php80/zipball/87b68208d5c1188808dd7839ee1e6c8ec3b02f1b", - "reference": "87b68208d5c1188808dd7839ee1e6c8ec3b02f1b", + "url": "https://api.github.com/repos/symfony/polyfill-php80/zipball/0cc9dd0f17f61d8131e7df6b84bd344899fe2608", + "reference": "0cc9dd0f17f61d8131e7df6b84bd344899fe2608", "shasum": "" }, "require": { - "php": ">=7.1" + "php": ">=7.2" }, "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -7098,7 +7298,7 @@ "shim" ], "support": { - "source": "https://github.com/symfony/polyfill-php80/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-php80/tree/v1.32.0" }, "funding": [ { @@ -7114,31 +7314,30 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2025-01-02T08:10:11+00:00" }, { "name": "symfony/polyfill-php83", - "version": "v1.29.0", + "version": "v1.32.0", "source": { "type": "git", "url": "https://github.com/symfony/polyfill-php83.git", - "reference": "86fcae159633351e5fd145d1c47de6c528f8caff" + "reference": "2fb86d65e2d424369ad2905e83b236a8805ba491" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-php83/zipball/86fcae159633351e5fd145d1c47de6c528f8caff", - "reference": "86fcae159633351e5fd145d1c47de6c528f8caff", + "url": "https://api.github.com/repos/symfony/polyfill-php83/zipball/2fb86d65e2d424369ad2905e83b236a8805ba491", + "reference": "2fb86d65e2d424369ad2905e83b236a8805ba491", "shasum": "" }, "require": { - "php": ">=7.1", - "symfony/polyfill-php80": "^1.14" + "php": ">=7.2" }, "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -7175,7 +7374,7 @@ "shim" ], "support": { - "source": "https://github.com/symfony/polyfill-php83/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-php83/tree/v1.32.0" }, "funding": [ { @@ -7191,24 +7390,24 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2024-09-09T11:45:10+00:00" }, { "name": "symfony/polyfill-uuid", - "version": "v1.29.0", + "version": "v1.32.0", "source": { "type": "git", "url": "https://github.com/symfony/polyfill-uuid.git", - "reference": "3abdd21b0ceaa3000ee950097bc3cf9efc137853" + "reference": "21533be36c24be3f4b1669c4725c7d1d2bab4ae2" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-uuid/zipball/3abdd21b0ceaa3000ee950097bc3cf9efc137853", - "reference": "3abdd21b0ceaa3000ee950097bc3cf9efc137853", + "url": "https://api.github.com/repos/symfony/polyfill-uuid/zipball/21533be36c24be3f4b1669c4725c7d1d2bab4ae2", + "reference": "21533be36c24be3f4b1669c4725c7d1d2bab4ae2", "shasum": "" }, "require": { - "php": ">=7.1" + "php": ">=7.2" }, "provide": { "ext-uuid": "*" @@ -7219,8 +7418,8 @@ "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -7254,7 +7453,7 @@ "uuid" ], "support": { - "source": "https://github.com/symfony/polyfill-uuid/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-uuid/tree/v1.32.0" }, "funding": [ { @@ -7270,20 +7469,20 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2024-09-09T11:45:10+00:00" }, { "name": "symfony/process", - "version": "v7.0.4", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/process.git", - "reference": "0e7727191c3b71ebec6d529fa0e50a01ca5679e9" + "reference": "40c295f2deb408d5e9d2d32b8ba1dd61e36f05af" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/process/zipball/0e7727191c3b71ebec6d529fa0e50a01ca5679e9", - "reference": "0e7727191c3b71ebec6d529fa0e50a01ca5679e9", + "url": "https://api.github.com/repos/symfony/process/zipball/40c295f2deb408d5e9d2d32b8ba1dd61e36f05af", + "reference": "40c295f2deb408d5e9d2d32b8ba1dd61e36f05af", "shasum": "" }, "require": { @@ -7315,7 +7514,7 @@ "description": "Executes commands in sub-processes", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/process/tree/v7.0.4" + "source": "https://github.com/symfony/process/tree/v7.3.0" }, "funding": [ { @@ -7331,20 +7530,182 @@ "type": "tidelift" } ], - "time": "2024-02-22T20:27:20+00:00" + "time": "2025-04-17T09:11:12+00:00" }, { - "name": "symfony/routing", - "version": "v7.0.5", + "name": "symfony/property-access", + "version": "v7.3.1", "source": { "type": "git", - "url": "https://github.com/symfony/routing.git", - "reference": "ba6bf07d43289c6a4b4591ddb75bc3bc5f069c19" + "url": "https://github.com/symfony/property-access.git", + "reference": "518d15c8cca726ebe665dcd7154074584cf862e8" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/routing/zipball/ba6bf07d43289c6a4b4591ddb75bc3bc5f069c19", - "reference": "ba6bf07d43289c6a4b4591ddb75bc3bc5f069c19", + "url": "https://api.github.com/repos/symfony/property-access/zipball/518d15c8cca726ebe665dcd7154074584cf862e8", + "reference": "518d15c8cca726ebe665dcd7154074584cf862e8", + "shasum": "" + }, + "require": { + "php": ">=8.2", + "symfony/property-info": "^6.4|^7.0" + }, + "require-dev": { + "symfony/cache": "^6.4|^7.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\PropertyAccess\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Provides functions to read and write from/to an object or array using a simple string notation", + "homepage": "https://symfony.com", + "keywords": [ + "access", + "array", + "extraction", + "index", + "injection", + "object", + "property", + "property-path", + "reflection" + ], + "support": { + "source": "https://github.com/symfony/property-access/tree/v7.3.1" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2025-06-24T04:04:43+00:00" + }, + { + "name": "symfony/property-info", + "version": "v7.3.1", + "source": { + "type": "git", + "url": "https://github.com/symfony/property-info.git", + "reference": "90586acbf2a6dd13bee4f09f09111c8bd4773970" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/property-info/zipball/90586acbf2a6dd13bee4f09f09111c8bd4773970", + "reference": "90586acbf2a6dd13bee4f09f09111c8bd4773970", + "shasum": "" + }, + "require": { + "php": ">=8.2", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/string": "^6.4|^7.0", + "symfony/type-info": "~7.2.8|^7.3.1" + }, + "conflict": { + "phpdocumentor/reflection-docblock": "<5.2", + "phpdocumentor/type-resolver": "<1.5.1", + "symfony/cache": "<6.4", + "symfony/dependency-injection": "<6.4", + "symfony/serializer": "<6.4" + }, + "require-dev": { + "phpdocumentor/reflection-docblock": "^5.2", + "phpstan/phpdoc-parser": "^1.0|^2.0", + "symfony/cache": "^6.4|^7.0", + "symfony/dependency-injection": "^6.4|^7.0", + "symfony/serializer": "^6.4|^7.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\PropertyInfo\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Kévin Dunglas", + "email": "dunglas@gmail.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Extracts information about PHP class' properties using metadata of popular sources", + "homepage": "https://symfony.com", + "keywords": [ + "doctrine", + "phpdoc", + "property", + "symfony", + "type", + "validator" + ], + "support": { + "source": "https://github.com/symfony/property-info/tree/v7.3.1" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2025-06-27T19:55:54+00:00" + }, + { + "name": "symfony/routing", + "version": "v7.3.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/routing.git", + "reference": "8e213820c5fea844ecea29203d2a308019007c15" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/routing/zipball/8e213820c5fea844ecea29203d2a308019007c15", + "reference": "8e213820c5fea844ecea29203d2a308019007c15", "shasum": "" }, "require": { @@ -7396,7 +7757,7 @@ "url" ], "support": { - "source": "https://github.com/symfony/routing/tree/v7.0.5" + "source": "https://github.com/symfony/routing/tree/v7.3.0" }, "funding": [ { @@ -7412,37 +7773,136 @@ "type": "tidelift" } ], - "time": "2024-02-27T12:34:35+00:00" + "time": "2025-05-24T20:43:28+00:00" }, { - "name": "symfony/service-contracts", - "version": "v3.4.1", + "name": "symfony/serializer", + "version": "v7.3.1", "source": { "type": "git", - "url": "https://github.com/symfony/service-contracts.git", - "reference": "fe07cbc8d837f60caf7018068e350cc5163681a0" + "url": "https://github.com/symfony/serializer.git", + "reference": "feaf837cedbbc8287986602223175d3fd639922d" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/service-contracts/zipball/fe07cbc8d837f60caf7018068e350cc5163681a0", - "reference": "fe07cbc8d837f60caf7018068e350cc5163681a0", + "url": "https://api.github.com/repos/symfony/serializer/zipball/feaf837cedbbc8287986602223175d3fd639922d", + "reference": "feaf837cedbbc8287986602223175d3fd639922d", + "shasum": "" + }, + "require": { + "php": ">=8.2", + "symfony/deprecation-contracts": "^2.5|^3", + "symfony/polyfill-ctype": "~1.8" + }, + "conflict": { + "phpdocumentor/reflection-docblock": "<3.2.2", + "phpdocumentor/type-resolver": "<1.4.0", + "symfony/dependency-injection": "<6.4", + "symfony/property-access": "<6.4", + "symfony/property-info": "<6.4", + "symfony/uid": "<6.4", + "symfony/validator": "<6.4", + "symfony/yaml": "<6.4" + }, + "require-dev": { + "phpdocumentor/reflection-docblock": "^3.2|^4.0|^5.0", + "phpstan/phpdoc-parser": "^1.0|^2.0", + "seld/jsonlint": "^1.10", + "symfony/cache": "^6.4|^7.0", + "symfony/config": "^6.4|^7.0", + "symfony/console": "^6.4|^7.0", + "symfony/dependency-injection": "^7.2", + "symfony/error-handler": "^6.4|^7.0", + "symfony/filesystem": "^6.4|^7.0", + "symfony/form": "^6.4|^7.0", + "symfony/http-foundation": "^6.4|^7.0", + "symfony/http-kernel": "^6.4|^7.0", + "symfony/messenger": "^6.4|^7.0", + "symfony/mime": "^6.4|^7.0", + "symfony/property-access": "^6.4|^7.0", + "symfony/property-info": "^6.4|^7.0", + "symfony/translation-contracts": "^2.5|^3", + "symfony/type-info": "^7.1", + "symfony/uid": "^6.4|^7.0", + "symfony/validator": "^6.4|^7.0", + "symfony/var-dumper": "^6.4|^7.0", + "symfony/var-exporter": "^6.4|^7.0", + "symfony/yaml": "^6.4|^7.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\Serializer\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Fabien Potencier", + "email": "fabien@symfony.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Handles serializing and deserializing data structures, including object graphs, into array structures or other formats like XML and JSON.", + "homepage": "https://symfony.com", + "support": { + "source": "https://github.com/symfony/serializer/tree/v7.3.1" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2025-06-27T19:55:54+00:00" + }, + { + "name": "symfony/service-contracts", + "version": "v3.6.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/service-contracts.git", + "reference": "f021b05a130d35510bd6b25fe9053c2a8a15d5d4" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/service-contracts/zipball/f021b05a130d35510bd6b25fe9053c2a8a15d5d4", + "reference": "f021b05a130d35510bd6b25fe9053c2a8a15d5d4", "shasum": "" }, "require": { "php": ">=8.1", - "psr/container": "^1.1|^2.0" + "psr/container": "^1.1|^2.0", + "symfony/deprecation-contracts": "^2.5|^3" }, "conflict": { "ext-psr": "<1.1|>=2" }, "type": "library", "extra": { - "branch-alias": { - "dev-main": "3.4-dev" - }, "thanks": { - "name": "symfony/contracts", - "url": "https://github.com/symfony/contracts" + "url": "https://github.com/symfony/contracts", + "name": "symfony/contracts" + }, + "branch-alias": { + "dev-main": "3.6-dev" } }, "autoload": { @@ -7478,7 +7938,7 @@ "standards" ], "support": { - "source": "https://github.com/symfony/service-contracts/tree/v3.4.1" + "source": "https://github.com/symfony/service-contracts/tree/v3.6.0" }, "funding": [ { @@ -7494,20 +7954,20 @@ "type": "tidelift" } ], - "time": "2023-12-26T14:02:43+00:00" + "time": "2025-04-25T09:37:31+00:00" }, { "name": "symfony/string", - "version": "v7.0.4", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/string.git", - "reference": "f5832521b998b0bec40bee688ad5de98d4cf111b" + "reference": "f3570b8c61ca887a9e2938e85cb6458515d2b125" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/string/zipball/f5832521b998b0bec40bee688ad5de98d4cf111b", - "reference": "f5832521b998b0bec40bee688ad5de98d4cf111b", + "url": "https://api.github.com/repos/symfony/string/zipball/f3570b8c61ca887a9e2938e85cb6458515d2b125", + "reference": "f3570b8c61ca887a9e2938e85cb6458515d2b125", "shasum": "" }, "require": { @@ -7521,6 +7981,7 @@ "symfony/translation-contracts": "<2.5" }, "require-dev": { + "symfony/emoji": "^7.1", "symfony/error-handler": "^6.4|^7.0", "symfony/http-client": "^6.4|^7.0", "symfony/intl": "^6.4|^7.0", @@ -7564,7 +8025,7 @@ "utf8" ], "support": { - "source": "https://github.com/symfony/string/tree/v7.0.4" + "source": "https://github.com/symfony/string/tree/v7.3.0" }, "funding": [ { @@ -7580,28 +8041,30 @@ "type": "tidelift" } ], - "time": "2024-02-01T13:17:36+00:00" + "time": "2025-04-20T20:19:01+00:00" }, { "name": "symfony/translation", - "version": "v7.0.4", + "version": "v7.3.1", "source": { "type": "git", "url": "https://github.com/symfony/translation.git", - "reference": "5b75e872f7d135d7abb4613809fadc8d9f3d30a0" + "reference": "241d5ac4910d256660238a7ecf250deba4c73063" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/translation/zipball/5b75e872f7d135d7abb4613809fadc8d9f3d30a0", - "reference": "5b75e872f7d135d7abb4613809fadc8d9f3d30a0", + "url": "https://api.github.com/repos/symfony/translation/zipball/241d5ac4910d256660238a7ecf250deba4c73063", + "reference": "241d5ac4910d256660238a7ecf250deba4c73063", "shasum": "" }, "require": { "php": ">=8.2", + "symfony/deprecation-contracts": "^2.5|^3", "symfony/polyfill-mbstring": "~1.0", "symfony/translation-contracts": "^2.5|^3.0" }, "conflict": { + "nikic/php-parser": "<5.0", "symfony/config": "<6.4", "symfony/console": "<6.4", "symfony/dependency-injection": "<6.4", @@ -7615,7 +8078,7 @@ "symfony/translation-implementation": "2.3|3.0" }, "require-dev": { - "nikic/php-parser": "^4.18|^5.0", + "nikic/php-parser": "^5.0", "psr/log": "^1|^2|^3", "symfony/config": "^6.4|^7.0", "symfony/console": "^6.4|^7.0", @@ -7658,7 +8121,7 @@ "description": "Provides tools to internationalize your application", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/translation/tree/v7.0.4" + "source": "https://github.com/symfony/translation/tree/v7.3.1" }, "funding": [ { @@ -7674,20 +8137,20 @@ "type": "tidelift" } ], - "time": "2024-02-22T20:27:20+00:00" + "time": "2025-06-27T19:55:54+00:00" }, { "name": "symfony/translation-contracts", - "version": "v3.4.1", + "version": "v3.6.0", "source": { "type": "git", "url": "https://github.com/symfony/translation-contracts.git", - "reference": "06450585bf65e978026bda220cdebca3f867fde7" + "reference": "df210c7a2573f1913b2d17cc95f90f53a73d8f7d" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/translation-contracts/zipball/06450585bf65e978026bda220cdebca3f867fde7", - "reference": "06450585bf65e978026bda220cdebca3f867fde7", + "url": "https://api.github.com/repos/symfony/translation-contracts/zipball/df210c7a2573f1913b2d17cc95f90f53a73d8f7d", + "reference": "df210c7a2573f1913b2d17cc95f90f53a73d8f7d", "shasum": "" }, "require": { @@ -7695,12 +8158,12 @@ }, "type": "library", "extra": { - "branch-alias": { - "dev-main": "3.4-dev" - }, "thanks": { - "name": "symfony/contracts", - "url": "https://github.com/symfony/contracts" + "url": "https://github.com/symfony/contracts", + "name": "symfony/contracts" + }, + "branch-alias": { + "dev-main": "3.6-dev" } }, "autoload": { @@ -7736,7 +8199,7 @@ "standards" ], "support": { - "source": "https://github.com/symfony/translation-contracts/tree/v3.4.1" + "source": "https://github.com/symfony/translation-contracts/tree/v3.6.0" }, "funding": [ { @@ -7752,20 +8215,99 @@ "type": "tidelift" } ], - "time": "2023-12-26T14:02:43+00:00" + "time": "2024-09-27T08:32:26+00:00" }, { - "name": "symfony/uid", - "version": "v7.0.3", + "name": "symfony/type-info", + "version": "v7.3.1", "source": { "type": "git", - "url": "https://github.com/symfony/uid.git", - "reference": "87cedaf3fabd7b733859d4d77aa4ca598259054b" + "url": "https://github.com/symfony/type-info.git", + "reference": "5fa6e25e4195e73ce9e457b521ac5e61ec271150" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/uid/zipball/87cedaf3fabd7b733859d4d77aa4ca598259054b", - "reference": "87cedaf3fabd7b733859d4d77aa4ca598259054b", + "url": "https://api.github.com/repos/symfony/type-info/zipball/5fa6e25e4195e73ce9e457b521ac5e61ec271150", + "reference": "5fa6e25e4195e73ce9e457b521ac5e61ec271150", + "shasum": "" + }, + "require": { + "php": ">=8.2", + "psr/container": "^1.1|^2.0", + "symfony/deprecation-contracts": "^2.5|^3" + }, + "conflict": { + "phpstan/phpdoc-parser": "<1.30" + }, + "require-dev": { + "phpstan/phpdoc-parser": "^1.30|^2.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Symfony\\Component\\TypeInfo\\": "" + }, + "exclude-from-classmap": [ + "/Tests/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Mathias Arlaud", + "email": "mathias.arlaud@gmail.com" + }, + { + "name": "Baptiste LEDUC", + "email": "baptiste.leduc@gmail.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Extracts PHP types information.", + "homepage": "https://symfony.com", + "keywords": [ + "PHPStan", + "phpdoc", + "symfony", + "type" + ], + "support": { + "source": "https://github.com/symfony/type-info/tree/v7.3.1" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2025-06-27T19:55:54+00:00" + }, + { + "name": "symfony/uid", + "version": "v7.3.1", + "source": { + "type": "git", + "url": "https://github.com/symfony/uid.git", + "reference": "a69f69f3159b852651a6bf45a9fdd149520525bb" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/uid/zipball/a69f69f3159b852651a6bf45a9fdd149520525bb", + "reference": "a69f69f3159b852651a6bf45a9fdd149520525bb", "shasum": "" }, "require": { @@ -7810,7 +8352,7 @@ "uuid" ], "support": { - "source": "https://github.com/symfony/uid/tree/v7.0.3" + "source": "https://github.com/symfony/uid/tree/v7.3.1" }, "funding": [ { @@ -7826,24 +8368,25 @@ "type": "tidelift" } ], - "time": "2024-01-23T15:02:46+00:00" + "time": "2025-06-27T19:55:54+00:00" }, { "name": "symfony/var-dumper", - "version": "v7.0.4", + "version": "v7.3.1", "source": { "type": "git", "url": "https://github.com/symfony/var-dumper.git", - "reference": "e03ad7c1535e623edbb94c22cc42353e488c6670" + "reference": "6e209fbe5f5a7b6043baba46fe5735a4b85d0d42" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/var-dumper/zipball/e03ad7c1535e623edbb94c22cc42353e488c6670", - "reference": "e03ad7c1535e623edbb94c22cc42353e488c6670", + "url": "https://api.github.com/repos/symfony/var-dumper/zipball/6e209fbe5f5a7b6043baba46fe5735a4b85d0d42", + "reference": "6e209fbe5f5a7b6043baba46fe5735a4b85d0d42", "shasum": "" }, "require": { "php": ">=8.2", + "symfony/deprecation-contracts": "^2.5|^3", "symfony/polyfill-mbstring": "~1.0" }, "conflict": { @@ -7855,7 +8398,7 @@ "symfony/http-kernel": "^6.4|^7.0", "symfony/process": "^6.4|^7.0", "symfony/uid": "^6.4|^7.0", - "twig/twig": "^3.0.4" + "twig/twig": "^3.12" }, "bin": [ "Resources/bin/var-dump-server" @@ -7893,7 +8436,7 @@ "dump" ], "support": { - "source": "https://github.com/symfony/var-dumper/tree/v7.0.4" + "source": "https://github.com/symfony/var-dumper/tree/v7.3.1" }, "funding": [ { @@ -7909,35 +8452,37 @@ "type": "tidelift" } ], - "time": "2024-02-15T11:33:06+00:00" + "time": "2025-06-27T19:55:54+00:00" }, { "name": "tijsverkoyen/css-to-inline-styles", - "version": "v2.2.7", + "version": "v2.3.0", "source": { "type": "git", "url": "https://github.com/tijsverkoyen/CssToInlineStyles.git", - "reference": "83ee6f38df0a63106a9e4536e3060458b74ccedb" + "reference": "0d72ac1c00084279c1816675284073c5a337c20d" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/tijsverkoyen/CssToInlineStyles/zipball/83ee6f38df0a63106a9e4536e3060458b74ccedb", - "reference": "83ee6f38df0a63106a9e4536e3060458b74ccedb", + "url": "https://api.github.com/repos/tijsverkoyen/CssToInlineStyles/zipball/0d72ac1c00084279c1816675284073c5a337c20d", + "reference": "0d72ac1c00084279c1816675284073c5a337c20d", "shasum": "" }, "require": { "ext-dom": "*", "ext-libxml": "*", - "php": "^5.5 || ^7.0 || ^8.0", - "symfony/css-selector": "^2.7 || ^3.0 || ^4.0 || ^5.0 || ^6.0 || ^7.0" + "php": "^7.4 || ^8.0", + "symfony/css-selector": "^5.4 || ^6.0 || ^7.0" }, "require-dev": { - "phpunit/phpunit": "^4.8.35 || ^5.7 || ^6.0 || ^7.5 || ^8.5.21 || ^9.5.10" + "phpstan/phpstan": "^2.0", + "phpstan/phpstan-phpunit": "^2.0", + "phpunit/phpunit": "^8.5.21 || ^9.5.10" }, "type": "library", "extra": { "branch-alias": { - "dev-master": "2.2.x-dev" + "dev-master": "2.x-dev" } }, "autoload": { @@ -7960,29 +8505,29 @@ "homepage": "https://github.com/tijsverkoyen/CssToInlineStyles", "support": { "issues": "https://github.com/tijsverkoyen/CssToInlineStyles/issues", - "source": "https://github.com/tijsverkoyen/CssToInlineStyles/tree/v2.2.7" + "source": "https://github.com/tijsverkoyen/CssToInlineStyles/tree/v2.3.0" }, - "time": "2023-12-08T13:03:43+00:00" + "time": "2024-12-21T16:25:41+00:00" }, { "name": "vlucas/phpdotenv", - "version": "v5.6.0", + "version": "v5.6.2", "source": { "type": "git", "url": "https://github.com/vlucas/phpdotenv.git", - "reference": "2cf9fb6054c2bb1d59d1f3817706ecdb9d2934c4" + "reference": "24ac4c74f91ee2c193fa1aaa5c249cb0822809af" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/vlucas/phpdotenv/zipball/2cf9fb6054c2bb1d59d1f3817706ecdb9d2934c4", - "reference": "2cf9fb6054c2bb1d59d1f3817706ecdb9d2934c4", + "url": "https://api.github.com/repos/vlucas/phpdotenv/zipball/24ac4c74f91ee2c193fa1aaa5c249cb0822809af", + "reference": "24ac4c74f91ee2c193fa1aaa5c249cb0822809af", "shasum": "" }, "require": { "ext-pcre": "*", - "graham-campbell/result-type": "^1.1.2", + "graham-campbell/result-type": "^1.1.3", "php": "^7.2.5 || ^8.0", - "phpoption/phpoption": "^1.9.2", + "phpoption/phpoption": "^1.9.3", "symfony/polyfill-ctype": "^1.24", "symfony/polyfill-mbstring": "^1.24", "symfony/polyfill-php80": "^1.24" @@ -7999,7 +8544,7 @@ "extra": { "bamarni-bin": { "bin-links": true, - "forward-command": true + "forward-command": false }, "branch-alias": { "dev-master": "5.6-dev" @@ -8034,7 +8579,7 @@ ], "support": { "issues": "https://github.com/vlucas/phpdotenv/issues", - "source": "https://github.com/vlucas/phpdotenv/tree/v5.6.0" + "source": "https://github.com/vlucas/phpdotenv/tree/v5.6.2" }, "funding": [ { @@ -8046,20 +8591,20 @@ "type": "tidelift" } ], - "time": "2023-11-12T22:43:29+00:00" + "time": "2025-04-30T23:37:27+00:00" }, { "name": "voku/portable-ascii", - "version": "2.0.1", + "version": "2.0.3", "source": { "type": "git", "url": "https://github.com/voku/portable-ascii.git", - "reference": "b56450eed252f6801410d810c8e1727224ae0743" + "reference": "b1d923f88091c6bf09699efcd7c8a1b1bfd7351d" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/voku/portable-ascii/zipball/b56450eed252f6801410d810c8e1727224ae0743", - "reference": "b56450eed252f6801410d810c8e1727224ae0743", + "url": "https://api.github.com/repos/voku/portable-ascii/zipball/b1d923f88091c6bf09699efcd7c8a1b1bfd7351d", + "reference": "b1d923f88091c6bf09699efcd7c8a1b1bfd7351d", "shasum": "" }, "require": { @@ -8084,7 +8629,7 @@ "authors": [ { "name": "Lars Moelleken", - "homepage": "http://www.moelleken.org/" + "homepage": "https://www.moelleken.org/" } ], "description": "Portable ASCII library - performance optimized (ascii) string functions for php.", @@ -8096,7 +8641,7 @@ ], "support": { "issues": "https://github.com/voku/portable-ascii/issues", - "source": "https://github.com/voku/portable-ascii/tree/2.0.1" + "source": "https://github.com/voku/portable-ascii/tree/2.0.3" }, "funding": [ { @@ -8120,42 +8665,41 @@ "type": "tidelift" } ], - "time": "2022-03-08T17:03:00+00:00" + "time": "2024-11-21T01:49:47+00:00" }, { "name": "web-auth/cose-lib", - "version": "4.3.0", + "version": "4.4.1", "source": { "type": "git", "url": "https://github.com/web-auth/cose-lib.git", - "reference": "e5c417b3b90e06c84638a18d350e438d760cb955" + "reference": "b095f160a8c8fa7e53d0e36307093e34c26e7787" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/web-auth/cose-lib/zipball/e5c417b3b90e06c84638a18d350e438d760cb955", - "reference": "e5c417b3b90e06c84638a18d350e438d760cb955", + "url": "https://api.github.com/repos/web-auth/cose-lib/zipball/b095f160a8c8fa7e53d0e36307093e34c26e7787", + "reference": "b095f160a8c8fa7e53d0e36307093e34c26e7787", "shasum": "" }, "require": { - "brick/math": "^0.9|^0.10|^0.11|^0.12", + "brick/math": "^0.9|^0.10|^0.11|^0.12|^0.13", "ext-json": "*", - "ext-mbstring": "*", "ext-openssl": "*", "php": ">=8.1", "spomky-labs/pki-framework": "^1.0" }, "require-dev": { - "ekino/phpstan-banned-code": "^1.0", - "infection/infection": "^0.27", + "deptrac/deptrac": "^3.0", + "ekino/phpstan-banned-code": "^1.0|^2.0|^3.0", + "infection/infection": "^0.29", "php-parallel-lint/php-parallel-lint": "^1.3", "phpstan/extension-installer": "^1.3", - "phpstan/phpstan": "^1.7", - "phpstan/phpstan-deprecation-rules": "^1.0", - "phpstan/phpstan-phpunit": "^1.1", - "phpstan/phpstan-strict-rules": "^1.2", - "phpunit/phpunit": "^10.1", - "qossmic/deptrac-shim": "^1.0", - "rector/rector": "^0.19", + "phpstan/phpstan": "^1.7|^2.0", + "phpstan/phpstan-deprecation-rules": "^1.0|^2.0", + "phpstan/phpstan-phpunit": "^1.1|^2.0", + "phpstan/phpstan-strict-rules": "^1.0|^2.0", + "phpunit/phpunit": "^10.1|^11.0|^12.0", + "rector/rector": "^2.0", "symfony/phpunit-bridge": "^6.4|^7.0", "symplify/easy-coding-standard": "^12.0" }, @@ -8191,7 +8735,7 @@ ], "support": { "issues": "https://github.com/web-auth/cose-lib/issues", - "source": "https://github.com/web-auth/cose-lib/tree/4.3.0" + "source": "https://github.com/web-auth/cose-lib/tree/4.4.1" }, "funding": [ { @@ -8203,135 +8747,51 @@ "type": "patreon" } ], - "time": "2024-02-05T21:00:39+00:00" + "time": "2025-06-13T11:35:45+00:00" }, { - "name": "web-auth/metadata-service", - "version": "4.8.2", + "name": "web-auth/webauthn-lib", + "version": "5.2.2", "source": { "type": "git", - "url": "https://github.com/web-auth/webauthn-metadata-service.git", - "reference": "024df5fb26166adf388dea697d2826ae5a6001cf" + "url": "https://github.com/web-auth/webauthn-lib.git", + "reference": "8937c397c8ae91b5af422ca8aa915c756062da74" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/web-auth/webauthn-metadata-service/zipball/024df5fb26166adf388dea697d2826ae5a6001cf", - "reference": "024df5fb26166adf388dea697d2826ae5a6001cf", + "url": "https://api.github.com/repos/web-auth/webauthn-lib/zipball/8937c397c8ae91b5af422ca8aa915c756062da74", + "reference": "8937c397c8ae91b5af422ca8aa915c756062da74", "shasum": "" }, "require": { "ext-json": "*", - "lcobucci/clock": "^2.2|^3.0", - "paragonie/constant_time_encoding": "^2.6", - "php": ">=8.1", + "ext-openssl": "*", + "paragonie/constant_time_encoding": "^2.6|^3.0", + "php": ">=8.2", + "phpdocumentor/reflection-docblock": "^5.3", "psr/clock": "^1.0", "psr/event-dispatcher": "^1.0", - "psr/http-client": "^1.0", - "psr/http-factory": "^1.0", "psr/log": "^1.0|^2.0|^3.0", + "spomky-labs/cbor-php": "^3.0", "spomky-labs/pki-framework": "^1.0", - "symfony/deprecation-contracts": "^3.2" + "symfony/clock": "^6.4|^7.0", + "symfony/deprecation-contracts": "^3.2", + "symfony/property-access": "^6.4|^7.0", + "symfony/property-info": "^6.4|^7.0", + "symfony/serializer": "^6.4|^7.0", + "symfony/uid": "^6.4|^7.0", + "web-auth/cose-lib": "^4.2.3" }, "suggest": { - "phpdocumentor/reflection-docblock": "As of 4.5.x, the phpdocumentor/reflection-docblock component will become mandatory for converting objects such as the Metadata Statement", - "psr/clock-implementation": "As of 4.5.x, the PSR Clock implementation will replace lcobucci/clock", "psr/log-implementation": "Recommended to receive logs from the library", - "symfony/property-access": "As of 4.5.x, the symfony/serializer component will become mandatory for converting objects such as the Metadata Statement", - "symfony/property-info": "As of 4.5.x, the symfony/serializer component will become mandatory for converting objects such as the Metadata Statement", - "symfony/serializer": "As of 4.5.x, the symfony/serializer component will become mandatory for converting objects such as the Metadata Statement", + "symfony/event-dispatcher": "Recommended to use dispatched events", "web-token/jwt-library": "Mandatory for fetching Metadata Statement from distant sources" }, "type": "library", "extra": { "thanks": { - "name": "web-auth/webauthn-framework", - "url": "https://github.com/web-auth/webauthn-framework" - } - }, - "autoload": { - "psr-4": { - "Webauthn\\MetadataService\\": "src/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Florent Morselli", - "homepage": "https://github.com/Spomky" - }, - { - "name": "All contributors", - "homepage": "https://github.com/web-auth/metadata-service/contributors" - } - ], - "description": "Metadata Service for FIDO2/Webauthn", - "homepage": "https://github.com/web-auth", - "keywords": [ - "FIDO2", - "fido", - "webauthn" - ], - "support": { - "source": "https://github.com/web-auth/webauthn-metadata-service/tree/4.8.2" - }, - "funding": [ - { - "url": "https://github.com/Spomky", - "type": "github" - }, - { - "url": "https://www.patreon.com/FlorentMorselli", - "type": "patreon" - } - ], - "time": "2024-02-26T07:58:15+00:00" - }, - { - "name": "web-auth/webauthn-lib", - "version": "4.8.2", - "source": { - "type": "git", - "url": "https://github.com/web-auth/webauthn-lib.git", - "reference": "abac08104bbbbdef01ace704c90ff8290696e47f" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/web-auth/webauthn-lib/zipball/abac08104bbbbdef01ace704c90ff8290696e47f", - "reference": "abac08104bbbbdef01ace704c90ff8290696e47f", - "shasum": "" - }, - "require": { - "ext-json": "*", - "ext-mbstring": "*", - "ext-openssl": "*", - "paragonie/constant_time_encoding": "^2.6", - "php": ">=8.1", - "psr/event-dispatcher": "^1.0", - "psr/http-client": "^1.0", - "psr/http-factory": "^1.0", - "psr/log": "^1.0|^2.0|^3.0", - "spomky-labs/cbor-php": "^3.0", - "symfony/uid": "^6.1|^7.0", - "web-auth/cose-lib": "^4.2.3", - "web-auth/metadata-service": "self.version" - }, - "suggest": { - "phpdocumentor/reflection-docblock": "As of 4.5.x, the phpdocumentor/reflection-docblock component will become mandatory for converting objects such as the Metadata Statement", - "psr/log-implementation": "Recommended to receive logs from the library", - "symfony/event-dispatcher": "Recommended to use dispatched events", - "symfony/property-access": "As of 4.5.x, the symfony/serializer component will become mandatory for converting objects such as the Metadata Statement", - "symfony/property-info": "As of 4.5.x, the symfony/serializer component will become mandatory for converting objects such as the Metadata Statement", - "symfony/serializer": "As of 4.5.x, the symfony/serializer component will become mandatory for converting objects such as the Metadata Statement", - "web-token/jwt-library": "Mandatory for the AndroidSafetyNet Attestation Statement support" - }, - "type": "library", - "extra": { - "thanks": { - "name": "web-auth/webauthn-framework", - "url": "https://github.com/web-auth/webauthn-framework" + "url": "https://github.com/web-auth/webauthn-framework", + "name": "web-auth/webauthn-framework" } }, "autoload": { @@ -8361,7 +8821,7 @@ "webauthn" ], "support": { - "source": "https://github.com/web-auth/webauthn-lib/tree/4.8.2" + "source": "https://github.com/web-auth/webauthn-lib/tree/5.2.2" }, "funding": [ { @@ -8373,7 +8833,7 @@ "type": "patreon" } ], - "time": "2024-02-26T19:17:26+00:00" + "time": "2025-03-16T14:38:43+00:00" }, { "name": "webmozart/assert", @@ -8435,212 +8895,46 @@ } ], "packages-dev": [ - { - "name": "amphp/amp", - "version": "v2.6.2", - "source": { - "type": "git", - "url": "https://github.com/amphp/amp.git", - "reference": "9d5100cebffa729aaffecd3ad25dc5aeea4f13bb" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/amphp/amp/zipball/9d5100cebffa729aaffecd3ad25dc5aeea4f13bb", - "reference": "9d5100cebffa729aaffecd3ad25dc5aeea4f13bb", - "shasum": "" - }, - "require": { - "php": ">=7.1" - }, - "require-dev": { - "amphp/php-cs-fixer-config": "dev-master", - "amphp/phpunit-util": "^1", - "ext-json": "*", - "jetbrains/phpstorm-stubs": "^2019.3", - "phpunit/phpunit": "^7 | ^8 | ^9", - "psalm/phar": "^3.11@dev", - "react/promise": "^2" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-master": "2.x-dev" - } - }, - "autoload": { - "files": [ - "lib/functions.php", - "lib/Internal/functions.php" - ], - "psr-4": { - "Amp\\": "lib" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Daniel Lowrey", - "email": "rdlowrey@php.net" - }, - { - "name": "Aaron Piotrowski", - "email": "aaron@trowski.com" - }, - { - "name": "Bob Weinand", - "email": "bobwei9@hotmail.com" - }, - { - "name": "Niklas Keller", - "email": "me@kelunik.com" - } - ], - "description": "A non-blocking concurrency framework for PHP applications.", - "homepage": "https://amphp.org/amp", - "keywords": [ - "async", - "asynchronous", - "awaitable", - "concurrency", - "event", - "event-loop", - "future", - "non-blocking", - "promise" - ], - "support": { - "irc": "irc://irc.freenode.org/amphp", - "issues": "https://github.com/amphp/amp/issues", - "source": "https://github.com/amphp/amp/tree/v2.6.2" - }, - "funding": [ - { - "url": "https://github.com/amphp", - "type": "github" - } - ], - "time": "2022-02-20T17:52:18+00:00" - }, - { - "name": "amphp/byte-stream", - "version": "v1.8.1", - "source": { - "type": "git", - "url": "https://github.com/amphp/byte-stream.git", - "reference": "acbd8002b3536485c997c4e019206b3f10ca15bd" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/amphp/byte-stream/zipball/acbd8002b3536485c997c4e019206b3f10ca15bd", - "reference": "acbd8002b3536485c997c4e019206b3f10ca15bd", - "shasum": "" - }, - "require": { - "amphp/amp": "^2", - "php": ">=7.1" - }, - "require-dev": { - "amphp/php-cs-fixer-config": "dev-master", - "amphp/phpunit-util": "^1.4", - "friendsofphp/php-cs-fixer": "^2.3", - "jetbrains/phpstorm-stubs": "^2019.3", - "phpunit/phpunit": "^6 || ^7 || ^8", - "psalm/phar": "^3.11.4" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-master": "1.x-dev" - } - }, - "autoload": { - "files": [ - "lib/functions.php" - ], - "psr-4": { - "Amp\\ByteStream\\": "lib" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Aaron Piotrowski", - "email": "aaron@trowski.com" - }, - { - "name": "Niklas Keller", - "email": "me@kelunik.com" - } - ], - "description": "A stream abstraction to make working with non-blocking I/O simple.", - "homepage": "http://amphp.org/byte-stream", - "keywords": [ - "amp", - "amphp", - "async", - "io", - "non-blocking", - "stream" - ], - "support": { - "irc": "irc://irc.freenode.org/amphp", - "issues": "https://github.com/amphp/byte-stream/issues", - "source": "https://github.com/amphp/byte-stream/tree/v1.8.1" - }, - "funding": [ - { - "url": "https://github.com/amphp", - "type": "github" - } - ], - "time": "2021-03-30T17:13:30+00:00" - }, { "name": "barryvdh/laravel-debugbar", - "version": "v3.12.2", + "version": "v3.15.4", "source": { "type": "git", "url": "https://github.com/barryvdh/laravel-debugbar.git", - "reference": "43555503052443964ce2c1c1f3b0378e58219eb8" + "reference": "c0667ea91f7185f1e074402c5788195e96bf8106" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/barryvdh/laravel-debugbar/zipball/43555503052443964ce2c1c1f3b0378e58219eb8", - "reference": "43555503052443964ce2c1c1f3b0378e58219eb8", + "url": "https://api.github.com/repos/barryvdh/laravel-debugbar/zipball/c0667ea91f7185f1e074402c5788195e96bf8106", + "reference": "c0667ea91f7185f1e074402c5788195e96bf8106", "shasum": "" }, "require": { - "illuminate/routing": "^9|^10|^11", - "illuminate/session": "^9|^10|^11", - "illuminate/support": "^9|^10|^11", - "maximebf/debugbar": "~1.21.0", - "php": "^8.0", + "illuminate/routing": "^9|^10|^11|^12", + "illuminate/session": "^9|^10|^11|^12", + "illuminate/support": "^9|^10|^11|^12", + "php": "^8.1", + "php-debugbar/php-debugbar": "~2.1.1", "symfony/finder": "^6|^7" }, "require-dev": { "mockery/mockery": "^1.3.3", - "orchestra/testbench-dusk": "^5|^6|^7|^8|^9", - "phpunit/phpunit": "^9.6|^10.5", + "orchestra/testbench-dusk": "^7|^8|^9|^10", + "phpunit/phpunit": "^9.5.10|^10|^11", "squizlabs/php_codesniffer": "^3.5" }, "type": "library", "extra": { - "branch-alias": { - "dev-master": "3.10-dev" - }, "laravel": { - "providers": [ - "Barryvdh\\Debugbar\\ServiceProvider" - ], "aliases": { "Debugbar": "Barryvdh\\Debugbar\\Facades\\Debugbar" - } + }, + "providers": [ + "Barryvdh\\Debugbar\\ServiceProvider" + ] + }, + "branch-alias": { + "dev-master": "3.15-dev" } }, "autoload": { @@ -8665,13 +8959,14 @@ "keywords": [ "debug", "debugbar", + "dev", "laravel", "profiler", "webprofiler" ], "support": { "issues": "https://github.com/barryvdh/laravel-debugbar/issues", - "source": "https://github.com/barryvdh/laravel-debugbar/tree/v3.12.2" + "source": "https://github.com/barryvdh/laravel-debugbar/tree/v3.15.4" }, "funding": [ { @@ -8683,57 +8978,56 @@ "type": "github" } ], - "time": "2024-03-13T09:50:34+00:00" + "time": "2025-04-16T06:32:06+00:00" }, { "name": "barryvdh/laravel-ide-helper", - "version": "v3.0.0", + "version": "v3.5.5", "source": { "type": "git", "url": "https://github.com/barryvdh/laravel-ide-helper.git", - "reference": "bc1d67f01ce8c77e3f97d48ba51fa1d81874f622" + "reference": "8d441ec99f8612b942b55f5183151d91591b618a" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/barryvdh/laravel-ide-helper/zipball/bc1d67f01ce8c77e3f97d48ba51fa1d81874f622", - "reference": "bc1d67f01ce8c77e3f97d48ba51fa1d81874f622", + "url": "https://api.github.com/repos/barryvdh/laravel-ide-helper/zipball/8d441ec99f8612b942b55f5183151d91591b618a", + "reference": "8d441ec99f8612b942b55f5183151d91591b618a", "shasum": "" }, "require": { - "barryvdh/reflection-docblock": "^2.1.1", + "barryvdh/reflection-docblock": "^2.3", "composer/class-map-generator": "^1.0", "ext-json": "*", - "illuminate/console": "^10 || ^11", - "illuminate/database": "^10.38 || ^11", - "illuminate/filesystem": "^10 || ^11", - "illuminate/support": "^10 || ^11", - "nikic/php-parser": "^4.18 || ^5", - "php": "^8.1", - "phpdocumentor/type-resolver": "^1.1.0" + "illuminate/console": "^11.15 || ^12", + "illuminate/database": "^11.15 || ^12", + "illuminate/filesystem": "^11.15 || ^12", + "illuminate/support": "^11.15 || ^12", + "php": "^8.2" }, "require-dev": { "ext-pdo_sqlite": "*", "friendsofphp/php-cs-fixer": "^3", - "illuminate/config": "^9 || ^10 || ^11", - "illuminate/view": "^9 || ^10 || ^11", + "illuminate/config": "^11.15 || ^12", + "illuminate/view": "^11.15 || ^12", "mockery/mockery": "^1.4", - "orchestra/testbench": "^8 || ^9", - "phpunit/phpunit": "^10.5", + "orchestra/testbench": "^9.2 || ^10", + "phpunit/phpunit": "^10.5 || ^11.5.3", "spatie/phpunit-snapshot-assertions": "^4 || ^5", - "vimeo/psalm": "^5.4" + "vimeo/psalm": "^5.4", + "vlucas/phpdotenv": "^5" }, "suggest": { "illuminate/events": "Required for automatic helper generation (^6|^7|^8|^9|^10|^11)." }, "type": "library", "extra": { - "branch-alias": { - "dev-master": "3.0-dev" - }, "laravel": { "providers": [ "Barryvdh\\LaravelIdeHelper\\IdeHelperServiceProvider" ] + }, + "branch-alias": { + "dev-master": "3.5-dev" } }, "autoload": { @@ -8755,6 +9049,7 @@ "keywords": [ "autocomplete", "codeintel", + "dev", "helper", "ide", "laravel", @@ -8765,7 +9060,7 @@ ], "support": { "issues": "https://github.com/barryvdh/laravel-ide-helper/issues", - "source": "https://github.com/barryvdh/laravel-ide-helper/tree/v3.0.0" + "source": "https://github.com/barryvdh/laravel-ide-helper/tree/v3.5.5" }, "funding": [ { @@ -8777,24 +9072,24 @@ "type": "github" } ], - "time": "2024-03-01T12:53:18+00:00" + "time": "2025-02-11T13:59:46+00:00" }, { "name": "barryvdh/reflection-docblock", - "version": "v2.1.1", + "version": "v2.3.1", "source": { "type": "git", "url": "https://github.com/barryvdh/ReflectionDocBlock.git", - "reference": "e6811e927f0ecc37cc4deaa6627033150343e597" + "reference": "b6ff9f93603561f50e53b64310495d20b8dff5d8" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/barryvdh/ReflectionDocBlock/zipball/e6811e927f0ecc37cc4deaa6627033150343e597", - "reference": "e6811e927f0ecc37cc4deaa6627033150343e597", + "url": "https://api.github.com/repos/barryvdh/ReflectionDocBlock/zipball/b6ff9f93603561f50e53b64310495d20b8dff5d8", + "reference": "b6ff9f93603561f50e53b64310495d20b8dff5d8", "shasum": "" }, "require": { - "php": ">=5.3.3" + "php": ">=7.1" }, "require-dev": { "phpunit/phpunit": "^8.5.14|^9" @@ -8806,7 +9101,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-master": "2.0.x-dev" + "dev-master": "2.3.x-dev" } }, "autoload": { @@ -8827,22 +9122,22 @@ } ], "support": { - "source": "https://github.com/barryvdh/ReflectionDocBlock/tree/v2.1.1" + "source": "https://github.com/barryvdh/ReflectionDocBlock/tree/v2.3.1" }, - "time": "2023-06-14T05:06:27+00:00" + "time": "2025-01-18T19:26:32+00:00" }, { "name": "composer/class-map-generator", - "version": "1.1.1", + "version": "1.6.1", "source": { "type": "git", "url": "https://github.com/composer/class-map-generator.git", - "reference": "8286a62d243312ed99b3eee20d5005c961adb311" + "reference": "134b705ddb0025d397d8318a75825fe3c9d1da34" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/composer/class-map-generator/zipball/8286a62d243312ed99b3eee20d5005c961adb311", - "reference": "8286a62d243312ed99b3eee20d5005c961adb311", + "url": "https://api.github.com/repos/composer/class-map-generator/zipball/134b705ddb0025d397d8318a75825fe3c9d1da34", + "reference": "134b705ddb0025d397d8318a75825fe3c9d1da34", "shasum": "" }, "require": { @@ -8851,12 +9146,12 @@ "symfony/finder": "^4.4 || ^5.3 || ^6 || ^7" }, "require-dev": { - "phpstan/phpstan": "^1.6", - "phpstan/phpstan-deprecation-rules": "^1", - "phpstan/phpstan-phpunit": "^1", - "phpstan/phpstan-strict-rules": "^1.1", - "symfony/filesystem": "^5.4 || ^6", - "symfony/phpunit-bridge": "^5" + "phpstan/phpstan": "^1.12 || ^2", + "phpstan/phpstan-deprecation-rules": "^1 || ^2", + "phpstan/phpstan-phpunit": "^1 || ^2", + "phpstan/phpstan-strict-rules": "^1.1 || ^2", + "phpunit/phpunit": "^8", + "symfony/filesystem": "^5.4 || ^6" }, "type": "library", "extra": { @@ -8886,7 +9181,7 @@ ], "support": { "issues": "https://github.com/composer/class-map-generator/issues", - "source": "https://github.com/composer/class-map-generator/tree/1.1.1" + "source": "https://github.com/composer/class-map-generator/tree/1.6.1" }, "funding": [ { @@ -8902,32 +9197,40 @@ "type": "tidelift" } ], - "time": "2024-03-15T12:53:41+00:00" + "time": "2025-03-24T13:50:44+00:00" }, { "name": "composer/pcre", - "version": "3.1.3", + "version": "3.3.2", "source": { "type": "git", "url": "https://github.com/composer/pcre.git", - "reference": "5b16e25a5355f1f3afdfc2f954a0a80aec4826a8" + "reference": "b2bed4734f0cc156ee1fe9c0da2550420d99a21e" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/composer/pcre/zipball/5b16e25a5355f1f3afdfc2f954a0a80aec4826a8", - "reference": "5b16e25a5355f1f3afdfc2f954a0a80aec4826a8", + "url": "https://api.github.com/repos/composer/pcre/zipball/b2bed4734f0cc156ee1fe9c0da2550420d99a21e", + "reference": "b2bed4734f0cc156ee1fe9c0da2550420d99a21e", "shasum": "" }, "require": { "php": "^7.4 || ^8.0" }, + "conflict": { + "phpstan/phpstan": "<1.11.10" + }, "require-dev": { - "phpstan/phpstan": "^1.3", - "phpstan/phpstan-strict-rules": "^1.1", - "symfony/phpunit-bridge": "^5" + "phpstan/phpstan": "^1.12 || ^2", + "phpstan/phpstan-strict-rules": "^1 || ^2", + "phpunit/phpunit": "^8 || ^9" }, "type": "library", "extra": { + "phpstan": { + "includes": [ + "extension.neon" + ] + }, "branch-alias": { "dev-main": "3.x-dev" } @@ -8957,7 +9260,7 @@ ], "support": { "issues": "https://github.com/composer/pcre/issues", - "source": "https://github.com/composer/pcre/tree/3.1.3" + "source": "https://github.com/composer/pcre/tree/3.3.2" }, "funding": [ { @@ -8973,251 +9276,20 @@ "type": "tidelift" } ], - "time": "2024-03-19T10:26:25+00:00" - }, - { - "name": "composer/semver", - "version": "3.4.0", - "source": { - "type": "git", - "url": "https://github.com/composer/semver.git", - "reference": "35e8d0af4486141bc745f23a29cc2091eb624a32" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/composer/semver/zipball/35e8d0af4486141bc745f23a29cc2091eb624a32", - "reference": "35e8d0af4486141bc745f23a29cc2091eb624a32", - "shasum": "" - }, - "require": { - "php": "^5.3.2 || ^7.0 || ^8.0" - }, - "require-dev": { - "phpstan/phpstan": "^1.4", - "symfony/phpunit-bridge": "^4.2 || ^5" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-main": "3.x-dev" - } - }, - "autoload": { - "psr-4": { - "Composer\\Semver\\": "src" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Nils Adermann", - "email": "naderman@naderman.de", - "homepage": "http://www.naderman.de" - }, - { - "name": "Jordi Boggiano", - "email": "j.boggiano@seld.be", - "homepage": "http://seld.be" - }, - { - "name": "Rob Bast", - "email": "rob.bast@gmail.com", - "homepage": "http://robbast.nl" - } - ], - "description": "Semver library that offers utilities, version constraint parsing and validation.", - "keywords": [ - "semantic", - "semver", - "validation", - "versioning" - ], - "support": { - "irc": "ircs://irc.libera.chat:6697/composer", - "issues": "https://github.com/composer/semver/issues", - "source": "https://github.com/composer/semver/tree/3.4.0" - }, - "funding": [ - { - "url": "https://packagist.com", - "type": "custom" - }, - { - "url": "https://github.com/composer", - "type": "github" - }, - { - "url": "https://tidelift.com/funding/github/packagist/composer/composer", - "type": "tidelift" - } - ], - "time": "2023-08-31T09:50:34+00:00" - }, - { - "name": "composer/xdebug-handler", - "version": "3.0.3", - "source": { - "type": "git", - "url": "https://github.com/composer/xdebug-handler.git", - "reference": "ced299686f41dce890debac69273b47ffe98a40c" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/composer/xdebug-handler/zipball/ced299686f41dce890debac69273b47ffe98a40c", - "reference": "ced299686f41dce890debac69273b47ffe98a40c", - "shasum": "" - }, - "require": { - "composer/pcre": "^1 || ^2 || ^3", - "php": "^7.2.5 || ^8.0", - "psr/log": "^1 || ^2 || ^3" - }, - "require-dev": { - "phpstan/phpstan": "^1.0", - "phpstan/phpstan-strict-rules": "^1.1", - "symfony/phpunit-bridge": "^6.0" - }, - "type": "library", - "autoload": { - "psr-4": { - "Composer\\XdebugHandler\\": "src" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "John Stevenson", - "email": "john-stevenson@blueyonder.co.uk" - } - ], - "description": "Restarts a process without Xdebug.", - "keywords": [ - "Xdebug", - "performance" - ], - "support": { - "irc": "irc://irc.freenode.org/composer", - "issues": "https://github.com/composer/xdebug-handler/issues", - "source": "https://github.com/composer/xdebug-handler/tree/3.0.3" - }, - "funding": [ - { - "url": "https://packagist.com", - "type": "custom" - }, - { - "url": "https://github.com/composer", - "type": "github" - }, - { - "url": "https://tidelift.com/funding/github/packagist/composer/composer", - "type": "tidelift" - } - ], - "time": "2022-02-25T21:32:43+00:00" - }, - { - "name": "dnoegel/php-xdg-base-dir", - "version": "v0.1.1", - "source": { - "type": "git", - "url": "https://github.com/dnoegel/php-xdg-base-dir.git", - "reference": "8f8a6e48c5ecb0f991c2fdcf5f154a47d85f9ffd" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/dnoegel/php-xdg-base-dir/zipball/8f8a6e48c5ecb0f991c2fdcf5f154a47d85f9ffd", - "reference": "8f8a6e48c5ecb0f991c2fdcf5f154a47d85f9ffd", - "shasum": "" - }, - "require": { - "php": ">=5.3.2" - }, - "require-dev": { - "phpunit/phpunit": "~7.0|~6.0|~5.0|~4.8.35" - }, - "type": "library", - "autoload": { - "psr-4": { - "XdgBaseDir\\": "src/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "description": "implementation of xdg base directory specification for php", - "support": { - "issues": "https://github.com/dnoegel/php-xdg-base-dir/issues", - "source": "https://github.com/dnoegel/php-xdg-base-dir/tree/v0.1.1" - }, - "time": "2019-12-04T15:06:13+00:00" - }, - { - "name": "doctrine/deprecations", - "version": "1.1.3", - "source": { - "type": "git", - "url": "https://github.com/doctrine/deprecations.git", - "reference": "dfbaa3c2d2e9a9df1118213f3b8b0c597bb99fab" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/doctrine/deprecations/zipball/dfbaa3c2d2e9a9df1118213f3b8b0c597bb99fab", - "reference": "dfbaa3c2d2e9a9df1118213f3b8b0c597bb99fab", - "shasum": "" - }, - "require": { - "php": "^7.1 || ^8.0" - }, - "require-dev": { - "doctrine/coding-standard": "^9", - "phpstan/phpstan": "1.4.10 || 1.10.15", - "phpstan/phpstan-phpunit": "^1.0", - "phpunit/phpunit": "^7.5 || ^8.5 || ^9.5", - "psalm/plugin-phpunit": "0.18.4", - "psr/log": "^1 || ^2 || ^3", - "vimeo/psalm": "4.30.0 || 5.12.0" - }, - "suggest": { - "psr/log": "Allows logging deprecations via PSR-3 logger implementation" - }, - "type": "library", - "autoload": { - "psr-4": { - "Doctrine\\Deprecations\\": "lib/Doctrine/Deprecations" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "description": "A small layer on top of trigger_error(E_USER_DEPRECATED) or PSR-3 logging with options to disable all deprecations or selectively for packages.", - "homepage": "https://www.doctrine-project.org/", - "support": { - "issues": "https://github.com/doctrine/deprecations/issues", - "source": "https://github.com/doctrine/deprecations/tree/1.1.3" - }, - "time": "2024-01-30T19:34:25+00:00" + "time": "2024-11-12T16:29:46+00:00" }, { "name": "fakerphp/faker", - "version": "v1.23.1", + "version": "v1.24.1", "source": { "type": "git", "url": "https://github.com/FakerPHP/Faker.git", - "reference": "bfb4fe148adbf78eff521199619b93a52ae3554b" + "reference": "e0ee18eb1e6dc3cda3ce9fd97e5a0689a88a64b5" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/FakerPHP/Faker/zipball/bfb4fe148adbf78eff521199619b93a52ae3554b", - "reference": "bfb4fe148adbf78eff521199619b93a52ae3554b", + "url": "https://api.github.com/repos/FakerPHP/Faker/zipball/e0ee18eb1e6dc3cda3ce9fd97e5a0689a88a64b5", + "reference": "e0ee18eb1e6dc3cda3ce9fd97e5a0689a88a64b5", "shasum": "" }, "require": { @@ -9265,194 +9337,32 @@ ], "support": { "issues": "https://github.com/FakerPHP/Faker/issues", - "source": "https://github.com/FakerPHP/Faker/tree/v1.23.1" + "source": "https://github.com/FakerPHP/Faker/tree/v1.24.1" }, - "time": "2024-01-02T13:46:09+00:00" - }, - { - "name": "felixfbecker/advanced-json-rpc", - "version": "v3.2.1", - "source": { - "type": "git", - "url": "https://github.com/felixfbecker/php-advanced-json-rpc.git", - "reference": "b5f37dbff9a8ad360ca341f3240dc1c168b45447" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/felixfbecker/php-advanced-json-rpc/zipball/b5f37dbff9a8ad360ca341f3240dc1c168b45447", - "reference": "b5f37dbff9a8ad360ca341f3240dc1c168b45447", - "shasum": "" - }, - "require": { - "netresearch/jsonmapper": "^1.0 || ^2.0 || ^3.0 || ^4.0", - "php": "^7.1 || ^8.0", - "phpdocumentor/reflection-docblock": "^4.3.4 || ^5.0.0" - }, - "require-dev": { - "phpunit/phpunit": "^7.0 || ^8.0" - }, - "type": "library", - "autoload": { - "psr-4": { - "AdvancedJsonRpc\\": "lib/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "ISC" - ], - "authors": [ - { - "name": "Felix Becker", - "email": "felix.b@outlook.com" - } - ], - "description": "A more advanced JSONRPC implementation", - "support": { - "issues": "https://github.com/felixfbecker/php-advanced-json-rpc/issues", - "source": "https://github.com/felixfbecker/php-advanced-json-rpc/tree/v3.2.1" - }, - "time": "2021-06-11T22:34:44+00:00" - }, - { - "name": "felixfbecker/language-server-protocol", - "version": "v1.5.2", - "source": { - "type": "git", - "url": "https://github.com/felixfbecker/php-language-server-protocol.git", - "reference": "6e82196ffd7c62f7794d778ca52b69feec9f2842" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/felixfbecker/php-language-server-protocol/zipball/6e82196ffd7c62f7794d778ca52b69feec9f2842", - "reference": "6e82196ffd7c62f7794d778ca52b69feec9f2842", - "shasum": "" - }, - "require": { - "php": ">=7.1" - }, - "require-dev": { - "phpstan/phpstan": "*", - "squizlabs/php_codesniffer": "^3.1", - "vimeo/psalm": "^4.0" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-master": "1.x-dev" - } - }, - "autoload": { - "psr-4": { - "LanguageServerProtocol\\": "src/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "ISC" - ], - "authors": [ - { - "name": "Felix Becker", - "email": "felix.b@outlook.com" - } - ], - "description": "PHP classes for the Language Server Protocol", - "keywords": [ - "language", - "microsoft", - "php", - "server" - ], - "support": { - "issues": "https://github.com/felixfbecker/php-language-server-protocol/issues", - "source": "https://github.com/felixfbecker/php-language-server-protocol/tree/v1.5.2" - }, - "time": "2022-03-02T22:36:06+00:00" - }, - { - "name": "fidry/cpu-core-counter", - "version": "1.1.0", - "source": { - "type": "git", - "url": "https://github.com/theofidry/cpu-core-counter.git", - "reference": "f92996c4d5c1a696a6a970e20f7c4216200fcc42" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/theofidry/cpu-core-counter/zipball/f92996c4d5c1a696a6a970e20f7c4216200fcc42", - "reference": "f92996c4d5c1a696a6a970e20f7c4216200fcc42", - "shasum": "" - }, - "require": { - "php": "^7.2 || ^8.0" - }, - "require-dev": { - "fidry/makefile": "^0.2.0", - "fidry/php-cs-fixer-config": "^1.1.2", - "phpstan/extension-installer": "^1.2.0", - "phpstan/phpstan": "^1.9.2", - "phpstan/phpstan-deprecation-rules": "^1.0.0", - "phpstan/phpstan-phpunit": "^1.2.2", - "phpstan/phpstan-strict-rules": "^1.4.4", - "phpunit/phpunit": "^8.5.31 || ^9.5.26", - "webmozarts/strict-phpunit": "^7.5" - }, - "type": "library", - "autoload": { - "psr-4": { - "Fidry\\CpuCoreCounter\\": "src/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Théo FIDRY", - "email": "theo.fidry@gmail.com" - } - ], - "description": "Tiny utility to get the number of CPU cores.", - "keywords": [ - "CPU", - "core" - ], - "support": { - "issues": "https://github.com/theofidry/cpu-core-counter/issues", - "source": "https://github.com/theofidry/cpu-core-counter/tree/1.1.0" - }, - "funding": [ - { - "url": "https://github.com/theofidry", - "type": "github" - } - ], - "time": "2024-02-07T09:43:46+00:00" + "time": "2024-11-21T13:46:39+00:00" }, { "name": "filp/whoops", - "version": "2.15.4", + "version": "2.18.3", "source": { "type": "git", "url": "https://github.com/filp/whoops.git", - "reference": "a139776fa3f5985a50b509f2a02ff0f709d2a546" + "reference": "59a123a3d459c5a23055802237cb317f609867e5" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/filp/whoops/zipball/a139776fa3f5985a50b509f2a02ff0f709d2a546", - "reference": "a139776fa3f5985a50b509f2a02ff0f709d2a546", + "url": "https://api.github.com/repos/filp/whoops/zipball/59a123a3d459c5a23055802237cb317f609867e5", + "reference": "59a123a3d459c5a23055802237cb317f609867e5", "shasum": "" }, "require": { - "php": "^5.5.9 || ^7.0 || ^8.0", + "php": "^7.1 || ^8.0", "psr/log": "^1.0.1 || ^2.0 || ^3.0" }, "require-dev": { - "mockery/mockery": "^0.9 || ^1.0", - "phpunit/phpunit": "^4.8.36 || ^5.7.27 || ^6.5.14 || ^7.5.20 || ^8.5.8 || ^9.3.3", - "symfony/var-dumper": "^2.6 || ^3.0 || ^4.0 || ^5.0" + "mockery/mockery": "^1.0", + "phpunit/phpunit": "^7.5.20 || ^8.5.8 || ^9.3.3", + "symfony/var-dumper": "^4.0 || ^5.0" }, "suggest": { "symfony/var-dumper": "Pretty print complex values better with var-dumper available", @@ -9492,7 +9402,7 @@ ], "support": { "issues": "https://github.com/filp/whoops/issues", - "source": "https://github.com/filp/whoops/tree/2.15.4" + "source": "https://github.com/filp/whoops/tree/2.18.3" }, "funding": [ { @@ -9500,24 +9410,24 @@ "type": "github" } ], - "time": "2023-11-03T12:00:00+00:00" + "time": "2025-06-16T00:02:10+00:00" }, { "name": "hamcrest/hamcrest-php", - "version": "v2.0.1", + "version": "v2.1.1", "source": { "type": "git", "url": "https://github.com/hamcrest/hamcrest-php.git", - "reference": "8c3d0a3f6af734494ad8f6fbbee0ba92422859f3" + "reference": "f8b1c0173b22fa6ec77a81fe63e5b01eba7e6487" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/hamcrest/hamcrest-php/zipball/8c3d0a3f6af734494ad8f6fbbee0ba92422859f3", - "reference": "8c3d0a3f6af734494ad8f6fbbee0ba92422859f3", + "url": "https://api.github.com/repos/hamcrest/hamcrest-php/zipball/f8b1c0173b22fa6ec77a81fe63e5b01eba7e6487", + "reference": "f8b1c0173b22fa6ec77a81fe63e5b01eba7e6487", "shasum": "" }, "require": { - "php": "^5.3|^7.0|^8.0" + "php": "^7.4|^8.0" }, "replace": { "cordoval/hamcrest-php": "*", @@ -9525,8 +9435,8 @@ "kodova/hamcrest-php": "*" }, "require-dev": { - "phpunit/php-file-iterator": "^1.4 || ^2.0", - "phpunit/phpunit": "^4.8.36 || ^5.7 || ^6.5 || ^7.0" + "phpunit/php-file-iterator": "^1.4 || ^2.0 || ^3.0", + "phpunit/phpunit": "^4.8.36 || ^5.7 || ^6.5 || ^7.0 || ^8.0 || ^9.0" }, "type": "library", "extra": { @@ -9549,43 +9459,45 @@ ], "support": { "issues": "https://github.com/hamcrest/hamcrest-php/issues", - "source": "https://github.com/hamcrest/hamcrest-php/tree/v2.0.1" + "source": "https://github.com/hamcrest/hamcrest-php/tree/v2.1.1" }, - "time": "2020-07-09T08:09:16+00:00" + "time": "2025-04-30T06:54:44+00:00" }, { "name": "laravel/dusk", - "version": "v8.0.0", + "version": "v8.3.3", "source": { "type": "git", "url": "https://github.com/laravel/dusk.git", - "reference": "9f3cdd096e28508f4b4a577c8bfecb5476e27b61" + "reference": "077d448cd993a08f97bfccf0ea3d6478b3908f7e" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/dusk/zipball/9f3cdd096e28508f4b4a577c8bfecb5476e27b61", - "reference": "9f3cdd096e28508f4b4a577c8bfecb5476e27b61", + "url": "https://api.github.com/repos/laravel/dusk/zipball/077d448cd993a08f97bfccf0ea3d6478b3908f7e", + "reference": "077d448cd993a08f97bfccf0ea3d6478b3908f7e", "shasum": "" }, "require": { "ext-json": "*", "ext-zip": "*", "guzzlehttp/guzzle": "^7.5", - "illuminate/console": "^10.0|^11.0", - "illuminate/support": "^10.0|^11.0", + "illuminate/console": "^10.0|^11.0|^12.0", + "illuminate/support": "^10.0|^11.0|^12.0", "php": "^8.1", - "php-webdriver/webdriver": "^1.9.0", + "php-webdriver/webdriver": "^1.15.2", "symfony/console": "^6.2|^7.0", "symfony/finder": "^6.2|^7.0", "symfony/process": "^6.2|^7.0", "vlucas/phpdotenv": "^5.2" }, "require-dev": { + "laravel/framework": "^10.0|^11.0|^12.0", "mockery/mockery": "^1.6", - "orchestra/testbench": "^8.19|^9.0", + "orchestra/testbench-core": "^8.19|^9.0|^10.0", "phpstan/phpstan": "^1.10", - "phpunit/phpunit": "^10.1|^11.0", - "psy/psysh": "^0.11.12|^0.12" + "phpunit/phpunit": "^10.1|^11.0|^12.0.1", + "psy/psysh": "^0.11.12|^0.12", + "symfony/yaml": "^6.2|^7.0" }, "suggest": { "ext-pcntl": "Used to gracefully terminate Dusk when tests are running." @@ -9621,22 +9533,101 @@ ], "support": { "issues": "https://github.com/laravel/dusk/issues", - "source": "https://github.com/laravel/dusk/tree/v8.0.0" + "source": "https://github.com/laravel/dusk/tree/v8.3.3" }, - "time": "2024-03-12T14:10:13+00:00" + "time": "2025-06-10T13:59:27+00:00" }, { - "name": "laravel/pint", - "version": "v1.14.0", + "name": "laravel/pail", + "version": "v1.2.3", "source": { "type": "git", - "url": "https://github.com/laravel/pint.git", - "reference": "6b127276e3f263f7bb17d5077e9e0269e61b2a0e" + "url": "https://github.com/laravel/pail.git", + "reference": "8cc3d575c1f0e57eeb923f366a37528c50d2385a" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/pint/zipball/6b127276e3f263f7bb17d5077e9e0269e61b2a0e", - "reference": "6b127276e3f263f7bb17d5077e9e0269e61b2a0e", + "url": "https://api.github.com/repos/laravel/pail/zipball/8cc3d575c1f0e57eeb923f366a37528c50d2385a", + "reference": "8cc3d575c1f0e57eeb923f366a37528c50d2385a", + "shasum": "" + }, + "require": { + "ext-mbstring": "*", + "illuminate/console": "^10.24|^11.0|^12.0", + "illuminate/contracts": "^10.24|^11.0|^12.0", + "illuminate/log": "^10.24|^11.0|^12.0", + "illuminate/process": "^10.24|^11.0|^12.0", + "illuminate/support": "^10.24|^11.0|^12.0", + "nunomaduro/termwind": "^1.15|^2.0", + "php": "^8.2", + "symfony/console": "^6.0|^7.0" + }, + "require-dev": { + "laravel/framework": "^10.24|^11.0|^12.0", + "laravel/pint": "^1.13", + "orchestra/testbench-core": "^8.13|^9.0|^10.0", + "pestphp/pest": "^2.20|^3.0", + "pestphp/pest-plugin-type-coverage": "^2.3|^3.0", + "phpstan/phpstan": "^1.12.27", + "symfony/var-dumper": "^6.3|^7.0" + }, + "type": "library", + "extra": { + "laravel": { + "providers": [ + "Laravel\\Pail\\PailServiceProvider" + ] + }, + "branch-alias": { + "dev-main": "1.x-dev" + } + }, + "autoload": { + "psr-4": { + "Laravel\\Pail\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + }, + { + "name": "Nuno Maduro", + "email": "enunomaduro@gmail.com" + } + ], + "description": "Easily delve into your Laravel application's log files directly from the command line.", + "homepage": "https://github.com/laravel/pail", + "keywords": [ + "dev", + "laravel", + "logs", + "php", + "tail" + ], + "support": { + "issues": "https://github.com/laravel/pail/issues", + "source": "https://github.com/laravel/pail" + }, + "time": "2025-06-05T13:55:57+00:00" + }, + { + "name": "laravel/pint", + "version": "v1.22.1", + "source": { + "type": "git", + "url": "https://github.com/laravel/pint.git", + "reference": "941d1927c5ca420c22710e98420287169c7bcaf7" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/pint/zipball/941d1927c5ca420c22710e98420287169c7bcaf7", + "reference": "941d1927c5ca420c22710e98420287169c7bcaf7", "shasum": "" }, "require": { @@ -9644,16 +9635,16 @@ "ext-mbstring": "*", "ext-tokenizer": "*", "ext-xml": "*", - "php": "^8.1.0" + "php": "^8.2.0" }, "require-dev": { - "friendsofphp/php-cs-fixer": "^3.49.0", - "illuminate/view": "^10.43.0", - "larastan/larastan": "^2.8.1", - "laravel-zero/framework": "^10.3.0", - "mockery/mockery": "^1.6.7", - "nunomaduro/termwind": "^1.15.1", - "pestphp/pest": "^2.33.6" + "friendsofphp/php-cs-fixer": "^3.75.0", + "illuminate/view": "^11.44.7", + "larastan/larastan": "^3.4.0", + "laravel-zero/framework": "^11.36.1", + "mockery/mockery": "^1.6.12", + "nunomaduro/termwind": "^2.3.1", + "pestphp/pest": "^2.36.0" }, "bin": [ "builds/pint" @@ -9689,32 +9680,32 @@ "issues": "https://github.com/laravel/pint/issues", "source": "https://github.com/laravel/pint" }, - "time": "2024-02-20T17:38:05+00:00" + "time": "2025-05-08T08:38:12+00:00" }, { "name": "laravel/sail", - "version": "v1.29.1", + "version": "v1.43.1", "source": { "type": "git", "url": "https://github.com/laravel/sail.git", - "reference": "8be4a31150eab3b46af11a2e7b2c4632eefaad7e" + "reference": "3e7d899232a8c5e3ea4fc6dee7525ad583887e72" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/laravel/sail/zipball/8be4a31150eab3b46af11a2e7b2c4632eefaad7e", - "reference": "8be4a31150eab3b46af11a2e7b2c4632eefaad7e", + "url": "https://api.github.com/repos/laravel/sail/zipball/3e7d899232a8c5e3ea4fc6dee7525ad583887e72", + "reference": "3e7d899232a8c5e3ea4fc6dee7525ad583887e72", "shasum": "" }, "require": { - "illuminate/console": "^9.52.16|^10.0|^11.0", - "illuminate/contracts": "^9.52.16|^10.0|^11.0", - "illuminate/support": "^9.52.16|^10.0|^11.0", + "illuminate/console": "^9.52.16|^10.0|^11.0|^12.0", + "illuminate/contracts": "^9.52.16|^10.0|^11.0|^12.0", + "illuminate/support": "^9.52.16|^10.0|^11.0|^12.0", "php": "^8.0", "symfony/console": "^6.0|^7.0", "symfony/yaml": "^6.0|^7.0" }, "require-dev": { - "orchestra/testbench": "^7.0|^8.0|^9.0", + "orchestra/testbench": "^7.0|^8.0|^9.0|^10.0", "phpstan/phpstan": "^1.10" }, "bin": [ @@ -9752,86 +9743,20 @@ "issues": "https://github.com/laravel/sail/issues", "source": "https://github.com/laravel/sail" }, - "time": "2024-03-20T20:09:31+00:00" - }, - { - "name": "maximebf/debugbar", - "version": "v1.21.3", - "source": { - "type": "git", - "url": "https://github.com/maximebf/php-debugbar.git", - "reference": "0b407703b08ea0cf6ebc61e267cc96ff7000911b" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/maximebf/php-debugbar/zipball/0b407703b08ea0cf6ebc61e267cc96ff7000911b", - "reference": "0b407703b08ea0cf6ebc61e267cc96ff7000911b", - "shasum": "" - }, - "require": { - "php": "^7.1|^8", - "psr/log": "^1|^2|^3", - "symfony/var-dumper": "^4|^5|^6|^7" - }, - "require-dev": { - "phpunit/phpunit": ">=7.5.20 <10.0", - "twig/twig": "^1.38|^2.7|^3.0" - }, - "suggest": { - "kriswallsmith/assetic": "The best way to manage assets", - "monolog/monolog": "Log using Monolog", - "predis/predis": "Redis storage" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-master": "1.21-dev" - } - }, - "autoload": { - "psr-4": { - "DebugBar\\": "src/DebugBar/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Maxime Bouroumeau-Fuseau", - "email": "maxime.bouroumeau@gmail.com", - "homepage": "http://maximebf.com" - }, - { - "name": "Barry vd. Heuvel", - "email": "barryvdh@gmail.com" - } - ], - "description": "Debug bar in the browser for php application", - "homepage": "https://github.com/maximebf/php-debugbar", - "keywords": [ - "debug", - "debugbar" - ], - "support": { - "issues": "https://github.com/maximebf/php-debugbar/issues", - "source": "https://github.com/maximebf/php-debugbar/tree/v1.21.3" - }, - "time": "2024-03-12T14:23:07+00:00" + "time": "2025-05-19T13:19:21+00:00" }, { "name": "mockery/mockery", - "version": "1.6.11", + "version": "1.6.12", "source": { "type": "git", "url": "https://github.com/mockery/mockery.git", - "reference": "81a161d0b135df89951abd52296adf97deb0723d" + "reference": "1f4efdd7d3beafe9807b08156dfcb176d18f1699" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/mockery/mockery/zipball/81a161d0b135df89951abd52296adf97deb0723d", - "reference": "81a161d0b135df89951abd52296adf97deb0723d", + "url": "https://api.github.com/repos/mockery/mockery/zipball/1f4efdd7d3beafe9807b08156dfcb176d18f1699", + "reference": "1f4efdd7d3beafe9807b08156dfcb176d18f1699", "shasum": "" }, "require": { @@ -9901,20 +9826,20 @@ "security": "https://github.com/mockery/mockery/security/advisories", "source": "https://github.com/mockery/mockery" }, - "time": "2024-03-21T18:34:15+00:00" + "time": "2024-05-16T03:13:13+00:00" }, { "name": "myclabs/deep-copy", - "version": "1.11.1", + "version": "1.13.1", "source": { "type": "git", "url": "https://github.com/myclabs/DeepCopy.git", - "reference": "7284c22080590fb39f2ffa3e9057f10a4ddd0e0c" + "reference": "1720ddd719e16cf0db4eb1c6eca108031636d46c" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/7284c22080590fb39f2ffa3e9057f10a4ddd0e0c", - "reference": "7284c22080590fb39f2ffa3e9057f10a4ddd0e0c", + "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/1720ddd719e16cf0db4eb1c6eca108031636d46c", + "reference": "1720ddd719e16cf0db4eb1c6eca108031636d46c", "shasum": "" }, "require": { @@ -9922,11 +9847,12 @@ }, "conflict": { "doctrine/collections": "<1.6.8", - "doctrine/common": "<2.13.3 || >=3,<3.2.2" + "doctrine/common": "<2.13.3 || >=3 <3.2.2" }, "require-dev": { "doctrine/collections": "^1.6.8", "doctrine/common": "^2.13.3 || ^3.2.2", + "phpspec/prophecy": "^1.10", "phpunit/phpunit": "^7.5.20 || ^8.5.23 || ^9.5.13" }, "type": "library", @@ -9952,7 +9878,7 @@ ], "support": { "issues": "https://github.com/myclabs/DeepCopy/issues", - "source": "https://github.com/myclabs/DeepCopy/tree/1.11.1" + "source": "https://github.com/myclabs/DeepCopy/tree/1.13.1" }, "funding": [ { @@ -9960,93 +9886,43 @@ "type": "tidelift" } ], - "time": "2023-03-08T13:26:56+00:00" - }, - { - "name": "netresearch/jsonmapper", - "version": "v4.4.1", - "source": { - "type": "git", - "url": "https://github.com/cweiske/jsonmapper.git", - "reference": "132c75c7dd83e45353ebb9c6c9f591952995bbf0" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/cweiske/jsonmapper/zipball/132c75c7dd83e45353ebb9c6c9f591952995bbf0", - "reference": "132c75c7dd83e45353ebb9c6c9f591952995bbf0", - "shasum": "" - }, - "require": { - "ext-json": "*", - "ext-pcre": "*", - "ext-reflection": "*", - "ext-spl": "*", - "php": ">=7.1" - }, - "require-dev": { - "phpunit/phpunit": "~7.5 || ~8.0 || ~9.0 || ~10.0", - "squizlabs/php_codesniffer": "~3.5" - }, - "type": "library", - "autoload": { - "psr-0": { - "JsonMapper": "src/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "OSL-3.0" - ], - "authors": [ - { - "name": "Christian Weiske", - "email": "cweiske@cweiske.de", - "homepage": "http://github.com/cweiske/jsonmapper/", - "role": "Developer" - } - ], - "description": "Map nested JSON structures onto PHP classes", - "support": { - "email": "cweiske@cweiske.de", - "issues": "https://github.com/cweiske/jsonmapper/issues", - "source": "https://github.com/cweiske/jsonmapper/tree/v4.4.1" - }, - "time": "2024-01-31T06:18:54+00:00" + "time": "2025-04-29T12:36:36+00:00" }, { "name": "nunomaduro/collision", - "version": "v8.1.1", + "version": "v8.8.2", "source": { "type": "git", "url": "https://github.com/nunomaduro/collision.git", - "reference": "13e5d538b95a744d85f447a321ce10adb28e9af9" + "reference": "60207965f9b7b7a4ce15a0f75d57f9dadb105bdb" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/nunomaduro/collision/zipball/13e5d538b95a744d85f447a321ce10adb28e9af9", - "reference": "13e5d538b95a744d85f447a321ce10adb28e9af9", + "url": "https://api.github.com/repos/nunomaduro/collision/zipball/60207965f9b7b7a4ce15a0f75d57f9dadb105bdb", + "reference": "60207965f9b7b7a4ce15a0f75d57f9dadb105bdb", "shasum": "" }, "require": { - "filp/whoops": "^2.15.4", - "nunomaduro/termwind": "^2.0.1", + "filp/whoops": "^2.18.1", + "nunomaduro/termwind": "^2.3.1", "php": "^8.2.0", - "symfony/console": "^7.0.4" + "symfony/console": "^7.3.0" }, "conflict": { - "laravel/framework": "<11.0.0 || >=12.0.0", - "phpunit/phpunit": "<10.5.1 || >=12.0.0" + "laravel/framework": "<11.44.2 || >=13.0.0", + "phpunit/phpunit": "<11.5.15 || >=13.0.0" }, "require-dev": { - "larastan/larastan": "^2.9.2", - "laravel/framework": "^11.0.0", - "laravel/pint": "^1.14.0", - "laravel/sail": "^1.28.2", - "laravel/sanctum": "^4.0.0", - "laravel/tinker": "^2.9.0", - "orchestra/testbench-core": "^9.0.0", - "pestphp/pest": "^2.34.1 || ^3.0.0", - "sebastian/environment": "^6.0.1 || ^7.0.0" + "brianium/paratest": "^7.8.3", + "larastan/larastan": "^3.4.2", + "laravel/framework": "^11.44.2 || ^12.18", + "laravel/pint": "^1.22.1", + "laravel/sail": "^1.43.1", + "laravel/sanctum": "^4.1.1", + "laravel/tinker": "^2.10.1", + "orchestra/testbench-core": "^9.12.0 || ^10.4", + "pestphp/pest": "^3.8.2", + "sebastian/environment": "^7.2.1 || ^8.0" }, "type": "library", "extra": { @@ -10083,6 +9959,7 @@ "cli", "command-line", "console", + "dev", "error", "handling", "laravel", @@ -10108,43 +9985,42 @@ "type": "patreon" } ], - "time": "2024-03-06T16:20:09+00:00" + "time": "2025-06-25T02:12:12+00:00" }, { "name": "openai-php/client", - "version": "v0.8.4", + "version": "v0.10.3", "source": { "type": "git", "url": "https://github.com/openai-php/client.git", - "reference": "00470f5fedd7b08ee4860959d6952f0be0ec48a0" + "reference": "4a565d145e0fb3ea1baba8fffe39d86c56b6dc2c" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/openai-php/client/zipball/00470f5fedd7b08ee4860959d6952f0be0ec48a0", - "reference": "00470f5fedd7b08ee4860959d6952f0be0ec48a0", + "url": "https://api.github.com/repos/openai-php/client/zipball/4a565d145e0fb3ea1baba8fffe39d86c56b6dc2c", + "reference": "4a565d145e0fb3ea1baba8fffe39d86c56b6dc2c", "shasum": "" }, "require": { "php": "^8.1.0", - "php-http/discovery": "^1.19.2", - "php-http/multipart-stream-builder": "^1.3.0", + "php-http/discovery": "^1.20.0", + "php-http/multipart-stream-builder": "^1.4.2", "psr/http-client": "^1.0.3", "psr/http-client-implementation": "^1.0.1", "psr/http-factory-implementation": "*", "psr/http-message": "^1.1.0|^2.0.0" }, "require-dev": { - "guzzlehttp/guzzle": "^7.8.1", - "guzzlehttp/psr7": "^2.6.2", - "laravel/pint": "^1.13.7", - "mockery/mockery": "^1.6.7", - "nunomaduro/collision": "^7.10.0", - "pestphp/pest": "^2.30.0", - "pestphp/pest-plugin-arch": "^2.6", - "pestphp/pest-plugin-type-coverage": "^2.7.0", - "phpstan/phpstan": "^1.10.55", - "rector/rector": "^0.16.0", - "symfony/var-dumper": "^6.4.2" + "guzzlehttp/guzzle": "^7.9.2", + "guzzlehttp/psr7": "^2.7.0", + "laravel/pint": "^1.18.1", + "mockery/mockery": "^1.6.12", + "nunomaduro/collision": "^7.11.0|^8.5.0", + "pestphp/pest": "^2.36.0|^3.5.0", + "pestphp/pest-plugin-arch": "^2.7|^3.0", + "pestphp/pest-plugin-type-coverage": "^2.8.7|^3.1.0", + "phpstan/phpstan": "^1.12.7", + "symfony/var-dumper": "^6.4.11|^7.1.5" }, "type": "library", "autoload": { @@ -10184,7 +10060,7 @@ ], "support": { "issues": "https://github.com/openai-php/client/issues", - "source": "https://github.com/openai-php/client/tree/v0.8.4" + "source": "https://github.com/openai-php/client/tree/v0.10.3" }, "funding": [ { @@ -10200,68 +10076,33 @@ "type": "github" } ], - "time": "2024-02-07T07:57:38+00:00" + "time": "2024-11-12T20:51:16+00:00" }, { - "name": "orchestra/testbench-core", - "version": "v9.0.6", + "name": "permafrost-dev/code-snippets", + "version": "1.2.0", "source": { "type": "git", - "url": "https://github.com/orchestral/testbench-core.git", - "reference": "ea532af82da288d363b7dc7c96edae6bbb329efe" + "url": "https://github.com/permafrost-dev/code-snippets.git", + "reference": "639827ba7118a6b5521c861a265358ce5bd2b0c5" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/orchestral/testbench-core/zipball/ea532af82da288d363b7dc7c96edae6bbb329efe", - "reference": "ea532af82da288d363b7dc7c96edae6bbb329efe", + "url": "https://api.github.com/repos/permafrost-dev/code-snippets/zipball/639827ba7118a6b5521c861a265358ce5bd2b0c5", + "reference": "639827ba7118a6b5521c861a265358ce5bd2b0c5", "shasum": "" }, "require": { - "composer-runtime-api": "^2.2", - "php": "^8.2", - "symfony/polyfill-php83": "^1.28" - }, - "conflict": { - "brianium/paratest": "<7.3.0 || >=8.0.0", - "laravel/framework": "<11.0.3 || >=12.0.0", - "nunomaduro/collision": "<8.0.0 || >=9.0.0", - "phpunit/phpunit": "<10.5.0 || 11.0.0 || >=11.1.0" + "php": "^7.3|^8.0" }, "require-dev": { - "fakerphp/faker": "^1.23", - "laravel/framework": "^11.0.3", - "laravel/pint": "^1.6", - "mockery/mockery": "^1.6", - "phpstan/phpstan": "^1.10.50", - "phpunit/phpunit": "^10.5 || ^11.0.1", - "spatie/laravel-ray": "^1.35", - "symfony/process": "^7.0", - "symfony/yaml": "^7.0", - "vlucas/phpdotenv": "^5.4.1" + "phpunit/phpunit": "^9.5", + "spatie/phpunit-snapshot-assertions": "^4.2" }, - "suggest": { - "brianium/paratest": "Allow using parallel tresting (^7.3).", - "ext-pcntl": "Required to use all features of the console signal trapping.", - "fakerphp/faker": "Allow using Faker for testing (^1.23).", - "laravel/framework": "Required for testing (^11.0.3).", - "mockery/mockery": "Allow using Mockery for testing (^1.6).", - "nunomaduro/collision": "Allow using Laravel style tests output and parallel testing (^8.0).", - "orchestra/testbench-dusk": "Allow using Laravel Dusk for testing (^9.0).", - "phpunit/phpunit": "Allow using PHPUnit for testing (^10.5).", - "symfony/process": "Required to use Orchestra\\Testbench\\remote function (^7.0).", - "symfony/yaml": "Required for Testbench CLI (^7.0).", - "vlucas/phpdotenv": "Required for Testbench CLI (^5.4.1)." - }, - "bin": [ - "testbench" - ], "type": "library", "autoload": { - "files": [ - "src/functions.php" - ], "psr-4": { - "Orchestra\\Testbench\\": "src/" + "Permafrost\\CodeSnippets\\": "src" } }, "notification-url": "https://packagist.org/downloads/", @@ -10270,26 +10111,99 @@ ], "authors": [ { - "name": "Mior Muhammad Zaki", - "email": "crynobone@gmail.com", - "homepage": "https://github.com/crynobone" + "name": "Patrick Organ", + "email": "patrick@permafrost.dev", + "role": "Developer" } ], - "description": "Testing Helper for Laravel Development", - "homepage": "https://packages.tools/testbench", + "description": "Easily work with code snippets in PHP", + "homepage": "https://github.com/permafrost-dev/code-snippets", "keywords": [ - "BDD", - "TDD", - "dev", - "laravel", - "laravel-packages", - "testing" + "code", + "code-snippets", + "permafrost", + "snippets" ], "support": { - "issues": "https://github.com/orchestral/testbench/issues", - "source": "https://github.com/orchestral/testbench-core" + "issues": "https://github.com/permafrost-dev/code-snippets/issues", + "source": "https://github.com/permafrost-dev/code-snippets/tree/1.2.0" }, - "time": "2024-03-19T11:20:27+00:00" + "funding": [ + { + "url": "https://permafrost.dev/open-source", + "type": "custom" + }, + { + "url": "https://github.com/permafrost-dev", + "type": "github" + } + ], + "time": "2021-07-27T05:15:06+00:00" + }, + { + "name": "permafrost-dev/php-code-search", + "version": "1.12.0", + "source": { + "type": "git", + "url": "https://github.com/permafrost-dev/php-code-search.git", + "reference": "dbbca18f7dc2950e88121bb62f8ed2c697df799a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/permafrost-dev/php-code-search/zipball/dbbca18f7dc2950e88121bb62f8ed2c697df799a", + "reference": "dbbca18f7dc2950e88121bb62f8ed2c697df799a", + "shasum": "" + }, + "require": { + "nikic/php-parser": "^5.0", + "permafrost-dev/code-snippets": "^1.2.0", + "php": "^7.4|^8.0" + }, + "require-dev": { + "phpunit/phpunit": "^9.5", + "spatie/phpunit-snapshot-assertions": "^4.2" + }, + "type": "library", + "autoload": { + "files": [ + "src/Support/helpers.php" + ], + "psr-4": { + "Permafrost\\PhpCodeSearch\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Patrick Organ", + "email": "patrick@permafrost.dev", + "homepage": "https://permafrost.dev", + "role": "Developer" + } + ], + "description": "Search PHP code for function & method calls, variable assignments, and more", + "homepage": "https://github.com/permafrost-dev/php-code-search", + "keywords": [ + "code", + "permafrost", + "php", + "search", + "sourcecode" + ], + "support": { + "issues": "https://github.com/permafrost-dev/php-code-search/issues", + "source": "https://github.com/permafrost-dev/php-code-search/tree/1.12.0" + }, + "funding": [ + { + "url": "https://github.com/sponsors/permafrost-dev", + "type": "github" + } + ], + "time": "2024-09-03T04:33:45+00:00" }, { "name": "phar-io/manifest", @@ -10410,17 +10324,215 @@ "time": "2022-02-21T01:04:05+00:00" }, { - "name": "php-http/discovery", - "version": "1.19.2", + "name": "php-debugbar/php-debugbar", + "version": "v2.1.6", "source": { "type": "git", - "url": "https://github.com/php-http/discovery.git", - "reference": "61e1a1eb69c92741f5896d9e05fb8e9d7e8bb0cb" + "url": "https://github.com/php-debugbar/php-debugbar.git", + "reference": "16fa68da5617220594aa5e33fa9de415f94784a0" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/php-http/discovery/zipball/61e1a1eb69c92741f5896d9e05fb8e9d7e8bb0cb", - "reference": "61e1a1eb69c92741f5896d9e05fb8e9d7e8bb0cb", + "url": "https://api.github.com/repos/php-debugbar/php-debugbar/zipball/16fa68da5617220594aa5e33fa9de415f94784a0", + "reference": "16fa68da5617220594aa5e33fa9de415f94784a0", + "shasum": "" + }, + "require": { + "php": "^8", + "psr/log": "^1|^2|^3", + "symfony/var-dumper": "^4|^5|^6|^7" + }, + "require-dev": { + "dbrekelmans/bdi": "^1", + "phpunit/phpunit": "^8|^9", + "symfony/panther": "^1|^2.1", + "twig/twig": "^1.38|^2.7|^3.0" + }, + "suggest": { + "kriswallsmith/assetic": "The best way to manage assets", + "monolog/monolog": "Log using Monolog", + "predis/predis": "Redis storage" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "psr-4": { + "DebugBar\\": "src/DebugBar/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Maxime Bouroumeau-Fuseau", + "email": "maxime.bouroumeau@gmail.com", + "homepage": "http://maximebf.com" + }, + { + "name": "Barry vd. Heuvel", + "email": "barryvdh@gmail.com" + } + ], + "description": "Debug bar in the browser for php application", + "homepage": "https://github.com/php-debugbar/php-debugbar", + "keywords": [ + "debug", + "debug bar", + "debugbar", + "dev" + ], + "support": { + "issues": "https://github.com/php-debugbar/php-debugbar/issues", + "source": "https://github.com/php-debugbar/php-debugbar/tree/v2.1.6" + }, + "time": "2025-02-21T17:47:03+00:00" + }, + { + "name": "php-di/invoker", + "version": "2.3.6", + "source": { + "type": "git", + "url": "https://github.com/PHP-DI/Invoker.git", + "reference": "59f15608528d8a8838d69b422a919fd6b16aa576" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/PHP-DI/Invoker/zipball/59f15608528d8a8838d69b422a919fd6b16aa576", + "reference": "59f15608528d8a8838d69b422a919fd6b16aa576", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "psr/container": "^1.0|^2.0" + }, + "require-dev": { + "athletic/athletic": "~0.1.8", + "mnapoli/hard-mode": "~0.3.0", + "phpunit/phpunit": "^9.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Invoker\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Generic and extensible callable invoker", + "homepage": "https://github.com/PHP-DI/Invoker", + "keywords": [ + "callable", + "dependency", + "dependency-injection", + "injection", + "invoke", + "invoker" + ], + "support": { + "issues": "https://github.com/PHP-DI/Invoker/issues", + "source": "https://github.com/PHP-DI/Invoker/tree/2.3.6" + }, + "funding": [ + { + "url": "https://github.com/mnapoli", + "type": "github" + } + ], + "time": "2025-01-17T12:49:27+00:00" + }, + { + "name": "php-di/php-di", + "version": "7.0.11", + "source": { + "type": "git", + "url": "https://github.com/PHP-DI/PHP-DI.git", + "reference": "32f111a6d214564520a57831d397263e8946c1d2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/PHP-DI/PHP-DI/zipball/32f111a6d214564520a57831d397263e8946c1d2", + "reference": "32f111a6d214564520a57831d397263e8946c1d2", + "shasum": "" + }, + "require": { + "laravel/serializable-closure": "^1.0 || ^2.0", + "php": ">=8.0", + "php-di/invoker": "^2.0", + "psr/container": "^1.1 || ^2.0" + }, + "provide": { + "psr/container-implementation": "^1.0" + }, + "require-dev": { + "friendsofphp/php-cs-fixer": "^3", + "friendsofphp/proxy-manager-lts": "^1", + "mnapoli/phpunit-easymock": "^1.3", + "phpunit/phpunit": "^9.6 || ^10 || ^11", + "vimeo/psalm": "^5|^6" + }, + "suggest": { + "friendsofphp/proxy-manager-lts": "Install it if you want to use lazy injection (version ^1)" + }, + "type": "library", + "autoload": { + "files": [ + "src/functions.php" + ], + "psr-4": { + "DI\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "The dependency injection container for humans", + "homepage": "https://php-di.org/", + "keywords": [ + "PSR-11", + "container", + "container-interop", + "dependency injection", + "di", + "ioc", + "psr11" + ], + "support": { + "issues": "https://github.com/PHP-DI/PHP-DI/issues", + "source": "https://github.com/PHP-DI/PHP-DI/tree/7.0.11" + }, + "funding": [ + { + "url": "https://github.com/mnapoli", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/php-di/php-di", + "type": "tidelift" + } + ], + "time": "2025-06-03T07:45:57+00:00" + }, + { + "name": "php-http/discovery", + "version": "1.20.0", + "source": { + "type": "git", + "url": "https://github.com/php-http/discovery.git", + "reference": "82fe4c73ef3363caed49ff8dd1539ba06044910d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-http/discovery/zipball/82fe4c73ef3363caed49ff8dd1539ba06044910d", + "reference": "82fe4c73ef3363caed49ff8dd1539ba06044910d", "shasum": "" }, "require": { @@ -10444,7 +10556,8 @@ "php-http/httplug": "^1.0 || ^2.0", "php-http/message-factory": "^1.0", "phpspec/phpspec": "^5.1 || ^6.1 || ^7.3", - "symfony/phpunit-bridge": "^6.2" + "sebastian/comparator": "^3.0.5 || ^4.0.8", + "symfony/phpunit-bridge": "^6.4.4 || ^7.0.1" }, "type": "composer-plugin", "extra": { @@ -10483,22 +10596,22 @@ ], "support": { "issues": "https://github.com/php-http/discovery/issues", - "source": "https://github.com/php-http/discovery/tree/1.19.2" + "source": "https://github.com/php-http/discovery/tree/1.20.0" }, - "time": "2023-11-30T16:49:05+00:00" + "time": "2024-10-02T11:20:13+00:00" }, { "name": "php-http/multipart-stream-builder", - "version": "1.3.0", + "version": "1.4.2", "source": { "type": "git", "url": "https://github.com/php-http/multipart-stream-builder.git", - "reference": "f5938fd135d9fa442cc297dc98481805acfe2b6a" + "reference": "10086e6de6f53489cca5ecc45b6f468604d3460e" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/php-http/multipart-stream-builder/zipball/f5938fd135d9fa442cc297dc98481805acfe2b6a", - "reference": "f5938fd135d9fa442cc297dc98481805acfe2b6a", + "url": "https://api.github.com/repos/php-http/multipart-stream-builder/zipball/10086e6de6f53489cca5ecc45b6f468604d3460e", + "reference": "10086e6de6f53489cca5ecc45b6f468604d3460e", "shasum": "" }, "require": { @@ -10539,22 +10652,22 @@ ], "support": { "issues": "https://github.com/php-http/multipart-stream-builder/issues", - "source": "https://github.com/php-http/multipart-stream-builder/tree/1.3.0" + "source": "https://github.com/php-http/multipart-stream-builder/tree/1.4.2" }, - "time": "2023-04-28T14:10:22+00:00" + "time": "2024-09-04T13:22:54+00:00" }, { "name": "php-webdriver/webdriver", - "version": "1.15.1", + "version": "1.15.2", "source": { "type": "git", "url": "https://github.com/php-webdriver/php-webdriver.git", - "reference": "cd52d9342c5aa738c2e75a67e47a1b6df97154e8" + "reference": "998e499b786805568deaf8cbf06f4044f05d91bf" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/php-webdriver/php-webdriver/zipball/cd52d9342c5aa738c2e75a67e47a1b6df97154e8", - "reference": "cd52d9342c5aa738c2e75a67e47a1b6df97154e8", + "url": "https://api.github.com/repos/php-webdriver/php-webdriver/zipball/998e499b786805568deaf8cbf06f4044f05d91bf", + "reference": "998e499b786805568deaf8cbf06f4044f05d91bf", "shasum": "" }, "require": { @@ -10576,7 +10689,7 @@ "php-parallel-lint/php-parallel-lint": "^1.2", "phpunit/phpunit": "^9.3", "squizlabs/php_codesniffer": "^3.5", - "symfony/var-dumper": "^5.0 || ^6.0" + "symfony/var-dumper": "^5.0 || ^6.0 || ^7.0" }, "suggest": { "ext-SimpleXML": "For Firefox profile creation" @@ -10605,318 +10718,41 @@ ], "support": { "issues": "https://github.com/php-webdriver/php-webdriver/issues", - "source": "https://github.com/php-webdriver/php-webdriver/tree/1.15.1" + "source": "https://github.com/php-webdriver/php-webdriver/tree/1.15.2" }, - "time": "2023-10-20T12:21:20+00:00" - }, - { - "name": "phpdocumentor/reflection-common", - "version": "2.2.0", - "source": { - "type": "git", - "url": "https://github.com/phpDocumentor/ReflectionCommon.git", - "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/1d01c49d4ed62f25aa84a747ad35d5a16924662b", - "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b", - "shasum": "" - }, - "require": { - "php": "^7.2 || ^8.0" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-2.x": "2.x-dev" - } - }, - "autoload": { - "psr-4": { - "phpDocumentor\\Reflection\\": "src/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Jaap van Otterdijk", - "email": "opensource@ijaap.nl" - } - ], - "description": "Common reflection classes used by phpdocumentor to reflect the code structure", - "homepage": "http://www.phpdoc.org", - "keywords": [ - "FQSEN", - "phpDocumentor", - "phpdoc", - "reflection", - "static analysis" - ], - "support": { - "issues": "https://github.com/phpDocumentor/ReflectionCommon/issues", - "source": "https://github.com/phpDocumentor/ReflectionCommon/tree/2.x" - }, - "time": "2020-06-27T09:03:43+00:00" - }, - { - "name": "phpdocumentor/reflection-docblock", - "version": "5.3.0", - "source": { - "type": "git", - "url": "https://github.com/phpDocumentor/ReflectionDocBlock.git", - "reference": "622548b623e81ca6d78b721c5e029f4ce664f170" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/phpDocumentor/ReflectionDocBlock/zipball/622548b623e81ca6d78b721c5e029f4ce664f170", - "reference": "622548b623e81ca6d78b721c5e029f4ce664f170", - "shasum": "" - }, - "require": { - "ext-filter": "*", - "php": "^7.2 || ^8.0", - "phpdocumentor/reflection-common": "^2.2", - "phpdocumentor/type-resolver": "^1.3", - "webmozart/assert": "^1.9.1" - }, - "require-dev": { - "mockery/mockery": "~1.3.2", - "psalm/phar": "^4.8" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-master": "5.x-dev" - } - }, - "autoload": { - "psr-4": { - "phpDocumentor\\Reflection\\": "src" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Mike van Riel", - "email": "me@mikevanriel.com" - }, - { - "name": "Jaap van Otterdijk", - "email": "account@ijaap.nl" - } - ], - "description": "With this component, a library can provide support for annotations via DocBlocks or otherwise retrieve information that is embedded in a DocBlock.", - "support": { - "issues": "https://github.com/phpDocumentor/ReflectionDocBlock/issues", - "source": "https://github.com/phpDocumentor/ReflectionDocBlock/tree/5.3.0" - }, - "time": "2021-10-19T17:43:47+00:00" - }, - { - "name": "phpdocumentor/type-resolver", - "version": "1.8.2", - "source": { - "type": "git", - "url": "https://github.com/phpDocumentor/TypeResolver.git", - "reference": "153ae662783729388a584b4361f2545e4d841e3c" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/153ae662783729388a584b4361f2545e4d841e3c", - "reference": "153ae662783729388a584b4361f2545e4d841e3c", - "shasum": "" - }, - "require": { - "doctrine/deprecations": "^1.0", - "php": "^7.3 || ^8.0", - "phpdocumentor/reflection-common": "^2.0", - "phpstan/phpdoc-parser": "^1.13" - }, - "require-dev": { - "ext-tokenizer": "*", - "phpbench/phpbench": "^1.2", - "phpstan/extension-installer": "^1.1", - "phpstan/phpstan": "^1.8", - "phpstan/phpstan-phpunit": "^1.1", - "phpunit/phpunit": "^9.5", - "rector/rector": "^0.13.9", - "vimeo/psalm": "^4.25" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-1.x": "1.x-dev" - } - }, - "autoload": { - "psr-4": { - "phpDocumentor\\Reflection\\": "src" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Mike van Riel", - "email": "me@mikevanriel.com" - } - ], - "description": "A PSR-5 based resolver of Class names, Types and Structural Element Names", - "support": { - "issues": "https://github.com/phpDocumentor/TypeResolver/issues", - "source": "https://github.com/phpDocumentor/TypeResolver/tree/1.8.2" - }, - "time": "2024-02-23T11:10:43+00:00" - }, - { - "name": "phpstan/phpdoc-parser", - "version": "1.26.0", - "source": { - "type": "git", - "url": "https://github.com/phpstan/phpdoc-parser.git", - "reference": "231e3186624c03d7e7c890ec662b81e6b0405227" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/phpstan/phpdoc-parser/zipball/231e3186624c03d7e7c890ec662b81e6b0405227", - "reference": "231e3186624c03d7e7c890ec662b81e6b0405227", - "shasum": "" - }, - "require": { - "php": "^7.2 || ^8.0" - }, - "require-dev": { - "doctrine/annotations": "^2.0", - "nikic/php-parser": "^4.15", - "php-parallel-lint/php-parallel-lint": "^1.2", - "phpstan/extension-installer": "^1.0", - "phpstan/phpstan": "^1.5", - "phpstan/phpstan-phpunit": "^1.1", - "phpstan/phpstan-strict-rules": "^1.0", - "phpunit/phpunit": "^9.5", - "symfony/process": "^5.2" - }, - "type": "library", - "autoload": { - "psr-4": { - "PHPStan\\PhpDocParser\\": [ - "src/" - ] - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "description": "PHPDoc parser with support for nullable, intersection and generic types", - "support": { - "issues": "https://github.com/phpstan/phpdoc-parser/issues", - "source": "https://github.com/phpstan/phpdoc-parser/tree/1.26.0" - }, - "time": "2024-02-23T16:05:55+00:00" - }, - { - "name": "phpstan/phpstan", - "version": "1.10.63", - "source": { - "type": "git", - "url": "https://github.com/phpstan/phpstan.git", - "reference": "ad12836d9ca227301f5fb9960979574ed8628339" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/phpstan/phpstan/zipball/ad12836d9ca227301f5fb9960979574ed8628339", - "reference": "ad12836d9ca227301f5fb9960979574ed8628339", - "shasum": "" - }, - "require": { - "php": "^7.2|^8.0" - }, - "conflict": { - "phpstan/phpstan-shim": "*" - }, - "bin": [ - "phpstan", - "phpstan.phar" - ], - "type": "library", - "autoload": { - "files": [ - "bootstrap.php" - ] - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "description": "PHPStan - PHP Static Analysis Tool", - "keywords": [ - "dev", - "static analysis" - ], - "support": { - "docs": "https://phpstan.org/user-guide/getting-started", - "forum": "https://github.com/phpstan/phpstan/discussions", - "issues": "https://github.com/phpstan/phpstan/issues", - "security": "https://github.com/phpstan/phpstan/security/policy", - "source": "https://github.com/phpstan/phpstan-src" - }, - "funding": [ - { - "url": "https://github.com/ondrejmirtes", - "type": "github" - }, - { - "url": "https://github.com/phpstan", - "type": "github" - }, - { - "url": "https://tidelift.com/funding/github/packagist/phpstan/phpstan", - "type": "tidelift" - } - ], - "time": "2024-03-18T16:53:53+00:00" + "time": "2024-11-21T15:12:59+00:00" }, { "name": "phpunit/php-code-coverage", - "version": "10.1.14", + "version": "11.0.10", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/php-code-coverage.git", - "reference": "e3f51450ebffe8e0efdf7346ae966a656f7d5e5b" + "reference": "1a800a7446add2d79cc6b3c01c45381810367d76" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/e3f51450ebffe8e0efdf7346ae966a656f7d5e5b", - "reference": "e3f51450ebffe8e0efdf7346ae966a656f7d5e5b", + "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/1a800a7446add2d79cc6b3c01c45381810367d76", + "reference": "1a800a7446add2d79cc6b3c01c45381810367d76", "shasum": "" }, "require": { "ext-dom": "*", "ext-libxml": "*", "ext-xmlwriter": "*", - "nikic/php-parser": "^4.18 || ^5.0", - "php": ">=8.1", - "phpunit/php-file-iterator": "^4.0", - "phpunit/php-text-template": "^3.0", - "sebastian/code-unit-reverse-lookup": "^3.0", - "sebastian/complexity": "^3.0", - "sebastian/environment": "^6.0", - "sebastian/lines-of-code": "^2.0", - "sebastian/version": "^4.0", - "theseer/tokenizer": "^1.2.0" + "nikic/php-parser": "^5.4.0", + "php": ">=8.2", + "phpunit/php-file-iterator": "^5.1.0", + "phpunit/php-text-template": "^4.0.1", + "sebastian/code-unit-reverse-lookup": "^4.0.1", + "sebastian/complexity": "^4.0.1", + "sebastian/environment": "^7.2.0", + "sebastian/lines-of-code": "^3.0.1", + "sebastian/version": "^5.0.2", + "theseer/tokenizer": "^1.2.3" }, "require-dev": { - "phpunit/phpunit": "^10.1" + "phpunit/phpunit": "^11.5.2" }, "suggest": { "ext-pcov": "PHP extension that provides line coverage", @@ -10925,7 +10761,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-main": "10.1-dev" + "dev-main": "11.0.x-dev" } }, "autoload": { @@ -10954,40 +10790,52 @@ "support": { "issues": "https://github.com/sebastianbergmann/php-code-coverage/issues", "security": "https://github.com/sebastianbergmann/php-code-coverage/security/policy", - "source": "https://github.com/sebastianbergmann/php-code-coverage/tree/10.1.14" + "source": "https://github.com/sebastianbergmann/php-code-coverage/tree/show" }, "funding": [ { "url": "https://github.com/sebastianbergmann", "type": "github" + }, + { + "url": "https://liberapay.com/sebastianbergmann", + "type": "liberapay" + }, + { + "url": "https://thanks.dev/u/gh/sebastianbergmann", + "type": "thanks_dev" + }, + { + "url": "https://tidelift.com/funding/github/packagist/phpunit/php-code-coverage", + "type": "tidelift" } ], - "time": "2024-03-12T15:33:41+00:00" + "time": "2025-06-18T08:56:18+00:00" }, { "name": "phpunit/php-file-iterator", - "version": "4.1.0", + "version": "5.1.0", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/php-file-iterator.git", - "reference": "a95037b6d9e608ba092da1b23931e537cadc3c3c" + "reference": "118cfaaa8bc5aef3287bf315b6060b1174754af6" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/a95037b6d9e608ba092da1b23931e537cadc3c3c", - "reference": "a95037b6d9e608ba092da1b23931e537cadc3c3c", + "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/118cfaaa8bc5aef3287bf315b6060b1174754af6", + "reference": "118cfaaa8bc5aef3287bf315b6060b1174754af6", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "4.0-dev" + "dev-main": "5.0-dev" } }, "autoload": { @@ -11015,7 +10863,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/php-file-iterator/issues", "security": "https://github.com/sebastianbergmann/php-file-iterator/security/policy", - "source": "https://github.com/sebastianbergmann/php-file-iterator/tree/4.1.0" + "source": "https://github.com/sebastianbergmann/php-file-iterator/tree/5.1.0" }, "funding": [ { @@ -11023,28 +10871,28 @@ "type": "github" } ], - "time": "2023-08-31T06:24:48+00:00" + "time": "2024-08-27T05:02:59+00:00" }, { "name": "phpunit/php-invoker", - "version": "4.0.0", + "version": "5.0.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/php-invoker.git", - "reference": "f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7" + "reference": "c1ca3814734c07492b3d4c5f794f4b0995333da2" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/php-invoker/zipball/f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7", - "reference": "f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7", + "url": "https://api.github.com/repos/sebastianbergmann/php-invoker/zipball/c1ca3814734c07492b3d4c5f794f4b0995333da2", + "reference": "c1ca3814734c07492b3d4c5f794f4b0995333da2", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { "ext-pcntl": "*", - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "suggest": { "ext-pcntl": "*" @@ -11052,7 +10900,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-main": "4.0-dev" + "dev-main": "5.0-dev" } }, "autoload": { @@ -11078,7 +10926,8 @@ ], "support": { "issues": "https://github.com/sebastianbergmann/php-invoker/issues", - "source": "https://github.com/sebastianbergmann/php-invoker/tree/4.0.0" + "security": "https://github.com/sebastianbergmann/php-invoker/security/policy", + "source": "https://github.com/sebastianbergmann/php-invoker/tree/5.0.1" }, "funding": [ { @@ -11086,32 +10935,32 @@ "type": "github" } ], - "time": "2023-02-03T06:56:09+00:00" + "time": "2024-07-03T05:07:44+00:00" }, { "name": "phpunit/php-text-template", - "version": "3.0.1", + "version": "4.0.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/php-text-template.git", - "reference": "0c7b06ff49e3d5072f057eb1fa59258bf287a748" + "reference": "3e0404dc6b300e6bf56415467ebcb3fe4f33e964" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/0c7b06ff49e3d5072f057eb1fa59258bf287a748", - "reference": "0c7b06ff49e3d5072f057eb1fa59258bf287a748", + "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/3e0404dc6b300e6bf56415467ebcb3fe4f33e964", + "reference": "3e0404dc6b300e6bf56415467ebcb3fe4f33e964", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "3.0-dev" + "dev-main": "4.0-dev" } }, "autoload": { @@ -11138,7 +10987,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/php-text-template/issues", "security": "https://github.com/sebastianbergmann/php-text-template/security/policy", - "source": "https://github.com/sebastianbergmann/php-text-template/tree/3.0.1" + "source": "https://github.com/sebastianbergmann/php-text-template/tree/4.0.1" }, "funding": [ { @@ -11146,32 +10995,32 @@ "type": "github" } ], - "time": "2023-08-31T14:07:24+00:00" + "time": "2024-07-03T05:08:43+00:00" }, { "name": "phpunit/php-timer", - "version": "6.0.0", + "version": "7.0.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/php-timer.git", - "reference": "e2a2d67966e740530f4a3343fe2e030ffdc1161d" + "reference": "3b415def83fbcb41f991d9ebf16ae4ad8b7837b3" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/e2a2d67966e740530f4a3343fe2e030ffdc1161d", - "reference": "e2a2d67966e740530f4a3343fe2e030ffdc1161d", + "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/3b415def83fbcb41f991d9ebf16ae4ad8b7837b3", + "reference": "3b415def83fbcb41f991d9ebf16ae4ad8b7837b3", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "6.0-dev" + "dev-main": "7.0-dev" } }, "autoload": { @@ -11197,7 +11046,8 @@ ], "support": { "issues": "https://github.com/sebastianbergmann/php-timer/issues", - "source": "https://github.com/sebastianbergmann/php-timer/tree/6.0.0" + "security": "https://github.com/sebastianbergmann/php-timer/security/policy", + "source": "https://github.com/sebastianbergmann/php-timer/tree/7.0.1" }, "funding": [ { @@ -11205,20 +11055,20 @@ "type": "github" } ], - "time": "2023-02-03T06:57:52+00:00" + "time": "2024-07-03T05:09:35+00:00" }, { "name": "phpunit/phpunit", - "version": "10.5.15", + "version": "11.5.25", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/phpunit.git", - "reference": "86376e05e8745ed81d88232ff92fee868247b07b" + "reference": "864ab32b3ff52058f917c5b19b3cef821e4a4f1b" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/86376e05e8745ed81d88232ff92fee868247b07b", - "reference": "86376e05e8745ed81d88232ff92fee868247b07b", + "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/864ab32b3ff52058f917c5b19b3cef821e4a4f1b", + "reference": "864ab32b3ff52058f917c5b19b3cef821e4a4f1b", "shasum": "" }, "require": { @@ -11228,26 +11078,26 @@ "ext-mbstring": "*", "ext-xml": "*", "ext-xmlwriter": "*", - "myclabs/deep-copy": "^1.10.1", - "phar-io/manifest": "^2.0.3", - "phar-io/version": "^3.0.2", - "php": ">=8.1", - "phpunit/php-code-coverage": "^10.1.5", - "phpunit/php-file-iterator": "^4.0", - "phpunit/php-invoker": "^4.0", - "phpunit/php-text-template": "^3.0", - "phpunit/php-timer": "^6.0", - "sebastian/cli-parser": "^2.0", - "sebastian/code-unit": "^2.0", - "sebastian/comparator": "^5.0", - "sebastian/diff": "^5.0", - "sebastian/environment": "^6.0", - "sebastian/exporter": "^5.1", - "sebastian/global-state": "^6.0.1", - "sebastian/object-enumerator": "^5.0", - "sebastian/recursion-context": "^5.0", - "sebastian/type": "^4.0", - "sebastian/version": "^4.0" + "myclabs/deep-copy": "^1.13.1", + "phar-io/manifest": "^2.0.4", + "phar-io/version": "^3.2.1", + "php": ">=8.2", + "phpunit/php-code-coverage": "^11.0.10", + "phpunit/php-file-iterator": "^5.1.0", + "phpunit/php-invoker": "^5.0.1", + "phpunit/php-text-template": "^4.0.1", + "phpunit/php-timer": "^7.0.1", + "sebastian/cli-parser": "^3.0.2", + "sebastian/code-unit": "^3.0.3", + "sebastian/comparator": "^6.3.1", + "sebastian/diff": "^6.0.2", + "sebastian/environment": "^7.2.1", + "sebastian/exporter": "^6.3.0", + "sebastian/global-state": "^7.0.2", + "sebastian/object-enumerator": "^6.0.1", + "sebastian/type": "^5.1.2", + "sebastian/version": "^5.0.2", + "staabm/side-effects-detector": "^1.0.5" }, "suggest": { "ext-soap": "To be able to generate mocks based on WSDL files" @@ -11258,7 +11108,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-main": "10.5-dev" + "dev-main": "11.5-dev" } }, "autoload": { @@ -11290,7 +11140,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/phpunit/issues", "security": "https://github.com/sebastianbergmann/phpunit/security/policy", - "source": "https://github.com/sebastianbergmann/phpunit/tree/10.5.15" + "source": "https://github.com/sebastianbergmann/phpunit/tree/11.5.25" }, "funding": [ { @@ -11301,220 +11151,45 @@ "url": "https://github.com/sebastianbergmann", "type": "github" }, + { + "url": "https://liberapay.com/sebastianbergmann", + "type": "liberapay" + }, + { + "url": "https://thanks.dev/u/gh/sebastianbergmann", + "type": "thanks_dev" + }, { "url": "https://tidelift.com/funding/github/packagist/phpunit/phpunit", "type": "tidelift" } ], - "time": "2024-03-22T04:17:47+00:00" - }, - { - "name": "pimple/pimple", - "version": "v3.5.0", - "source": { - "type": "git", - "url": "https://github.com/silexphp/Pimple.git", - "reference": "a94b3a4db7fb774b3d78dad2315ddc07629e1bed" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/silexphp/Pimple/zipball/a94b3a4db7fb774b3d78dad2315ddc07629e1bed", - "reference": "a94b3a4db7fb774b3d78dad2315ddc07629e1bed", - "shasum": "" - }, - "require": { - "php": ">=7.2.5", - "psr/container": "^1.1 || ^2.0" - }, - "require-dev": { - "symfony/phpunit-bridge": "^5.4@dev" - }, - "type": "library", - "extra": { - "branch-alias": { - "dev-master": "3.4.x-dev" - } - }, - "autoload": { - "psr-0": { - "Pimple": "src/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Fabien Potencier", - "email": "fabien@symfony.com" - } - ], - "description": "Pimple, a simple Dependency Injection Container", - "homepage": "https://pimple.symfony.com", - "keywords": [ - "container", - "dependency injection" - ], - "support": { - "source": "https://github.com/silexphp/Pimple/tree/v3.5.0" - }, - "time": "2021-10-28T11:13:42+00:00" - }, - { - "name": "psalm/plugin-laravel", - "version": "v2.10.1", - "source": { - "type": "git", - "url": "https://github.com/psalm/psalm-plugin-laravel.git", - "reference": "a87f401437c0555af5f6570566bf6e689916a316" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/psalm/psalm-plugin-laravel/zipball/a87f401437c0555af5f6570566bf6e689916a316", - "reference": "a87f401437c0555af5f6570566bf6e689916a316", - "shasum": "" - }, - "require": { - "barryvdh/laravel-ide-helper": "^2.13 || ^3.0", - "ext-simplexml": "*", - "illuminate/config": "^10.48 || ^11.0", - "illuminate/container": "^10.48 || ^11.0", - "illuminate/contracts": "^10.48 || ^11.0", - "illuminate/database": "^10.48 || ^11.0", - "illuminate/events": "^10.48 || ^11.0", - "illuminate/http": "^10.48 || ^11.0", - "illuminate/routing": "^10.48 || ^11.0", - "illuminate/support": "^10.48 || ^11.0", - "illuminate/view": "^10.48 || ^11.0", - "nikic/php-parser": "^4.18 || ^5.0", - "orchestra/testbench-core": "^8.22 || ^9.0", - "php": "^8.1", - "symfony/console": "^6.0 || ^7.0", - "vimeo/psalm": "^5.20" - }, - "require-dev": { - "codeception/codeception": "^5.0", - "codeception/module-asserts": "^3.0", - "codeception/module-cli": "^2.0", - "codeception/module-filesystem": "^3.0", - "codeception/module-phpbrowser": "^3.0", - "laravel/framework": "^10.48 || ^11.0", - "phpunit/phpunit": "^10.5 || ^11.0", - "ramsey/collection": "^1.3", - "slevomat/coding-standard": "^8.8", - "squizlabs/php_codesniffer": "*", - "symfony/http-foundation": "^6.0 || ^7.0" - }, - "type": "psalm-plugin", - "extra": { - "psalm": { - "pluginClass": "Psalm\\LaravelPlugin\\Plugin" - } - }, - "autoload": { - "psr-4": { - "Psalm\\LaravelPlugin\\": "src" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Matthew Brown", - "email": "github@muglug.com" - } - ], - "description": "Psalm plugin for Laravel", - "homepage": "https://github.com/psalm/psalm-plugin-laravel", - "support": { - "issues": "https://github.com/psalm/psalm-plugin-laravel/issues", - "source": "https://github.com/psalm/psalm-plugin-laravel/tree/v2.10.1" - }, - "time": "2024-03-13T11:16:29+00:00" - }, - { - "name": "rector/rector", - "version": "1.0.3", - "source": { - "type": "git", - "url": "https://github.com/rectorphp/rector.git", - "reference": "c59507a9090b465d65e1aceed91e5b81986e375b" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/rectorphp/rector/zipball/c59507a9090b465d65e1aceed91e5b81986e375b", - "reference": "c59507a9090b465d65e1aceed91e5b81986e375b", - "shasum": "" - }, - "require": { - "php": "^7.2|^8.0", - "phpstan/phpstan": "^1.10.57" - }, - "conflict": { - "rector/rector-doctrine": "*", - "rector/rector-downgrade-php": "*", - "rector/rector-phpunit": "*", - "rector/rector-symfony": "*" - }, - "bin": [ - "bin/rector" - ], - "type": "library", - "autoload": { - "files": [ - "bootstrap.php" - ] - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "description": "Instant Upgrade and Automated Refactoring of any PHP code", - "keywords": [ - "automation", - "dev", - "migration", - "refactoring" - ], - "support": { - "issues": "https://github.com/rectorphp/rector/issues", - "source": "https://github.com/rectorphp/rector/tree/1.0.3" - }, - "funding": [ - { - "url": "https://github.com/tomasvotruba", - "type": "github" - } - ], - "time": "2024-03-14T15:04:18+00:00" + "time": "2025-06-27T04:36:07+00:00" }, { "name": "sebastian/cli-parser", - "version": "2.0.1", + "version": "3.0.2", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/cli-parser.git", - "reference": "c34583b87e7b7a8055bf6c450c2c77ce32a24084" + "reference": "15c5dd40dc4f38794d383bb95465193f5e0ae180" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/cli-parser/zipball/c34583b87e7b7a8055bf6c450c2c77ce32a24084", - "reference": "c34583b87e7b7a8055bf6c450c2c77ce32a24084", + "url": "https://api.github.com/repos/sebastianbergmann/cli-parser/zipball/15c5dd40dc4f38794d383bb95465193f5e0ae180", + "reference": "15c5dd40dc4f38794d383bb95465193f5e0ae180", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "2.0-dev" + "dev-main": "3.0-dev" } }, "autoload": { @@ -11538,7 +11213,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/cli-parser/issues", "security": "https://github.com/sebastianbergmann/cli-parser/security/policy", - "source": "https://github.com/sebastianbergmann/cli-parser/tree/2.0.1" + "source": "https://github.com/sebastianbergmann/cli-parser/tree/3.0.2" }, "funding": [ { @@ -11546,32 +11221,32 @@ "type": "github" } ], - "time": "2024-03-02T07:12:49+00:00" + "time": "2024-07-03T04:41:36+00:00" }, { "name": "sebastian/code-unit", - "version": "2.0.0", + "version": "3.0.3", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/code-unit.git", - "reference": "a81fee9eef0b7a76af11d121767abc44c104e503" + "reference": "54391c61e4af8078e5b276ab082b6d3c54c9ad64" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/code-unit/zipball/a81fee9eef0b7a76af11d121767abc44c104e503", - "reference": "a81fee9eef0b7a76af11d121767abc44c104e503", + "url": "https://api.github.com/repos/sebastianbergmann/code-unit/zipball/54391c61e4af8078e5b276ab082b6d3c54c9ad64", + "reference": "54391c61e4af8078e5b276ab082b6d3c54c9ad64", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.5" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "2.0-dev" + "dev-main": "3.0-dev" } }, "autoload": { @@ -11594,7 +11269,8 @@ "homepage": "https://github.com/sebastianbergmann/code-unit", "support": { "issues": "https://github.com/sebastianbergmann/code-unit/issues", - "source": "https://github.com/sebastianbergmann/code-unit/tree/2.0.0" + "security": "https://github.com/sebastianbergmann/code-unit/security/policy", + "source": "https://github.com/sebastianbergmann/code-unit/tree/3.0.3" }, "funding": [ { @@ -11602,32 +11278,32 @@ "type": "github" } ], - "time": "2023-02-03T06:58:43+00:00" + "time": "2025-03-19T07:56:08+00:00" }, { "name": "sebastian/code-unit-reverse-lookup", - "version": "3.0.0", + "version": "4.0.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/code-unit-reverse-lookup.git", - "reference": "5e3a687f7d8ae33fb362c5c0743794bbb2420a1d" + "reference": "183a9b2632194febd219bb9246eee421dad8d45e" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/5e3a687f7d8ae33fb362c5c0743794bbb2420a1d", - "reference": "5e3a687f7d8ae33fb362c5c0743794bbb2420a1d", + "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/183a9b2632194febd219bb9246eee421dad8d45e", + "reference": "183a9b2632194febd219bb9246eee421dad8d45e", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "3.0-dev" + "dev-main": "4.0-dev" } }, "autoload": { @@ -11649,7 +11325,8 @@ "homepage": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/", "support": { "issues": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/issues", - "source": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/tree/3.0.0" + "security": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/security/policy", + "source": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/tree/4.0.1" }, "funding": [ { @@ -11657,36 +11334,39 @@ "type": "github" } ], - "time": "2023-02-03T06:59:15+00:00" + "time": "2024-07-03T04:45:54+00:00" }, { "name": "sebastian/comparator", - "version": "5.0.1", + "version": "6.3.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/comparator.git", - "reference": "2db5010a484d53ebf536087a70b4a5423c102372" + "reference": "24b8fbc2c8e201bb1308e7b05148d6ab393b6959" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/2db5010a484d53ebf536087a70b4a5423c102372", - "reference": "2db5010a484d53ebf536087a70b4a5423c102372", + "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/24b8fbc2c8e201bb1308e7b05148d6ab393b6959", + "reference": "24b8fbc2c8e201bb1308e7b05148d6ab393b6959", "shasum": "" }, "require": { "ext-dom": "*", "ext-mbstring": "*", - "php": ">=8.1", - "sebastian/diff": "^5.0", - "sebastian/exporter": "^5.0" + "php": ">=8.2", + "sebastian/diff": "^6.0", + "sebastian/exporter": "^6.0" }, "require-dev": { - "phpunit/phpunit": "^10.3" + "phpunit/phpunit": "^11.4" + }, + "suggest": { + "ext-bcmath": "For comparing BcMath\\Number objects" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "5.0-dev" + "dev-main": "6.3-dev" } }, "autoload": { @@ -11726,7 +11406,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/comparator/issues", "security": "https://github.com/sebastianbergmann/comparator/security/policy", - "source": "https://github.com/sebastianbergmann/comparator/tree/5.0.1" + "source": "https://github.com/sebastianbergmann/comparator/tree/6.3.1" }, "funding": [ { @@ -11734,33 +11414,33 @@ "type": "github" } ], - "time": "2023-08-14T13:18:12+00:00" + "time": "2025-03-07T06:57:01+00:00" }, { "name": "sebastian/complexity", - "version": "3.2.0", + "version": "4.0.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/complexity.git", - "reference": "68ff824baeae169ec9f2137158ee529584553799" + "reference": "ee41d384ab1906c68852636b6de493846e13e5a0" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/complexity/zipball/68ff824baeae169ec9f2137158ee529584553799", - "reference": "68ff824baeae169ec9f2137158ee529584553799", + "url": "https://api.github.com/repos/sebastianbergmann/complexity/zipball/ee41d384ab1906c68852636b6de493846e13e5a0", + "reference": "ee41d384ab1906c68852636b6de493846e13e5a0", "shasum": "" }, "require": { - "nikic/php-parser": "^4.18 || ^5.0", - "php": ">=8.1" + "nikic/php-parser": "^5.0", + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "3.2-dev" + "dev-main": "4.0-dev" } }, "autoload": { @@ -11784,7 +11464,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/complexity/issues", "security": "https://github.com/sebastianbergmann/complexity/security/policy", - "source": "https://github.com/sebastianbergmann/complexity/tree/3.2.0" + "source": "https://github.com/sebastianbergmann/complexity/tree/4.0.1" }, "funding": [ { @@ -11792,33 +11472,33 @@ "type": "github" } ], - "time": "2023-12-21T08:37:17+00:00" + "time": "2024-07-03T04:49:50+00:00" }, { "name": "sebastian/diff", - "version": "5.1.1", + "version": "6.0.2", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/diff.git", - "reference": "c41e007b4b62af48218231d6c2275e4c9b975b2e" + "reference": "b4ccd857127db5d41a5b676f24b51371d76d8544" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/c41e007b4b62af48218231d6c2275e4c9b975b2e", - "reference": "c41e007b4b62af48218231d6c2275e4c9b975b2e", + "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/b4ccd857127db5d41a5b676f24b51371d76d8544", + "reference": "b4ccd857127db5d41a5b676f24b51371d76d8544", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0", - "symfony/process": "^6.4" + "phpunit/phpunit": "^11.0", + "symfony/process": "^4.2 || ^5" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "5.1-dev" + "dev-main": "6.0-dev" } }, "autoload": { @@ -11851,7 +11531,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/diff/issues", "security": "https://github.com/sebastianbergmann/diff/security/policy", - "source": "https://github.com/sebastianbergmann/diff/tree/5.1.1" + "source": "https://github.com/sebastianbergmann/diff/tree/6.0.2" }, "funding": [ { @@ -11859,27 +11539,27 @@ "type": "github" } ], - "time": "2024-03-02T07:15:17+00:00" + "time": "2024-07-03T04:53:05+00:00" }, { "name": "sebastian/environment", - "version": "6.0.1", + "version": "7.2.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/environment.git", - "reference": "43c751b41d74f96cbbd4e07b7aec9675651e2951" + "reference": "a5c75038693ad2e8d4b6c15ba2403532647830c4" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/43c751b41d74f96cbbd4e07b7aec9675651e2951", - "reference": "43c751b41d74f96cbbd4e07b7aec9675651e2951", + "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/a5c75038693ad2e8d4b6c15ba2403532647830c4", + "reference": "a5c75038693ad2e8d4b6c15ba2403532647830c4", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.3" }, "suggest": { "ext-posix": "*" @@ -11887,7 +11567,7 @@ "type": "library", "extra": { "branch-alias": { - "dev-main": "6.0-dev" + "dev-main": "7.2-dev" } }, "autoload": { @@ -11915,42 +11595,54 @@ "support": { "issues": "https://github.com/sebastianbergmann/environment/issues", "security": "https://github.com/sebastianbergmann/environment/security/policy", - "source": "https://github.com/sebastianbergmann/environment/tree/6.0.1" + "source": "https://github.com/sebastianbergmann/environment/tree/7.2.1" }, "funding": [ { "url": "https://github.com/sebastianbergmann", "type": "github" + }, + { + "url": "https://liberapay.com/sebastianbergmann", + "type": "liberapay" + }, + { + "url": "https://thanks.dev/u/gh/sebastianbergmann", + "type": "thanks_dev" + }, + { + "url": "https://tidelift.com/funding/github/packagist/sebastian/environment", + "type": "tidelift" } ], - "time": "2023-04-11T05:39:26+00:00" + "time": "2025-05-21T11:55:47+00:00" }, { "name": "sebastian/exporter", - "version": "5.1.2", + "version": "6.3.0", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/exporter.git", - "reference": "955288482d97c19a372d3f31006ab3f37da47adf" + "reference": "3473f61172093b2da7de1fb5782e1f24cc036dc3" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/955288482d97c19a372d3f31006ab3f37da47adf", - "reference": "955288482d97c19a372d3f31006ab3f37da47adf", + "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/3473f61172093b2da7de1fb5782e1f24cc036dc3", + "reference": "3473f61172093b2da7de1fb5782e1f24cc036dc3", "shasum": "" }, "require": { "ext-mbstring": "*", - "php": ">=8.1", - "sebastian/recursion-context": "^5.0" + "php": ">=8.2", + "sebastian/recursion-context": "^6.0" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.3" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "5.1-dev" + "dev-main": "6.1-dev" } }, "autoload": { @@ -11993,7 +11685,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/exporter/issues", "security": "https://github.com/sebastianbergmann/exporter/security/policy", - "source": "https://github.com/sebastianbergmann/exporter/tree/5.1.2" + "source": "https://github.com/sebastianbergmann/exporter/tree/6.3.0" }, "funding": [ { @@ -12001,35 +11693,35 @@ "type": "github" } ], - "time": "2024-03-02T07:17:12+00:00" + "time": "2024-12-05T09:17:50+00:00" }, { "name": "sebastian/global-state", - "version": "6.0.2", + "version": "7.0.2", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/global-state.git", - "reference": "987bafff24ecc4c9ac418cab1145b96dd6e9cbd9" + "reference": "3be331570a721f9a4b5917f4209773de17f747d7" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/987bafff24ecc4c9ac418cab1145b96dd6e9cbd9", - "reference": "987bafff24ecc4c9ac418cab1145b96dd6e9cbd9", + "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/3be331570a721f9a4b5917f4209773de17f747d7", + "reference": "3be331570a721f9a4b5917f4209773de17f747d7", "shasum": "" }, "require": { - "php": ">=8.1", - "sebastian/object-reflector": "^3.0", - "sebastian/recursion-context": "^5.0" + "php": ">=8.2", + "sebastian/object-reflector": "^4.0", + "sebastian/recursion-context": "^6.0" }, "require-dev": { "ext-dom": "*", - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "6.0-dev" + "dev-main": "7.0-dev" } }, "autoload": { @@ -12055,7 +11747,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/global-state/issues", "security": "https://github.com/sebastianbergmann/global-state/security/policy", - "source": "https://github.com/sebastianbergmann/global-state/tree/6.0.2" + "source": "https://github.com/sebastianbergmann/global-state/tree/7.0.2" }, "funding": [ { @@ -12063,33 +11755,33 @@ "type": "github" } ], - "time": "2024-03-02T07:19:19+00:00" + "time": "2024-07-03T04:57:36+00:00" }, { "name": "sebastian/lines-of-code", - "version": "2.0.2", + "version": "3.0.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/lines-of-code.git", - "reference": "856e7f6a75a84e339195d48c556f23be2ebf75d0" + "reference": "d36ad0d782e5756913e42ad87cb2890f4ffe467a" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/lines-of-code/zipball/856e7f6a75a84e339195d48c556f23be2ebf75d0", - "reference": "856e7f6a75a84e339195d48c556f23be2ebf75d0", + "url": "https://api.github.com/repos/sebastianbergmann/lines-of-code/zipball/d36ad0d782e5756913e42ad87cb2890f4ffe467a", + "reference": "d36ad0d782e5756913e42ad87cb2890f4ffe467a", "shasum": "" }, "require": { - "nikic/php-parser": "^4.18 || ^5.0", - "php": ">=8.1" + "nikic/php-parser": "^5.0", + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "2.0-dev" + "dev-main": "3.0-dev" } }, "autoload": { @@ -12113,7 +11805,7 @@ "support": { "issues": "https://github.com/sebastianbergmann/lines-of-code/issues", "security": "https://github.com/sebastianbergmann/lines-of-code/security/policy", - "source": "https://github.com/sebastianbergmann/lines-of-code/tree/2.0.2" + "source": "https://github.com/sebastianbergmann/lines-of-code/tree/3.0.1" }, "funding": [ { @@ -12121,34 +11813,34 @@ "type": "github" } ], - "time": "2023-12-21T08:38:20+00:00" + "time": "2024-07-03T04:58:38+00:00" }, { "name": "sebastian/object-enumerator", - "version": "5.0.0", + "version": "6.0.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/object-enumerator.git", - "reference": "202d0e344a580d7f7d04b3fafce6933e59dae906" + "reference": "f5b498e631a74204185071eb41f33f38d64608aa" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/202d0e344a580d7f7d04b3fafce6933e59dae906", - "reference": "202d0e344a580d7f7d04b3fafce6933e59dae906", + "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/f5b498e631a74204185071eb41f33f38d64608aa", + "reference": "f5b498e631a74204185071eb41f33f38d64608aa", "shasum": "" }, "require": { - "php": ">=8.1", - "sebastian/object-reflector": "^3.0", - "sebastian/recursion-context": "^5.0" + "php": ">=8.2", + "sebastian/object-reflector": "^4.0", + "sebastian/recursion-context": "^6.0" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "5.0-dev" + "dev-main": "6.0-dev" } }, "autoload": { @@ -12170,7 +11862,8 @@ "homepage": "https://github.com/sebastianbergmann/object-enumerator/", "support": { "issues": "https://github.com/sebastianbergmann/object-enumerator/issues", - "source": "https://github.com/sebastianbergmann/object-enumerator/tree/5.0.0" + "security": "https://github.com/sebastianbergmann/object-enumerator/security/policy", + "source": "https://github.com/sebastianbergmann/object-enumerator/tree/6.0.1" }, "funding": [ { @@ -12178,32 +11871,32 @@ "type": "github" } ], - "time": "2023-02-03T07:08:32+00:00" + "time": "2024-07-03T05:00:13+00:00" }, { "name": "sebastian/object-reflector", - "version": "3.0.0", + "version": "4.0.1", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/object-reflector.git", - "reference": "24ed13d98130f0e7122df55d06c5c4942a577957" + "reference": "6e1a43b411b2ad34146dee7524cb13a068bb35f9" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/24ed13d98130f0e7122df55d06c5c4942a577957", - "reference": "24ed13d98130f0e7122df55d06c5c4942a577957", + "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/6e1a43b411b2ad34146dee7524cb13a068bb35f9", + "reference": "6e1a43b411b2ad34146dee7524cb13a068bb35f9", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "3.0-dev" + "dev-main": "4.0-dev" } }, "autoload": { @@ -12225,7 +11918,8 @@ "homepage": "https://github.com/sebastianbergmann/object-reflector/", "support": { "issues": "https://github.com/sebastianbergmann/object-reflector/issues", - "source": "https://github.com/sebastianbergmann/object-reflector/tree/3.0.0" + "security": "https://github.com/sebastianbergmann/object-reflector/security/policy", + "source": "https://github.com/sebastianbergmann/object-reflector/tree/4.0.1" }, "funding": [ { @@ -12233,32 +11927,32 @@ "type": "github" } ], - "time": "2023-02-03T07:06:18+00:00" + "time": "2024-07-03T05:01:32+00:00" }, { "name": "sebastian/recursion-context", - "version": "5.0.0", + "version": "6.0.2", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/recursion-context.git", - "reference": "05909fb5bc7df4c52992396d0116aed689f93712" + "reference": "694d156164372abbd149a4b85ccda2e4670c0e16" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/05909fb5bc7df4c52992396d0116aed689f93712", - "reference": "05909fb5bc7df4c52992396d0116aed689f93712", + "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/694d156164372abbd149a4b85ccda2e4670c0e16", + "reference": "694d156164372abbd149a4b85ccda2e4670c0e16", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.0" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "5.0-dev" + "dev-main": "6.0-dev" } }, "autoload": { @@ -12288,7 +11982,8 @@ "homepage": "https://github.com/sebastianbergmann/recursion-context", "support": { "issues": "https://github.com/sebastianbergmann/recursion-context/issues", - "source": "https://github.com/sebastianbergmann/recursion-context/tree/5.0.0" + "security": "https://github.com/sebastianbergmann/recursion-context/security/policy", + "source": "https://github.com/sebastianbergmann/recursion-context/tree/6.0.2" }, "funding": [ { @@ -12296,32 +11991,32 @@ "type": "github" } ], - "time": "2023-02-03T07:05:40+00:00" + "time": "2024-07-03T05:10:34+00:00" }, { "name": "sebastian/type", - "version": "4.0.0", + "version": "5.1.2", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/type.git", - "reference": "462699a16464c3944eefc02ebdd77882bd3925bf" + "reference": "a8a7e30534b0eb0c77cd9d07e82de1a114389f5e" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/462699a16464c3944eefc02ebdd77882bd3925bf", - "reference": "462699a16464c3944eefc02ebdd77882bd3925bf", + "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/a8a7e30534b0eb0c77cd9d07e82de1a114389f5e", + "reference": "a8a7e30534b0eb0c77cd9d07e82de1a114389f5e", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "require-dev": { - "phpunit/phpunit": "^10.0" + "phpunit/phpunit": "^11.3" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "4.0-dev" + "dev-main": "5.1-dev" } }, "autoload": { @@ -12344,7 +12039,8 @@ "homepage": "https://github.com/sebastianbergmann/type", "support": { "issues": "https://github.com/sebastianbergmann/type/issues", - "source": "https://github.com/sebastianbergmann/type/tree/4.0.0" + "security": "https://github.com/sebastianbergmann/type/security/policy", + "source": "https://github.com/sebastianbergmann/type/tree/5.1.2" }, "funding": [ { @@ -12352,29 +12048,29 @@ "type": "github" } ], - "time": "2023-02-03T07:10:45+00:00" + "time": "2025-03-18T13:35:50+00:00" }, { "name": "sebastian/version", - "version": "4.0.1", + "version": "5.0.2", "source": { "type": "git", "url": "https://github.com/sebastianbergmann/version.git", - "reference": "c51fa83a5d8f43f1402e3f32a005e6262244ef17" + "reference": "c687e3387b99f5b03b6caa64c74b63e2936ff874" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/c51fa83a5d8f43f1402e3f32a005e6262244ef17", - "reference": "c51fa83a5d8f43f1402e3f32a005e6262244ef17", + "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/c687e3387b99f5b03b6caa64c74b63e2936ff874", + "reference": "c687e3387b99f5b03b6caa64c74b63e2936ff874", "shasum": "" }, "require": { - "php": ">=8.1" + "php": ">=8.2" }, "type": "library", "extra": { "branch-alias": { - "dev-main": "4.0-dev" + "dev-main": "5.0-dev" } }, "autoload": { @@ -12397,7 +12093,8 @@ "homepage": "https://github.com/sebastianbergmann/version", "support": { "issues": "https://github.com/sebastianbergmann/version/issues", - "source": "https://github.com/sebastianbergmann/version/tree/4.0.1" + "security": "https://github.com/sebastianbergmann/version/security/policy", + "source": "https://github.com/sebastianbergmann/version/tree/5.0.2" }, "funding": [ { @@ -12405,117 +12102,55 @@ "type": "github" } ], - "time": "2023-02-07T11:34:05+00:00" - }, - { - "name": "spatie/array-to-xml", - "version": "3.2.3", - "source": { - "type": "git", - "url": "https://github.com/spatie/array-to-xml.git", - "reference": "c95fd4db94ec199f798d4b5b4a81757bd20d88ab" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/spatie/array-to-xml/zipball/c95fd4db94ec199f798d4b5b4a81757bd20d88ab", - "reference": "c95fd4db94ec199f798d4b5b4a81757bd20d88ab", - "shasum": "" - }, - "require": { - "ext-dom": "*", - "php": "^8.0" - }, - "require-dev": { - "mockery/mockery": "^1.2", - "pestphp/pest": "^1.21", - "spatie/pest-plugin-snapshots": "^1.1" - }, - "type": "library", - "autoload": { - "psr-4": { - "Spatie\\ArrayToXml\\": "src" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Freek Van der Herten", - "email": "freek@spatie.be", - "homepage": "https://freek.dev", - "role": "Developer" - } - ], - "description": "Convert an array to xml", - "homepage": "https://github.com/spatie/array-to-xml", - "keywords": [ - "array", - "convert", - "xml" - ], - "support": { - "source": "https://github.com/spatie/array-to-xml/tree/3.2.3" - }, - "funding": [ - { - "url": "https://spatie.be/open-source/support-us", - "type": "custom" - }, - { - "url": "https://github.com/spatie", - "type": "github" - } - ], - "time": "2024-02-07T10:39:02+00:00" + "time": "2024-10-09T05:16:32+00:00" }, { "name": "spatie/laravel-ray", - "version": "1.35.1", + "version": "1.40.2", "source": { "type": "git", "url": "https://github.com/spatie/laravel-ray.git", - "reference": "f504d3787d88c7e5de7a4290658f7ad9b1352f22" + "reference": "1d1b31eb83cb38b41975c37363c7461de6d86b25" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/spatie/laravel-ray/zipball/f504d3787d88c7e5de7a4290658f7ad9b1352f22", - "reference": "f504d3787d88c7e5de7a4290658f7ad9b1352f22", + "url": "https://api.github.com/repos/spatie/laravel-ray/zipball/1d1b31eb83cb38b41975c37363c7461de6d86b25", + "reference": "1d1b31eb83cb38b41975c37363c7461de6d86b25", "shasum": "" }, "require": { + "composer-runtime-api": "^2.2", "ext-json": "*", - "illuminate/contracts": "^7.20|^8.19|^9.0|^10.0|^11.0", - "illuminate/database": "^7.20|^8.19|^9.0|^10.0|^11.0", - "illuminate/queue": "^7.20|^8.19|^9.0|^10.0|^11.0", - "illuminate/support": "^7.20|^8.19|^9.0|^10.0|^11.0", - "php": "^7.4|^8.0", - "rector/rector": "^0.19.2|^1.0", - "spatie/backtrace": "^1.0", - "spatie/ray": "^1.41.1", - "symfony/stopwatch": "4.2|^5.1|^6.0|^7.0", - "zbateson/mail-mime-parser": "^1.3.1|^2.0" + "illuminate/contracts": "^7.20 || ^8.19 || ^9.0 || ^10.0 || ^11.0 || ^12.0", + "illuminate/database": "^7.20 || ^8.19 || ^9.0 || ^10.0 || ^11.0 || ^12.0", + "illuminate/queue": "^7.20 || ^8.19 || ^9.0 || ^10.0 || ^11.0 || ^12.0", + "illuminate/support": "^7.20 || ^8.19 || ^9.0 || ^10.0 || ^11.0 || ^12.0", + "php": "^7.4 || ^8.0", + "spatie/backtrace": "^1.7.1", + "spatie/ray": "^1.41.3", + "symfony/stopwatch": "4.2 || ^5.1 || ^6.0 || ^7.0", + "zbateson/mail-mime-parser": "^1.3.1 || ^2.0 || ^3.0" }, "require-dev": { "guzzlehttp/guzzle": "^7.3", - "laravel/framework": "^7.20|^8.19|^9.0|^10.0|^11.0", - "orchestra/testbench-core": "^5.0|^6.0|^7.0|^8.0|^9.0", - "pestphp/pest": "^1.22|^2.0", - "phpstan/phpstan": "^1.10.57", - "phpunit/phpunit": "^9.3|^10.1", - "spatie/pest-plugin-snapshots": "^1.1|^2.0", - "symfony/var-dumper": "^4.2|^5.1|^6.0|^7.0.3" + "laravel/framework": "^7.20 || ^8.19 || ^9.0 || ^10.0 || ^11.0 || ^12.0", + "orchestra/testbench-core": "^5.0 || ^6.0 || ^7.0 || ^8.0 || ^9.0 || ^10.0", + "pestphp/pest": "^1.22 || ^2.0 || ^3.0", + "phpstan/phpstan": "^1.10.57 || ^2.0.2", + "phpunit/phpunit": "^9.3 || ^10.1 || ^11.0.10", + "rector/rector": "^0.19.2 || ^1.0.1 || ^2.0.0", + "spatie/pest-plugin-snapshots": "^1.1 || ^2.0", + "symfony/var-dumper": "^4.2 || ^5.1 || ^6.0 || ^7.0.3" }, "type": "library", "extra": { - "branch-alias": { - "dev-main": "1.29.x-dev" - }, "laravel": { "providers": [ "Spatie\\LaravelRay\\RayServiceProvider" ] + }, + "branch-alias": { + "dev-main": "1.x-dev" } }, "autoload": { @@ -12543,7 +12178,7 @@ ], "support": { "issues": "https://github.com/spatie/laravel-ray/issues", - "source": "https://github.com/spatie/laravel-ray/tree/1.35.1" + "source": "https://github.com/spatie/laravel-ray/tree/1.40.2" }, "funding": [ { @@ -12555,7 +12190,7 @@ "type": "other" } ], - "time": "2024-02-13T14:19:41+00:00" + "time": "2025-03-27T08:26:55+00:00" }, { "name": "spatie/macroable", @@ -12609,35 +12244,35 @@ }, { "name": "spatie/ray", - "version": "1.41.1", + "version": "1.42.0", "source": { "type": "git", "url": "https://github.com/spatie/ray.git", - "reference": "051a0facb1d2462fafef87ff77eb74d6f2d12944" + "reference": "152250ce7c490bf830349fa30ba5200084e95860" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/spatie/ray/zipball/051a0facb1d2462fafef87ff77eb74d6f2d12944", - "reference": "051a0facb1d2462fafef87ff77eb74d6f2d12944", + "url": "https://api.github.com/repos/spatie/ray/zipball/152250ce7c490bf830349fa30ba5200084e95860", + "reference": "152250ce7c490bf830349fa30ba5200084e95860", "shasum": "" }, "require": { "ext-curl": "*", "ext-json": "*", - "php": "^7.3|^8.0", - "ramsey/uuid": "^3.0|^4.1", - "spatie/backtrace": "^1.1", - "spatie/macroable": "^1.0|^2.0", - "symfony/stopwatch": "^4.0|^5.1|^6.0|^7.0", - "symfony/var-dumper": "^4.2|^5.1|^6.0|^7.0" + "php": "^7.4 || ^8.0", + "ramsey/uuid": "^3.0 || ^4.1", + "spatie/backtrace": "^1.7.1", + "spatie/macroable": "^1.0 || ^2.0", + "symfony/stopwatch": "^4.2 || ^5.1 || ^6.0 || ^7.0", + "symfony/var-dumper": "^4.2 || ^5.1 || ^6.0 || ^7.0.3" }, "require-dev": { - "illuminate/support": "6.x|^8.18|^9.0", - "nesbot/carbon": "^2.63", + "illuminate/support": "^7.20 || ^8.18 || ^9.0 || ^10.0 || ^11.0 || ^12.0", + "nesbot/carbon": "^2.63 || ^3.8.4", "pestphp/pest": "^1.22", - "phpstan/phpstan": "^1.10", + "phpstan/phpstan": "^1.10.57 || ^2.0.3", "phpunit/phpunit": "^9.5", - "rector/rector": "^0.19.2", + "rector/rector": "^0.19.2 || ^1.0.1 || ^2.0.0", "spatie/phpunit-snapshot-assertions": "^4.2", "spatie/test-time": "^1.2" }, @@ -12645,6 +12280,11 @@ "bin/remove-ray.sh" ], "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.x-dev" + } + }, "autoload": { "files": [ "src/helpers.php" @@ -12673,7 +12313,7 @@ ], "support": { "issues": "https://github.com/spatie/ray/issues", - "source": "https://github.com/spatie/ray/tree/1.41.1" + "source": "https://github.com/spatie/ray/tree/1.42.0" }, "funding": [ { @@ -12685,35 +12325,43 @@ "type": "other" } ], - "time": "2024-01-25T10:15:50+00:00" + "time": "2025-04-18T08:17:40+00:00" }, { - "name": "symfony/filesystem", - "version": "v7.0.3", + "name": "spatie/x-ray", + "version": "1.2.0", "source": { "type": "git", - "url": "https://github.com/symfony/filesystem.git", - "reference": "2890e3a825bc0c0558526c04499c13f83e1b6b12" + "url": "https://github.com/spatie/x-ray.git", + "reference": "c1d8fe19951b752422d058fc911f14066e4ac346" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/filesystem/zipball/2890e3a825bc0c0558526c04499c13f83e1b6b12", - "reference": "2890e3a825bc0c0558526c04499c13f83e1b6b12", + "url": "https://api.github.com/repos/spatie/x-ray/zipball/c1d8fe19951b752422d058fc911f14066e4ac346", + "reference": "c1d8fe19951b752422d058fc911f14066e4ac346", "shasum": "" }, "require": { - "php": ">=8.2", - "symfony/polyfill-ctype": "~1.8", - "symfony/polyfill-mbstring": "~1.8" + "permafrost-dev/code-snippets": "^1.2.0", + "permafrost-dev/php-code-search": "^1.10.5", + "php": "^8.0", + "symfony/console": "^5.3|^6.0|^7.0", + "symfony/finder": "^5.3|^6.0|^7.0", + "symfony/yaml": "^5.3|^6.0|^7.0" }, + "require-dev": { + "phpstan/phpstan": "^2.0.0", + "phpunit/phpunit": "^9.5", + "spatie/phpunit-snapshot-assertions": "^4.2" + }, + "bin": [ + "bin/x-ray" + ], "type": "library", "autoload": { "psr-4": { - "Symfony\\Component\\Filesystem\\": "" - }, - "exclude-from-classmap": [ - "/Tests/" - ] + "Spatie\\XRay\\": "src/" + } }, "notification-url": "https://packagist.org/downloads/", "license": [ @@ -12721,51 +12369,104 @@ ], "authors": [ { - "name": "Fabien Potencier", - "email": "fabien@symfony.com" - }, - { - "name": "Symfony Community", - "homepage": "https://symfony.com/contributors" + "name": "Patrick Organ", + "email": "patrick@permafrost.dev", + "homepage": "https://permafrost.dev", + "role": "Developer" } ], - "description": "Provides basic utilities for the filesystem", - "homepage": "https://symfony.com", + "description": "Quickly scan source code for calls to Ray", + "homepage": "https://github.com/spatie/x-ray", + "keywords": [ + "permafrost", + "ray", + "search", + "spatie" + ], "support": { - "source": "https://github.com/symfony/filesystem/tree/v7.0.3" + "issues": "https://github.com/spatie/x-ray/issues", + "source": "https://github.com/spatie/x-ray/tree/1.2.0" }, "funding": [ { - "url": "https://symfony.com/sponsor", - "type": "custom" - }, - { - "url": "https://github.com/fabpot", + "url": "https://github.com/sponsors/permafrost-dev", "type": "github" }, { - "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", - "type": "tidelift" + "url": "https://github.com/sponsors/spatie", + "type": "github" } ], - "time": "2024-01-23T15:02:46+00:00" + "time": "2024-11-12T13:23:31+00:00" }, { - "name": "symfony/polyfill-iconv", - "version": "v1.29.0", + "name": "staabm/side-effects-detector", + "version": "1.0.5", "source": { "type": "git", - "url": "https://github.com/symfony/polyfill-iconv.git", - "reference": "cd4226d140ecd3d0f13d32ed0a4a095ffe871d2f" + "url": "https://github.com/staabm/side-effects-detector.git", + "reference": "d8334211a140ce329c13726d4a715adbddd0a163" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/polyfill-iconv/zipball/cd4226d140ecd3d0f13d32ed0a4a095ffe871d2f", - "reference": "cd4226d140ecd3d0f13d32ed0a4a095ffe871d2f", + "url": "https://api.github.com/repos/staabm/side-effects-detector/zipball/d8334211a140ce329c13726d4a715adbddd0a163", + "reference": "d8334211a140ce329c13726d4a715adbddd0a163", "shasum": "" }, "require": { - "php": ">=7.1" + "ext-tokenizer": "*", + "php": "^7.4 || ^8.0" + }, + "require-dev": { + "phpstan/extension-installer": "^1.4.3", + "phpstan/phpstan": "^1.12.6", + "phpunit/phpunit": "^9.6.21", + "symfony/var-dumper": "^5.4.43", + "tomasvotruba/type-coverage": "1.0.0", + "tomasvotruba/unused-public": "1.0.0" + }, + "type": "library", + "autoload": { + "classmap": [ + "lib/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "A static analysis tool to detect side effects in PHP code", + "keywords": [ + "static analysis" + ], + "support": { + "issues": "https://github.com/staabm/side-effects-detector/issues", + "source": "https://github.com/staabm/side-effects-detector/tree/1.0.5" + }, + "funding": [ + { + "url": "https://github.com/staabm", + "type": "github" + } + ], + "time": "2024-10-20T05:08:20+00:00" + }, + { + "name": "symfony/polyfill-iconv", + "version": "v1.32.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-iconv.git", + "reference": "5f3b930437ae03ae5dff61269024d8ea1b3774aa" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-iconv/zipball/5f3b930437ae03ae5dff61269024d8ea1b3774aa", + "reference": "5f3b930437ae03ae5dff61269024d8ea1b3774aa", + "shasum": "" + }, + "require": { + "php": ">=7.2" }, "provide": { "ext-iconv": "*" @@ -12776,8 +12477,8 @@ "type": "library", "extra": { "thanks": { - "name": "symfony/polyfill", - "url": "https://github.com/symfony/polyfill" + "url": "https://github.com/symfony/polyfill", + "name": "symfony/polyfill" } }, "autoload": { @@ -12812,7 +12513,7 @@ "shim" ], "support": { - "source": "https://github.com/symfony/polyfill-iconv/tree/v1.29.0" + "source": "https://github.com/symfony/polyfill-iconv/tree/v1.32.0" }, "funding": [ { @@ -12828,20 +12529,20 @@ "type": "tidelift" } ], - "time": "2024-01-29T20:11:03+00:00" + "time": "2024-09-17T14:58:18+00:00" }, { "name": "symfony/stopwatch", - "version": "v7.0.3", + "version": "v7.3.0", "source": { "type": "git", "url": "https://github.com/symfony/stopwatch.git", - "reference": "983900d6fddf2b0cbaacacbbad07610854bd8112" + "reference": "5a49289e2b308214c8b9c2fda4ea454d8b8ad7cd" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/stopwatch/zipball/983900d6fddf2b0cbaacacbbad07610854bd8112", - "reference": "983900d6fddf2b0cbaacacbbad07610854bd8112", + "url": "https://api.github.com/repos/symfony/stopwatch/zipball/5a49289e2b308214c8b9c2fda4ea454d8b8ad7cd", + "reference": "5a49289e2b308214c8b9c2fda4ea454d8b8ad7cd", "shasum": "" }, "require": { @@ -12874,7 +12575,7 @@ "description": "Provides a way to profile code", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/stopwatch/tree/v7.0.3" + "source": "https://github.com/symfony/stopwatch/tree/v7.3.0" }, "funding": [ { @@ -12890,24 +12591,25 @@ "type": "tidelift" } ], - "time": "2024-01-23T15:02:46+00:00" + "time": "2025-02-24T10:49:57+00:00" }, { "name": "symfony/yaml", - "version": "v7.0.3", + "version": "v7.3.1", "source": { "type": "git", "url": "https://github.com/symfony/yaml.git", - "reference": "2d4fca631c00700597e9442a0b2451ce234513d3" + "reference": "0c3555045a46ab3cd4cc5a69d161225195230edb" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/symfony/yaml/zipball/2d4fca631c00700597e9442a0b2451ce234513d3", - "reference": "2d4fca631c00700597e9442a0b2451ce234513d3", + "url": "https://api.github.com/repos/symfony/yaml/zipball/0c3555045a46ab3cd4cc5a69d161225195230edb", + "reference": "0c3555045a46ab3cd4cc5a69d161225195230edb", "shasum": "" }, "require": { "php": ">=8.2", + "symfony/deprecation-contracts": "^2.5|^3.0", "symfony/polyfill-ctype": "^1.8" }, "conflict": { @@ -12945,7 +12647,7 @@ "description": "Loads and dumps YAML files", "homepage": "https://symfony.com", "support": { - "source": "https://github.com/symfony/yaml/tree/v7.0.3" + "source": "https://github.com/symfony/yaml/tree/v7.3.1" }, "funding": [ { @@ -12961,7 +12663,7 @@ "type": "tidelift" } ], - "time": "2024-01-23T15:02:46+00:00" + "time": "2025-06-03T06:57:57+00:00" }, { "name": "theseer/tokenizer", @@ -13013,142 +12715,33 @@ ], "time": "2024-03-03T12:36:25+00:00" }, - { - "name": "vimeo/psalm", - "version": "5.23.1", - "source": { - "type": "git", - "url": "https://github.com/vimeo/psalm.git", - "reference": "8471a896ccea3526b26d082f4461eeea467f10a4" - }, - "dist": { - "type": "zip", - "url": "https://api.github.com/repos/vimeo/psalm/zipball/8471a896ccea3526b26d082f4461eeea467f10a4", - "reference": "8471a896ccea3526b26d082f4461eeea467f10a4", - "shasum": "" - }, - "require": { - "amphp/amp": "^2.4.2", - "amphp/byte-stream": "^1.5", - "composer-runtime-api": "^2", - "composer/semver": "^1.4 || ^2.0 || ^3.0", - "composer/xdebug-handler": "^2.0 || ^3.0", - "dnoegel/php-xdg-base-dir": "^0.1.1", - "ext-ctype": "*", - "ext-dom": "*", - "ext-json": "*", - "ext-libxml": "*", - "ext-mbstring": "*", - "ext-simplexml": "*", - "ext-tokenizer": "*", - "felixfbecker/advanced-json-rpc": "^3.1", - "felixfbecker/language-server-protocol": "^1.5.2", - "fidry/cpu-core-counter": "^0.4.1 || ^0.5.1 || ^1.0.0", - "netresearch/jsonmapper": "^1.0 || ^2.0 || ^3.0 || ^4.0", - "nikic/php-parser": "^4.16", - "php": "^7.4 || ~8.0.0 || ~8.1.0 || ~8.2.0 || ~8.3.0", - "sebastian/diff": "^4.0 || ^5.0 || ^6.0", - "spatie/array-to-xml": "^2.17.0 || ^3.0", - "symfony/console": "^4.1.6 || ^5.0 || ^6.0 || ^7.0", - "symfony/filesystem": "^5.4 || ^6.0 || ^7.0" - }, - "conflict": { - "nikic/php-parser": "4.17.0" - }, - "provide": { - "psalm/psalm": "self.version" - }, - "require-dev": { - "amphp/phpunit-util": "^2.0", - "bamarni/composer-bin-plugin": "^1.4", - "brianium/paratest": "^6.9", - "ext-curl": "*", - "mockery/mockery": "^1.5", - "nunomaduro/mock-final-classes": "^1.1", - "php-parallel-lint/php-parallel-lint": "^1.2", - "phpstan/phpdoc-parser": "^1.6", - "phpunit/phpunit": "^9.6", - "psalm/plugin-mockery": "^1.1", - "psalm/plugin-phpunit": "^0.18", - "slevomat/coding-standard": "^8.4", - "squizlabs/php_codesniffer": "^3.6", - "symfony/process": "^4.4 || ^5.0 || ^6.0 || ^7.0" - }, - "suggest": { - "ext-curl": "In order to send data to shepherd", - "ext-igbinary": "^2.0.5 is required, used to serialize caching data" - }, - "bin": [ - "psalm", - "psalm-language-server", - "psalm-plugin", - "psalm-refactor", - "psalter" - ], - "type": "project", - "extra": { - "branch-alias": { - "dev-master": "5.x-dev", - "dev-4.x": "4.x-dev", - "dev-3.x": "3.x-dev", - "dev-2.x": "2.x-dev", - "dev-1.x": "1.x-dev" - } - }, - "autoload": { - "psr-4": { - "Psalm\\": "src/Psalm/" - } - }, - "notification-url": "https://packagist.org/downloads/", - "license": [ - "MIT" - ], - "authors": [ - { - "name": "Matthew Brown" - } - ], - "description": "A static analysis tool for finding errors in PHP applications", - "keywords": [ - "code", - "inspection", - "php", - "static analysis" - ], - "support": { - "docs": "https://psalm.dev/docs", - "issues": "https://github.com/vimeo/psalm/issues", - "source": "https://github.com/vimeo/psalm" - }, - "time": "2024-03-11T20:33:46+00:00" - }, { "name": "zbateson/mail-mime-parser", - "version": "2.4.0", + "version": "3.0.3", "source": { "type": "git", "url": "https://github.com/zbateson/mail-mime-parser.git", - "reference": "20b3e48eb799537683780bc8782fbbe9bc25934a" + "reference": "e0d4423fe27850c9dd301190767dbc421acc2f19" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/zbateson/mail-mime-parser/zipball/20b3e48eb799537683780bc8782fbbe9bc25934a", - "reference": "20b3e48eb799537683780bc8782fbbe9bc25934a", + "url": "https://api.github.com/repos/zbateson/mail-mime-parser/zipball/e0d4423fe27850c9dd301190767dbc421acc2f19", + "reference": "e0d4423fe27850c9dd301190767dbc421acc2f19", "shasum": "" }, "require": { - "guzzlehttp/psr7": "^1.7.0|^2.0", - "php": ">=7.1", - "pimple/pimple": "^3.0", - "zbateson/mb-wrapper": "^1.0.1", - "zbateson/stream-decorators": "^1.0.6" + "guzzlehttp/psr7": "^2.5", + "php": ">=8.0", + "php-di/php-di": "^6.0|^7.0", + "psr/log": "^1|^2|^3", + "zbateson/mb-wrapper": "^2.0", + "zbateson/stream-decorators": "^2.1" }, "require-dev": { "friendsofphp/php-cs-fixer": "*", - "mikey179/vfsstream": "^1.6.0", + "monolog/monolog": "^2|^3", "phpstan/phpstan": "*", - "phpunit/phpunit": "<10" + "phpunit/phpunit": "^9.6" }, "suggest": { "ext-iconv": "For best support/performance", @@ -13196,31 +12789,31 @@ "type": "github" } ], - "time": "2023-02-14T22:58:03+00:00" + "time": "2024-08-10T18:44:09+00:00" }, { "name": "zbateson/mb-wrapper", - "version": "1.2.1", + "version": "2.0.1", "source": { "type": "git", "url": "https://github.com/zbateson/mb-wrapper.git", - "reference": "09a8b77eb94af3823a9a6623dcc94f8d988da67f" + "reference": "50a14c0c9537f978a61cde9fdc192a0267cc9cff" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/zbateson/mb-wrapper/zipball/09a8b77eb94af3823a9a6623dcc94f8d988da67f", - "reference": "09a8b77eb94af3823a9a6623dcc94f8d988da67f", + "url": "https://api.github.com/repos/zbateson/mb-wrapper/zipball/50a14c0c9537f978a61cde9fdc192a0267cc9cff", + "reference": "50a14c0c9537f978a61cde9fdc192a0267cc9cff", "shasum": "" }, "require": { - "php": ">=7.1", + "php": ">=8.0", "symfony/polyfill-iconv": "^1.9", "symfony/polyfill-mbstring": "^1.9" }, "require-dev": { "friendsofphp/php-cs-fixer": "*", "phpstan/phpstan": "*", - "phpunit/phpunit": "<10.0" + "phpunit/phpunit": "^9.6|^10.0" }, "suggest": { "ext-iconv": "For best support/performance", @@ -13257,7 +12850,7 @@ ], "support": { "issues": "https://github.com/zbateson/mb-wrapper/issues", - "source": "https://github.com/zbateson/mb-wrapper/tree/1.2.1" + "source": "https://github.com/zbateson/mb-wrapper/tree/2.0.1" }, "funding": [ { @@ -13265,31 +12858,31 @@ "type": "github" } ], - "time": "2024-03-18T04:31:04+00:00" + "time": "2024-12-20T22:05:33+00:00" }, { "name": "zbateson/stream-decorators", - "version": "1.2.1", + "version": "2.1.1", "source": { "type": "git", "url": "https://github.com/zbateson/stream-decorators.git", - "reference": "783b034024fda8eafa19675fb2552f8654d3a3e9" + "reference": "32a2a62fb0f26313395c996ebd658d33c3f9c4e5" }, "dist": { "type": "zip", - "url": "https://api.github.com/repos/zbateson/stream-decorators/zipball/783b034024fda8eafa19675fb2552f8654d3a3e9", - "reference": "783b034024fda8eafa19675fb2552f8654d3a3e9", + "url": "https://api.github.com/repos/zbateson/stream-decorators/zipball/32a2a62fb0f26313395c996ebd658d33c3f9c4e5", + "reference": "32a2a62fb0f26313395c996ebd658d33c3f9c4e5", "shasum": "" }, "require": { - "guzzlehttp/psr7": "^1.9 | ^2.0", - "php": ">=7.2", - "zbateson/mb-wrapper": "^1.0.0" + "guzzlehttp/psr7": "^2.5", + "php": ">=8.0", + "zbateson/mb-wrapper": "^2.0" }, "require-dev": { "friendsofphp/php-cs-fixer": "*", "phpstan/phpstan": "*", - "phpunit/phpunit": "<10.0" + "phpunit/phpunit": "^9.6|^10.0" }, "type": "library", "autoload": { @@ -13320,7 +12913,7 @@ ], "support": { "issues": "https://github.com/zbateson/stream-decorators/issues", - "source": "https://github.com/zbateson/stream-decorators/tree/1.2.1" + "source": "https://github.com/zbateson/stream-decorators/tree/2.1.1" }, "funding": [ { @@ -13328,7 +12921,7 @@ "type": "github" } ], - "time": "2023-05-30T22:51:52+00:00" + "time": "2024-04-29T21:42:39+00:00" } ], "aliases": [], @@ -13343,8 +12936,9 @@ "ext-dom": "*", "ext-intl": "*", "ext-json": "*", - "ext-pgsql": "*" + "ext-pgsql": "*", + "ext-sodium": "*" }, - "platform-dev": [], + "platform-dev": {}, "plugin-api-version": "2.6.0" } diff --git a/config/app.php b/config/app.php index f4672673..324b513a 100644 --- a/config/app.php +++ b/config/app.php @@ -65,7 +65,7 @@ return [ | */ - 'timezone' => env('APP_TIMEZONE', 'UTC'), + 'timezone' => 'UTC', /* |-------------------------------------------------------------------------- diff --git a/config/bridgy.php b/config/bridgy.php index 9717625f..5314afa4 100644 --- a/config/bridgy.php +++ b/config/bridgy.php @@ -15,4 +15,17 @@ return [ 'mastodon_token' => env('BRIDGY_MASTODON_TOKEN'), + /* + |-------------------------------------------------------------------------- + | Bluesky Token + |-------------------------------------------------------------------------- + | + | When syndicating posts to Bluesky using Brid.gy’s Micropub endpoint, we + | need to provide an access token. This token can be generated by going to + | https://brid.gy/bluesky and clicking the “Get token” button. + | + */ + + 'bluesky_token' => env('BRIDGY_BLUESKY_TOKEN'), + ]; diff --git a/config/database.php b/config/database.php index f8e8dcb8..8910562d 100644 --- a/config/database.php +++ b/config/database.php @@ -37,6 +37,9 @@ return [ 'database' => env('DB_DATABASE', database_path('database.sqlite')), 'prefix' => '', 'foreign_key_constraints' => env('DB_FOREIGN_KEYS', true), + 'busy_timeout' => null, + 'journal_mode' => null, + 'synchronous' => null, ], 'mysql' => [ @@ -145,6 +148,7 @@ return [ 'options' => [ 'cluster' => env('REDIS_CLUSTER', 'redis'), 'prefix' => env('REDIS_PREFIX', Str::slug(env('APP_NAME', 'laravel'), '_').'_database_'), + 'persistent' => env('REDIS_PERSISTENT', false), ], 'default' => [ diff --git a/config/debugbar.php b/config/debugbar.php index b045f6ca..cb04694e 100644 --- a/config/debugbar.php +++ b/config/debugbar.php @@ -119,7 +119,7 @@ return [ 'full_log' => false, ], 'views' => [ - 'data' => false, //Note: Can slow down the application, because the data can be quite large.. + 'data' => false, // Note: Can slow down the application, because the data can be quite large.. ], 'route' => [ 'label' => true, // show complete route on bar diff --git a/config/filesystems.php b/config/filesystems.php index 44fe9c82..a17a9a47 100644 --- a/config/filesystems.php +++ b/config/filesystems.php @@ -32,8 +32,10 @@ return [ 'local' => [ 'driver' => 'local', - 'root' => storage_path('app'), + 'root' => storage_path('app/private'), + 'serve' => true, 'throw' => false, + 'report' => false, ], 'public' => [ @@ -42,6 +44,7 @@ return [ 'url' => env('APP_URL').'/storage', 'visibility' => 'public', 'throw' => false, + 'report' => false, ], 's3' => [ @@ -54,6 +57,7 @@ return [ 'endpoint' => env('AWS_ENDPOINT'), 'use_path_style_endpoint' => env('AWS_USE_PATH_STYLE_ENDPOINT', false), 'throw' => false, + 'report' => false, ], ], diff --git a/config/mail.php b/config/mail.php index a4a02fe4..7132144d 100644 --- a/config/mail.php +++ b/config/mail.php @@ -38,14 +38,14 @@ return [ 'smtp' => [ 'transport' => 'smtp', + 'scheme' => env('MAIL_SCHEME'), 'url' => env('MAIL_URL'), 'host' => env('MAIL_HOST', '127.0.0.1'), 'port' => env('MAIL_PORT', 2525), - 'encryption' => env('MAIL_ENCRYPTION', 'tls'), 'username' => env('MAIL_USERNAME'), 'password' => env('MAIL_PASSWORD'), 'timeout' => null, - 'local_domain' => env('MAIL_EHLO_DOMAIN'), + 'local_domain' => env('MAIL_EHLO_DOMAIN', parse_url(env('APP_URL', 'http://localhost'), PHP_URL_HOST)), ], 'ses' => [ diff --git a/config/session.php b/config/session.php index 0e22ee41..6ff263bd 100644 --- a/config/session.php +++ b/config/session.php @@ -32,7 +32,7 @@ return [ | */ - 'lifetime' => env('SESSION_LIFETIME', 120), + 'lifetime' => (int) env('SESSION_LIFETIME', 120), 'expire_on_close' => env('SESSION_EXPIRE_ON_CLOSE', false), diff --git a/config/url.php b/config/url.php deleted file mode 100644 index a1962ade..00000000 --- a/config/url.php +++ /dev/null @@ -1,43 +0,0 @@ - env('APP_LONGURL', 'longurl.local'), - - /* - |-------------------------------------------------------------------------- - | Application Short URL - |-------------------------------------------------------------------------- - | - | The short URL for the application - | - */ - - 'shorturl' => env('APP_SHORTURL', 'shorturl.local'), - - /* - |-------------------------------------------------------------------------- - | Authorization endpoint - |-------------------------------------------------------------------------- - | - | The authorization endpoint for the application, used primarily for Micropub - | - */ - - 'authorization_endpoint' => env('AUTHORIZATION_ENDPOINT', 'https://indieauth.com/auth'), - -]; diff --git a/database/factories/ArticleFactory.php b/database/factories/ArticleFactory.php index 54c91aa0..7695e27e 100644 --- a/database/factories/ArticleFactory.php +++ b/database/factories/ArticleFactory.php @@ -7,8 +7,6 @@ use Illuminate\Database\Eloquent\Factories\Factory; use Illuminate\Support\Carbon; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Article> */ class ArticleFactory extends Factory diff --git a/database/factories/BioFactory.php b/database/factories/BioFactory.php index 7ed8cb6f..b2493014 100644 --- a/database/factories/BioFactory.php +++ b/database/factories/BioFactory.php @@ -5,8 +5,6 @@ namespace Database\Factories; use Illuminate\Database\Eloquent\Factories\Factory; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Bio> */ class BioFactory extends Factory diff --git a/database/factories/BookmarkFactory.php b/database/factories/BookmarkFactory.php index 0d10db4a..ddfe0f97 100644 --- a/database/factories/BookmarkFactory.php +++ b/database/factories/BookmarkFactory.php @@ -7,8 +7,6 @@ use Illuminate\Database\Eloquent\Factories\Factory; use Illuminate\Support\Carbon; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Bookmark> */ class BookmarkFactory extends Factory diff --git a/database/factories/ContactFactory.php b/database/factories/ContactFactory.php index 57efafd9..1b0be43b 100644 --- a/database/factories/ContactFactory.php +++ b/database/factories/ContactFactory.php @@ -7,8 +7,6 @@ use Illuminate\Database\Eloquent\Factories\Factory; use Illuminate\Support\Carbon; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Contact> */ class ContactFactory extends Factory diff --git a/database/factories/LikeFactory.php b/database/factories/LikeFactory.php index 92ad76ce..8bf4f62f 100644 --- a/database/factories/LikeFactory.php +++ b/database/factories/LikeFactory.php @@ -7,8 +7,6 @@ use Illuminate\Database\Eloquent\Factories\Factory; use Illuminate\Support\Carbon; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Like> */ class LikeFactory extends Factory diff --git a/database/factories/MediaFactory.php b/database/factories/MediaFactory.php index 6f1e4838..ca253109 100644 --- a/database/factories/MediaFactory.php +++ b/database/factories/MediaFactory.php @@ -7,8 +7,6 @@ use Illuminate\Database\Eloquent\Factories\Factory; use Illuminate\Support\Carbon; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Media> */ class MediaFactory extends Factory diff --git a/database/factories/MicropubClientFactory.php b/database/factories/MicropubClientFactory.php index 923a9df9..4916f404 100644 --- a/database/factories/MicropubClientFactory.php +++ b/database/factories/MicropubClientFactory.php @@ -6,8 +6,6 @@ use App\Models\MicropubClient; use Illuminate\Database\Eloquent\Factories\Factory; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\MicropubClient> */ class MicropubClientFactory extends Factory diff --git a/database/factories/NoteFactory.php b/database/factories/NoteFactory.php index 0ea928a6..e2238a23 100644 --- a/database/factories/NoteFactory.php +++ b/database/factories/NoteFactory.php @@ -8,8 +8,6 @@ use Illuminate\Database\Eloquent\Factories\Factory; use Illuminate\Support\Carbon; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Note> */ class NoteFactory extends Factory diff --git a/database/factories/PlaceFactory.php b/database/factories/PlaceFactory.php index a9f23f0b..61bdd70f 100644 --- a/database/factories/PlaceFactory.php +++ b/database/factories/PlaceFactory.php @@ -6,8 +6,6 @@ use App\Models\Place; use Illuminate\Database\Eloquent\Factories\Factory; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Place> */ class PlaceFactory extends Factory diff --git a/database/factories/SyndicationTargetFactory.php b/database/factories/SyndicationTargetFactory.php index f409a3f6..05243632 100644 --- a/database/factories/SyndicationTargetFactory.php +++ b/database/factories/SyndicationTargetFactory.php @@ -5,8 +5,6 @@ namespace Database\Factories; use Illuminate\Database\Eloquent\Factories\Factory; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\SyndicationTarget> */ class SyndicationTargetFactory extends Factory diff --git a/database/factories/TagFactory.php b/database/factories/TagFactory.php index b5478679..24cae028 100644 --- a/database/factories/TagFactory.php +++ b/database/factories/TagFactory.php @@ -6,8 +6,6 @@ use App\Models\Tag; use Illuminate\Database\Eloquent\Factories\Factory; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\Tag> */ class TagFactory extends Factory diff --git a/database/factories/UserFactory.php b/database/factories/UserFactory.php index e456f5d8..ba1ff997 100644 --- a/database/factories/UserFactory.php +++ b/database/factories/UserFactory.php @@ -7,8 +7,6 @@ use Illuminate\Database\Eloquent\Factories\Factory; use Illuminate\Support\Str; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\User> */ class UserFactory extends Factory diff --git a/database/factories/WebMentionFactory.php b/database/factories/WebMentionFactory.php index 08829bad..65dbb92f 100644 --- a/database/factories/WebMentionFactory.php +++ b/database/factories/WebMentionFactory.php @@ -6,8 +6,6 @@ use App\Models\WebMention; use Illuminate\Database\Eloquent\Factories\Factory; /** - * @psalm-suppress UnusedClass - * * @extends \Illuminate\Database\Eloquent\Factories\Factory<\App\Models\WebMention> */ class WebMentionFactory extends Factory diff --git a/database/migrations/2024_03_23_204940_add_bluesky_syndication_column.php b/database/migrations/2024_03_23_204940_add_bluesky_syndication_column.php new file mode 100644 index 00000000..864d949c --- /dev/null +++ b/database/migrations/2024_03_23_204940_add_bluesky_syndication_column.php @@ -0,0 +1,28 @@ +string('bluesky_url')->nullable(); + }); + } + + /** + * Reverse the migrations. + */ + public function down(): void + { + Schema::table('notes', function (Blueprint $table) { + $table->dropColumn('bluesky_url'); + }); + } +}; diff --git a/database/seeders/ArticlesTableSeeder.php b/database/seeders/ArticlesTableSeeder.php index 898471fc..cbfd7a36 100644 --- a/database/seeders/ArticlesTableSeeder.php +++ b/database/seeders/ArticlesTableSeeder.php @@ -11,8 +11,6 @@ class ArticlesTableSeeder extends Seeder { /** * Seed the articles table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { diff --git a/database/seeders/BioSeeder.php b/database/seeders/BioSeeder.php index 05a60c33..093d0609 100644 --- a/database/seeders/BioSeeder.php +++ b/database/seeders/BioSeeder.php @@ -5,9 +5,6 @@ namespace Database\Seeders; use App\Models\Bio; use Illuminate\Database\Seeder; -/** - * @psalm-suppress UnusedClass - */ class BioSeeder extends Seeder { /** diff --git a/database/seeders/BookmarksTableSeeder.php b/database/seeders/BookmarksTableSeeder.php index a8c48f69..baa3580f 100644 --- a/database/seeders/BookmarksTableSeeder.php +++ b/database/seeders/BookmarksTableSeeder.php @@ -10,8 +10,6 @@ class BookmarksTableSeeder extends Seeder { /** * Seed the bookmarks table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { diff --git a/database/seeders/ClientsTableSeeder.php b/database/seeders/ClientsTableSeeder.php index 98d403b0..35dcb296 100644 --- a/database/seeders/ClientsTableSeeder.php +++ b/database/seeders/ClientsTableSeeder.php @@ -11,8 +11,6 @@ class ClientsTableSeeder extends Seeder { /** * Seed the clients table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { diff --git a/database/seeders/ContactsTableSeeder.php b/database/seeders/ContactsTableSeeder.php index b3097ce3..3d191ec1 100644 --- a/database/seeders/ContactsTableSeeder.php +++ b/database/seeders/ContactsTableSeeder.php @@ -10,8 +10,6 @@ class ContactsTableSeeder extends Seeder { /** * Seed the contacts table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { @@ -27,7 +25,7 @@ class ContactsTableSeeder extends Seeder 'homepage' => 'https://aaronparecki.com', 'facebook' => '123456', ]); - $fs = new FileSystem(); + $fs = new FileSystem; if (! $fs->exists(public_path('assets/profile-images/aaronparecki.com'))) { $fs->makeDirectory(public_path('assets/profile-images/aaronparecki.com')); } diff --git a/database/seeders/DatabaseSeeder.php b/database/seeders/DatabaseSeeder.php index c91e2edb..5117a89d 100644 --- a/database/seeders/DatabaseSeeder.php +++ b/database/seeders/DatabaseSeeder.php @@ -4,9 +4,6 @@ namespace Database\Seeders; use Illuminate\Database\Seeder; -/** - * @psalm-suppress UnusedClass - */ class DatabaseSeeder extends Seeder { /** diff --git a/database/seeders/LikesTableSeeder.php b/database/seeders/LikesTableSeeder.php index 5a1f365c..4600fb69 100644 --- a/database/seeders/LikesTableSeeder.php +++ b/database/seeders/LikesTableSeeder.php @@ -12,15 +12,13 @@ class LikesTableSeeder extends Seeder { /** * Seed the likes table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { Like::factory(10)->create(); $now = Carbon::now()->subDays(rand(3, 6)); - $faker = new Generator(); + $faker = new Generator; $faker->addProvider(new \Faker\Provider\en_US\Person($faker)); $faker->addProvider(new \Faker\Provider\Lorem($faker)); $faker->addProvider(new \Faker\Provider\Internet($faker)); diff --git a/database/seeders/NotesTableSeeder.php b/database/seeders/NotesTableSeeder.php index 4a42f379..630cfda6 100644 --- a/database/seeders/NotesTableSeeder.php +++ b/database/seeders/NotesTableSeeder.php @@ -14,8 +14,6 @@ class NotesTableSeeder extends Seeder { /** * Seed the notes table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { @@ -83,7 +81,7 @@ class NotesTableSeeder extends Seeder ->where('id', $noteWithoutContact->id) ->update(['updated_at' => $now->toDateTimeString()]); - //copy aaron’s profile pic in place + // copy aaron’s profile pic in place $spl = new SplFileInfo(public_path() . '/assets/profile-images/aaronparecki.com'); if ($spl->isDir() === false) { mkdir(public_path() . '/assets/profile-images/aaronparecki.com', 0755); @@ -138,6 +136,7 @@ class NotesTableSeeder extends Seeder $noteSyndicated->swarm_url = 'https://www.swarmapp.com/checking/123456789'; $noteSyndicated->instagram_url = 'https://www.instagram.com/p/aWsEd123Jh'; $noteSyndicated->mastodon_url = 'https://mastodon.social/@jonnybarnes/123456789'; + $noteSyndicated->bluesky_url = 'https://bsky.app/profile/jonnybarnes.uk/post/123456789'; $noteSyndicated->save(); DB::table('notes') ->where('id', $noteSyndicated->id) @@ -153,7 +152,7 @@ class NotesTableSeeder extends Seeder ->update(['updated_at' => $now->toDateTimeString()]); $now = Carbon::now()->subHours(5); - $noteJustCheckin = new Note(); + $noteJustCheckin = new Note; $noteJustCheckin->setCreatedAt($now); $place = Place::find(1); $noteJustCheckin->place()->associate($place); @@ -163,12 +162,12 @@ class NotesTableSeeder extends Seeder ->update(['updated_at' => $now->toDateTimeString()]); $now = Carbon::now()->subHours(4); - $media = new Media(); + $media = new Media; $media->path = 'media/f1bc8faa-1a8f-45b8-a9b1-57282fa73f87.jpg'; $media->type = 'image'; $media->image_widths = '3648'; $media->save(); - $noteWithOnlyImage = new Note(); + $noteWithOnlyImage = new Note; $noteWithOnlyImage->setCreatedAt($now); $noteWithOnlyImage->setUpdatedAt($now); $noteWithOnlyImage->save(); diff --git a/database/seeders/PlacesTableSeeder.php b/database/seeders/PlacesTableSeeder.php index f9f0884f..70324ff8 100644 --- a/database/seeders/PlacesTableSeeder.php +++ b/database/seeders/PlacesTableSeeder.php @@ -9,12 +9,10 @@ class PlacesTableSeeder extends Seeder { /** * Seed the places table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { - $place = new Place(); + $place = new Place; $place->name = 'The Bridgewater Pub'; $place->description = 'A lovely local pub with a decent selection of cask ales'; $place->latitude = 53.4983; diff --git a/database/seeders/UsersTableSeeder.php b/database/seeders/UsersTableSeeder.php index dfc155cd..d9e608e2 100644 --- a/database/seeders/UsersTableSeeder.php +++ b/database/seeders/UsersTableSeeder.php @@ -9,8 +9,6 @@ class UsersTableSeeder extends Seeder { /** * Seed the users table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { diff --git a/database/seeders/WebMentionsTableSeeder.php b/database/seeders/WebMentionsTableSeeder.php index afd1ffb7..46da28d5 100644 --- a/database/seeders/WebMentionsTableSeeder.php +++ b/database/seeders/WebMentionsTableSeeder.php @@ -9,8 +9,6 @@ class WebMentionsTableSeeder extends Seeder { /** * Seed the webmentions table. - * - * @psalm-suppress PossiblyUnusedMethod */ public function run(): void { @@ -41,5 +39,14 @@ class WebMentionsTableSeeder extends Seeder 'type' => 'repost-of', 'mf2' => '{"rels": [], "items": [{"type": ["h-entry"], "properties": {"url": ["https://barryfrost.com/reposts/1"], "name": ["Kagi is the best"], "author": [{"type": ["h-card"], "value": "Barry Frost", "properties": {"url": ["https://barryfrost.com/"], "name": ["Barry Frost"], "photo": ["https://barryfrost.com/barryfrost.jpg"]}}], "content": [{"html": "Kagi is the Best", "value": "Kagi is the Best"}], "published": ["' . date(DATE_W3C) . '"], "u-repost-of": ["' . config('app.url') . '/notes/C"]}}]}', ]); + // WebMention like from Bluesky + WebMention::create([ + 'source' => 'https://brid.gy/like/bluesky/did:plc:n3jhgiq2ykctnpgzlm6p6b25/at%253A%252F%252Fdid%253Aplc%253An3jhgiq2ykctnpgzlm6p6b25%252Fapp.bsky.feed.post%252F3lalppbcyuc2w/did%253Aplc%253Aia23nh3t37r2lydmmqsixrps', + 'target' => config('app.url') . '/notes/B', + 'commentable_id' => '11', + 'commentable_type' => 'App\Models\Note', + 'type' => 'like-of', + 'mf2' => '{"rels": [], "items": [{"type": ["h-entry"], "properties": {"uid": ["tag:bsky.app,2013:at://did:plc:n3jhgiq2ykctnpgzlm6p6b25/app.bsky.feed.post/3lalppbcyuc2w_liked_by_did:plc:ia23nh3t37r2lydmmqsixrps"], "url": ["https://bsky.app/profile/jonnybarnes.uk/post/3lalppbcyuc2w#liked_by_did:plc:ia23nh3t37r2lydmmqsixrps"], "name": [""], "author": [{"type": ["h-card"], "value": "bsky.app/profile/little... littledawg13.bsky.social", "properties": {"uid": ["tag:bsky.app,2013:did:plc:ia23nh3t37r2lydmmqsixrps"], "url": ["https://bsky.app/profile/littledawg13.bsky.social", "https://bsky.app/profile/did:plc:ia23nh3t37r2lydmmqsixrps"], "photo": [{"alt": "", "value": "https://cdn.bsky.app/img/avatar/plain/did:plc:ia23nh3t37r2lydmmqsixrps/bafkreifh7ydbyq7qe4maorornocksfnahijxqgx2i5zvvyq6y4i4mydfau@jpeg"}], "nickname": ["littledawg13.bsky.social"]}}], "like-of": ["https://bsky.app/profile/jonnybarnes.uk/post/3lalppbcyuc2w", "http://jonnybarnes.localhost/notes/B"]}}], "rel-urls": []}', + ]); } } diff --git a/docker-compose.yml b/docker-compose.yml index 5fb2a542..cd9242e8 100644 --- a/docker-compose.yml +++ b/docker-compose.yml @@ -1,9 +1,8 @@ # For more information: https://laravel.com/docs/sail -version: '3' services: laravel.test: build: - context: ./vendor/laravel/sail/runtimes/8.3 + context: ./vendor/laravel/sail/runtimes/8.4 dockerfile: Dockerfile args: WWWGROUP: '${WWWGROUP}' @@ -18,6 +17,7 @@ services: LARAVEL_SAIL: 1 XDEBUG_MODE: '${SAIL_XDEBUG_MODE:-off}' XDEBUG_CONFIG: '${SAIL_XDEBUG_CONFIG:-client_host=host.docker.internal}' + IGNITION_LOCAL_SITES_PATH: '${PWD}' volumes: - '.:/var/www/html' networks: @@ -26,7 +26,7 @@ services: - pgsql - redis pgsql: - image: 'postgres:14' + image: 'postgres:17' ports: - '${FORWARD_DB_PORT:-5432}:5432' environment: diff --git a/eslint.config.js b/eslint.config.js new file mode 100644 index 00000000..0e4c99eb --- /dev/null +++ b/eslint.config.js @@ -0,0 +1,35 @@ +import js from '@eslint/js'; +import stylistic from '@stylistic/eslint-plugin'; +import globals from 'globals'; + +export default [ + { + name: 'jonnybarnes-uk-config', + languageOptions: { + ecmaVersion: 'latest', + sourceType: 'module', + globals: { + ...globals.browser + } + }, + linterOptions: { + reportUnusedDisableDirectives: 'error' + }, + plugins: { + '@stylistic': stylistic + }, + rules: { + ...js.configs.recommended.rules, + '@stylistic/indent': ['error', 2], + '@stylistic/linebreak-style': ['error', 'unix'], + '@stylistic/quotes': ['error', 'single'], + '@stylistic/semi': ['error', 'always'], + 'no-console': ['error', { allow: ['warn', 'error'] }], + 'no-await-in-loop': 'error', + 'no-promise-executor-return': 'error', + 'require-atomic-updates': 'error', + 'max-nested-callbacks': ['error', 3], + 'prefer-promise-reject-errors': 'error', + }, + } +]; diff --git a/helpers.php b/helpers.php index ed1f9912..0c3dfcfa 100644 --- a/helpers.php +++ b/helpers.php @@ -138,7 +138,7 @@ if (! function_exists('normalize_url')) { $url['query'] = ''; sort($queries); foreach ($queries as $query) { - //lets drop query params we don’t want + // lets drop query params we don’t want $key = stristr($query, '=', true); if (queryKeyIsBanned($key) === false) { $url['query'] .= "{$query}&"; @@ -197,7 +197,7 @@ if (! function_exists('prettyPrintJson')) { case '{': case '[': $level++; - //no break + // no break case ',': $ends_line_level = $level; break; diff --git a/package-lock.json b/package-lock.json index eb9f58bb..3fc2acf4 100644 --- a/package-lock.json +++ b/package-lock.json @@ -8,216 +8,47 @@ "name": "jbuk-frontend", "version": "0.0.1", "license": "CC0-1.0", - "dependencies": { - "@11ty/is-land": "^4.0.0", - "@zachleat/snow-fall": "^1.0.2" - }, "devDependencies": { - "eslint": "^8.57.0", - "stylelint": "^16.2.1", - "stylelint-config-standard": "^36.0.0" - } - }, - "node_modules/@11ty/is-land": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/@11ty/is-land/-/is-land-4.0.0.tgz", - "integrity": "sha512-RxbjF2+FzSu3rerHrWLRsvsPX2YM47RwXpdWCCzLhwRSsz5sJe9TnK7mphEld1gZnp2GeD5ByvhqjIc4CqidsQ==", - "funding": { - "type": "opencollective", - "url": "https://opencollective.com/11ty" - } - }, - "node_modules/@aashutoshrathi/word-wrap": { - "version": "1.2.6", - "resolved": "https://registry.npmjs.org/@aashutoshrathi/word-wrap/-/word-wrap-1.2.6.tgz", - "integrity": "sha512-1Yjs2SvM8TflER/OD3cOjhWWOZb58A2t7wpE2S9XfBYTiIl+XFhQG2bjy4Pu1I+EAlCNUzRDYDdFwFYUKvXcIA==", - "dev": true, - "engines": { - "node": ">=0.10.0" + "@eslint/js": "^9.6.0", + "@stylistic/eslint-plugin": "^5.1.0", + "esbuild": "^0.25.2", + "eslint": "^9.7.0", + "globals": "^16.0.0", + "lightningcss": "^1.29.3", + "lightningcss-cli": "^1.29.3", + "stylelint": "^16.7.0", + "stylelint-config-standard": "^38.0.0" } }, "node_modules/@babel/code-frame": { - "version": "7.23.5", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.23.5.tgz", - "integrity": "sha512-CgH3s1a96LipHCmSUmYFPwY7MNx8C3avkq7i4Wl3cfa662ldtUe4VM1TPXX70pfmrlWTb6jLqTYrZyT2ZTJBgA==", + "version": "7.27.1", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.27.1.tgz", + "integrity": "sha512-cjQ7ZlQ0Mv3b47hABuTevyTuYN4i+loJKGeV9flcCgIK37cCXRh+L1bd3iBHlynerhQ7BhCkn2BPbQUL+rGqFg==", "dev": true, + "license": "MIT", "dependencies": { - "@babel/highlight": "^7.23.4", - "chalk": "^2.4.2" + "@babel/helper-validator-identifier": "^7.27.1", + "js-tokens": "^4.0.0", + "picocolors": "^1.1.1" }, "engines": { "node": ">=6.9.0" } }, - "node_modules/@babel/code-frame/node_modules/ansi-styles": { - "version": "3.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", - "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", - "dev": true, - "dependencies": { - "color-convert": "^1.9.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/@babel/code-frame/node_modules/chalk": { - "version": "2.4.2", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", - "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", - "dev": true, - "dependencies": { - "ansi-styles": "^3.2.1", - "escape-string-regexp": "^1.0.5", - "supports-color": "^5.3.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/@babel/code-frame/node_modules/color-convert": { - "version": "1.9.3", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", - "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", - "dev": true, - "dependencies": { - "color-name": "1.1.3" - } - }, - "node_modules/@babel/code-frame/node_modules/color-name": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", - "integrity": "sha512-72fSenhMw2HZMTVHeCA9KCmpEIbzWiQsjN+BHcBbS9vr1mtt+vJjPdksIBNUmKAW8TFUDPJK5SUU3QhE9NEXDw==", - "dev": true - }, - "node_modules/@babel/code-frame/node_modules/escape-string-regexp": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", - "integrity": "sha512-vbRorB5FUQWvla16U8R/qgaFIya2qGzwDrNmCZuYKrbdSUMG6I1ZCGQRefkRVhuOkIGVne7BQ35DSfo1qvJqFg==", - "dev": true, - "engines": { - "node": ">=0.8.0" - } - }, - "node_modules/@babel/code-frame/node_modules/has-flag": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", - "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==", - "dev": true, - "engines": { - "node": ">=4" - } - }, - "node_modules/@babel/code-frame/node_modules/supports-color": { - "version": "5.5.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", - "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", - "dev": true, - "dependencies": { - "has-flag": "^3.0.0" - }, - "engines": { - "node": ">=4" - } - }, "node_modules/@babel/helper-validator-identifier": { - "version": "7.22.20", - "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.22.20.tgz", - "integrity": "sha512-Y4OZ+ytlatR8AI+8KZfKuL5urKp7qey08ha31L8b3BwewJAoJamTzyvxPR/5D+KkdJCGPq/+8TukHBlY10FX9A==", + "version": "7.27.1", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.27.1.tgz", + "integrity": "sha512-D2hP9eA+Sqx1kBZgzxZh0y1trbuU+JoDkiEwqhQ36nodYqJwyEIhPSdMNd7lOm/4io72luTPWH20Yda0xOuUow==", "dev": true, + "license": "MIT", "engines": { "node": ">=6.9.0" } }, - "node_modules/@babel/highlight": { - "version": "7.23.4", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.23.4.tgz", - "integrity": "sha512-acGdbYSfp2WheJoJm/EBBBLh/ID8KDc64ISZ9DYtBmC8/Q204PZJLHyzeB5qMzJ5trcOkybd78M4x2KWsUq++A==", - "dev": true, - "dependencies": { - "@babel/helper-validator-identifier": "^7.22.20", - "chalk": "^2.4.2", - "js-tokens": "^4.0.0" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/highlight/node_modules/ansi-styles": { - "version": "3.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", - "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", - "dev": true, - "dependencies": { - "color-convert": "^1.9.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/@babel/highlight/node_modules/chalk": { - "version": "2.4.2", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", - "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", - "dev": true, - "dependencies": { - "ansi-styles": "^3.2.1", - "escape-string-regexp": "^1.0.5", - "supports-color": "^5.3.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/@babel/highlight/node_modules/color-convert": { - "version": "1.9.3", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", - "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", - "dev": true, - "dependencies": { - "color-name": "1.1.3" - } - }, - "node_modules/@babel/highlight/node_modules/color-name": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", - "integrity": "sha512-72fSenhMw2HZMTVHeCA9KCmpEIbzWiQsjN+BHcBbS9vr1mtt+vJjPdksIBNUmKAW8TFUDPJK5SUU3QhE9NEXDw==", - "dev": true - }, - "node_modules/@babel/highlight/node_modules/escape-string-regexp": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", - "integrity": "sha512-vbRorB5FUQWvla16U8R/qgaFIya2qGzwDrNmCZuYKrbdSUMG6I1ZCGQRefkRVhuOkIGVne7BQ35DSfo1qvJqFg==", - "dev": true, - "engines": { - "node": ">=0.8.0" - } - }, - "node_modules/@babel/highlight/node_modules/has-flag": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", - "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==", - "dev": true, - "engines": { - "node": ">=4" - } - }, - "node_modules/@babel/highlight/node_modules/supports-color": { - "version": "5.5.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", - "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", - "dev": true, - "dependencies": { - "has-flag": "^3.0.0" - }, - "engines": { - "node": ">=4" - } - }, "node_modules/@csstools/css-parser-algorithms": { - "version": "2.5.0", - "resolved": "https://registry.npmjs.org/@csstools/css-parser-algorithms/-/css-parser-algorithms-2.5.0.tgz", - "integrity": "sha512-abypo6m9re3clXA00eu5syw+oaPHbJTPapu9C4pzNsJ4hdZDzushT50Zhu+iIYXgEe1CxnRMn7ngsbV+MLrlpQ==", + "version": "3.0.5", + "resolved": "https://registry.npmjs.org/@csstools/css-parser-algorithms/-/css-parser-algorithms-3.0.5.tgz", + "integrity": "sha512-DaDeUkXZKjdGhgYaHNJTV9pV7Y9B3b644jCLs9Upc3VeNGg6LWARAT6O+Q+/COo+2gg/bM5rhpMAtf70WqfBdQ==", "dev": true, "funding": [ { @@ -229,17 +60,18 @@ "url": "https://opencollective.com/csstools" } ], + "license": "MIT", "engines": { - "node": "^14 || ^16 || >=18" + "node": ">=18" }, "peerDependencies": { - "@csstools/css-tokenizer": "^2.2.3" + "@csstools/css-tokenizer": "^3.0.4" } }, "node_modules/@csstools/css-tokenizer": { - "version": "2.2.3", - "resolved": "https://registry.npmjs.org/@csstools/css-tokenizer/-/css-tokenizer-2.2.3.tgz", - "integrity": "sha512-pp//EvZ9dUmGuGtG1p+n17gTHEOqu9jO+FiCUjNN3BDmyhdA2Jq9QsVeR7K8/2QCK17HSsioPlTW9ZkzoWb3Lg==", + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/@csstools/css-tokenizer/-/css-tokenizer-3.0.4.tgz", + "integrity": "sha512-Vd/9EVDiu6PPJt9yAh6roZP6El1xHrdvIVGjyBsHR0RYwNHgL7FJPyIIW4fANJNG6FtyZfvlRPpFI4ZM/lubvw==", "dev": true, "funding": [ { @@ -251,14 +83,15 @@ "url": "https://opencollective.com/csstools" } ], + "license": "MIT", "engines": { - "node": "^14 || ^16 || >=18" + "node": ">=18" } }, "node_modules/@csstools/media-query-list-parser": { - "version": "2.1.7", - "resolved": "https://registry.npmjs.org/@csstools/media-query-list-parser/-/media-query-list-parser-2.1.7.tgz", - "integrity": "sha512-lHPKJDkPUECsyAvD60joYfDmp8UERYxHGkFfyLJFTVK/ERJe0sVlIFLXU5XFxdjNDTerp5L4KeaKG+Z5S94qxQ==", + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/@csstools/media-query-list-parser/-/media-query-list-parser-4.0.3.tgz", + "integrity": "sha512-HAYH7d3TLRHDOUQK4mZKf9k9Ph/m8Akstg66ywKR4SFAigjs3yBiUeZtFxywiTm5moZMAp/5W/ZuFnNXXYLuuQ==", "dev": true, "funding": [ { @@ -270,18 +103,19 @@ "url": "https://opencollective.com/csstools" } ], + "license": "MIT", "engines": { - "node": "^14 || ^16 || >=18" + "node": ">=18" }, "peerDependencies": { - "@csstools/css-parser-algorithms": "^2.5.0", - "@csstools/css-tokenizer": "^2.2.3" + "@csstools/css-parser-algorithms": "^3.0.5", + "@csstools/css-tokenizer": "^3.0.4" } }, "node_modules/@csstools/selector-specificity": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/@csstools/selector-specificity/-/selector-specificity-3.0.1.tgz", - "integrity": "sha512-NPljRHkq4a14YzZ3YD406uaxh7s0g6eAq3L9aLOWywoqe8PkYamAvtsh7KNX6c++ihDrJ0RiU+/z7rGnhlZ5ww==", + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/@csstools/selector-specificity/-/selector-specificity-5.0.0.tgz", + "integrity": "sha512-PCqQV3c4CoVm3kdPhyeZ07VmBRdH2EpMFA/pd9OASpOEC3aXNGoqPDAZ80D0cLpMBxnmk0+yNhGsEx31hq7Gtw==", "dev": true, "funding": [ { @@ -293,53 +127,475 @@ "url": "https://opencollective.com/csstools" } ], + "license": "MIT-0", "engines": { - "node": "^14 || ^16 || >=18" + "node": ">=18" }, "peerDependencies": { - "postcss-selector-parser": "^6.0.13" + "postcss-selector-parser": "^7.0.0" + } + }, + "node_modules/@dual-bundle/import-meta-resolve": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/@dual-bundle/import-meta-resolve/-/import-meta-resolve-4.1.0.tgz", + "integrity": "sha512-+nxncfwHM5SgAtrVzgpzJOI1ol0PkumhVo469KCf9lUi21IGcY90G98VuHm9VRrUypmAzawAHO9bs6hqeADaVg==", + "dev": true, + "license": "MIT", + "funding": { + "type": "github", + "url": "https://github.com/sponsors/wooorm" + } + }, + "node_modules/@esbuild/aix-ppc64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.25.5.tgz", + "integrity": "sha512-9o3TMmpmftaCMepOdA5k/yDw8SfInyzWWTjYTFCX3kPSDJMROQTb8jg+h9Cnwnmm1vOzvxN7gIfB5V2ewpjtGA==", + "cpu": [ + "ppc64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "aix" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-arm": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.25.5.tgz", + "integrity": "sha512-AdJKSPeEHgi7/ZhuIPtcQKr5RQdo6OO2IL87JkianiMYMPbCtot9fxPbrMiBADOWWm3T2si9stAiVsGbTQFkbA==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-arm64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.25.5.tgz", + "integrity": "sha512-VGzGhj4lJO+TVGV1v8ntCZWJktV7SGCs3Pn1GRWI1SBFtRALoomm8k5E9Pmwg3HOAal2VDc2F9+PM/rEY6oIDg==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-x64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.25.5.tgz", + "integrity": "sha512-D2GyJT1kjvO//drbRT3Hib9XPwQeWd9vZoBJn+bu/lVsOZ13cqNdDeqIF/xQ5/VmWvMduP6AmXvylO/PIc2isw==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/darwin-arm64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.25.5.tgz", + "integrity": "sha512-GtaBgammVvdF7aPIgH2jxMDdivezgFu6iKpmT+48+F8Hhg5J/sfnDieg0aeG/jfSvkYQU2/pceFPDKlqZzwnfQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/darwin-x64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.25.5.tgz", + "integrity": "sha512-1iT4FVL0dJ76/q1wd7XDsXrSW+oLoquptvh4CLR4kITDtqi2e/xwXwdCVH8hVHU43wgJdsq7Gxuzcs6Iq/7bxQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/freebsd-arm64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.25.5.tgz", + "integrity": "sha512-nk4tGP3JThz4La38Uy/gzyXtpkPW8zSAmoUhK9xKKXdBCzKODMc2adkB2+8om9BDYugz+uGV7sLmpTYzvmz6Sw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/freebsd-x64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.25.5.tgz", + "integrity": "sha512-PrikaNjiXdR2laW6OIjlbeuCPrPaAl0IwPIaRv+SMV8CiM8i2LqVUHFC1+8eORgWyY7yhQY+2U2fA55mBzReaw==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-arm": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.25.5.tgz", + "integrity": "sha512-cPzojwW2okgh7ZlRpcBEtsX7WBuqbLrNXqLU89GxWbNt6uIg78ET82qifUy3W6OVww6ZWobWub5oqZOVtwolfw==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-arm64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.25.5.tgz", + "integrity": "sha512-Z9kfb1v6ZlGbWj8EJk9T6czVEjjq2ntSYLY2cw6pAZl4oKtfgQuS4HOq41M/BcoLPzrUbNd+R4BXFyH//nHxVg==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-ia32": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.25.5.tgz", + "integrity": "sha512-sQ7l00M8bSv36GLV95BVAdhJ2QsIbCuCjh/uYrWiMQSUuV+LpXwIqhgJDcvMTj+VsQmqAHL2yYaasENvJ7CDKA==", + "cpu": [ + "ia32" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-loong64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.25.5.tgz", + "integrity": "sha512-0ur7ae16hDUC4OL5iEnDb0tZHDxYmuQyhKhsPBV8f99f6Z9KQM02g33f93rNH5A30agMS46u2HP6qTdEt6Q1kg==", + "cpu": [ + "loong64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-mips64el": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.25.5.tgz", + "integrity": "sha512-kB/66P1OsHO5zLz0i6X0RxlQ+3cu0mkxS3TKFvkb5lin6uwZ/ttOkP3Z8lfR9mJOBk14ZwZ9182SIIWFGNmqmg==", + "cpu": [ + "mips64el" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-ppc64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.25.5.tgz", + "integrity": "sha512-UZCmJ7r9X2fe2D6jBmkLBMQetXPXIsZjQJCjgwpVDz+YMcS6oFR27alkgGv3Oqkv07bxdvw7fyB71/olceJhkQ==", + "cpu": [ + "ppc64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-riscv64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.25.5.tgz", + "integrity": "sha512-kTxwu4mLyeOlsVIFPfQo+fQJAV9mh24xL+y+Bm6ej067sYANjyEw1dNHmvoqxJUCMnkBdKpvOn0Ahql6+4VyeA==", + "cpu": [ + "riscv64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-s390x": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.25.5.tgz", + "integrity": "sha512-K2dSKTKfmdh78uJ3NcWFiqyRrimfdinS5ErLSn3vluHNeHVnBAFWC8a4X5N+7FgVE1EjXS1QDZbpqZBjfrqMTQ==", + "cpu": [ + "s390x" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-x64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.25.5.tgz", + "integrity": "sha512-uhj8N2obKTE6pSZ+aMUbqq+1nXxNjZIIjCjGLfsWvVpy7gKCOL6rsY1MhRh9zLtUtAI7vpgLMK6DxjO8Qm9lJw==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/netbsd-arm64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-arm64/-/netbsd-arm64-0.25.5.tgz", + "integrity": "sha512-pwHtMP9viAy1oHPvgxtOv+OkduK5ugofNTVDilIzBLpoWAM16r7b/mxBvfpuQDpRQFMfuVr5aLcn4yveGvBZvw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/netbsd-x64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.25.5.tgz", + "integrity": "sha512-WOb5fKrvVTRMfWFNCroYWWklbnXH0Q5rZppjq0vQIdlsQKuw6mdSihwSo4RV/YdQ5UCKKvBy7/0ZZYLBZKIbwQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/openbsd-arm64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-arm64/-/openbsd-arm64-0.25.5.tgz", + "integrity": "sha512-7A208+uQKgTxHd0G0uqZO8UjK2R0DDb4fDmERtARjSHWxqMTye4Erz4zZafx7Di9Cv+lNHYuncAkiGFySoD+Mw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/openbsd-x64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.25.5.tgz", + "integrity": "sha512-G4hE405ErTWraiZ8UiSoesH8DaCsMm0Cay4fsFWOOUcz8b8rC6uCvnagr+gnioEjWn0wC+o1/TAHt+It+MpIMg==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/sunos-x64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.25.5.tgz", + "integrity": "sha512-l+azKShMy7FxzY0Rj4RCt5VD/q8mG/e+mDivgspo+yL8zW7qEwctQ6YqKX34DTEleFAvCIUviCFX1SDZRSyMQA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "sunos" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-arm64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.25.5.tgz", + "integrity": "sha512-O2S7SNZzdcFG7eFKgvwUEZ2VG9D/sn/eIiz8XRZ1Q/DO5a3s76Xv0mdBzVM5j5R639lXQmPmSo0iRpHqUUrsxw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-ia32": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.25.5.tgz", + "integrity": "sha512-onOJ02pqs9h1iMJ1PQphR+VZv8qBMQ77Klcsqv9CNW2w6yLqoURLcgERAIurY6QE63bbLuqgP9ATqajFLK5AMQ==", + "cpu": [ + "ia32" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-x64": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.25.5.tgz", + "integrity": "sha512-TXv6YnJ8ZMVdX+SXWVBo/0p8LTcrUYngpWjvm91TMjjBQii7Oz11Lw5lbDV5Y0TzuhSJHwiH4hEtC1I42mMS0g==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MIT", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" } }, "node_modules/@eslint-community/eslint-utils": { - "version": "4.4.0", - "resolved": "https://registry.npmjs.org/@eslint-community/eslint-utils/-/eslint-utils-4.4.0.tgz", - "integrity": "sha512-1/sA4dwrzBAyeUoQ6oxahHKmrZvsnLCg4RfxW3ZFGGmQkSNQPFNLV9CUEFQP1x9EYXHTo5p6xdhZM1Ne9p/AfA==", + "version": "4.7.0", + "resolved": "https://registry.npmjs.org/@eslint-community/eslint-utils/-/eslint-utils-4.7.0.tgz", + "integrity": "sha512-dyybb3AcajC7uha6CvhdVRJqaKyn7w2YKqKyAN37NKYgZT36w+iRb0Dymmc5qEJ549c/S31cMMSFd75bteCpCw==", "dev": true, + "license": "MIT", "dependencies": { - "eslint-visitor-keys": "^3.3.0" + "eslint-visitor-keys": "^3.4.3" }, "engines": { "node": "^12.22.0 || ^14.17.0 || >=16.0.0" }, + "funding": { + "url": "https://opencollective.com/eslint" + }, "peerDependencies": { "eslint": "^6.0.0 || ^7.0.0 || >=8.0.0" } }, - "node_modules/@eslint-community/regexpp": { - "version": "4.10.0", - "resolved": "https://registry.npmjs.org/@eslint-community/regexpp/-/regexpp-4.10.0.tgz", - "integrity": "sha512-Cu96Sd2By9mCNTx2iyKOmq10v22jUVQv0lQnlGNy16oE9589yE+QADPbrMGCkA51cKZSg3Pu/aTJVTGfL/qjUA==", + "node_modules/@eslint-community/eslint-utils/node_modules/eslint-visitor-keys": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz", + "integrity": "sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==", "dev": true, - "engines": { - "node": "^12.0.0 || ^14.0.0 || >=16.0.0" - } - }, - "node_modules/@eslint/eslintrc": { - "version": "2.1.4", - "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-2.1.4.tgz", - "integrity": "sha512-269Z39MS6wVJtsoUl10L60WdkhJVdPG24Q4eZTH3nnF6lpvSShEK3wQjDX9JRWAUPvPh7COouPpU9IrqaZFvtQ==", - "dev": true, - "dependencies": { - "ajv": "^6.12.4", - "debug": "^4.3.2", - "espree": "^9.6.0", - "globals": "^13.19.0", - "ignore": "^5.2.0", - "import-fresh": "^3.2.1", - "js-yaml": "^4.1.0", - "minimatch": "^3.1.2", - "strip-json-comments": "^3.1.1" - }, + "license": "Apache-2.0", "engines": { "node": "^12.22.0 || ^14.17.0 || >=16.0.0" }, @@ -347,27 +603,225 @@ "url": "https://opencollective.com/eslint" } }, - "node_modules/@eslint/js": { - "version": "8.57.0", - "resolved": "https://registry.npmjs.org/@eslint/js/-/js-8.57.0.tgz", - "integrity": "sha512-Ys+3g2TaW7gADOJzPt83SJtCDhMjndcDMFVQ/Tj9iA1BfJzFKD9mAUXT3OenpuPHbI6P/myECxRJrofUsDx/5g==", + "node_modules/@eslint-community/regexpp": { + "version": "4.12.1", + "resolved": "https://registry.npmjs.org/@eslint-community/regexpp/-/regexpp-4.12.1.tgz", + "integrity": "sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==", "dev": true, + "license": "MIT", "engines": { - "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + "node": "^12.0.0 || ^14.0.0 || >=16.0.0" } }, - "node_modules/@humanwhocodes/config-array": { - "version": "0.11.14", - "resolved": "https://registry.npmjs.org/@humanwhocodes/config-array/-/config-array-0.11.14.tgz", - "integrity": "sha512-3T8LkOmg45BV5FICb15QQMsyUSWrQ8AygVfC7ZG32zOalnqrilm018ZVCw0eapXux8FtA33q8PSRSstjee3jSg==", + "node_modules/@eslint/config-array": { + "version": "0.21.0", + "resolved": "https://registry.npmjs.org/@eslint/config-array/-/config-array-0.21.0.tgz", + "integrity": "sha512-ENIdc4iLu0d93HeYirvKmrzshzofPw6VkZRKQGe9Nv46ZnWUzcF1xV01dcvEg/1wXUR61OmmlSfyeyO7EvjLxQ==", "dev": true, + "license": "Apache-2.0", "dependencies": { - "@humanwhocodes/object-schema": "^2.0.2", + "@eslint/object-schema": "^2.1.6", "debug": "^4.3.1", - "minimatch": "^3.0.5" + "minimatch": "^3.1.2" }, "engines": { - "node": ">=10.10.0" + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/config-array/node_modules/brace-expansion": { + "version": "1.1.12", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.12.tgz", + "integrity": "sha512-9T9UjW3r0UW5c1Q7GTwllptXwhvYmEzFhzMfZ9H7FQWt+uZePjZPjBP/W1ZEyZ1twGWom5/56TF4lPcqjnDHcg==", + "dev": true, + "license": "MIT", + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/@eslint/config-array/node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dev": true, + "license": "ISC", + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/@eslint/config-helpers": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/@eslint/config-helpers/-/config-helpers-0.3.0.tgz", + "integrity": "sha512-ViuymvFmcJi04qdZeDc2whTHryouGcDlaxPqarTD0ZE10ISpxGUVZGZDx4w01upyIynL3iu6IXH2bS1NhclQMw==", + "dev": true, + "license": "Apache-2.0", + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/core": { + "version": "0.14.0", + "resolved": "https://registry.npmjs.org/@eslint/core/-/core-0.14.0.tgz", + "integrity": "sha512-qIbV0/JZr7iSDjqAc60IqbLdsj9GDt16xQtWD+B78d/HAlvysGdZZ6rpJHGAc2T0FQx1X6thsSPdnoiGKdNtdg==", + "dev": true, + "license": "Apache-2.0", + "dependencies": { + "@types/json-schema": "^7.0.15" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/eslintrc": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-3.3.1.tgz", + "integrity": "sha512-gtF186CXhIl1p4pJNGZw8Yc6RlshoePRvE0X91oPGb3vZ8pM3qOS9W9NGPat9LziaBV7XrJWGylNQXkGcnM3IQ==", + "dev": true, + "license": "MIT", + "dependencies": { + "ajv": "^6.12.4", + "debug": "^4.3.2", + "espree": "^10.0.1", + "globals": "^14.0.0", + "ignore": "^5.2.0", + "import-fresh": "^3.2.1", + "js-yaml": "^4.1.0", + "minimatch": "^3.1.2", + "strip-json-comments": "^3.1.1" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/@eslint/eslintrc/node_modules/brace-expansion": { + "version": "1.1.12", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.12.tgz", + "integrity": "sha512-9T9UjW3r0UW5c1Q7GTwllptXwhvYmEzFhzMfZ9H7FQWt+uZePjZPjBP/W1ZEyZ1twGWom5/56TF4lPcqjnDHcg==", + "dev": true, + "license": "MIT", + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/@eslint/eslintrc/node_modules/globals": { + "version": "14.0.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-14.0.0.tgz", + "integrity": "sha512-oahGvuMGQlPw/ivIYBjVSrWAfWLBeku5tpPE2fOPLi+WHffIWbuh2tCjhyQhTBPMf5E9jDEH4FOmTYgYwbKwtQ==", + "dev": true, + "license": "MIT", + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/@eslint/eslintrc/node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dev": true, + "license": "ISC", + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/@eslint/js": { + "version": "9.30.0", + "resolved": "https://registry.npmjs.org/@eslint/js/-/js-9.30.0.tgz", + "integrity": "sha512-Wzw3wQwPvc9sHM+NjakWTcPx11mbZyiYHuwWa/QfZ7cIRX7WK54PSk7bdyXDaoaopUcMatv1zaQvOAAO8hCdww==", + "dev": true, + "license": "MIT", + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "funding": { + "url": "https://eslint.org/donate" + } + }, + "node_modules/@eslint/object-schema": { + "version": "2.1.6", + "resolved": "https://registry.npmjs.org/@eslint/object-schema/-/object-schema-2.1.6.tgz", + "integrity": "sha512-RBMg5FRL0I0gs51M/guSAj5/e14VQ4tpZnQNWwuDT66P14I43ItmPfIZRhO9fUVIPOAQXU47atlywZ/czoqFPA==", + "dev": true, + "license": "Apache-2.0", + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/plugin-kit": { + "version": "0.3.3", + "resolved": "https://registry.npmjs.org/@eslint/plugin-kit/-/plugin-kit-0.3.3.tgz", + "integrity": "sha512-1+WqvgNMhmlAambTvT3KPtCl/Ibr68VldY2XY40SL1CE0ZXiakFR/cbTspaF5HsnpDMvcYYoJHfl4980NBjGag==", + "dev": true, + "license": "Apache-2.0", + "dependencies": { + "@eslint/core": "^0.15.1", + "levn": "^0.4.1" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/plugin-kit/node_modules/@eslint/core": { + "version": "0.15.1", + "resolved": "https://registry.npmjs.org/@eslint/core/-/core-0.15.1.tgz", + "integrity": "sha512-bkOp+iumZCCbt1K1CmWf0R9pM5yKpDv+ZXtvSyQpudrI9kuFLp+bM2WOPXImuD/ceQuaa8f5pj93Y7zyECIGNA==", + "dev": true, + "license": "Apache-2.0", + "dependencies": { + "@types/json-schema": "^7.0.15" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@humanfs/core": { + "version": "0.19.1", + "resolved": "https://registry.npmjs.org/@humanfs/core/-/core-0.19.1.tgz", + "integrity": "sha512-5DyQ4+1JEUzejeK1JGICcideyfUbGixgS9jNgex5nqkW+cY7WZhxBigmieN5Qnw9ZosSNVC9KQKyb+GUaGyKUA==", + "dev": true, + "license": "Apache-2.0", + "engines": { + "node": ">=18.18.0" + } + }, + "node_modules/@humanfs/node": { + "version": "0.16.6", + "resolved": "https://registry.npmjs.org/@humanfs/node/-/node-0.16.6.tgz", + "integrity": "sha512-YuI2ZHQL78Q5HbhDiBA1X4LmYdXCKCMQIfw0pw7piHJwyREFebJUvrQN4cMssyES6x+vfUbx1CIpaQUKYdQZOw==", + "dev": true, + "license": "Apache-2.0", + "dependencies": { + "@humanfs/core": "^0.19.1", + "@humanwhocodes/retry": "^0.3.0" + }, + "engines": { + "node": ">=18.18.0" + } + }, + "node_modules/@humanfs/node/node_modules/@humanwhocodes/retry": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/@humanwhocodes/retry/-/retry-0.3.1.tgz", + "integrity": "sha512-JBxkERygn7Bv/GbN5Rv8Ul6LVknS+5Bp6RgDC/O8gEBU/yeH5Ui5C/OlWrTb6qct7LjjfT6Re2NxB0ln0yYybA==", + "dev": true, + "license": "Apache-2.0", + "engines": { + "node": ">=18.18" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/nzakas" } }, "node_modules/@humanwhocodes/module-importer": { @@ -375,6 +829,7 @@ "resolved": "https://registry.npmjs.org/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz", "integrity": "sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==", "dev": true, + "license": "Apache-2.0", "engines": { "node": ">=12.22" }, @@ -383,77 +838,28 @@ "url": "https://github.com/sponsors/nzakas" } }, - "node_modules/@humanwhocodes/object-schema": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/@humanwhocodes/object-schema/-/object-schema-2.0.2.tgz", - "integrity": "sha512-6EwiSjwWYP7pTckG6I5eyFANjPhmPjUX9JRLUSfNPC7FX7zK9gyZAfUEaECL6ALTpGX5AjnBq3C9XmVWPitNpw==", - "dev": true - }, - "node_modules/@isaacs/cliui": { - "version": "8.0.2", - "resolved": "https://registry.npmjs.org/@isaacs/cliui/-/cliui-8.0.2.tgz", - "integrity": "sha512-O8jcjabXaleOG9DQ0+ARXWZBTfnP4WNAqzuiJK7ll44AmxGKv/J2M4TPjxjY3znBCfvBXFzucm1twdyFybFqEA==", + "node_modules/@humanwhocodes/retry": { + "version": "0.4.3", + "resolved": "https://registry.npmjs.org/@humanwhocodes/retry/-/retry-0.4.3.tgz", + "integrity": "sha512-bV0Tgo9K4hfPCek+aMAn81RppFKv2ySDQeMoSZuvTASywNTnVJCArCZE2FWqpvIatKu7VMRLWlR1EazvVhDyhQ==", "dev": true, - "dependencies": { - "string-width": "^5.1.2", - "string-width-cjs": "npm:string-width@^4.2.0", - "strip-ansi": "^7.0.1", - "strip-ansi-cjs": "npm:strip-ansi@^6.0.1", - "wrap-ansi": "^8.1.0", - "wrap-ansi-cjs": "npm:wrap-ansi@^7.0.0" - }, + "license": "Apache-2.0", "engines": { - "node": ">=12" - } - }, - "node_modules/@isaacs/cliui/node_modules/ansi-regex": { - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz", - "integrity": "sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==", - "dev": true, - "engines": { - "node": ">=12" + "node": ">=18.18" }, "funding": { - "url": "https://github.com/chalk/ansi-regex?sponsor=1" + "type": "github", + "url": "https://github.com/sponsors/nzakas" } }, - "node_modules/@isaacs/cliui/node_modules/emoji-regex": { - "version": "9.2.2", - "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-9.2.2.tgz", - "integrity": "sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==", - "dev": true - }, - "node_modules/@isaacs/cliui/node_modules/string-width": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-5.1.2.tgz", - "integrity": "sha512-HnLOCR3vjcY8beoNLtcjZ5/nxn2afmME6lhrDrebokqMap+XbeW8n9TXpPDOqdGK5qcI3oT0GKTW6wC7EMiVqA==", + "node_modules/@keyv/serialize": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/@keyv/serialize/-/serialize-1.0.3.tgz", + "integrity": "sha512-qnEovoOp5Np2JDGonIDL6Ayihw0RhnRh6vxPuHo4RDn1UOzwEo4AeIfpL6UGIrsceWrCMiVPgwRjbHu4vYFc3g==", "dev": true, + "license": "MIT", "dependencies": { - "eastasianwidth": "^0.2.0", - "emoji-regex": "^9.2.2", - "strip-ansi": "^7.0.1" - }, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/@isaacs/cliui/node_modules/strip-ansi": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-7.1.0.tgz", - "integrity": "sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==", - "dev": true, - "dependencies": { - "ansi-regex": "^6.0.1" - }, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/strip-ansi?sponsor=1" + "buffer": "^6.0.3" } }, "node_modules/@nodelib/fs.scandir": { @@ -461,6 +867,7 @@ "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz", "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==", "dev": true, + "license": "MIT", "dependencies": { "@nodelib/fs.stat": "2.0.5", "run-parallel": "^1.1.9" @@ -474,6 +881,7 @@ "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz", "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==", "dev": true, + "license": "MIT", "engines": { "node": ">= 8" } @@ -483,6 +891,7 @@ "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz", "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==", "dev": true, + "license": "MIT", "dependencies": { "@nodelib/fs.scandir": "2.1.5", "fastq": "^1.6.0" @@ -491,32 +900,61 @@ "node": ">= 8" } }, - "node_modules/@pkgjs/parseargs": { - "version": "0.11.0", - "resolved": "https://registry.npmjs.org/@pkgjs/parseargs/-/parseargs-0.11.0.tgz", - "integrity": "sha512-+1VkjdD0QBLPodGrJUeqarH8VAIvQODIbwh9XpP5Syisf7YoQgsJKPNFoqqLQlu+VQ/tVSshMR6loPMn8U+dPg==", + "node_modules/@stylistic/eslint-plugin": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/@stylistic/eslint-plugin/-/eslint-plugin-5.1.0.tgz", + "integrity": "sha512-TJRJul4u/lmry5N/kyCU+7RWWOk0wyXN+BncRlDYBqpLFnzXkd7QGVfN7KewarFIXv0IX0jSF/Ksu7aHWEDeuw==", "dev": true, - "optional": true, + "license": "MIT", + "dependencies": { + "@eslint-community/eslint-utils": "^4.7.0", + "@typescript-eslint/types": "^8.34.1", + "eslint-visitor-keys": "^4.2.1", + "espree": "^10.4.0", + "estraverse": "^5.3.0", + "picomatch": "^4.0.2" + }, "engines": { - "node": ">=14" + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "peerDependencies": { + "eslint": ">=9.0.0" } }, - "node_modules/@ungap/structured-clone": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/@ungap/structured-clone/-/structured-clone-1.2.0.tgz", - "integrity": "sha512-zuVdFrMJiuCDQUMCzQaD6KL28MjnqqN8XnAqiEq9PNm/hCPTSGfrXCOfwj1ow4LFb/tNymJPwsNbVePc1xFqrQ==", - "dev": true + "node_modules/@types/estree": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/@types/estree/-/estree-1.0.8.tgz", + "integrity": "sha512-dWHzHa2WqEXI/O1E9OjrocMTKJl2mSrEolh1Iomrv6U+JuNwaHXsXx9bLu5gG7BUWFIN0skIQJQ/L1rIex4X6w==", + "dev": true, + "license": "MIT" }, - "node_modules/@zachleat/snow-fall": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/@zachleat/snow-fall/-/snow-fall-1.0.2.tgz", - "integrity": "sha512-nyNeliowryq+roSMktyV3o14DduSuU4BvBzruVSPV6e8U8Eid2zNzSj1AzCQByPId7Q4MrIP2QWL2UHeHGfmcA==" + "node_modules/@types/json-schema": { + "version": "7.0.15", + "resolved": "https://registry.npmjs.org/@types/json-schema/-/json-schema-7.0.15.tgz", + "integrity": "sha512-5+fP8P8MFNC+AyZCDxrB2pkZFPGzqQWUzpSeuuVLvm8VMcorNYavBqoFcxK8bQz4Qsbn4oUEEem4wDLfcysGHA==", + "dev": true, + "license": "MIT" + }, + "node_modules/@typescript-eslint/types": { + "version": "8.35.1", + "resolved": "https://registry.npmjs.org/@typescript-eslint/types/-/types-8.35.1.tgz", + "integrity": "sha512-q/O04vVnKHfrrhNAscndAn1tuQhIkwqnaW+eu5waD5IPts2eX1dgJxgqcPx5BX109/qAz7IG6VrEPTOYKCNfRQ==", + "dev": true, + "license": "MIT", + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/typescript-eslint" + } }, "node_modules/acorn": { - "version": "8.11.2", - "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.11.2.tgz", - "integrity": "sha512-nc0Axzp/0FILLEVsm4fNwLCwMttvhEI263QtVPQcbpfZZ3ts0hLsZGOpE6czNlid7CJ9MlyH8reXkpsf3YUY4w==", + "version": "8.15.0", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.15.0.tgz", + "integrity": "sha512-NZyJarBfL7nWwIq+FDL6Zp/yHEhePMNnnJ0y3qfieCrmNvYct8uvtiV41UvlSe6apAfk0fY1FbWx+NwfmpvtTg==", "dev": true, + "license": "MIT", "bin": { "acorn": "bin/acorn" }, @@ -529,6 +967,7 @@ "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.3.2.tgz", "integrity": "sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==", "dev": true, + "license": "MIT", "peerDependencies": { "acorn": "^6.0.0 || ^7.0.0 || ^8.0.0" } @@ -538,6 +977,7 @@ "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", "dev": true, + "license": "MIT", "dependencies": { "fast-deep-equal": "^3.1.1", "fast-json-stable-stringify": "^2.0.0", @@ -554,6 +994,7 @@ "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } @@ -563,6 +1004,7 @@ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", "dev": true, + "license": "MIT", "dependencies": { "color-convert": "^2.0.1" }, @@ -577,13 +1019,15 @@ "version": "2.0.1", "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz", "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==", - "dev": true + "dev": true, + "license": "Python-2.0" }, "node_modules/array-union": { "version": "2.1.0", "resolved": "https://registry.npmjs.org/array-union/-/array-union-2.1.0.tgz", "integrity": "sha512-HGyxoOTYUyCM6stUe6EJgnd4EoewAI7zMdfqO+kGjnlZmBDz/cR5pf8r/cR4Wq60sL/p0IkcjUEEPwS3GFrIyw==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } @@ -593,6 +1037,7 @@ "resolved": "https://registry.npmjs.org/astral-regex/-/astral-regex-2.0.0.tgz", "integrity": "sha512-Z7tMw1ytTXt5jqMcOP+OQteU1VuNK9Y02uuJtKQ1Sv69jXQKKg5cibLwGJow8yzZP+eAc18EmLGPal0bp36rvQ==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } @@ -601,35 +1046,95 @@ "version": "1.0.2", "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", - "dev": true - }, - "node_modules/brace-expansion": { - "version": "1.1.11", - "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", - "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", "dev": true, - "dependencies": { - "balanced-match": "^1.0.0", - "concat-map": "0.0.1" - } + "license": "MIT" + }, + "node_modules/base64-js": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.5.1.tgz", + "integrity": "sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT" }, "node_modules/braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz", + "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==", "dev": true, + "license": "MIT", "dependencies": { - "fill-range": "^7.0.1" + "fill-range": "^7.1.1" }, "engines": { "node": ">=8" } }, + "node_modules/buffer": { + "version": "6.0.3", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-6.0.3.tgz", + "integrity": "sha512-FTiCpNxtwiZZHEZbcbTIcZjERVICn9yq/pDFkTl95/AxzD1naBctN7YO68riM/gLSDY7sdrMby8hofADYuuqOA==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "MIT", + "dependencies": { + "base64-js": "^1.3.1", + "ieee754": "^1.2.1" + } + }, + "node_modules/cacheable": { + "version": "1.10.1", + "resolved": "https://registry.npmjs.org/cacheable/-/cacheable-1.10.1.tgz", + "integrity": "sha512-Fa2BZY0CS9F0PFc/6aVA6tgpOdw+hmv9dkZOlHXII5v5Hw+meJBIWDcPrG9q/dXxGcNbym5t77fzmawrBQfTmQ==", + "dev": true, + "license": "MIT", + "dependencies": { + "hookified": "^1.10.0", + "keyv": "^5.3.4" + } + }, + "node_modules/cacheable/node_modules/keyv": { + "version": "5.3.4", + "resolved": "https://registry.npmjs.org/keyv/-/keyv-5.3.4.tgz", + "integrity": "sha512-ypEvQvInNpUe+u+w8BIcPkQvEqXquyyibWE/1NB5T2BTzIpS5cGEV1LZskDzPSTvNAaT4+5FutvzlvnkxOSKlw==", + "dev": true, + "license": "MIT", + "dependencies": { + "@keyv/serialize": "^1.0.3" + } + }, "node_modules/callsites": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz", "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==", "dev": true, + "license": "MIT", "engines": { "node": ">=6" } @@ -639,6 +1144,7 @@ "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz", "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==", "dev": true, + "license": "MIT", "dependencies": { "ansi-styles": "^4.1.0", "supports-color": "^7.1.0" @@ -655,6 +1161,7 @@ "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", "dev": true, + "license": "MIT", "dependencies": { "color-name": "~1.1.4" }, @@ -666,25 +1173,29 @@ "version": "1.1.4", "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/colord": { "version": "2.9.3", "resolved": "https://registry.npmjs.org/colord/-/colord-2.9.3.tgz", "integrity": "sha512-jeC1axXpnb0/2nn/Y1LPuLdgXBLH7aDcHu4KEKfqw3CUhX7ZpfBSlPKyqXE6btIgEzfWtrX3/tyBCaCvXvMkOw==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/concat-map": { "version": "0.0.1", "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/cosmiconfig": { "version": "9.0.0", "resolved": "https://registry.npmjs.org/cosmiconfig/-/cosmiconfig-9.0.0.tgz", "integrity": "sha512-itvL5h8RETACmOTFc4UfIyB2RfEHi71Ax6E/PivVxq9NseKbOWpeyHEOIbmAw1rs8Ak0VursQNww7lf7YtUwzg==", "dev": true, + "license": "MIT", "dependencies": { "env-paths": "^2.2.1", "import-fresh": "^3.3.0", @@ -707,10 +1218,11 @@ } }, "node_modules/cross-spawn": { - "version": "7.0.3", - "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.3.tgz", - "integrity": "sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==", + "version": "7.0.6", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.6.tgz", + "integrity": "sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==", "dev": true, + "license": "MIT", "dependencies": { "path-key": "^3.1.0", "shebang-command": "^2.0.0", @@ -721,21 +1233,23 @@ } }, "node_modules/css-functions-list": { - "version": "3.2.1", - "resolved": "https://registry.npmjs.org/css-functions-list/-/css-functions-list-3.2.1.tgz", - "integrity": "sha512-Nj5YcaGgBtuUmn1D7oHqPW0c9iui7xsTsj5lIX8ZgevdfhmjFfKB3r8moHJtNJnctnYXJyYX5I1pp90HM4TPgQ==", + "version": "3.2.3", + "resolved": "https://registry.npmjs.org/css-functions-list/-/css-functions-list-3.2.3.tgz", + "integrity": "sha512-IQOkD3hbR5KrN93MtcYuad6YPuTSUhntLHDuLEbFWE+ff2/XSZNdZG+LcbbIW5AXKg/WFIfYItIzVoHngHXZzA==", "dev": true, + "license": "MIT", "engines": { "node": ">=12 || >=16" } }, "node_modules/css-tree": { - "version": "2.3.1", - "resolved": "https://registry.npmjs.org/css-tree/-/css-tree-2.3.1.tgz", - "integrity": "sha512-6Fv1DV/TYw//QF5IzQdqsNDjx/wc8TrMBZsqjL9eW01tWb7R7k/mq+/VXfJCl7SoD5emsJop9cOByJZfs8hYIw==", + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/css-tree/-/css-tree-3.1.0.tgz", + "integrity": "sha512-0eW44TGN5SQXU1mWSkKwFstI/22X2bG1nYzZTYMAWjylYURhse752YgbE4Cx46AC+bAvI+/dYTPRk1LqSUnu6w==", "dev": true, + "license": "MIT", "dependencies": { - "mdn-data": "2.0.30", + "mdn-data": "2.12.2", "source-map-js": "^1.0.1" }, "engines": { @@ -747,6 +1261,7 @@ "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", "dev": true, + "license": "MIT", "bin": { "cssesc": "bin/cssesc" }, @@ -755,12 +1270,13 @@ } }, "node_modules/debug": { - "version": "4.3.4", - "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", - "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.1.tgz", + "integrity": "sha512-KcKCqiftBJcZr++7ykoDIEwSa3XWowTfNPo92BYxjXiyYEVrUQh2aLyhxBCwww+heortUFxEJYcRzosstTEBYQ==", "dev": true, + "license": "MIT", "dependencies": { - "ms": "2.1.2" + "ms": "^2.1.3" }, "engines": { "node": ">=6.0" @@ -775,13 +1291,25 @@ "version": "0.1.4", "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.4.tgz", "integrity": "sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==", - "dev": true + "dev": true, + "license": "MIT" + }, + "node_modules/detect-libc": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-2.0.4.tgz", + "integrity": "sha512-3UDv+G9CsCKO1WKMGw9fwq/SWJYbI0c5Y7LU1AXYoDdbhE2AHQ6N6Nb34sG8Fj7T5APy8qXDCKuuIHd1BR0tVA==", + "dev": true, + "license": "Apache-2.0", + "engines": { + "node": ">=8" + } }, "node_modules/dir-glob": { "version": "3.0.1", "resolved": "https://registry.npmjs.org/dir-glob/-/dir-glob-3.0.1.tgz", "integrity": "sha512-WkrWp9GR4KXfKGYzOLmTuGVi1UWFfws377n9cc55/tb6DuqyF6pcQ5AbiHEshaDpY9v6oaSr2XCDidGmMwdzIA==", "dev": true, + "license": "MIT", "dependencies": { "path-type": "^4.0.0" }, @@ -789,35 +1317,19 @@ "node": ">=8" } }, - "node_modules/doctrine": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-3.0.0.tgz", - "integrity": "sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==", - "dev": true, - "dependencies": { - "esutils": "^2.0.2" - }, - "engines": { - "node": ">=6.0.0" - } - }, - "node_modules/eastasianwidth": { - "version": "0.2.0", - "resolved": "https://registry.npmjs.org/eastasianwidth/-/eastasianwidth-0.2.0.tgz", - "integrity": "sha512-I88TYZWc9XiYHRQ4/3c5rjjfgkjhLyW2luGIheGERbNQ6OY7yTybanSpDXZa8y7VUP9YmDcYa+eyq4ca7iLqWA==", - "dev": true - }, "node_modules/emoji-regex": { "version": "8.0.0", "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/env-paths": { "version": "2.2.1", "resolved": "https://registry.npmjs.org/env-paths/-/env-paths-2.2.1.tgz", "integrity": "sha512-+h1lkLKhZMTYjog1VEpJNG7NZJWcuc2DDk/qsqSTRRCOXiLjeQ1d1/udrUGhqMxUgAlwKNZ0cf2uqan5GLuS2A==", "dev": true, + "license": "MIT", "engines": { "node": ">=6" } @@ -827,15 +1339,58 @@ "resolved": "https://registry.npmjs.org/error-ex/-/error-ex-1.3.2.tgz", "integrity": "sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g==", "dev": true, + "license": "MIT", "dependencies": { "is-arrayish": "^0.2.1" } }, + "node_modules/esbuild": { + "version": "0.25.5", + "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.25.5.tgz", + "integrity": "sha512-P8OtKZRv/5J5hhz0cUAdu/cLuPIKXpQl1R9pZtvmHWQvrAUVd0UNIPT4IB4W3rNOqVO0rlqHmCIbSwxh/c9yUQ==", + "dev": true, + "hasInstallScript": true, + "license": "MIT", + "bin": { + "esbuild": "bin/esbuild" + }, + "engines": { + "node": ">=18" + }, + "optionalDependencies": { + "@esbuild/aix-ppc64": "0.25.5", + "@esbuild/android-arm": "0.25.5", + "@esbuild/android-arm64": "0.25.5", + "@esbuild/android-x64": "0.25.5", + "@esbuild/darwin-arm64": "0.25.5", + "@esbuild/darwin-x64": "0.25.5", + "@esbuild/freebsd-arm64": "0.25.5", + "@esbuild/freebsd-x64": "0.25.5", + "@esbuild/linux-arm": "0.25.5", + "@esbuild/linux-arm64": "0.25.5", + "@esbuild/linux-ia32": "0.25.5", + "@esbuild/linux-loong64": "0.25.5", + "@esbuild/linux-mips64el": "0.25.5", + "@esbuild/linux-ppc64": "0.25.5", + "@esbuild/linux-riscv64": "0.25.5", + "@esbuild/linux-s390x": "0.25.5", + "@esbuild/linux-x64": "0.25.5", + "@esbuild/netbsd-arm64": "0.25.5", + "@esbuild/netbsd-x64": "0.25.5", + "@esbuild/openbsd-arm64": "0.25.5", + "@esbuild/openbsd-x64": "0.25.5", + "@esbuild/sunos-x64": "0.25.5", + "@esbuild/win32-arm64": "0.25.5", + "@esbuild/win32-ia32": "0.25.5", + "@esbuild/win32-x64": "0.25.5" + } + }, "node_modules/escape-string-regexp": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz", "integrity": "sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==", "dev": true, + "license": "MIT", "engines": { "node": ">=10" }, @@ -844,110 +1399,144 @@ } }, "node_modules/eslint": { - "version": "8.57.0", - "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.57.0.tgz", - "integrity": "sha512-dZ6+mexnaTIbSBZWgou51U6OmzIhYM2VcNdtiTtI7qPNZm35Akpr0f6vtw3w1Kmn5PYo+tZVfh13WrhpS6oLqQ==", + "version": "9.30.0", + "resolved": "https://registry.npmjs.org/eslint/-/eslint-9.30.0.tgz", + "integrity": "sha512-iN/SiPxmQu6EVkf+m1qpBxzUhE12YqFLOSySuOyVLJLEF9nzTf+h/1AJYc1JWzCnktggeNrjvQGLngDzXirU6g==", "dev": true, + "license": "MIT", "dependencies": { "@eslint-community/eslint-utils": "^4.2.0", - "@eslint-community/regexpp": "^4.6.1", - "@eslint/eslintrc": "^2.1.4", - "@eslint/js": "8.57.0", - "@humanwhocodes/config-array": "^0.11.14", + "@eslint-community/regexpp": "^4.12.1", + "@eslint/config-array": "^0.21.0", + "@eslint/config-helpers": "^0.3.0", + "@eslint/core": "^0.14.0", + "@eslint/eslintrc": "^3.3.1", + "@eslint/js": "9.30.0", + "@eslint/plugin-kit": "^0.3.1", + "@humanfs/node": "^0.16.6", "@humanwhocodes/module-importer": "^1.0.1", - "@nodelib/fs.walk": "^1.2.8", - "@ungap/structured-clone": "^1.2.0", + "@humanwhocodes/retry": "^0.4.2", + "@types/estree": "^1.0.6", + "@types/json-schema": "^7.0.15", "ajv": "^6.12.4", "chalk": "^4.0.0", - "cross-spawn": "^7.0.2", + "cross-spawn": "^7.0.6", "debug": "^4.3.2", - "doctrine": "^3.0.0", "escape-string-regexp": "^4.0.0", - "eslint-scope": "^7.2.2", - "eslint-visitor-keys": "^3.4.3", - "espree": "^9.6.1", - "esquery": "^1.4.2", + "eslint-scope": "^8.4.0", + "eslint-visitor-keys": "^4.2.1", + "espree": "^10.4.0", + "esquery": "^1.5.0", "esutils": "^2.0.2", "fast-deep-equal": "^3.1.3", - "file-entry-cache": "^6.0.1", + "file-entry-cache": "^8.0.0", "find-up": "^5.0.0", "glob-parent": "^6.0.2", - "globals": "^13.19.0", - "graphemer": "^1.4.0", "ignore": "^5.2.0", "imurmurhash": "^0.1.4", "is-glob": "^4.0.0", - "is-path-inside": "^3.0.3", - "js-yaml": "^4.1.0", "json-stable-stringify-without-jsonify": "^1.0.1", - "levn": "^0.4.1", "lodash.merge": "^4.6.2", "minimatch": "^3.1.2", "natural-compare": "^1.4.0", - "optionator": "^0.9.3", - "strip-ansi": "^6.0.1", - "text-table": "^0.2.0" + "optionator": "^0.9.3" }, "bin": { "eslint": "bin/eslint.js" }, "engines": { - "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" }, "funding": { - "url": "https://opencollective.com/eslint" + "url": "https://eslint.org/donate" + }, + "peerDependencies": { + "jiti": "*" + }, + "peerDependenciesMeta": { + "jiti": { + "optional": true + } } }, "node_modules/eslint-scope": { - "version": "7.2.2", - "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.2.tgz", - "integrity": "sha512-dOt21O7lTMhDM+X9mB4GX+DZrZtCUJPL/wlcTqxyrx5IvO0IYtILdtrQGQp+8n5S0gwSVmOf9NQrjMOgfQZlIg==", + "version": "8.4.0", + "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-8.4.0.tgz", + "integrity": "sha512-sNXOfKCn74rt8RICKMvJS7XKV/Xk9kA7DyJr8mJik3S7Cwgy3qlkkmyS2uQB3jiJg6VNdZd/pDBJu0nvG2NlTg==", "dev": true, + "license": "BSD-2-Clause", "dependencies": { "esrecurse": "^4.3.0", "estraverse": "^5.2.0" }, "engines": { - "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" }, "funding": { "url": "https://opencollective.com/eslint" } }, "node_modules/eslint-visitor-keys": { - "version": "3.4.3", - "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz", - "integrity": "sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==", + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-4.2.1.tgz", + "integrity": "sha512-Uhdk5sfqcee/9H/rCOJikYz67o0a2Tw2hGRPOG2Y1R2dg7brRe1uG0yaNQDHu+TO/uQPF/5eCapvYSmHUjt7JQ==", "dev": true, + "license": "Apache-2.0", "engines": { - "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" }, "funding": { "url": "https://opencollective.com/eslint" } }, - "node_modules/espree": { - "version": "9.6.1", - "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.1.tgz", - "integrity": "sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==", + "node_modules/eslint/node_modules/brace-expansion": { + "version": "1.1.12", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.12.tgz", + "integrity": "sha512-9T9UjW3r0UW5c1Q7GTwllptXwhvYmEzFhzMfZ9H7FQWt+uZePjZPjBP/W1ZEyZ1twGWom5/56TF4lPcqjnDHcg==", "dev": true, + "license": "MIT", "dependencies": { - "acorn": "^8.9.0", - "acorn-jsx": "^5.3.2", - "eslint-visitor-keys": "^3.4.1" + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/eslint/node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dev": true, + "license": "ISC", + "dependencies": { + "brace-expansion": "^1.1.7" }, "engines": { - "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + "node": "*" + } + }, + "node_modules/espree": { + "version": "10.4.0", + "resolved": "https://registry.npmjs.org/espree/-/espree-10.4.0.tgz", + "integrity": "sha512-j6PAQ2uUr79PZhBjP5C5fhl8e39FmRnOjsD5lGnWrFU8i2G776tBK7+nP8KuQUTTyAZUwfQqXAgrVH5MbH9CYQ==", + "dev": true, + "license": "BSD-2-Clause", + "dependencies": { + "acorn": "^8.15.0", + "acorn-jsx": "^5.3.2", + "eslint-visitor-keys": "^4.2.1" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" }, "funding": { "url": "https://opencollective.com/eslint" } }, "node_modules/esquery": { - "version": "1.5.0", - "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.5.0.tgz", - "integrity": "sha512-YQLXUplAwJgCydQ78IMJywZCceoqk1oH01OERdSAJc/7U2AylwjhSCLDEtqwg811idIS/9fIU5GjG73IgjKMVg==", + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.6.0.tgz", + "integrity": "sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==", "dev": true, + "license": "BSD-3-Clause", "dependencies": { "estraverse": "^5.1.0" }, @@ -960,6 +1549,7 @@ "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz", "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==", "dev": true, + "license": "BSD-2-Clause", "dependencies": { "estraverse": "^5.2.0" }, @@ -972,6 +1562,7 @@ "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.3.0.tgz", "integrity": "sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==", "dev": true, + "license": "BSD-2-Clause", "engines": { "node": ">=4.0" } @@ -981,6 +1572,7 @@ "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==", "dev": true, + "license": "BSD-2-Clause", "engines": { "node": ">=0.10.0" } @@ -989,19 +1581,21 @@ "version": "3.1.3", "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/fast-glob": { - "version": "3.3.2", - "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.2.tgz", - "integrity": "sha512-oX2ruAFQwf/Orj8m737Y5adxDQO0LAB7/S5MnxCdTNDd4p6BsyIVsv9JQsATbTSq8KHRpLwIHbVlUNatxd+1Ow==", + "version": "3.3.3", + "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.3.tgz", + "integrity": "sha512-7MptL8U0cqcFdzIzwOTHoilX9x5BrNqye7Z/LuC7kCMRio1EMSyqRK3BEAUD7sXRq4iT4AzTVuZdhgQ2TCvYLg==", "dev": true, + "license": "MIT", "dependencies": { "@nodelib/fs.stat": "^2.0.2", "@nodelib/fs.walk": "^1.2.3", "glob-parent": "^5.1.2", "merge2": "^1.3.0", - "micromatch": "^4.0.4" + "micromatch": "^4.0.8" }, "engines": { "node": ">=8.6.0" @@ -1012,6 +1606,7 @@ "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", "dev": true, + "license": "ISC", "dependencies": { "is-glob": "^4.0.1" }, @@ -1023,49 +1618,72 @@ "version": "2.1.0", "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/fast-levenshtein": { "version": "2.0.6", "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz", "integrity": "sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==", - "dev": true + "dev": true, + "license": "MIT" + }, + "node_modules/fast-uri": { + "version": "3.0.6", + "resolved": "https://registry.npmjs.org/fast-uri/-/fast-uri-3.0.6.tgz", + "integrity": "sha512-Atfo14OibSv5wAp4VWNsFYE1AchQRTv9cBGWET4pZWHzYshFSS9NQI6I57rdKn9croWVMbYFbLhJ+yJvmZIIHw==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/fastify" + }, + { + "type": "opencollective", + "url": "https://opencollective.com/fastify" + } + ], + "license": "BSD-3-Clause" }, "node_modules/fastest-levenshtein": { "version": "1.0.16", "resolved": "https://registry.npmjs.org/fastest-levenshtein/-/fastest-levenshtein-1.0.16.tgz", "integrity": "sha512-eRnCtTTtGZFpQCwhJiUOuxPQWRXVKYDn0b2PeHfXL6/Zi53SLAzAHfVhVWK2AryC/WH05kGfxhFIPvTF0SXQzg==", "dev": true, + "license": "MIT", "engines": { "node": ">= 4.9.1" } }, "node_modules/fastq": { - "version": "1.16.0", - "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.16.0.tgz", - "integrity": "sha512-ifCoaXsDrsdkWTtiNJX5uzHDsrck5TzfKKDcuFFTIrrc/BS076qgEIfoIy1VeZqViznfKiysPYTh/QeHtnIsYA==", + "version": "1.19.1", + "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.19.1.tgz", + "integrity": "sha512-GwLTyxkCXjXbxqIhTsMI2Nui8huMPtnxg7krajPJAjnEG/iiOS7i+zCtWGZR9G0NBKbXKh6X9m9UIsYX/N6vvQ==", "dev": true, + "license": "ISC", "dependencies": { "reusify": "^1.0.4" } }, "node_modules/file-entry-cache": { - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-6.0.1.tgz", - "integrity": "sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==", + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-8.0.0.tgz", + "integrity": "sha512-XXTUwCvisa5oacNGRP9SfNtYBNAMi+RPwBFmblZEF7N7swHYQS6/Zfk7SRwx4D5j3CH211YNRco1DEMNVfZCnQ==", "dev": true, + "license": "MIT", "dependencies": { - "flat-cache": "^3.0.4" + "flat-cache": "^4.0.0" }, "engines": { - "node": "^10.12.0 || >=12.0.0" + "node": ">=16.0.0" } }, "node_modules/fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz", + "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==", "dev": true, + "license": "MIT", "dependencies": { "to-regex-range": "^5.0.1" }, @@ -1078,6 +1696,7 @@ "resolved": "https://registry.npmjs.org/find-up/-/find-up-5.0.0.tgz", "integrity": "sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==", "dev": true, + "license": "MIT", "dependencies": { "locate-path": "^6.0.0", "path-exists": "^4.0.0" @@ -1090,72 +1709,32 @@ } }, "node_modules/flat-cache": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-3.2.0.tgz", - "integrity": "sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==", + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-4.0.1.tgz", + "integrity": "sha512-f7ccFPK3SXFHpx15UIGyRJ/FJQctuKZ0zVuN3frBo4HnK3cay9VEW0R6yPYFHC0AgqhukPzKjq22t5DmAyqGyw==", "dev": true, + "license": "MIT", "dependencies": { "flatted": "^3.2.9", - "keyv": "^4.5.3", - "rimraf": "^3.0.2" + "keyv": "^4.5.4" }, "engines": { - "node": "^10.12.0 || >=12.0.0" + "node": ">=16" } }, "node_modules/flatted": { - "version": "3.2.9", - "resolved": "https://registry.npmjs.org/flatted/-/flatted-3.2.9.tgz", - "integrity": "sha512-36yxDn5H7OFZQla0/jFJmbIKTdZAQHngCedGxiMmpNfEZM0sdEeT+WczLQrjK6D7o2aiyLYDnkw0R3JK0Qv1RQ==", - "dev": true - }, - "node_modules/foreground-child": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/foreground-child/-/foreground-child-3.1.1.tgz", - "integrity": "sha512-TMKDUnIte6bfb5nWv7V/caI169OHgvwjb7V4WkeUvbQQdjr5rWKqHFiKWb/fcOwB+CzBT+qbWjvj+DVwRskpIg==", + "version": "3.3.3", + "resolved": "https://registry.npmjs.org/flatted/-/flatted-3.3.3.tgz", + "integrity": "sha512-GX+ysw4PBCz0PzosHDepZGANEuFCMLrnRTiEy9McGjmkCQYwRq4A/X786G/fjM/+OjsWSU1ZrY5qyARZmO/uwg==", "dev": true, - "dependencies": { - "cross-spawn": "^7.0.0", - "signal-exit": "^4.0.1" - }, - "engines": { - "node": ">=14" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, - "node_modules/fs.realpath": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", - "integrity": "sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw==", - "dev": true - }, - "node_modules/glob": { - "version": "7.2.3", - "resolved": "https://registry.npmjs.org/glob/-/glob-7.2.3.tgz", - "integrity": "sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q==", - "dev": true, - "dependencies": { - "fs.realpath": "^1.0.0", - "inflight": "^1.0.4", - "inherits": "2", - "minimatch": "^3.1.1", - "once": "^1.3.0", - "path-is-absolute": "^1.0.0" - }, - "engines": { - "node": "*" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } + "license": "ISC" }, "node_modules/glob-parent": { "version": "6.0.2", "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz", "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==", "dev": true, + "license": "ISC", "dependencies": { "is-glob": "^4.0.3" }, @@ -1168,6 +1747,7 @@ "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-2.0.0.tgz", "integrity": "sha512-NGbfmJBp9x8IxyJSd1P+otYK8vonoJactOogrVfFRIAEY1ukil8RSKDz2Yo7wh1oihl51l/r6W4epkeKJHqL8A==", "dev": true, + "license": "MIT", "dependencies": { "global-prefix": "^3.0.0" }, @@ -1180,6 +1760,7 @@ "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-3.0.0.tgz", "integrity": "sha512-awConJSVCHVGND6x3tmMaKcQvwXLhjdkmomy2W+Goaui8YPgYgXJZewhg3fWC+DlfqqQuWg8AwqjGTD2nAPVWg==", "dev": true, + "license": "MIT", "dependencies": { "ini": "^1.3.5", "kind-of": "^6.0.2", @@ -1194,6 +1775,7 @@ "resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz", "integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==", "dev": true, + "license": "ISC", "dependencies": { "isexe": "^2.0.0" }, @@ -1202,15 +1784,13 @@ } }, "node_modules/globals": { - "version": "13.24.0", - "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz", - "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==", + "version": "16.2.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-16.2.0.tgz", + "integrity": "sha512-O+7l9tPdHCU320IigZZPj5zmRCFG9xHmx9cU8FqU2Rp+JN714seHV+2S9+JslCpY4gJwU2vOGox0wzgae/MCEg==", "dev": true, - "dependencies": { - "type-fest": "^0.20.2" - }, + "license": "MIT", "engines": { - "node": ">=8" + "node": ">=18" }, "funding": { "url": "https://github.com/sponsors/sindresorhus" @@ -1221,6 +1801,7 @@ "resolved": "https://registry.npmjs.org/globby/-/globby-11.1.0.tgz", "integrity": "sha512-jhIXaOzy1sb8IyocaruWSn1TjmnBVs8Ayhcy83rmxNJ8q2uWKCAj3CnJY+KpGSXCueAPc0i05kVvVKtP1t9S3g==", "dev": true, + "license": "MIT", "dependencies": { "array-union": "^2.1.0", "dir-glob": "^3.0.1", @@ -1240,28 +1821,32 @@ "version": "0.1.4", "resolved": "https://registry.npmjs.org/globjoin/-/globjoin-0.1.4.tgz", "integrity": "sha512-xYfnw62CKG8nLkZBfWbhWwDw02CHty86jfPcc2cr3ZfeuK9ysoVPPEUxf21bAD/rWAgk52SuBrLJlefNy8mvFg==", - "dev": true - }, - "node_modules/graphemer": { - "version": "1.4.0", - "resolved": "https://registry.npmjs.org/graphemer/-/graphemer-1.4.0.tgz", - "integrity": "sha512-EtKwoO6kxCL9WO5xipiHTZlSzBm7WLT627TqC/uVRd0HKmq8NXyebnNYxDoBi7wt8eTWrUrKXCOVaFq9x1kgag==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/has-flag": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } }, + "node_modules/hookified": { + "version": "1.10.0", + "resolved": "https://registry.npmjs.org/hookified/-/hookified-1.10.0.tgz", + "integrity": "sha512-dJw0492Iddsj56U1JsSTm9E/0B/29a1AuoSLRAte8vQg/kaTGF3IgjEWT8c8yG4cC10+HisE1x5QAwR0Xwc+DA==", + "dev": true, + "license": "MIT" + }, "node_modules/html-tags": { "version": "3.3.1", "resolved": "https://registry.npmjs.org/html-tags/-/html-tags-3.3.1.tgz", "integrity": "sha512-ztqyC3kLto0e9WbNp0aeP+M3kTt+nbaIveGmUxAtZa+8iFgKLUOD4YKM5j+f3QD89bra7UeumolZHKuOXnTmeQ==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" }, @@ -1269,20 +1854,43 @@ "url": "https://github.com/sponsors/sindresorhus" } }, - "node_modules/ignore": { - "version": "5.3.0", - "resolved": "https://registry.npmjs.org/ignore/-/ignore-5.3.0.tgz", - "integrity": "sha512-g7dmpshy+gD7mh88OC9NwSGTKoc3kyLAZQRU1mt53Aw/vnvfXnbC+F/7F7QoYVKbV+KNvJx8wArewKy1vXMtlg==", + "node_modules/ieee754": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.2.1.tgz", + "integrity": "sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==", "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "license": "BSD-3-Clause" + }, + "node_modules/ignore": { + "version": "5.3.2", + "resolved": "https://registry.npmjs.org/ignore/-/ignore-5.3.2.tgz", + "integrity": "sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==", + "dev": true, + "license": "MIT", "engines": { "node": ">= 4" } }, "node_modules/import-fresh": { - "version": "3.3.0", - "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.0.tgz", - "integrity": "sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw==", + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.1.tgz", + "integrity": "sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==", "dev": true, + "license": "MIT", "dependencies": { "parent-module": "^1.0.0", "resolve-from": "^4.0.0" @@ -1299,43 +1907,31 @@ "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", "integrity": "sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA==", "dev": true, + "license": "MIT", "engines": { "node": ">=0.8.19" } }, - "node_modules/inflight": { - "version": "1.0.6", - "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", - "integrity": "sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA==", - "dev": true, - "dependencies": { - "once": "^1.3.0", - "wrappy": "1" - } - }, - "node_modules/inherits": { - "version": "2.0.4", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", - "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", - "dev": true - }, "node_modules/ini": { "version": "1.3.8", "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.8.tgz", "integrity": "sha512-JV/yugV2uzW5iMRSiZAyDtQd+nxtUnjeLt0acNdw98kKLrvuRVyB80tsREOE7yvGVgalhZ6RNXCmEHkUKBKxew==", - "dev": true + "dev": true, + "license": "ISC" }, "node_modules/is-arrayish": { "version": "0.2.1", "resolved": "https://registry.npmjs.org/is-arrayish/-/is-arrayish-0.2.1.tgz", "integrity": "sha512-zz06S8t0ozoDXMG+ube26zeCTNXcKIPJZJi8hBrF4idCLms4CG9QtK7qBl1boi5ODzFpjswb5JPmHCbMpjaYzg==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/is-extglob": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", "dev": true, + "license": "MIT", "engines": { "node": ">=0.10.0" } @@ -1345,6 +1941,7 @@ "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } @@ -1354,6 +1951,7 @@ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", "dev": true, + "license": "MIT", "dependencies": { "is-extglob": "^2.1.1" }, @@ -1366,24 +1964,17 @@ "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", "dev": true, + "license": "MIT", "engines": { "node": ">=0.12.0" } }, - "node_modules/is-path-inside": { - "version": "3.0.3", - "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-3.0.3.tgz", - "integrity": "sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==", - "dev": true, - "engines": { - "node": ">=8" - } - }, "node_modules/is-plain-object": { "version": "5.0.0", "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-5.0.0.tgz", "integrity": "sha512-VRSzKkbMm5jMDoKLbltAkFQ5Qr7VDiTFGXxYFXXowVj387GeGNOCsOH6Msy00SGZ3Fp84b1Naa1psqgcCIEP5Q==", "dev": true, + "license": "MIT", "engines": { "node": ">=0.10.0" } @@ -1392,37 +1983,22 @@ "version": "2.0.0", "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==", - "dev": true - }, - "node_modules/jackspeak": { - "version": "2.3.6", - "resolved": "https://registry.npmjs.org/jackspeak/-/jackspeak-2.3.6.tgz", - "integrity": "sha512-N3yCS/NegsOBokc8GAdM8UcmfsKiSS8cipheD/nivzr700H+nsMOxJjQnvwOcRYVuFkdH0wGUvW2WbXGmrZGbQ==", "dev": true, - "dependencies": { - "@isaacs/cliui": "^8.0.2" - }, - "engines": { - "node": ">=14" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - }, - "optionalDependencies": { - "@pkgjs/parseargs": "^0.11.0" - } + "license": "ISC" }, "node_modules/js-tokens": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/js-yaml": { "version": "4.1.0", "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.0.tgz", "integrity": "sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==", "dev": true, + "license": "MIT", "dependencies": { "argparse": "^2.0.1" }, @@ -1434,31 +2010,36 @@ "version": "3.0.1", "resolved": "https://registry.npmjs.org/json-buffer/-/json-buffer-3.0.1.tgz", "integrity": "sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/json-parse-even-better-errors": { "version": "2.3.1", "resolved": "https://registry.npmjs.org/json-parse-even-better-errors/-/json-parse-even-better-errors-2.3.1.tgz", "integrity": "sha512-xyFwyhro/JEof6Ghe2iz2NcXoj2sloNsWr/XsERDK/oiPCfaNhl5ONfp+jQdAZRQQ0IJWNzH9zIZF7li91kh2w==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/json-schema-traverse": { "version": "0.4.1", "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/json-stable-stringify-without-jsonify": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz", "integrity": "sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/keyv": { "version": "4.5.4", "resolved": "https://registry.npmjs.org/keyv/-/keyv-4.5.4.tgz", "integrity": "sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==", "dev": true, + "license": "MIT", "dependencies": { "json-buffer": "3.0.1" } @@ -1468,21 +2049,24 @@ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.3.tgz", "integrity": "sha512-dcS1ul+9tmeD95T+x28/ehLgd9mENa3LsvDTtzm3vyBEO7RPptvAD+t44WVXaUjTBRcrpFeFlC8WCruUR456hw==", "dev": true, + "license": "MIT", "engines": { "node": ">=0.10.0" } }, "node_modules/known-css-properties": { - "version": "0.29.0", - "resolved": "https://registry.npmjs.org/known-css-properties/-/known-css-properties-0.29.0.tgz", - "integrity": "sha512-Ne7wqW7/9Cz54PDt4I3tcV+hAyat8ypyOGzYRJQfdxnnjeWsTxt1cy8pjvvKeI5kfXuyvULyeeAvwvvtAX3ayQ==", - "dev": true + "version": "0.37.0", + "resolved": "https://registry.npmjs.org/known-css-properties/-/known-css-properties-0.37.0.tgz", + "integrity": "sha512-JCDrsP4Z1Sb9JwG0aJ8Eo2r7k4Ou5MwmThS/6lcIe1ICyb7UBJKGRIUUdqc2ASdE/42lgz6zFUnzAIhtXnBVrQ==", + "dev": true, + "license": "MIT" }, "node_modules/levn": { "version": "0.4.1", "resolved": "https://registry.npmjs.org/levn/-/levn-0.4.1.tgz", "integrity": "sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==", "dev": true, + "license": "MIT", "dependencies": { "prelude-ls": "^1.2.1", "type-check": "~0.4.0" @@ -1491,17 +2075,501 @@ "node": ">= 0.8.0" } }, + "node_modules/lightningcss": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss/-/lightningcss-1.30.1.tgz", + "integrity": "sha512-xi6IyHML+c9+Q3W0S4fCQJOym42pyurFiJUHEcEyHS0CeKzia4yZDEsLlqOFykxOdHpNy0NmvVO31vcSqAxJCg==", + "dev": true, + "license": "MPL-2.0", + "dependencies": { + "detect-libc": "^2.0.3" + }, + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + }, + "optionalDependencies": { + "lightningcss-darwin-arm64": "1.30.1", + "lightningcss-darwin-x64": "1.30.1", + "lightningcss-freebsd-x64": "1.30.1", + "lightningcss-linux-arm-gnueabihf": "1.30.1", + "lightningcss-linux-arm64-gnu": "1.30.1", + "lightningcss-linux-arm64-musl": "1.30.1", + "lightningcss-linux-x64-gnu": "1.30.1", + "lightningcss-linux-x64-musl": "1.30.1", + "lightningcss-win32-arm64-msvc": "1.30.1", + "lightningcss-win32-x64-msvc": "1.30.1" + } + }, + "node_modules/lightningcss-cli": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli/-/lightningcss-cli-1.30.1.tgz", + "integrity": "sha512-m3VtCMfPrEucBbdbJ4om7biAknXJUnMukGzE64Anww6iYgsEaBJJhXQZMLwwEEWtpZrQf78f1xejCDIBhumjUw==", + "dev": true, + "hasInstallScript": true, + "license": "MPL-2.0", + "dependencies": { + "detect-libc": "^2.0.3" + }, + "bin": { + "lightningcss": "lightningcss" + }, + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + }, + "optionalDependencies": { + "lightningcss-cli-darwin-arm64": "1.30.1", + "lightningcss-cli-darwin-x64": "1.30.1", + "lightningcss-cli-freebsd-x64": "1.30.1", + "lightningcss-cli-linux-arm-gnueabihf": "1.30.1", + "lightningcss-cli-linux-arm64-gnu": "1.30.1", + "lightningcss-cli-linux-arm64-musl": "1.30.1", + "lightningcss-cli-linux-x64-gnu": "1.30.1", + "lightningcss-cli-linux-x64-musl": "1.30.1", + "lightningcss-cli-win32-arm64-msvc": "1.30.1", + "lightningcss-cli-win32-x64-msvc": "1.30.1" + } + }, + "node_modules/lightningcss-cli-darwin-arm64": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-darwin-arm64/-/lightningcss-cli-darwin-arm64-1.30.1.tgz", + "integrity": "sha512-h00/Iq4Hjw+1Bm3Uoc2i1cryDdH1YhTK8e7d/Y/Wn2sUrdK9nVRxzuTk7qUur6KqVgXFthItAUhuGjFyDBJpmg==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-darwin-x64": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-darwin-x64/-/lightningcss-cli-darwin-x64-1.30.1.tgz", + "integrity": "sha512-Q7hzbzkGe5EUMgojjYgnhT9wkSLZp0I9Q25IP7IDnMv2KMTdqUSLAn7YMu9Xqt22MspAuIWV7DkyTiN4xM7fIA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-freebsd-x64": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-freebsd-x64/-/lightningcss-cli-freebsd-x64-1.30.1.tgz", + "integrity": "sha512-0VbQDecfjJn7GtvtVbsdEnvR8OY8PyWiVnchbozjODqE4ASpDBjQDtSMbIDRvBtkk5Me6PFhVmCKfuyctCuDqQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-linux-arm-gnueabihf": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-linux-arm-gnueabihf/-/lightningcss-cli-linux-arm-gnueabihf-1.30.1.tgz", + "integrity": "sha512-ngJVmTygPRafw2sF7NFWwez54NKDO2AEY5IEm241qytAw+YsY/oAx/0gG2Fyq4HTGcKud9dc7kHQpWfDTXuGHg==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-linux-arm64-gnu": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-linux-arm64-gnu/-/lightningcss-cli-linux-arm64-gnu-1.30.1.tgz", + "integrity": "sha512-2uh0vwHn0UyrZnVX2XCw8qbwLKuAwM1nLo43ddcviQum9rF08nHdPEqLXZfDzR/VA0pbyFjSw7EbbEBjXGsFxw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-linux-arm64-musl": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-linux-arm64-musl/-/lightningcss-cli-linux-arm64-musl-1.30.1.tgz", + "integrity": "sha512-IUrg/O4r7OPuGo+G9BGaDDodvAoLSq3f0pMmdiODCl8so/LkYvue7ySL8JQO8TebTKoUXE7VcZgdfoSVxkCbuQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-linux-x64-gnu": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-linux-x64-gnu/-/lightningcss-cli-linux-x64-gnu-1.30.1.tgz", + "integrity": "sha512-AoxyUYuwl/IGTFl178Kxm/MMIgao3s9bmp/RrTbh51+8LsUh9YWolvyhmVxfiCauJ70dfoknQ/tsa+NKs2XDfQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-linux-x64-musl": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-linux-x64-musl/-/lightningcss-cli-linux-x64-musl-1.30.1.tgz", + "integrity": "sha512-NSkm/6sKsMTvO/pf8hU1Nwalrz9VsmSC9AKTYmxNsLDrLtzc8PYobcauyv0b1MnXxO1KuqLmFiCnVzGU7WbRPQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-win32-arm64-msvc": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-win32-arm64-msvc/-/lightningcss-cli-win32-arm64-msvc-1.30.1.tgz", + "integrity": "sha512-qDlhf9FAy+26MDMP14VWy+W5ho7KruR1ne2fYWKxgCGw7WZ5gnaaZpRBewp4KRd7lqo/opaIsK8kQy/WJTJD9A==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-cli-win32-x64-msvc": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-cli-win32-x64-msvc/-/lightningcss-cli-win32-x64-msvc-1.30.1.tgz", + "integrity": "sha512-AwkpPbM9NABz1bRLr6GPrUa1wyOOUAZpOoR/HmDMOYPUAiQOlzxsNUR0/YreWbwD3X+dqkwXywSbwHddvTNZ1A==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-darwin-arm64": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-darwin-arm64/-/lightningcss-darwin-arm64-1.30.1.tgz", + "integrity": "sha512-c8JK7hyE65X1MHMN+Viq9n11RRC7hgin3HhYKhrMyaXflk5GVplZ60IxyoVtzILeKr+xAJwg6zK6sjTBJ0FKYQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-darwin-x64": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-darwin-x64/-/lightningcss-darwin-x64-1.30.1.tgz", + "integrity": "sha512-k1EvjakfumAQoTfcXUcHQZhSpLlkAuEkdMBsI/ivWw9hL+7FtilQc0Cy3hrx0AAQrVtQAbMI7YjCgYgvn37PzA==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-freebsd-x64": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-freebsd-x64/-/lightningcss-freebsd-x64-1.30.1.tgz", + "integrity": "sha512-kmW6UGCGg2PcyUE59K5r0kWfKPAVy4SltVeut+umLCFoJ53RdCUWxcRDzO1eTaxf/7Q2H7LTquFHPL5R+Gjyig==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm-gnueabihf": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm-gnueabihf/-/lightningcss-linux-arm-gnueabihf-1.30.1.tgz", + "integrity": "sha512-MjxUShl1v8pit+6D/zSPq9S9dQ2NPFSQwGvxBCYaBYLPlCWuPh9/t1MRS8iUaR8i+a6w7aps+B4N0S1TYP/R+Q==", + "cpu": [ + "arm" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm64-gnu": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-gnu/-/lightningcss-linux-arm64-gnu-1.30.1.tgz", + "integrity": "sha512-gB72maP8rmrKsnKYy8XUuXi/4OctJiuQjcuqWNlJQ6jZiWqtPvqFziskH3hnajfvKB27ynbVCucKSm2rkQp4Bw==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm64-musl": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-musl/-/lightningcss-linux-arm64-musl-1.30.1.tgz", + "integrity": "sha512-jmUQVx4331m6LIX+0wUhBbmMX7TCfjF5FoOH6SD1CttzuYlGNVpA7QnrmLxrsub43ClTINfGSYyHe2HWeLl5CQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-x64-gnu": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-gnu/-/lightningcss-linux-x64-gnu-1.30.1.tgz", + "integrity": "sha512-piWx3z4wN8J8z3+O5kO74+yr6ze/dKmPnI7vLqfSqI8bccaTGY5xiSGVIJBDd5K5BHlvVLpUB3S2YCfelyJ1bw==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-x64-musl": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-musl/-/lightningcss-linux-x64-musl-1.30.1.tgz", + "integrity": "sha512-rRomAK7eIkL+tHY0YPxbc5Dra2gXlI63HL+v1Pdi1a3sC+tJTcFrHX+E86sulgAXeI7rSzDYhPSeHHjqFhqfeQ==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-win32-arm64-msvc": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-win32-arm64-msvc/-/lightningcss-win32-arm64-msvc-1.30.1.tgz", + "integrity": "sha512-mSL4rqPi4iXq5YVqzSsJgMVFENoa4nGTT/GjO2c0Yl9OuQfPsIfncvLrEW6RbbB24WtZ3xP/2CCmI3tNkNV4oA==", + "cpu": [ + "arm64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-win32-x64-msvc": { + "version": "1.30.1", + "resolved": "https://registry.npmjs.org/lightningcss-win32-x64-msvc/-/lightningcss-win32-x64-msvc-1.30.1.tgz", + "integrity": "sha512-PVqXh48wh4T53F/1CCu8PIPCxLzWyCnn/9T5W1Jpmdy5h9Cwd+0YQS6/LwhHXSafuc61/xg9Lv5OrCby6a++jg==", + "cpu": [ + "x64" + ], + "dev": true, + "license": "MPL-2.0", + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, "node_modules/lines-and-columns": { "version": "1.2.4", "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.2.4.tgz", "integrity": "sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/locate-path": { "version": "6.0.0", "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-6.0.0.tgz", "integrity": "sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==", "dev": true, + "license": "MIT", "dependencies": { "p-locate": "^5.0.0" }, @@ -1516,44 +2584,40 @@ "version": "4.6.2", "resolved": "https://registry.npmjs.org/lodash.merge/-/lodash.merge-4.6.2.tgz", "integrity": "sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/lodash.truncate": { "version": "4.4.2", "resolved": "https://registry.npmjs.org/lodash.truncate/-/lodash.truncate-4.4.2.tgz", "integrity": "sha512-jttmRe7bRse52OsWIMDLaXxWqRAmtIUccAQ3garviCqJjafXOfNMO0yMfNpdD6zbGaTU0P5Nz7e7gAT6cKmJRw==", - "dev": true - }, - "node_modules/lru-cache": { - "version": "10.1.0", - "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-10.1.0.tgz", - "integrity": "sha512-/1clY/ui8CzjKFyjdvwPWJUYKiFVXG2I2cY0ssG7h4+hwk+XOIX7ZSG9Q7TW8TW3Kp3BUSqgFWBLgL4PJ+Blag==", "dev": true, - "engines": { - "node": "14 || >=16.14" - } + "license": "MIT" }, "node_modules/mathml-tag-names": { "version": "2.1.3", "resolved": "https://registry.npmjs.org/mathml-tag-names/-/mathml-tag-names-2.1.3.tgz", "integrity": "sha512-APMBEanjybaPzUrfqU0IMU5I0AswKMH7k8OTLs0vvV4KZpExkTkY87nR/zpbuTPj+gARop7aGUbl11pnDfW6xg==", "dev": true, + "license": "MIT", "funding": { "type": "github", "url": "https://github.com/sponsors/wooorm" } }, "node_modules/mdn-data": { - "version": "2.0.30", - "resolved": "https://registry.npmjs.org/mdn-data/-/mdn-data-2.0.30.tgz", - "integrity": "sha512-GaqWWShW4kv/G9IEucWScBx9G1/vsFZZJUO+tD26M8J8z3Kw5RDQjaoZe03YAClgeS/SWPOcb4nkFBTEi5DUEA==", - "dev": true + "version": "2.12.2", + "resolved": "https://registry.npmjs.org/mdn-data/-/mdn-data-2.12.2.tgz", + "integrity": "sha512-IEn+pegP1aManZuckezWCO+XZQDplx1366JoVhTpMpBB1sPey/SbveZQUosKiKiGYjg1wH4pMlNgXbCiYgihQA==", + "dev": true, + "license": "CC0-1.0" }, "node_modules/meow": { - "version": "13.1.0", - "resolved": "https://registry.npmjs.org/meow/-/meow-13.1.0.tgz", - "integrity": "sha512-o5R/R3Tzxq0PJ3v3qcQJtSvSE9nKOLSAaDuuoMzDVuGTwHdccMWcYomh9Xolng2tjT6O/Y83d+0coVGof6tqmA==", + "version": "13.2.0", + "resolved": "https://registry.npmjs.org/meow/-/meow-13.2.0.tgz", + "integrity": "sha512-pxQJQzB6djGPXh08dacEloMFopsOqGVRKFPYvPOt9XDZ1HasbgDZA74CJGreSU4G3Ak7EFJGoiH2auq+yXISgA==", "dev": true, + "license": "MIT", "engines": { "node": ">=18" }, @@ -1566,54 +2630,49 @@ "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz", "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==", "dev": true, + "license": "MIT", "engines": { "node": ">= 8" } }, "node_modules/micromatch": { - "version": "4.0.5", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.5.tgz", - "integrity": "sha512-DMy+ERcEW2q8Z2Po+WNXuw3c5YaUSFjAO5GsJqfEl7UjvtIuFKO6ZrKvcItdy98dwFI2N1tg3zNIdKaQT+aNdA==", + "version": "4.0.8", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.8.tgz", + "integrity": "sha512-PXwfBhYu0hBCPw8Dn0E+WDYb7af3dSLVWKi3HGv84IdF4TyFoC0ysxFd0Goxw7nSv4T/PzEJQxsYsEiFCKo2BA==", "dev": true, + "license": "MIT", "dependencies": { - "braces": "^3.0.2", + "braces": "^3.0.3", "picomatch": "^2.3.1" }, "engines": { "node": ">=8.6" } }, - "node_modules/minimatch": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", - "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "node_modules/micromatch/node_modules/picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", "dev": true, - "dependencies": { - "brace-expansion": "^1.1.7" + "license": "MIT", + "engines": { + "node": ">=8.6" }, - "engines": { - "node": "*" - } - }, - "node_modules/minipass": { - "version": "7.0.4", - "resolved": "https://registry.npmjs.org/minipass/-/minipass-7.0.4.tgz", - "integrity": "sha512-jYofLM5Dam9279rdkWzqHozUo4ybjdZmCsDHePy5V/PbBcVMiSZR97gmAy45aqi8CK1lG2ECd356FU86avfwUQ==", - "dev": true, - "engines": { - "node": ">=16 || 14 >=14.17" + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" } }, "node_modules/ms": { - "version": "2.1.2", - "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", - "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", - "dev": true + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "dev": true, + "license": "MIT" }, "node_modules/nanoid": { - "version": "3.3.7", - "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.7.tgz", - "integrity": "sha512-eSRppjcPIatRIMC1U6UngP8XFcz8MQWGQdt1MTBQ7NaAmvXDfvNxbvWV3x2y6CdEUciCSsDHDQZbhYaB8QEo2g==", + "version": "3.3.11", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.11.tgz", + "integrity": "sha512-N8SpfPUnUp1bK+PMYW8qSWdl9U+wwNWI4QKxOYDy9JAro3WMX7p2OeVRF9v+347pnakNevPmiHhNmZ2HbFA76w==", "dev": true, "funding": [ { @@ -1621,6 +2680,7 @@ "url": "https://github.com/sponsors/ai" } ], + "license": "MIT", "bin": { "nanoid": "bin/nanoid.cjs" }, @@ -1632,38 +2692,32 @@ "version": "1.4.0", "resolved": "https://registry.npmjs.org/natural-compare/-/natural-compare-1.4.0.tgz", "integrity": "sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/normalize-path": { "version": "3.0.0", "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", "dev": true, + "license": "MIT", "engines": { "node": ">=0.10.0" } }, - "node_modules/once": { - "version": "1.4.0", - "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", - "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==", - "dev": true, - "dependencies": { - "wrappy": "1" - } - }, "node_modules/optionator": { - "version": "0.9.3", - "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.3.tgz", - "integrity": "sha512-JjCoypp+jKn1ttEFExxhetCKeJt9zhAgAve5FXHixTvFDW/5aEktX9bufBKLRRMdU7bNtpLfcGu94B3cdEJgjg==", + "version": "0.9.4", + "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.4.tgz", + "integrity": "sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==", "dev": true, + "license": "MIT", "dependencies": { - "@aashutoshrathi/word-wrap": "^1.2.3", "deep-is": "^0.1.3", "fast-levenshtein": "^2.0.6", "levn": "^0.4.1", "prelude-ls": "^1.2.1", - "type-check": "^0.4.0" + "type-check": "^0.4.0", + "word-wrap": "^1.2.5" }, "engines": { "node": ">= 0.8.0" @@ -1674,6 +2728,7 @@ "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-3.1.0.tgz", "integrity": "sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==", "dev": true, + "license": "MIT", "dependencies": { "yocto-queue": "^0.1.0" }, @@ -1689,6 +2744,7 @@ "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-5.0.0.tgz", "integrity": "sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==", "dev": true, + "license": "MIT", "dependencies": { "p-limit": "^3.0.2" }, @@ -1704,6 +2760,7 @@ "resolved": "https://registry.npmjs.org/parent-module/-/parent-module-1.0.1.tgz", "integrity": "sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==", "dev": true, + "license": "MIT", "dependencies": { "callsites": "^3.0.0" }, @@ -1716,6 +2773,7 @@ "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.2.0.tgz", "integrity": "sha512-ayCKvm/phCGxOkYRSCM82iDwct8/EonSEgCSxWxD7ve6jHggsFl4fZVQBPRNgQoKiuV/odhFrGzQXZwbifC8Rg==", "dev": true, + "license": "MIT", "dependencies": { "@babel/code-frame": "^7.0.0", "error-ex": "^1.3.1", @@ -1734,75 +2792,55 @@ "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } }, - "node_modules/path-is-absolute": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", - "integrity": "sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg==", - "dev": true, - "engines": { - "node": ">=0.10.0" - } - }, "node_modules/path-key": { "version": "3.1.1", "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz", "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } }, - "node_modules/path-scurry": { - "version": "1.10.1", - "resolved": "https://registry.npmjs.org/path-scurry/-/path-scurry-1.10.1.tgz", - "integrity": "sha512-MkhCqzzBEpPvxxQ71Md0b1Kk51W01lrYvlMzSUaIzNsODdd7mqhiimSZlr+VegAz5Z6Vzt9Xg2ttE//XBhH3EQ==", - "dev": true, - "dependencies": { - "lru-cache": "^9.1.1 || ^10.0.0", - "minipass": "^5.0.0 || ^6.0.2 || ^7.0.0" - }, - "engines": { - "node": ">=16 || 14 >=14.17" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, "node_modules/path-type": { "version": "4.0.0", "resolved": "https://registry.npmjs.org/path-type/-/path-type-4.0.0.tgz", "integrity": "sha512-gDKb8aZMDeD/tZWs9P6+q0J9Mwkdl6xMV8TjnGP3qJVJ06bdMgkbBlLU8IdfOsIsFz2BW1rNVT3XuNEl8zPAvw==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } }, "node_modules/picocolors": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.0.0.tgz", - "integrity": "sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==", - "dev": true + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.1.1.tgz", + "integrity": "sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==", + "dev": true, + "license": "ISC" }, "node_modules/picomatch": { - "version": "2.3.1", - "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", - "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-4.0.2.tgz", + "integrity": "sha512-M7BAV6Rlcy5u+m6oPhAPFgJTzAioX/6B0DxyvDlo9l8+T3nLKbrczg2WLUyzd45L8RqfUMyGPzekbMvX2Ldkwg==", "dev": true, + "license": "MIT", "engines": { - "node": ">=8.6" + "node": ">=12" }, "funding": { "url": "https://github.com/sponsors/jonschlinkert" } }, "node_modules/postcss": { - "version": "8.4.33", - "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.33.tgz", - "integrity": "sha512-Kkpbhhdjw2qQs2O2DGX+8m5OVqEcbB9HRBvuYM9pgrjEFUg30A9LmXNlTAUj4S9kgtGyrMbTzVjH7E+s5Re2yg==", + "version": "8.5.6", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.5.6.tgz", + "integrity": "sha512-3Ybi1tAuwAP9s0r1UQ2J4n5Y0G05bJkpUIO0/bI9MhwmD70S5aTWbXGBwxHrelT+XM1k6dM0pk+SwNkpTRN7Pg==", "dev": true, "funding": [ { @@ -1818,25 +2856,27 @@ "url": "https://github.com/sponsors/ai" } ], + "license": "MIT", "dependencies": { - "nanoid": "^3.3.7", - "picocolors": "^1.0.0", - "source-map-js": "^1.0.2" + "nanoid": "^3.3.11", + "picocolors": "^1.1.1", + "source-map-js": "^1.2.1" }, "engines": { "node": "^10 || ^12 || >=14" } }, "node_modules/postcss-resolve-nested-selector": { - "version": "0.1.1", - "resolved": "https://registry.npmjs.org/postcss-resolve-nested-selector/-/postcss-resolve-nested-selector-0.1.1.tgz", - "integrity": "sha512-HvExULSwLqHLgUy1rl3ANIqCsvMS0WHss2UOsXhXnQaZ9VCc2oBvIpXrl00IUFT5ZDITME0o6oiXeiHr2SAIfw==", - "dev": true + "version": "0.1.6", + "resolved": "https://registry.npmjs.org/postcss-resolve-nested-selector/-/postcss-resolve-nested-selector-0.1.6.tgz", + "integrity": "sha512-0sglIs9Wmkzbr8lQwEyIzlDOOC9bGmfVKcJTaxv3vMmd3uo4o4DerC3En0bnmgceeql9BfC8hRkp7cg0fjdVqw==", + "dev": true, + "license": "MIT" }, "node_modules/postcss-safe-parser": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/postcss-safe-parser/-/postcss-safe-parser-7.0.0.tgz", - "integrity": "sha512-ovehqRNVCpuFzbXoTb4qLtyzK3xn3t/CUBxOs8LsnQjQrShaB4lKiHoVqY8ANaC0hBMHq5QVWk77rwGklFUDrg==", + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/postcss-safe-parser/-/postcss-safe-parser-7.0.1.tgz", + "integrity": "sha512-0AioNCJZ2DPYz5ABT6bddIqlhgwhpHZ/l65YAYo0BCIn0xiDpsnTHz0gnoTGk0OXZW0JRs+cDwL8u/teRdz+8A==", "dev": true, "funding": [ { @@ -1852,6 +2892,7 @@ "url": "https://github.com/sponsors/ai" } ], + "license": "MIT", "engines": { "node": ">=18.0" }, @@ -1860,10 +2901,11 @@ } }, "node_modules/postcss-selector-parser": { - "version": "6.0.15", - "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.0.15.tgz", - "integrity": "sha512-rEYkQOMUCEMhsKbK66tbEU9QVIxbhN18YiniAwA7XQYTVBqrBy+P2p5JcdqsHgKM2zWylp8d7J6eszocfds5Sw==", + "version": "7.1.0", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-7.1.0.tgz", + "integrity": "sha512-8sLjZwK0R+JlxlYcTuVnyT2v+htpdrjDOKuMcOVdYjt52Lh8hWRYpxBPoKx/Zg+bcjc3wx6fmQevMmUztS/ccA==", "dev": true, + "license": "MIT", "dependencies": { "cssesc": "^3.0.0", "util-deprecate": "^1.0.2" @@ -1876,13 +2918,15 @@ "version": "4.2.0", "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz", "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/prelude-ls": { "version": "1.2.1", "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.2.1.tgz", "integrity": "sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==", "dev": true, + "license": "MIT", "engines": { "node": ">= 0.8.0" } @@ -1892,6 +2936,7 @@ "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.3.1.tgz", "integrity": "sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==", "dev": true, + "license": "MIT", "engines": { "node": ">=6" } @@ -1914,13 +2959,15 @@ "type": "consulting", "url": "https://feross.org/support" } - ] + ], + "license": "MIT" }, "node_modules/require-from-string": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/require-from-string/-/require-from-string-2.0.2.tgz", "integrity": "sha512-Xf0nWe6RseziFMu+Ap9biiUbmplq6S9/p+7w7YXP/JBHhrUDDUhwa+vANyubuqfZWTveU//DYVGsDG7RKL/vEw==", "dev": true, + "license": "MIT", "engines": { "node": ">=0.10.0" } @@ -1930,35 +2977,22 @@ "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-4.0.0.tgz", "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==", "dev": true, + "license": "MIT", "engines": { "node": ">=4" } }, "node_modules/reusify": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz", - "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==", + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.1.0.tgz", + "integrity": "sha512-g6QUff04oZpHs0eG5p83rFLhHeV00ug/Yf9nZM6fLeUrPguBTkTQOdpAWWspMh55TZfVQDPaN3NQJfbVRAxdIw==", "dev": true, + "license": "MIT", "engines": { "iojs": ">=1.0.0", "node": ">=0.10.0" } }, - "node_modules/rimraf": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", - "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", - "dev": true, - "dependencies": { - "glob": "^7.1.3" - }, - "bin": { - "rimraf": "bin.js" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, "node_modules/run-parallel": { "version": "1.2.0", "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz", @@ -1978,6 +3012,7 @@ "url": "https://feross.org/support" } ], + "license": "MIT", "dependencies": { "queue-microtask": "^1.2.2" } @@ -1987,6 +3022,7 @@ "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz", "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==", "dev": true, + "license": "MIT", "dependencies": { "shebang-regex": "^3.0.0" }, @@ -1999,6 +3035,7 @@ "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz", "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } @@ -2008,6 +3045,7 @@ "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-4.1.0.tgz", "integrity": "sha512-bzyZ1e88w9O1iNJbKnOlvYTrWPDl46O1bG0D3XInv+9tkPrxrN8jUUTiFlDkkmKWgn1M6CfIA13SuGqOa9Korw==", "dev": true, + "license": "ISC", "engines": { "node": ">=14" }, @@ -2020,6 +3058,7 @@ "resolved": "https://registry.npmjs.org/slash/-/slash-3.0.0.tgz", "integrity": "sha512-g9Q1haeby36OSStwb4ntCGGGaKsaVSjQ68fBxoQcutl5fS1vuY18H3wSt3jFyFtrkx+Kz0V1G85A4MyAdDMi2Q==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } @@ -2029,6 +3068,7 @@ "resolved": "https://registry.npmjs.org/slice-ansi/-/slice-ansi-4.0.0.tgz", "integrity": "sha512-qMCMfhY040cVHT43K9BFygqYbUPFZKHOg7K73mtTWJRb8pyP3fzf4Ixd5SzdEJQ6MRUg/WBnOLxghZtKKurENQ==", "dev": true, + "license": "MIT", "dependencies": { "ansi-styles": "^4.0.0", "astral-regex": "^2.0.0", @@ -2042,10 +3082,11 @@ } }, "node_modules/source-map-js": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.0.2.tgz", - "integrity": "sha512-R0XvVJ9WusLiqTCEiGCmICCMplcCkIwwR11mOSD9CR5u+IXYdiseeEuXCVAjS54zqwkLcPNnmU4OeJ6tUrWhDw==", + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.2.1.tgz", + "integrity": "sha512-UXWMKhLOwVKb728IUtQPXxfYU+usdybtUrK/8uGE8CQMvrhOpwvzDBwj0QhSL7MQc7vIsISBG8VQ8+IDQxpfQA==", "dev": true, + "license": "BSD-3-Clause", "engines": { "node": ">=0.10.0" } @@ -2055,21 +3096,7 @@ "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", "dev": true, - "dependencies": { - "emoji-regex": "^8.0.0", - "is-fullwidth-code-point": "^3.0.0", - "strip-ansi": "^6.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/string-width-cjs": { - "name": "string-width", - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", - "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", - "dev": true, + "license": "MIT", "dependencies": { "emoji-regex": "^8.0.0", "is-fullwidth-code-point": "^3.0.0", @@ -2084,19 +3111,7 @@ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", "dev": true, - "dependencies": { - "ansi-regex": "^5.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/strip-ansi-cjs": { - "name": "strip-ansi", - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", - "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", - "dev": true, + "license": "MIT", "dependencies": { "ansi-regex": "^5.0.1" }, @@ -2109,6 +3124,7 @@ "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.1.1.tgz", "integrity": "sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" }, @@ -2117,48 +3133,59 @@ } }, "node_modules/stylelint": { - "version": "16.2.1", - "resolved": "https://registry.npmjs.org/stylelint/-/stylelint-16.2.1.tgz", - "integrity": "sha512-SfIMGFK+4n7XVAyv50CpVfcGYWG4v41y6xG7PqOgQSY8M/PgdK0SQbjWFblxjJZlN9jNq879mB4BCZHJRIJ1hA==", + "version": "16.21.0", + "resolved": "https://registry.npmjs.org/stylelint/-/stylelint-16.21.0.tgz", + "integrity": "sha512-ki3PpJGG7xhm3WtINoWGnlvqAmbqSexoRMbEMJzlwewSIOqPRKPlq452c22xAdEJISVi80r+I7KL9GPUiwFgbg==", "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/stylelint" + }, + { + "type": "github", + "url": "https://github.com/sponsors/stylelint" + } + ], + "license": "MIT", "dependencies": { - "@csstools/css-parser-algorithms": "^2.5.0", - "@csstools/css-tokenizer": "^2.2.3", - "@csstools/media-query-list-parser": "^2.1.7", - "@csstools/selector-specificity": "^3.0.1", + "@csstools/css-parser-algorithms": "^3.0.5", + "@csstools/css-tokenizer": "^3.0.4", + "@csstools/media-query-list-parser": "^4.0.3", + "@csstools/selector-specificity": "^5.0.0", + "@dual-bundle/import-meta-resolve": "^4.1.0", "balanced-match": "^2.0.0", "colord": "^2.9.3", "cosmiconfig": "^9.0.0", - "css-functions-list": "^3.2.1", - "css-tree": "^2.3.1", - "debug": "^4.3.4", - "fast-glob": "^3.3.2", + "css-functions-list": "^3.2.3", + "css-tree": "^3.1.0", + "debug": "^4.4.1", + "fast-glob": "^3.3.3", "fastest-levenshtein": "^1.0.16", - "file-entry-cache": "^8.0.0", + "file-entry-cache": "^10.1.1", "global-modules": "^2.0.0", "globby": "^11.1.0", "globjoin": "^0.1.4", "html-tags": "^3.3.1", - "ignore": "^5.3.0", + "ignore": "^7.0.5", "imurmurhash": "^0.1.4", "is-plain-object": "^5.0.0", - "known-css-properties": "^0.29.0", + "known-css-properties": "^0.37.0", "mathml-tag-names": "^2.1.3", - "meow": "^13.1.0", - "micromatch": "^4.0.5", + "meow": "^13.2.0", + "micromatch": "^4.0.8", "normalize-path": "^3.0.0", - "picocolors": "^1.0.0", - "postcss": "^8.4.33", - "postcss-resolve-nested-selector": "^0.1.1", - "postcss-safe-parser": "^7.0.0", - "postcss-selector-parser": "^6.0.15", + "picocolors": "^1.1.1", + "postcss": "^8.5.5", + "postcss-resolve-nested-selector": "^0.1.6", + "postcss-safe-parser": "^7.0.1", + "postcss-selector-parser": "^7.1.0", "postcss-value-parser": "^4.2.0", "resolve-from": "^5.0.0", "string-width": "^4.2.3", - "strip-ansi": "^7.1.0", - "supports-hyperlinks": "^3.0.0", + "supports-hyperlinks": "^3.2.0", "svg-tags": "^1.0.0", - "table": "^6.8.1", + "table": "^6.9.0", "write-file-atomic": "^5.0.1" }, "bin": { @@ -2166,133 +3193,94 @@ }, "engines": { "node": ">=18.12.0" - }, - "funding": { - "type": "opencollective", - "url": "https://opencollective.com/stylelint" } }, "node_modules/stylelint-config-recommended": { - "version": "14.0.0", - "resolved": "https://registry.npmjs.org/stylelint-config-recommended/-/stylelint-config-recommended-14.0.0.tgz", - "integrity": "sha512-jSkx290CglS8StmrLp2TxAppIajzIBZKYm3IxT89Kg6fGlxbPiTiyH9PS5YUuVAFwaJLl1ikiXX0QWjI0jmgZQ==", + "version": "16.0.0", + "resolved": "https://registry.npmjs.org/stylelint-config-recommended/-/stylelint-config-recommended-16.0.0.tgz", + "integrity": "sha512-4RSmPjQegF34wNcK1e1O3Uz91HN8P1aFdFzio90wNK9mjgAI19u5vsU868cVZboKzCaa5XbpvtTzAAGQAxpcXA==", "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/stylelint" + }, + { + "type": "github", + "url": "https://github.com/sponsors/stylelint" + } + ], + "license": "MIT", "engines": { "node": ">=18.12.0" }, "peerDependencies": { - "stylelint": "^16.0.0" + "stylelint": "^16.16.0" } }, "node_modules/stylelint-config-standard": { - "version": "36.0.0", - "resolved": "https://registry.npmjs.org/stylelint-config-standard/-/stylelint-config-standard-36.0.0.tgz", - "integrity": "sha512-3Kjyq4d62bYFp/Aq8PMKDwlgUyPU4nacXsjDLWJdNPRUgpuxALu1KnlAHIj36cdtxViVhXexZij65yM0uNIHug==", + "version": "38.0.0", + "resolved": "https://registry.npmjs.org/stylelint-config-standard/-/stylelint-config-standard-38.0.0.tgz", + "integrity": "sha512-uj3JIX+dpFseqd/DJx8Gy3PcRAJhlEZ2IrlFOc4LUxBX/PNMEQ198x7LCOE2Q5oT9Vw8nyc4CIL78xSqPr6iag==", "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/stylelint" + }, + { + "type": "github", + "url": "https://github.com/sponsors/stylelint" + } + ], + "license": "MIT", "dependencies": { - "stylelint-config-recommended": "^14.0.0" + "stylelint-config-recommended": "^16.0.0" }, "engines": { "node": ">=18.12.0" }, "peerDependencies": { - "stylelint": "^16.1.0" - } - }, - "node_modules/stylelint/node_modules/ansi-regex": { - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz", - "integrity": "sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==", - "dev": true, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/ansi-regex?sponsor=1" + "stylelint": "^16.18.0" } }, "node_modules/stylelint/node_modules/balanced-match": { "version": "2.0.0", "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-2.0.0.tgz", "integrity": "sha512-1ugUSr8BHXRnK23KfuYS+gVMC3LB8QGH9W1iGtDPsNWoQbgtXSExkBu2aDR4epiGWZOjZsj6lDl/N/AqqTC3UA==", - "dev": true - }, - "node_modules/stylelint/node_modules/brace-expansion": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-2.0.1.tgz", - "integrity": "sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==", "dev": true, - "dependencies": { - "balanced-match": "^1.0.0" - } - }, - "node_modules/stylelint/node_modules/brace-expansion/node_modules/balanced-match": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", - "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", - "dev": true + "license": "MIT" }, "node_modules/stylelint/node_modules/file-entry-cache": { - "version": "8.0.0", - "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-8.0.0.tgz", - "integrity": "sha512-XXTUwCvisa5oacNGRP9SfNtYBNAMi+RPwBFmblZEF7N7swHYQS6/Zfk7SRwx4D5j3CH211YNRco1DEMNVfZCnQ==", + "version": "10.1.1", + "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-10.1.1.tgz", + "integrity": "sha512-zcmsHjg2B2zjuBgjdnB+9q0+cWcgWfykIcsDkWDB4GTPtl1eXUA+gTI6sO0u01AqK3cliHryTU55/b2Ow1hfZg==", "dev": true, + "license": "MIT", "dependencies": { - "flat-cache": "^4.0.0" - }, - "engines": { - "node": ">=16.0.0" + "flat-cache": "^6.1.10" } }, "node_modules/stylelint/node_modules/flat-cache": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-4.0.0.tgz", - "integrity": "sha512-EryKbCE/wxpxKniQlyas6PY1I9vwtF3uCBweX+N8KYTCn3Y12RTGtQAJ/bd5pl7kxUAc8v/R3Ake/N17OZiFqA==", + "version": "6.1.11", + "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-6.1.11.tgz", + "integrity": "sha512-zfOAns94mp7bHG/vCn9Ru2eDCmIxVQ5dELUHKjHfDEOJmHNzE+uGa6208kfkgmtym4a0FFjEuFksCXFacbVhSg==", "dev": true, + "license": "MIT", "dependencies": { - "flatted": "^3.2.9", - "keyv": "^4.5.4", - "rimraf": "^5.0.5" - }, - "engines": { - "node": ">=16" + "cacheable": "^1.10.1", + "flatted": "^3.3.3", + "hookified": "^1.10.0" } }, - "node_modules/stylelint/node_modules/glob": { - "version": "10.3.10", - "resolved": "https://registry.npmjs.org/glob/-/glob-10.3.10.tgz", - "integrity": "sha512-fa46+tv1Ak0UPK1TOy/pZrIybNNt4HCv7SDzwyfiOZkvZLEbjsZkJBPtDHVshZjbecAoAGSC20MjLDG/qr679g==", + "node_modules/stylelint/node_modules/ignore": { + "version": "7.0.5", + "resolved": "https://registry.npmjs.org/ignore/-/ignore-7.0.5.tgz", + "integrity": "sha512-Hs59xBNfUIunMFgWAbGX5cq6893IbWg4KnrjbYwX3tx0ztorVgTDA6B2sxf8ejHJ4wz8BqGUMYlnzNBer5NvGg==", "dev": true, - "dependencies": { - "foreground-child": "^3.1.0", - "jackspeak": "^2.3.5", - "minimatch": "^9.0.1", - "minipass": "^5.0.0 || ^6.0.2 || ^7.0.0", - "path-scurry": "^1.10.1" - }, - "bin": { - "glob": "dist/esm/bin.mjs" - }, + "license": "MIT", "engines": { - "node": ">=16 || 14 >=14.17" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, - "node_modules/stylelint/node_modules/minimatch": { - "version": "9.0.3", - "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-9.0.3.tgz", - "integrity": "sha512-RHiac9mvaRw0x3AYRgDC1CxAP7HTcNrrECeA8YYJeWnpo+2Q5CegtZjaotWTWxDG3UeGA1coE05iH1mPjT/2mg==", - "dev": true, - "dependencies": { - "brace-expansion": "^2.0.1" - }, - "engines": { - "node": ">=16 || 14 >=14.17" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" + "node": ">= 4" } }, "node_modules/stylelint/node_modules/resolve-from": { @@ -2300,48 +3288,17 @@ "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-5.0.0.tgz", "integrity": "sha512-qYg9KP24dD5qka9J47d0aVky0N+b4fTU89LN9iDnjB5waksiC49rvMB0PrUJQGoTmH50XPiqOvAjDfaijGxYZw==", "dev": true, + "license": "MIT", "engines": { "node": ">=8" } }, - "node_modules/stylelint/node_modules/rimraf": { - "version": "5.0.5", - "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-5.0.5.tgz", - "integrity": "sha512-CqDakW+hMe/Bz202FPEymy68P+G50RfMQK+Qo5YUqc9SPipvbGjCGKd0RSKEelbsfQuw3g5NZDSrlZZAJurH1A==", - "dev": true, - "dependencies": { - "glob": "^10.3.7" - }, - "bin": { - "rimraf": "dist/esm/bin.mjs" - }, - "engines": { - "node": ">=14" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, - "node_modules/stylelint/node_modules/strip-ansi": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-7.1.0.tgz", - "integrity": "sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==", - "dev": true, - "dependencies": { - "ansi-regex": "^6.0.1" - }, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/strip-ansi?sponsor=1" - } - }, "node_modules/supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", "dev": true, + "license": "MIT", "dependencies": { "has-flag": "^4.0.0" }, @@ -2350,16 +3307,20 @@ } }, "node_modules/supports-hyperlinks": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/supports-hyperlinks/-/supports-hyperlinks-3.0.0.tgz", - "integrity": "sha512-QBDPHyPQDRTy9ku4URNGY5Lah8PAaXs6tAAwp55sL5WCsSW7GIfdf6W5ixfziW+t7wh3GVvHyHHyQ1ESsoRvaA==", + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/supports-hyperlinks/-/supports-hyperlinks-3.2.0.tgz", + "integrity": "sha512-zFObLMyZeEwzAoKCyu1B91U79K2t7ApXuQfo8OuxwXLDgcKxuwM+YvcbIhm6QWqz7mHUH1TVytR1PwVVjEuMig==", "dev": true, + "license": "MIT", "dependencies": { "has-flag": "^4.0.0", "supports-color": "^7.0.0" }, "engines": { "node": ">=14.18" + }, + "funding": { + "url": "https://github.com/chalk/supports-hyperlinks?sponsor=1" } }, "node_modules/svg-tags": { @@ -2369,10 +3330,11 @@ "dev": true }, "node_modules/table": { - "version": "6.8.1", - "resolved": "https://registry.npmjs.org/table/-/table-6.8.1.tgz", - "integrity": "sha512-Y4X9zqrCftUhMeH2EptSSERdVKt/nEdijTOacGD/97EKjhQ/Qs8RTlEGABSJNNN8lac9kheH+af7yAkEWlgneA==", + "version": "6.9.0", + "resolved": "https://registry.npmjs.org/table/-/table-6.9.0.tgz", + "integrity": "sha512-9kY+CygyYM6j02t5YFHbNz2FN5QmYGv9zAjVp4lCDjlCw7amdckXlEt/bjMhUIfj4ThGRE4gCUH5+yGnNuPo5A==", "dev": true, + "license": "BSD-3-Clause", "dependencies": { "ajv": "^8.0.1", "lodash.truncate": "^4.4.2", @@ -2385,15 +3347,16 @@ } }, "node_modules/table/node_modules/ajv": { - "version": "8.12.0", - "resolved": "https://registry.npmjs.org/ajv/-/ajv-8.12.0.tgz", - "integrity": "sha512-sRu1kpcO9yLtYxBKvqfTeh9KzZEwO3STyX1HT+4CaDzC6HpTGYhIhPIzj9XuKU7KYDwnaeh5hcOwjy1QuJzBPA==", + "version": "8.17.1", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-8.17.1.tgz", + "integrity": "sha512-B/gBuNg5SiMTrPkC+A2+cW0RszwxYmn6VYxB/inlBStS5nx6xHIt/ehKRhIMhqusl7a8LjQoZnjCs5vhwxOQ1g==", "dev": true, + "license": "MIT", "dependencies": { - "fast-deep-equal": "^3.1.1", + "fast-deep-equal": "^3.1.3", + "fast-uri": "^3.0.1", "json-schema-traverse": "^1.0.0", - "require-from-string": "^2.0.2", - "uri-js": "^4.2.2" + "require-from-string": "^2.0.2" }, "funding": { "type": "github", @@ -2404,19 +3367,15 @@ "version": "1.0.0", "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-1.0.0.tgz", "integrity": "sha512-NM8/P9n3XjXhIZn1lLhkFaACTOURQXjWhV4BA/RnOv8xvgqtqpAX9IO4mRQxSx1Rlo4tqzeqb0sOlruaOy3dug==", - "dev": true - }, - "node_modules/text-table": { - "version": "0.2.0", - "resolved": "https://registry.npmjs.org/text-table/-/text-table-0.2.0.tgz", - "integrity": "sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/to-regex-range": { "version": "5.0.1", "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", "dev": true, + "license": "MIT", "dependencies": { "is-number": "^7.0.0" }, @@ -2429,6 +3388,7 @@ "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.4.0.tgz", "integrity": "sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==", "dev": true, + "license": "MIT", "dependencies": { "prelude-ls": "^1.2.1" }, @@ -2436,16 +3396,20 @@ "node": ">= 0.8.0" } }, - "node_modules/type-fest": { - "version": "0.20.2", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.20.2.tgz", - "integrity": "sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==", + "node_modules/typescript": { + "version": "5.8.3", + "resolved": "https://registry.npmjs.org/typescript/-/typescript-5.8.3.tgz", + "integrity": "sha512-p1diW6TqL9L07nNxvRMM7hMMw4c5XOo/1ibL4aAIGmSAt9slTE1Xgw5KWuof2uTOvCg9BY7ZRi+GaF+7sfgPeQ==", "dev": true, - "engines": { - "node": ">=10" + "license": "Apache-2.0", + "optional": true, + "peer": true, + "bin": { + "tsc": "bin/tsc", + "tsserver": "bin/tsserver" }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" + "engines": { + "node": ">=14.17" } }, "node_modules/uri-js": { @@ -2453,6 +3417,7 @@ "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.1.tgz", "integrity": "sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==", "dev": true, + "license": "BSD-2-Clause", "dependencies": { "punycode": "^2.1.0" } @@ -2461,13 +3426,15 @@ "version": "1.0.2", "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==", - "dev": true + "dev": true, + "license": "MIT" }, "node_modules/which": { "version": "2.0.2", "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", "dev": true, + "license": "ISC", "dependencies": { "isexe": "^2.0.0" }, @@ -2478,114 +3445,22 @@ "node": ">= 8" } }, - "node_modules/wrap-ansi": { - "version": "8.1.0", - "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-8.1.0.tgz", - "integrity": "sha512-si7QWI6zUMq56bESFvagtmzMdGOtoxfR+Sez11Mobfc7tm+VkUckk9bW2UeffTGVUbOksxmSw0AA2gs8g71NCQ==", + "node_modules/word-wrap": { + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/word-wrap/-/word-wrap-1.2.5.tgz", + "integrity": "sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==", "dev": true, - "dependencies": { - "ansi-styles": "^6.1.0", - "string-width": "^5.0.1", - "strip-ansi": "^7.0.1" - }, + "license": "MIT", "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/wrap-ansi?sponsor=1" + "node": ">=0.10.0" } }, - "node_modules/wrap-ansi-cjs": { - "name": "wrap-ansi", - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-7.0.0.tgz", - "integrity": "sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==", - "dev": true, - "dependencies": { - "ansi-styles": "^4.0.0", - "string-width": "^4.1.0", - "strip-ansi": "^6.0.0" - }, - "engines": { - "node": ">=10" - }, - "funding": { - "url": "https://github.com/chalk/wrap-ansi?sponsor=1" - } - }, - "node_modules/wrap-ansi/node_modules/ansi-regex": { - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz", - "integrity": "sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==", - "dev": true, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/ansi-regex?sponsor=1" - } - }, - "node_modules/wrap-ansi/node_modules/ansi-styles": { - "version": "6.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-6.2.1.tgz", - "integrity": "sha512-bN798gFfQX+viw3R7yrGWRqnrN2oRkEkUjjl4JNn4E8GxxbjtG3FbrEIIY3l8/hrwUwIeCZvi4QuOTP4MErVug==", - "dev": true, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/ansi-styles?sponsor=1" - } - }, - "node_modules/wrap-ansi/node_modules/emoji-regex": { - "version": "9.2.2", - "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-9.2.2.tgz", - "integrity": "sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==", - "dev": true - }, - "node_modules/wrap-ansi/node_modules/string-width": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-5.1.2.tgz", - "integrity": "sha512-HnLOCR3vjcY8beoNLtcjZ5/nxn2afmME6lhrDrebokqMap+XbeW8n9TXpPDOqdGK5qcI3oT0GKTW6wC7EMiVqA==", - "dev": true, - "dependencies": { - "eastasianwidth": "^0.2.0", - "emoji-regex": "^9.2.2", - "strip-ansi": "^7.0.1" - }, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/wrap-ansi/node_modules/strip-ansi": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-7.1.0.tgz", - "integrity": "sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==", - "dev": true, - "dependencies": { - "ansi-regex": "^6.0.1" - }, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/strip-ansi?sponsor=1" - } - }, - "node_modules/wrappy": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", - "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==", - "dev": true - }, "node_modules/write-file-atomic": { "version": "5.0.1", "resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-5.0.1.tgz", "integrity": "sha512-+QU2zd6OTD8XWIJCbffaiQeH9U73qIqafo1x6V1snCWYGJf6cVE0cDR4D8xRzcEnfI21IFrUPzPGtcPf8AC+Rw==", "dev": true, + "license": "ISC", "dependencies": { "imurmurhash": "^0.1.4", "signal-exit": "^4.0.1" @@ -2599,6 +3474,7 @@ "resolved": "https://registry.npmjs.org/yocto-queue/-/yocto-queue-0.1.0.tgz", "integrity": "sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==", "dev": true, + "license": "MIT", "engines": { "node": ">=10" }, diff --git a/package.json b/package.json index 35c8527b..d0179b11 100644 --- a/package.json +++ b/package.json @@ -2,22 +2,28 @@ "private": true, "name": "jbuk-frontend", "version": "0.0.1", + "type": "module", "repository": "https://github.com/jonnybarnes/jonnybarnes.uk", "license": "CC0-1.0", "devDependencies": { - "eslint": "^8.57.0", - "stylelint": "^16.2.1", - "stylelint-config-standard": "^36.0.0" + "@eslint/js": "^9.6.0", + "@stylistic/eslint-plugin": "^5.1.0", + "esbuild": "^0.25.2", + "eslint": "^9.7.0", + "globals": "^16.0.0", + "lightningcss": "^1.29.3", + "lightningcss-cli": "^1.29.3", + "stylelint": "^16.7.0", + "stylelint-config-standard": "^38.0.0" }, "scripts": { "eslint": "eslint public/assets/js/*.js", - "stylelint": "stylelint public/assets/css/*.css", + "stylelint": "stylelint resources/css/*.css", "lint": "npm run eslint && npm run stylelint", + "lightningcss": "lightningcss --output-dir public/assets/css --sourcemap --bundle --minify resources/css/app.css", + "fix-sourcemap": "./scripts/fix-sourcemap.sh", + "build-css": "npm run lightningcss && npm run fix-sourcemap", "compress": "./scripts/compress.sh", "build": "npm run lint && npm run compress" - }, - "dependencies": { - "@11ty/is-land": "^4.0.0", - "@zachleat/snow-fall": "^1.0.2" } } diff --git a/phpunit.xml b/phpunit.xml index 1d924c4b..5dd3edaa 100644 --- a/phpunit.xml +++ b/phpunit.xml @@ -24,7 +24,7 @@ - + diff --git a/postcss.config.js b/postcss.config.js deleted file mode 100644 index f0ba5a6f..00000000 --- a/postcss.config.js +++ /dev/null @@ -1,16 +0,0 @@ -module.exports = { - plugins: { - 'postcss-import': {}, - 'autoprefixer': {}, - '@csstools/postcss-oklab-function': { - preserve: true - }, - 'postcss-nesting': {}, - 'postcss-combine-media-query': {}, - 'postcss-combine-duplicated-selectors': { - removeDuplicatedProperties: true, - removeDuplicatedValues: true - }, - 'cssnano': { preset: 'default' }, - } -}; diff --git a/psalm.xml b/psalm.xml deleted file mode 100644 index da693b64..00000000 --- a/psalm.xml +++ /dev/null @@ -1,18 +0,0 @@ - - - - - - - - - - - diff --git a/public/assets/css/app.css b/public/assets/css/app.css index 9e91b28a..07bfbf3d 100644 --- a/public/assets/css/app.css +++ b/public/assets/css/app.css @@ -1,7 +1,2 @@ -@import url('variables.css'); -@import url('fonts.css'); -@import url('layout.css'); -@import url('colours.css'); -@import url('code.css'); -@import url('content.css'); -@import url('notes.css'); +:root{--font-family-headings:"Rockwell","Rockwell Nova","Roboto Slab","DejaVu Serif","Sitka Small",serif;--font-family-body:"Charter","Bitstream Charter","Sitka Text","Cambria",serif;--font-family-monospace:ui-monospace,"Cascadia Code","Source Code Pro","Menlo","Consolas","DejaVu Sans Mono",monospace;--font-size-sm:.75rem;--font-size-base:1rem;--font-size-md:1.25rem;--font-size-lg:1.5rem;--font-size-xl:1.75rem;--font-size-xxl:2rem;--font-size-xxxl:2.25rem;--color-primary:oklch(36.8% .1 125.505);--color-secondary:oklch(96.3% .1 125.505);--color-link:oklch(48.09% .146 241.41);--color-link-visited:oklch(70.44% .21 304.41);--color-primary-shadow:oklch(19.56% .054 125.505/.4);--rss-color-link:oklch(67.59% .189 42.04);--color-danger:oklch(64.41% .281 23.29);--color-danger-shadow:oklch(64.41% .281 23.29/.1)}body{font-family:var(--font-family-body);font-size:var(--font-size-md)}code{font-family:var(--font-family-monospace)}h1,h2,h3,h4,h5,h6{font-family:var(--font-family-headings)}.grid{grid-template-rows:min-content 1fr min-content;grid-template-columns:5vw 1fr 5vw;row-gap:1rem;display:grid}#site-header{grid-area:1/2/2/3;& .rss-icon{& svg{width:auto;height:1rem}}}main{grid-area:2/2/3/3}.h-feed{flex-direction:column;gap:2rem;display:flex}.h-entry{& p:first-of-type,& h1:first-of-type{margin-block-start:0}}.pagination{margin-block-start:1rem}footer{grid-area:3/2/4/3;& .iwc-logo{max-width:85vw}& .footer-actions{flex-direction:row;gap:1rem;display:flex}}body{background-color:var(--color-secondary);color:var(--color-primary)}a{color:var(--color-link);&:visited{color:var(--color-link-visited)}&.auth:visited{color:var(--color-link)}}#site-header{& a:visited{color:var(--color-link)}& .rss-icon{& svg{color:var(--rss-color-link)}}}.hljs{border-radius:.5rem}.h-card{& .hovercard{z-index:100;box-shadow:0 .5rem .5rem .5rem var(--color-primary-shadow);background-color:var(--color-secondary);opacity:0;border-radius:1rem;flex-direction:column;gap:.5rem;width:fit-content;padding:1rem;transition:opacity .5s ease-in-out;display:none;position:absolute;& .u-photo{max-width:6rem}& .social-icon{width:1rem;height:1rem}}&:hover{& .hovercard{opacity:1;display:flex}}}.h-entry{border-inline-start:1px solid var(--color-primary);padding-inline-start:.5rem;& .reply-to{font-style:italic}& .post-info{& a{text-decoration:none}}& .note-metadata{flex-direction:row;gap:1rem;display:flex;& .replies,& .likes,& .reposts{flex-direction:row;align-items:center;gap:.5rem;display:inline-flex}& .syndication-links{flex-flow:wrap;& a{text-decoration:none;& svg{width:1rem;height:1rem}}}}}.feather{stroke:currentColor;stroke-width:2px;stroke-linecap:round;stroke-linejoin:round;fill:none;width:24px;height:24px}.sr-only{clip:rect(0 0 0 0);clip-path:inset(50%);white-space:nowrap;width:1px;height:1px;position:absolute;overflow:hidden}main{&>.u-comment{border-inline-start:1px solid var(--color-primary);margin-block-start:2rem;margin-inline-start:2rem;padding-inline-start:.5rem;& .mini-h-card{flex-direction:row;align-items:baseline;display:inline-flex;& .u-photo{border-radius:50%;width:2rem;height:2rem;margin-block-end:.5rem}}}& .notes-subtitle{font-size:1.2rem;font-weight:600}& .webmentions-author-list{flex-flow:wrap;gap:1rem;display:flex;& img{border-radius:50%;width:4rem;height:4rem}}}.indieauth{& .error{color:var(--color-danger);background-color:var(--color-danger-shadow);border:1px solid var(--color-danger);border-radius:.5rem;width:fit-content;margin-block-end:1rem;padding-block:.5rem;padding-inline:1rem;display:flex}} +/*# sourceMappingURL=/assets/css/app.css.map */ diff --git a/public/assets/css/app.css.br b/public/assets/css/app.css.br index e58c83d2..405c55ea 100644 Binary files a/public/assets/css/app.css.br and b/public/assets/css/app.css.br differ diff --git a/public/assets/css/app.css.map b/public/assets/css/app.css.map new file mode 100644 index 00000000..877478ee --- /dev/null +++ b/public/assets/css/app.css.map @@ -0,0 +1 @@ +{"version":3,"mappings":"AGAA,4yBEAA,uEAKA,8CAIA,0DJTA,iHAOA,+BAIE,YACE,+BAOJ,uBAKA,oDAMA,SACE,2DAMF,oCAIA,yBAIE,2BAIA,4DKjDF,wEAKA,0BAGE,0CAIA,wCAKF,aACE,oCAIA,YACE,oCEvBJ,0BCAA,QACE,0RAcE,0BAIA,uCAMF,QACE,sCFxBJ,uFAIE,8BAIA,aACE,0BAKF,0DAKE,mGASA,oCAGE,yBAGE,iCASR,0HAUA,2HHvDA,KACE,4IAME,2EAKE,6EASJ,mDAKA,gEAKE,iDF/BJ,WACE","sources":["resources/css/app.css","resources/css/layout.css","resources/css/indieauth.css","resources/css/variables.css","resources/css/notes.css","resources/css/colours.css","resources/css/content.css","resources/css/code.css","resources/css/fonts.css","resources/css/h-card.css"],"sourcesContent":["@import url('variables.css');\n@import url('fonts.css');\n@import url('layout.css');\n@import url('colours.css');\n@import url('code.css');\n@import url('content.css');\n@import url('notes.css');\n@import url('indieauth.css');\n",".grid {\n display: grid;\n grid-template-columns: 5vw 1fr 5vw;\n grid-template-rows: min-content 1fr min-content;\n row-gap: 1rem;\n}\n\n#site-header {\n grid-column: 2 / 3;\n grid-row: 1 / 2;\n\n & .rss-icon {\n & svg {\n width: auto;\n height: 1rem;\n }\n }\n}\n\nmain {\n grid-column: 2 / 3;\n grid-row: 2 / 3;\n}\n\n.h-feed {\n display: flex;\n flex-direction: column;\n gap: 2rem;\n}\n\n.h-entry {\n & p:first-of-type,\n & h1:first-of-type {\n margin-block-start: 0;\n }\n}\n\n.pagination {\n margin-block-start: 1rem;\n}\n\nfooter {\n grid-column: 2 / 3;\n grid-row: 3 / 4;\n\n & .iwc-logo {\n max-width: 85vw;\n }\n\n & .footer-actions {\n display: flex;\n flex-direction: row;\n gap: 1rem;\n }\n}\n",".indieauth {\n .error {\n color: var(--color-danger);\n background-color: var(--color-danger-shadow);\n border: 1px solid var(--color-danger);\n border-radius: .5rem;\n display: flex;\n padding-inline: 1rem;\n padding-block: .5rem;\n width: fit-content;\n margin-block-end: 1rem;\n }\n}\n",":root {\n /* Font Family */\n --font-family-headings: 'Rockwell', 'Rockwell Nova', 'Roboto Slab', 'DejaVu Serif', 'Sitka Small', serif;\n --font-family-body: 'Charter', 'Bitstream Charter', 'Sitka Text', 'Cambria', serif;\n --font-family-monospace: ui-monospace, 'Cascadia Code', 'Source Code Pro', 'Menlo', 'Consolas', 'DejaVu Sans Mono', monospace;\n\n /* Font Size */\n --font-size-sm: 0.75rem; /* 12px */\n --font-size-base: 1rem; /* 16px, base */\n --font-size-md: 1.25rem; /* 20px */\n --font-size-lg: 1.5rem; /* 24px */\n --font-size-xl: 1.75rem; /* 28px */\n --font-size-xxl: 2rem; /* 32px */\n --font-size-xxxl: 2.25rem; /* 36px */\n\n /* Colours */\n --color-primary: oklch(36.8% 0.1 125.505deg);\n --color-secondary: oklch(96.3% 0.1 125.505deg);\n --color-link: oklch(48.09% 0.146 241.41deg);\n --color-link-visited: oklch(70.44% 0.21 304.41deg);\n --color-primary-shadow: oklch(19.56% 0.054 125.505deg / 40%);\n --rss-color-link: oklch(67.59% 0.189 42.04deg);\n --color-danger: oklch(64.41% 0.281 23.29deg);\n --color-danger-shadow: oklch(64.41% 0.281 23.29deg / 10%);\n}\n","main {\n & > .u-comment {\n margin-block-start: 2rem;\n margin-inline-start: 2rem;\n border-inline-start: 1px solid var(--color-primary);\n padding-inline-start: .5rem;\n\n & .mini-h-card {\n display: inline-flex;\n flex-direction: row;\n align-items: baseline;\n\n & .u-photo {\n width: 2rem;\n height: 2rem;\n border-radius: 50%;\n margin-block-end: 0.5rem;\n }\n }\n }\n\n & .notes-subtitle {\n font-size: 1.2rem;\n font-weight: 600;\n }\n\n & .webmentions-author-list {\n display: flex;\n flex-flow: row wrap;\n gap: 1rem;\n\n & img {\n width: 4rem;\n height: 4rem;\n border-radius: 50%;\n }\n }\n}\n","body {\n background-color: var(--color-secondary);\n color: var(--color-primary);\n}\n\na {\n color: var(--color-link);\n\n &:visited {\n color: var(--color-link-visited);\n }\n\n &.auth:visited {\n color: var(--color-link);\n }\n}\n\n#site-header {\n & a:visited {\n color: var(--color-link);\n }\n\n & .rss-icon {\n & svg {\n color: var(--rss-color-link);\n }\n }\n}\n","@import url('h-card.css');\n\n.h-entry {\n border-inline-start: 1px solid var(--color-primary);\n padding-inline-start: .5rem;\n\n & .reply-to {\n font-style: italic;\n }\n\n & .post-info {\n & a {\n text-decoration: none;\n }\n }\n\n & .note-metadata {\n display: flex;\n flex-direction: row;\n gap: 1rem;\n\n & .replies,\n & .likes,\n & .reposts {\n display: inline-flex;\n flex-direction: row;\n gap: .5rem;\n align-items: center;\n }\n\n & .syndication-links {\n flex-flow: row wrap;\n\n & a {\n text-decoration: none;\n\n & svg {\n width: 1rem;\n height: 1rem;\n }\n }\n }\n }\n}\n\n.feather {\n width: 24px;\n height: 24px;\n stroke: currentcolor;\n stroke-width: 2;\n stroke-linecap: round;\n stroke-linejoin: round;\n fill: none;\n}\n\n.sr-only {\n clip: rect(0 0 0 0);\n clip-path: inset(50%);\n height: 1px;\n overflow: hidden;\n position: absolute;\n white-space: nowrap;\n width: 1px;\n}\n",".hljs {\n border-radius: .5rem;\n}\n","body {\n font-family: var(--font-family-body);\n font-size: var(--font-size-md);\n}\n\ncode {\n font-family: var(--font-family-monospace);\n}\n\nh1,\nh2,\nh3,\nh4,\nh5,\nh6 {\n font-family: var(--font-family-headings);\n}\n",".h-card {\n & .hovercard {\n display: none;\n position: absolute;\n z-index: 100;\n padding: 1rem;\n border-radius: 1rem;\n box-shadow: 0 .5rem .5rem .5rem var(--color-primary-shadow);\n background-color: var(--color-secondary);\n width: fit-content;\n transition: opacity 0.5s ease-in-out;\n opacity: 0;\n flex-direction: column;\n gap: .5rem;\n\n & .u-photo {\n max-width: 6rem;\n }\n\n & .social-icon {\n width: 1rem;\n height: 1rem;\n }\n }\n\n &:hover {\n & .hovercard {\n display: flex;\n opacity: 1;\n }\n }\n}\n"],"names":[]} \ No newline at end of file diff --git a/public/assets/css/app.css.zst b/public/assets/css/app.css.zst new file mode 100644 index 00000000..460b37b6 Binary files /dev/null and b/public/assets/css/app.css.zst differ diff --git a/public/assets/css/code.css.br b/public/assets/css/code.css.br deleted file mode 100644 index c0809f08..00000000 Binary files a/public/assets/css/code.css.br and /dev/null differ diff --git a/public/assets/css/colours.css.br b/public/assets/css/colours.css.br deleted file mode 100644 index ddedc7a3..00000000 Binary files a/public/assets/css/colours.css.br and /dev/null differ diff --git a/public/assets/css/content.css.br b/public/assets/css/content.css.br deleted file mode 100644 index ae9d299d..00000000 Binary files a/public/assets/css/content.css.br and /dev/null differ diff --git a/public/assets/css/fonts.css.br b/public/assets/css/fonts.css.br deleted file mode 100644 index a99e5684..00000000 Binary files a/public/assets/css/fonts.css.br and /dev/null differ diff --git a/public/assets/css/h-card.css.br b/public/assets/css/h-card.css.br deleted file mode 100644 index 8dd3d22d..00000000 Binary files a/public/assets/css/h-card.css.br and /dev/null differ diff --git a/public/assets/css/layout.css.br b/public/assets/css/layout.css.br deleted file mode 100644 index 2fe4608b..00000000 Binary files a/public/assets/css/layout.css.br and /dev/null differ diff --git a/public/assets/css/notes.css.br b/public/assets/css/notes.css.br deleted file mode 100644 index 686ddf2f..00000000 Binary files a/public/assets/css/notes.css.br and /dev/null differ diff --git a/public/assets/css/variables.css.br b/public/assets/css/variables.css.br deleted file mode 100644 index b55500f3..00000000 Binary files a/public/assets/css/variables.css.br and /dev/null differ diff --git a/public/assets/frontend/is-land.js b/public/assets/frontend/is-land.js deleted file mode 100644 index 435a13b9..00000000 --- a/public/assets/frontend/is-land.js +++ /dev/null @@ -1,338 +0,0 @@ -class Island extends HTMLElement { - static tagName = "is-land"; - static prefix = "is-land--"; - static attr = { - template: "data-island", - ready: "ready", - defer: "defer-hydration", - }; - - static onceCache = new Map(); - static onReady = new Map(); - - static fallback = { - ":not(is-land,:defined,[defer-hydration])": (readyPromise, node, prefix) => { - // remove from document to prevent web component init - let cloned = document.createElement(prefix + node.localName); - for(let attr of node.getAttributeNames()) { - cloned.setAttribute(attr, node.getAttribute(attr)); - } - - // Declarative Shadow DOM (with polyfill) - let shadowroot = node.shadowRoot; - if(!shadowroot) { - let tmpl = node.querySelector(":scope > template:is([shadowrootmode], [shadowroot])"); - if(tmpl) { - let mode = tmpl.getAttribute("shadowrootmode") || tmpl.getAttribute("shadowroot") || "closed"; - shadowroot = node.attachShadow({ mode }); // default is closed - shadowroot.appendChild(tmpl.content.cloneNode(true)); - } - } - - // Cheers to https://gist.github.com/developit/45c85e9be01e8c3f1a0ec073d600d01e - if(shadowroot) { - cloned.attachShadow({ mode: shadowroot.mode }).append(...shadowroot.childNodes); - } - - // Keep *same* child nodes to preserve state of children (e.g. details->summary) - cloned.append(...node.childNodes); - node.replaceWith(cloned); - - return readyPromise.then(() => { - // Restore original children and shadow DOM - if(cloned.shadowRoot) { - node.shadowRoot.append(...cloned.shadowRoot.childNodes); - } - node.append(...cloned.childNodes); - cloned.replaceWith(node); - }); - } - } - - constructor() { - super(); - - // Internal promises - this.ready = new Promise(resolve => { - this.readyResolve = resolve; - }); - } - - // any parents of `el` that are (with conditions) - static getParents(el, stopAt = false) { - let nodes = []; - while(el) { - if(el.matches && el.matches(Island.tagName)) { - if(stopAt && el === stopAt) { - break; - } - - if(Conditions.hasConditions(el)) { - nodes.push(el); - } - } - el = el.parentNode; - } - return nodes; - } - - static async ready(el, parents) { - if(!parents) { - parents = Island.getParents(el); - } - if(parents.length === 0) { - return; - } - let imports = await Promise.all(parents.map(p => p.wait())); - // return innermost module import - if(imports.length) { - return imports[0]; - } - } - - forceFallback() { - if(window.Island) { - Object.assign(Island.fallback, window.Island.fallback); - } - - for(let selector in Island.fallback) { - // Reverse here as a cheap way to get the deepest nodes first - let components = Array.from(this.querySelectorAll(selector)).reverse(); - - // with thanks to https://gist.github.com/cowboy/938767 - for(let node of components) { - if(!node.isConnected) { - continue; - } - - let parents = Island.getParents(node); - // must be in a leaf island (not nested deep) - if(parents.length === 1) { - let p = Island.ready(node, parents); - Island.fallback[selector](p, node, Island.prefix); - } - } - } - } - - wait() { - return this.ready; - } - - async connectedCallback() { - // Only use fallback content with loading conditions - if(Conditions.hasConditions(this)) { - // Keep fallback content without initializing the components - this.forceFallback(); - } - - await this.hydrate(); - } - - getTemplates() { - return this.querySelectorAll(`template[${Island.attr.template}]`); - } - - replaceTemplates(templates) { - // replace